mirror of
https://github.com/dolphin-emu/dolphin.git
synced 2025-04-28 21:08:04 +03:00
Compare commits
343 commits
Author | SHA1 | Date | |
---|---|---|---|
![]() |
8ee64a84c7 | ||
![]() |
741ffc3114 | ||
![]() |
3e5286c1a4 | ||
![]() |
3a883f28d6 | ||
![]() |
45b9def42c | ||
![]() |
d0dc8ae5e1 | ||
![]() |
9db4067957 | ||
![]() |
8724daf44e | ||
![]() |
9c40a7976b | ||
![]() |
e37a195192 | ||
![]() |
9868138c22 | ||
![]() |
805307f432 | ||
![]() |
fe307a06c6 | ||
![]() |
a95779add0 | ||
![]() |
5523b9a01b | ||
![]() |
50026ab795 | ||
![]() |
908094714b | ||
![]() |
8fa725d5e4 | ||
![]() |
fc0aafca3b | ||
![]() |
f675048768 | ||
![]() |
1cea31c75a | ||
![]() |
3025cd472c | ||
![]() |
022bc3bf8d | ||
![]() |
879a8889aa | ||
![]() |
564e7c3320 | ||
![]() |
467a568f60 | ||
![]() |
6c751fb722 | ||
![]() |
bda1f379b7 | ||
![]() |
c44418a4d9 | ||
![]() |
fe657b9759 | ||
![]() |
e751235574 | ||
![]() |
8f3483fdd4 | ||
![]() |
af960651e8 | ||
![]() |
d04e9e79a6 | ||
![]() |
968b0cff44 | ||
![]() |
116bd3a031 | ||
![]() |
8b610101bc | ||
![]() |
c4f65febf3 | ||
![]() |
871073eee2 | ||
![]() |
31a3de819d | ||
![]() |
0fd090ce19 | ||
![]() |
4773a6f323 | ||
![]() |
826625c7be | ||
![]() |
00544e4dff | ||
![]() |
609165b62b | ||
![]() |
f6d3f448d9 | ||
![]() |
ac76deaef0 | ||
![]() |
da84a9f605 | ||
![]() |
afee9a56e9 | ||
![]() |
9254a53397 | ||
![]() |
25fdde4204 | ||
![]() |
fd8ce3ce80 | ||
![]() |
12010ebf78 | ||
![]() |
ecafd8058f | ||
![]() |
89873d6238 | ||
![]() |
d670c21c8e | ||
![]() |
0f30b59aef | ||
![]() |
1e8b668793 | ||
![]() |
1fc6be7f80 | ||
![]() |
de2826d995 | ||
![]() |
e468e2359a | ||
![]() |
8f12512d0d | ||
![]() |
920a44aec2 | ||
![]() |
24fdcc1a0e | ||
![]() |
50a8ae9d90 | ||
![]() |
427e9c5ad2 | ||
![]() |
c0c180bdc2 | ||
![]() |
258fc1b209 | ||
![]() |
0b2338a5ee | ||
![]() |
89fdc0b9e0 | ||
![]() |
2238967d93 | ||
![]() |
660232a12c | ||
![]() |
2baa09d5b4 | ||
![]() |
8d94d25203 | ||
![]() |
71f654cdc4 | ||
![]() |
494e2c05c2 | ||
![]() |
0827d9f06d | ||
![]() |
0109c27ad7 | ||
![]() |
e40c9b674c | ||
![]() |
ec9fb08dab | ||
![]() |
65f42ee2d2 | ||
![]() |
53b66be47d | ||
![]() |
0bc33fb6df | ||
![]() |
dc8865718e | ||
![]() |
7213cdd439 | ||
![]() |
ad79a62d22 | ||
![]() |
82ee77e4e1 | ||
![]() |
39e535d4aa | ||
![]() |
bc3c3eb79a | ||
![]() |
41408076e3 | ||
![]() |
7e7b75c1e6 | ||
![]() |
9504916f72 | ||
![]() |
0a52140145 | ||
![]() |
45ed4b2be9 | ||
![]() |
2adf3449f3 | ||
![]() |
8d7d026da6 | ||
![]() |
2d1161150b | ||
![]() |
5dd896a7d9 | ||
![]() |
a1691a4031 | ||
![]() |
ac3dbe2294 | ||
![]() |
12dcd6c285 | ||
![]() |
f78fa2e9f1 | ||
![]() |
77b4270981 | ||
![]() |
7123fcd19b | ||
![]() |
f6ba69f99a | ||
![]() |
1ae0b23265 | ||
![]() |
b8e70df413 | ||
![]() |
3eee52cb6b | ||
![]() |
49ebdaaae3 | ||
![]() |
fda8afaf5c | ||
![]() |
301cc5ee63 | ||
![]() |
cb20959679 | ||
![]() |
056b0339be | ||
![]() |
c55624702c | ||
![]() |
a96c935c1c | ||
![]() |
b9a93794ff | ||
![]() |
ef612912a2 | ||
![]() |
fa782de15c | ||
![]() |
f8bf35e6f0 | ||
![]() |
8bfde300f4 | ||
![]() |
5af315ec17 | ||
![]() |
2af276d27e | ||
![]() |
c4f906bcd9 | ||
![]() |
3bb925c1c7 | ||
![]() |
90a4be4b36 | ||
![]() |
9caa02493d | ||
![]() |
36c7e7f3c7 | ||
![]() |
cab5bc5680 | ||
![]() |
6ad267017c | ||
![]() |
4f210df86a | ||
![]() |
bcddd78a89 | ||
![]() |
d194e69bbd | ||
![]() |
5285b1168a | ||
![]() |
03451f2bc9 | ||
![]() |
87beb7d67b | ||
![]() |
fc0179c1ea | ||
![]() |
4aa056dd4d | ||
![]() |
7ca8dc3767 | ||
![]() |
01363572cb | ||
![]() |
91380258a1 | ||
![]() |
ee27f03a43 | ||
![]() |
b306d00d5d | ||
![]() |
f59507c856 | ||
![]() |
69bdb0535c | ||
![]() |
ec49ea5be3 | ||
![]() |
74e752ed9c | ||
![]() |
2d1671a863 | ||
![]() |
06afa0036a | ||
![]() |
edb1db7400 | ||
![]() |
bee7035322 | ||
![]() |
e0e53f3235 | ||
![]() |
7dc27753e2 | ||
![]() |
e5c8935acc | ||
![]() |
dadbd2f9fb | ||
![]() |
af1f07207f | ||
![]() |
c42dab6388 | ||
![]() |
61ab662733 | ||
![]() |
ebc9c8492d | ||
![]() |
c705e366f0 | ||
![]() |
ec36fce7c6 | ||
![]() |
877864c23a | ||
![]() |
33a7283d3b | ||
![]() |
01a7732d50 | ||
![]() |
17c994df2a | ||
![]() |
1b85da9b85 | ||
![]() |
1b87ea83e6 | ||
![]() |
957265ba52 | ||
![]() |
9819d66a47 | ||
![]() |
f00b7d39f0 | ||
![]() |
efd993f382 | ||
![]() |
4c727a84c5 | ||
![]() |
932b4abdcf | ||
![]() |
7d794897c4 | ||
![]() |
e0032b3e2c | ||
![]() |
c7ede8a6b7 | ||
![]() |
ee22cf9b22 | ||
![]() |
0a3feb3e42 | ||
![]() |
3a1a60d4f8 | ||
![]() |
662cfa38c2 | ||
![]() |
cb24821dcc | ||
![]() |
ebd879cb30 | ||
![]() |
e5608c6ca5 | ||
![]() |
896b4bb1fa | ||
![]() |
e351f03cdf | ||
![]() |
849d8b7dae | ||
![]() |
1981f22228 | ||
![]() |
eb84b0fb9b | ||
![]() |
e34907025d | ||
![]() |
5d4b884e64 | ||
![]() |
5a708f0f24 | ||
![]() |
6d8ba94e4c | ||
![]() |
9e9faf3be1 | ||
![]() |
516c1314d2 | ||
![]() |
ad3650abfc | ||
![]() |
1515cf6ccd | ||
![]() |
cef4d8fb76 | ||
![]() |
f50d2ee86c | ||
![]() |
28f1beeca8 | ||
![]() |
178462e10f | ||
![]() |
9b0471532c | ||
![]() |
2da255d8cd | ||
![]() |
e93f0de8a4 | ||
![]() |
c1990bc687 | ||
![]() |
8e253518e6 | ||
![]() |
e18d98d4fc | ||
![]() |
d03f9032c1 | ||
![]() |
b0867c1602 | ||
![]() |
18979129f3 | ||
![]() |
3bf2de369a | ||
![]() |
561aee7707 | ||
![]() |
4b711e1e0a | ||
![]() |
ba1bf6959e | ||
![]() |
137d1375d4 | ||
![]() |
79a1e480ca | ||
![]() |
a7d1cac8ad | ||
![]() |
0299540209 | ||
![]() |
3b8384acf6 | ||
![]() |
6a90affa38 | ||
![]() |
0afbeae70c | ||
![]() |
dc4cb7874a | ||
![]() |
49bee36e6a | ||
![]() |
9720b1f5f5 | ||
![]() |
9e513d93e1 | ||
![]() |
07cec796f4 | ||
![]() |
c5f89f2de9 | ||
![]() |
48b2f7d200 | ||
![]() |
c1dea828ab | ||
![]() |
452cd1c261 | ||
![]() |
373a1a5dc0 | ||
![]() |
f4c37aeb14 | ||
![]() |
90b6f0d16d | ||
![]() |
951a84833a | ||
![]() |
6aff82eda3 | ||
![]() |
99cde4e269 | ||
![]() |
1bd3e79fda | ||
![]() |
e3deb14156 | ||
![]() |
46e0952e97 | ||
![]() |
c763961112 | ||
![]() |
b2ce3fbefc | ||
![]() |
ddb82a5e8c | ||
![]() |
225039f742 | ||
![]() |
049e52ce1c | ||
![]() |
f2d1918714 | ||
![]() |
e637a05707 | ||
![]() |
1f087473aa | ||
![]() |
b2f8dac739 | ||
![]() |
541344ef9b | ||
![]() |
8c7ab286f5 | ||
![]() |
3fb4084e25 | ||
![]() |
fd2c6918fa | ||
![]() |
0615ade725 | ||
![]() |
01978cfcf7 | ||
![]() |
2690a62949 | ||
![]() |
e1745f682f | ||
![]() |
4d3f247cc3 | ||
![]() |
f09ba10daa | ||
![]() |
e82f03b825 | ||
![]() |
6c158ed590 | ||
![]() |
63b848ca93 | ||
![]() |
15372dc835 | ||
![]() |
ca9b34a6d1 | ||
![]() |
0e2785a562 | ||
![]() |
a421d6859f | ||
![]() |
fdf00050a6 | ||
![]() |
5b36c13bfb | ||
![]() |
1b47dbf519 | ||
![]() |
de997d616f | ||
![]() |
b7bd0a0836 | ||
![]() |
67c8d5640f | ||
![]() |
1698daef66 | ||
![]() |
a80062f1b1 | ||
![]() |
9b2ab6e259 | ||
![]() |
c191ed5321 | ||
![]() |
5b88c0b90e | ||
![]() |
de01a790e1 | ||
![]() |
7f3d8a1ad4 | ||
![]() |
44423a3656 | ||
![]() |
7222188cde | ||
![]() |
c4bd98c626 | ||
![]() |
9ac9813492 | ||
![]() |
aa624d8ba8 | ||
![]() |
9675c90890 | ||
![]() |
81e842e2aa | ||
![]() |
fe2d247acb | ||
![]() |
cf1541a511 | ||
![]() |
3705c73d55 | ||
![]() |
ae11ffadf6 | ||
![]() |
433c6ce0f2 | ||
![]() |
5ed8b7bc9d | ||
![]() |
d45e6c6729 | ||
![]() |
203454a97a | ||
![]() |
ff4486ee23 | ||
![]() |
189d09011b | ||
![]() |
3f73a39dbd | ||
![]() |
9f43f59c9b | ||
![]() |
13d966760d | ||
![]() |
9e23a0a506 | ||
![]() |
ba40e4abad | ||
![]() |
1cc6b6c5d8 | ||
![]() |
f4e6878384 | ||
![]() |
cbd71f06ba | ||
![]() |
e4efe011d7 | ||
![]() |
258ec4f9cd | ||
![]() |
c9f589faa5 | ||
![]() |
8b9f92a0af | ||
![]() |
9f972db4b8 | ||
![]() |
00e147c722 | ||
![]() |
62b2b939b5 | ||
![]() |
1e5e9219cd | ||
![]() |
87496205aa | ||
![]() |
e974e48e1f | ||
![]() |
c18c039089 | ||
![]() |
fb6c625fed | ||
![]() |
9b7d494bd4 | ||
![]() |
d2b4e12f9e | ||
![]() |
7925240107 | ||
![]() |
325c1a24b9 | ||
![]() |
99e686de34 | ||
![]() |
5ff2af9b6a | ||
![]() |
5beb136992 | ||
![]() |
16d75eadb5 | ||
![]() |
b28dcf3687 | ||
![]() |
38099f282d | ||
![]() |
3c5da38177 | ||
![]() |
ecb0a3e5c7 | ||
![]() |
e217d6c939 | ||
![]() |
6dedf11c96 | ||
![]() |
5d16c51963 | ||
![]() |
5dd10b9644 | ||
![]() |
3f92f86de1 | ||
![]() |
0d0734e083 | ||
![]() |
1d481a395a | ||
![]() |
4e460a7968 | ||
![]() |
359fb51d64 | ||
![]() |
7abb9e7974 | ||
![]() |
0a83783fae | ||
![]() |
97bc28aac4 | ||
![]() |
5b4d4ca5eb | ||
![]() |
363155b597 | ||
![]() |
a3b06b0572 | ||
![]() |
6d44afc7dd | ||
![]() |
ea7928b3cd | ||
![]() |
dc6e5e7ff6 |
663 changed files with 49501 additions and 62308 deletions
3
.gitmodules
vendored
3
.gitmodules
vendored
|
@ -84,3 +84,6 @@
|
||||||
[submodule "Externals/Vulkan-Headers"]
|
[submodule "Externals/Vulkan-Headers"]
|
||||||
path = Externals/Vulkan-Headers
|
path = Externals/Vulkan-Headers
|
||||||
url = https://github.com/KhronosGroup/Vulkan-Headers.git
|
url = https://github.com/KhronosGroup/Vulkan-Headers.git
|
||||||
|
[submodule "Externals/SFML/SFML"]
|
||||||
|
path = Externals/SFML/SFML
|
||||||
|
url = https://github.com/SFML/SFML.git
|
||||||
|
|
|
@ -57,13 +57,9 @@ DEFAULT_CONFIG = {
|
||||||
# SHA checksum to verify the integrity of the app. This doesn't
|
# SHA checksum to verify the integrity of the app. This doesn't
|
||||||
# protect against malicious actors, but it does protect against
|
# protect against malicious actors, but it does protect against
|
||||||
# running corrupted binaries and allows for access to the extended
|
# running corrupted binaries and allows for access to the extended
|
||||||
# permisions needed for ARM builds
|
# permissions needed for ARM builds
|
||||||
"codesign_identity": "-",
|
"codesign_identity": "-",
|
||||||
|
|
||||||
# Minimum macOS version for each architecture slice
|
|
||||||
"arm64_mac_os_deployment_target": "11.0.0",
|
|
||||||
"x86_64_mac_os_deployment_target": "10.15.0",
|
|
||||||
|
|
||||||
# CMake Generator to use for building
|
# CMake Generator to use for building
|
||||||
"generator": "Unix Makefiles",
|
"generator": "Unix Makefiles",
|
||||||
"build_type": "Release",
|
"build_type": "Release",
|
||||||
|
@ -77,7 +73,7 @@ DEFAULT_CONFIG = {
|
||||||
"distributor": "None"
|
"distributor": "None"
|
||||||
}
|
}
|
||||||
|
|
||||||
# Architectures to build for. This is explicity left out of the command line
|
# Architectures to build for. This is explicitly left out of the command line
|
||||||
# config options for several reasons:
|
# config options for several reasons:
|
||||||
# 1) Adding new architectures will generally require more code changes
|
# 1) Adding new architectures will generally require more code changes
|
||||||
# 2) Single architecture builds should utilize the normal generated cmake
|
# 2) Single architecture builds should utilize the normal generated cmake
|
||||||
|
@ -146,11 +142,6 @@ def parse_args(conf=DEFAULT_CONFIG):
|
||||||
help=f"Install path for {arch} qt5 libraries",
|
help=f"Install path for {arch} qt5 libraries",
|
||||||
default=conf[arch+"_qt5_path"])
|
default=conf[arch+"_qt5_path"])
|
||||||
|
|
||||||
parser.add_argument(
|
|
||||||
f"--{arch}_mac_os_deployment_target",
|
|
||||||
help=f"Deployment architecture for {arch} slice",
|
|
||||||
default=conf[arch+"_mac_os_deployment_target"])
|
|
||||||
|
|
||||||
return vars(parser.parse_args())
|
return vars(parser.parse_args())
|
||||||
|
|
||||||
|
|
||||||
|
@ -297,8 +288,7 @@ def build(config):
|
||||||
"-DCMAKE_PREFIX_PATH="+prefix_path,
|
"-DCMAKE_PREFIX_PATH="+prefix_path,
|
||||||
"-DCMAKE_SYSTEM_PROCESSOR="+arch,
|
"-DCMAKE_SYSTEM_PROCESSOR="+arch,
|
||||||
"-DCMAKE_IGNORE_PATH="+ignore_path,
|
"-DCMAKE_IGNORE_PATH="+ignore_path,
|
||||||
"-DCMAKE_OSX_DEPLOYMENT_TARGET="
|
"-DCMAKE_OSX_DEPLOYMENT_TARGET=11.0.0",
|
||||||
+ config[arch+"_mac_os_deployment_target"],
|
|
||||||
"-DMACOS_CODE_SIGNING_IDENTITY="
|
"-DMACOS_CODE_SIGNING_IDENTITY="
|
||||||
+ config["codesign_identity"],
|
+ config["codesign_identity"],
|
||||||
'-DMACOS_CODE_SIGNING="ON"',
|
'-DMACOS_CODE_SIGNING="ON"',
|
||||||
|
|
|
@ -11,7 +11,7 @@
|
||||||
# FFmpeg_LIBRARIES: aggregate all the paths to the libraries
|
# FFmpeg_LIBRARIES: aggregate all the paths to the libraries
|
||||||
# FFmpeg_FOUND: True if all components have been found
|
# FFmpeg_FOUND: True if all components have been found
|
||||||
#
|
#
|
||||||
# This module defines the following targets, which are prefered over variables:
|
# This module defines the following targets, which are preferred over variables:
|
||||||
#
|
#
|
||||||
# FFmpeg::<component>: Target to use <component> directly, with include path,
|
# FFmpeg::<component>: Target to use <component> directly, with include path,
|
||||||
# library and dependencies set up. If you are using a static build, you are
|
# library and dependencies set up. If you are using a static build, you are
|
||||||
|
|
|
@ -87,9 +87,10 @@ if(SFML_FIND_VERSION AND SFML_INCLUDE_DIR)
|
||||||
set(SFML_CONFIG_HPP_INPUT "${SFML_INCLUDE_DIR}/SFML/Config.hpp")
|
set(SFML_CONFIG_HPP_INPUT "${SFML_INCLUDE_DIR}/SFML/Config.hpp")
|
||||||
endif()
|
endif()
|
||||||
FILE(READ "${SFML_CONFIG_HPP_INPUT}" SFML_CONFIG_HPP_CONTENTS)
|
FILE(READ "${SFML_CONFIG_HPP_INPUT}" SFML_CONFIG_HPP_CONTENTS)
|
||||||
STRING(REGEX MATCH ".*#define SFML_VERSION_MAJOR ([0-9]+).*#define SFML_VERSION_MINOR ([0-9]+).*" SFML_CONFIG_HPP_CONTENTS "${SFML_CONFIG_HPP_CONTENTS}")
|
STRING(REGEX MATCH "#define SFML_VERSION_MAJOR[ \t]+([0-9]+)" SFML_VERSION_MAJOR_MATCH "${SFML_CONFIG_HPP_CONTENTS}")
|
||||||
STRING(REGEX REPLACE ".*#define SFML_VERSION_MAJOR ([0-9]+).*" "\\1" SFML_VERSION_MAJOR "${SFML_CONFIG_HPP_CONTENTS}")
|
STRING(REGEX MATCH "#define SFML_VERSION_MINOR[ \t]+([0-9]+)" SFML_VERSION_MINOR_MATCH "${SFML_CONFIG_HPP_CONTENTS}")
|
||||||
STRING(REGEX REPLACE ".*#define SFML_VERSION_MINOR ([0-9]+).*" "\\1" SFML_VERSION_MINOR "${SFML_CONFIG_HPP_CONTENTS}")
|
STRING(REGEX REPLACE "#define SFML_VERSION_MAJOR[ \t]+([0-9]+)" "\\1" SFML_VERSION_MAJOR "${SFML_VERSION_MAJOR_MATCH}")
|
||||||
|
STRING(REGEX REPLACE "#define SFML_VERSION_MINOR[ \t]+([0-9]+)" "\\1" SFML_VERSION_MINOR "${SFML_VERSION_MINOR_MATCH}")
|
||||||
math(EXPR SFML_REQUESTED_VERSION "${SFML_FIND_VERSION_MAJOR} * 10 + ${SFML_FIND_VERSION_MINOR}")
|
math(EXPR SFML_REQUESTED_VERSION "${SFML_FIND_VERSION_MAJOR} * 10 + ${SFML_FIND_VERSION_MINOR}")
|
||||||
|
|
||||||
# if we could extract them, compare with the requested version number
|
# if we could extract them, compare with the requested version number
|
||||||
|
@ -102,10 +103,14 @@ if(SFML_FIND_VERSION AND SFML_INCLUDE_DIR)
|
||||||
set(SFML_VERSION_OK FALSE)
|
set(SFML_VERSION_OK FALSE)
|
||||||
endif()
|
endif()
|
||||||
else()
|
else()
|
||||||
# SFML version is < 2.0
|
# SFML version is < 3.0
|
||||||
if (SFML_REQUESTED_VERSION GREATER 19)
|
if (SFML_REQUESTED_VERSION GREATER 29)
|
||||||
set(SFML_VERSION_OK FALSE)
|
set(SFML_VERSION_OK FALSE)
|
||||||
set(SFML_VERSION_MAJOR 1)
|
if (SFML_REQUESTED_VERSION GREATER 19)
|
||||||
|
set(SFML_VERSION_MAJOR 1)
|
||||||
|
else()
|
||||||
|
set(SFML_VERSION_MAJOR 2)
|
||||||
|
endif()
|
||||||
set(SFML_VERSION_MINOR x)
|
set(SFML_VERSION_MINOR x)
|
||||||
endif()
|
endif()
|
||||||
endif()
|
endif()
|
||||||
|
|
|
@ -34,7 +34,7 @@ string(TIMESTAMP DOLPHIN_WC_BUILD_DATE "%Y-%m-%d" UTC)
|
||||||
|
|
||||||
# version number
|
# version number
|
||||||
set(DOLPHIN_VERSION_MAJOR "2503")
|
set(DOLPHIN_VERSION_MAJOR "2503")
|
||||||
set(DOLPHIN_VERSION_MINOR "0")
|
set(DOLPHIN_VERSION_MINOR "1")
|
||||||
set(DOLPHIN_VERSION_PATCH ${DOLPHIN_WC_REVISION})
|
set(DOLPHIN_VERSION_PATCH ${DOLPHIN_WC_REVISION})
|
||||||
|
|
||||||
# If Dolphin is not built from a Git repository, default the version info to
|
# If Dolphin is not built from a Git repository, default the version info to
|
||||||
|
|
|
@ -24,7 +24,7 @@ endif()
|
||||||
|
|
||||||
# Minimum OS X version.
|
# Minimum OS X version.
|
||||||
# This is inserted into the Info.plist as well.
|
# This is inserted into the Info.plist as well.
|
||||||
set(CMAKE_OSX_DEPLOYMENT_TARGET "10.15.0" CACHE STRING "")
|
set(CMAKE_OSX_DEPLOYMENT_TARGET "11.0.0" CACHE STRING "")
|
||||||
|
|
||||||
set(CMAKE_USER_MAKE_RULES_OVERRIDE "${CMAKE_CURRENT_SOURCE_DIR}/CMake/FlagsOverride.cmake")
|
set(CMAKE_USER_MAKE_RULES_OVERRIDE "${CMAKE_CURRENT_SOURCE_DIR}/CMake/FlagsOverride.cmake")
|
||||||
|
|
||||||
|
@ -44,7 +44,7 @@ endif()
|
||||||
|
|
||||||
set(COMPILER ${CMAKE_CXX_COMPILER_ID})
|
set(COMPILER ${CMAKE_CXX_COMPILER_ID})
|
||||||
if (COMPILER STREQUAL "GNU")
|
if (COMPILER STREQUAL "GNU")
|
||||||
set(COMPILER "GCC") # perfer printing GCC instead of GNU
|
set(COMPILER "GCC") # prefer printing GCC instead of GNU
|
||||||
endif()
|
endif()
|
||||||
|
|
||||||
# Enforce minimum compiler versions that support the c++20 features we use
|
# Enforce minimum compiler versions that support the c++20 features we use
|
||||||
|
@ -124,6 +124,11 @@ option(OPROFILING "Enable profiling" OFF)
|
||||||
# TODO: Add DSPSpy
|
# TODO: Add DSPSpy
|
||||||
option(DSPTOOL "Build dsptool" OFF)
|
option(DSPTOOL "Build dsptool" OFF)
|
||||||
|
|
||||||
|
# RetroAchievements developer tools require Windows hooks
|
||||||
|
if(WIN32)
|
||||||
|
option(RC_CLIENT_SUPPORTS_RAINTEGRATION "Enables RetroAchievements developer tools" ON)
|
||||||
|
endif()
|
||||||
|
|
||||||
# Enable SDL by default on operating systems that aren't Android.
|
# Enable SDL by default on operating systems that aren't Android.
|
||||||
if(NOT ANDROID)
|
if(NOT ANDROID)
|
||||||
option(ENABLE_SDL "Enables SDL as a generic controller backend" ON)
|
option(ENABLE_SDL "Enables SDL as a generic controller backend" ON)
|
||||||
|
@ -144,6 +149,7 @@ if(CMAKE_SYSTEM_NAME STREQUAL "Linux")
|
||||||
option(ENABLE_VTUNE "Enable Intel VTune integration for JIT code." OFF)
|
option(ENABLE_VTUNE "Enable Intel VTune integration for JIT code." OFF)
|
||||||
|
|
||||||
if(NOT ANDROID)
|
if(NOT ANDROID)
|
||||||
|
option(ENABLE_HWDB "Enables the udev hardware database" ON)
|
||||||
option(ENABLE_EVDEV "Enables the evdev controller backend" ON)
|
option(ENABLE_EVDEV "Enables the evdev controller backend" ON)
|
||||||
endif()
|
endif()
|
||||||
endif()
|
endif()
|
||||||
|
@ -407,7 +413,7 @@ if(CMAKE_SYSTEM_NAME MATCHES "FreeBSD")
|
||||||
set(CMAKE_EXE_LINKER_FLAGS "${CMAKE_EXE_LINKER_FLAGS} -L/usr/local/lib")
|
set(CMAKE_EXE_LINKER_FLAGS "${CMAKE_EXE_LINKER_FLAGS} -L/usr/local/lib")
|
||||||
|
|
||||||
if (CMAKE_CXX_COMPILER_ID MATCHES "Clang" AND CMAKE_CXX_COMPILER_VERSION VERSION_LESS 14.0)
|
if (CMAKE_CXX_COMPILER_ID MATCHES "Clang" AND CMAKE_CXX_COMPILER_VERSION VERSION_LESS 14.0)
|
||||||
# Workaround: the llvm libc++ and versions of clang eariler than 14 have a bug with consteval
|
# Workaround: the llvm libc++ and versions of clang earlier than 14 have a bug with consteval
|
||||||
# so we define FMT_CONSTEVAL to blank to just disable consteval in fmt
|
# so we define FMT_CONSTEVAL to blank to just disable consteval in fmt
|
||||||
add_definitions(-DFMT_CONSTEVAL=)
|
add_definitions(-DFMT_CONSTEVAL=)
|
||||||
endif()
|
endif()
|
||||||
|
@ -566,6 +572,16 @@ if(OPROFILING)
|
||||||
endif()
|
endif()
|
||||||
endif()
|
endif()
|
||||||
|
|
||||||
|
if(ENABLE_HWDB)
|
||||||
|
find_package(LIBUDEV REQUIRED)
|
||||||
|
if(LIBUDEV_FOUND)
|
||||||
|
message(STATUS "libudev found, enabling hardware database")
|
||||||
|
add_definitions(-DHAVE_LIBUDEV=1)
|
||||||
|
else()
|
||||||
|
message(FATAL_ERROR "Couldn't find libudev. Can't build hardware database.\nDisable ENABLE_HWDB if you wish to build without hardware database support")
|
||||||
|
endif()
|
||||||
|
endif()
|
||||||
|
|
||||||
if(ENABLE_EVDEV)
|
if(ENABLE_EVDEV)
|
||||||
find_package(LIBUDEV REQUIRED)
|
find_package(LIBUDEV REQUIRED)
|
||||||
find_package(LIBEVDEV REQUIRED)
|
find_package(LIBEVDEV REQUIRED)
|
||||||
|
@ -696,11 +712,6 @@ if (APPLE OR WIN32)
|
||||||
include_directories(Externals/ed25519)
|
include_directories(Externals/ed25519)
|
||||||
endif()
|
endif()
|
||||||
|
|
||||||
# Using static soundtouch from Externals
|
|
||||||
# Unable to use system soundtouch library: We require shorts, not floats.
|
|
||||||
add_subdirectory(Externals/soundtouch)
|
|
||||||
include_directories(Externals/soundtouch)
|
|
||||||
|
|
||||||
if(ENABLE_CUBEB)
|
if(ENABLE_CUBEB)
|
||||||
dolphin_find_optional_system_library(CUBEB Externals/cubeb)
|
dolphin_find_optional_system_library(CUBEB Externals/cubeb)
|
||||||
add_definitions(-DHAVE_CUBEB)
|
add_definitions(-DHAVE_CUBEB)
|
||||||
|
@ -713,7 +724,7 @@ if(NOT ANDROID)
|
||||||
add_definitions(-D__LIBUSB__)
|
add_definitions(-D__LIBUSB__)
|
||||||
endif()
|
endif()
|
||||||
|
|
||||||
dolphin_find_optional_system_library(SFML Externals/SFML 2.1 COMPONENTS network system)
|
dolphin_find_optional_system_library(SFML Externals/SFML 3.0 COMPONENTS Network System)
|
||||||
|
|
||||||
if(USE_UPNP)
|
if(USE_UPNP)
|
||||||
dolphin_find_optional_system_library(MINIUPNPC Externals/miniupnpc 1.6)
|
dolphin_find_optional_system_library(MINIUPNPC Externals/miniupnpc 1.6)
|
||||||
|
|
|
@ -49,7 +49,7 @@ In most cases, clang-format can and **should** be used to automatically reformat
|
||||||
|
|
||||||
- To run clang-format on all staged files:
|
- To run clang-format on all staged files:
|
||||||
```
|
```
|
||||||
git diff --cached --name-only | egrep '[.](cpp|h|mm)$' | xargs clang-format -i
|
git diff --cached --name-only | grep -E '[.](cpp|h|mm)$' | xargs -I {} clang-format -i {}
|
||||||
```
|
```
|
||||||
|
|
||||||
- Formatting issues can be checked for before committing with a lint script that is included with the codebase. To enable it as a pre-commit hook (assuming you are in the repository root):
|
- Formatting issues can be checked for before committing with a lint script that is included with the codebase. To enable it as a pre-commit hook (assuming you are in the repository root):
|
||||||
|
|
|
@ -932,10 +932,6 @@
|
||||||
"title": "Region Select",
|
"title": "Region Select",
|
||||||
"AD12237401ABE9FE4A545AADB5C5AE10355E2076": "RSAPatch"
|
"AD12237401ABE9FE4A545AADB5C5AE10355E2076": "RSAPatch"
|
||||||
},
|
},
|
||||||
"RELJAB": {
|
|
||||||
"title": "SegaBoot",
|
|
||||||
"130F3594CAB57B85616F95C7126F4748AAC5867D": "DI Seed Blanker"
|
|
||||||
},
|
|
||||||
"RGQE70": {
|
"RGQE70": {
|
||||||
"title": "Ghostbusters",
|
"title": "Ghostbusters",
|
||||||
"5F4CF8D4DA19A0FF74FF9EB925AC0236069BFD59": "crashfix"
|
"5F4CF8D4DA19A0FF74FF9EB925AC0236069BFD59": "crashfix"
|
||||||
|
|
|
@ -9,9 +9,9 @@ SafeTextureCacheColorSamples = 0
|
||||||
|
|
||||||
[Video_Hacks]
|
[Video_Hacks]
|
||||||
# Some very early NES releases use a version of the NES emulator that doesn't require EFB2Ram.
|
# Some very early NES releases use a version of the NES emulator that doesn't require EFB2Ram.
|
||||||
# All US releases before Feburary 2007 use this version (with all remaining US releases requiring EFB2Ram).
|
# All US releases before February 2007 use this version (with all remaining US releases requiring EFB2Ram).
|
||||||
# But in the PAL region the same games don't necessarily have the same emulator version and
|
# But in the PAL region the same games don't necessarily have the same emulator version and
|
||||||
# only a few of the pre-Feburary 2007 releases don't require EFB2Ram.
|
# only a few of the pre-February 2007 releases don't require EFB2Ram.
|
||||||
#
|
#
|
||||||
# Because of this, Inifiles that override this setting should only be created for the explicit region
|
# Because of this, Inifiles that override this setting should only be created for the explicit region
|
||||||
# that was tested and they should not be merged.
|
# that was tested and they should not be merged.
|
||||||
|
|
|
@ -1,5 +1,5 @@
|
||||||
# FAAE01 - Donkey Kong
|
# FAAE01 - Donkey Kong
|
||||||
|
|
||||||
[Video_Hacks]
|
[Video_Hacks]
|
||||||
# All US NES VC titles released before Feburary 2007 don't need EFB2ram
|
# All US NES VC titles released before February 2007 don't need EFB2ram
|
||||||
EFBToTextureEnable =
|
EFBToTextureEnable =
|
||||||
|
|
|
@ -1,5 +1,5 @@
|
||||||
# FAGE01 - Super Mario Bros.
|
# FAGE01 - Super Mario Bros.
|
||||||
|
|
||||||
[Video_Hacks]
|
[Video_Hacks]
|
||||||
# All US NES VC titles released before Feburary 2007 don't need EFB2ram
|
# All US NES VC titles released before February 2007 don't need EFB2ram
|
||||||
EFBToTextureEnable =
|
EFBToTextureEnable =
|
||||||
|
|
|
@ -11,3 +11,9 @@
|
||||||
|
|
||||||
[Video_Hacks]
|
[Video_Hacks]
|
||||||
EFBToTextureEnable = False
|
EFBToTextureEnable = False
|
||||||
|
DeferEFBCopies = False
|
||||||
|
|
||||||
|
[Gecko]
|
||||||
|
$Widescreen 16:9 (Region Free)
|
||||||
|
04007B7C 38600001
|
||||||
|
*Renders the game in Widescreen 16:9
|
||||||
|
|
|
@ -968,7 +968,7 @@ $Minigame: Memory Lane - No Trail [Airsola]
|
||||||
204d6a0f 00000000
|
204d6a0f 00000000
|
||||||
044d699f 0000003f
|
044d699f 0000003f
|
||||||
e2000002 80008000
|
e2000002 80008000
|
||||||
*Shy Guy will no longer leave a trail durning the demo in the minigame Memory Lane.
|
*Shy Guy will no longer leave a trail during the demo in the minigame Memory Lane.
|
||||||
|
|
||||||
$Minigame: Mole It – All Moles are Worth 3 Points [gamemasterplc]
|
$Minigame: Mole It – All Moles are Worth 3 Points [gamemasterplc]
|
||||||
204D57F0 A8A10008
|
204D57F0 A8A10008
|
||||||
|
|
|
@ -1164,7 +1164,7 @@ $Mechanics - Use Multiple Orbs in the Same Turn [Ralf]
|
||||||
041E3764 3860FFFF
|
041E3764 3860FFFF
|
||||||
*Does not work with CPUs
|
*Does not work with CPUs
|
||||||
|
|
||||||
$Mechanics - Vaccum Orb Always Steals 5 Coins
|
$Mechanics - Vacuum Orb Always Steals 5 Coins
|
||||||
041c8a34 38600005
|
041c8a34 38600005
|
||||||
|
|
||||||
$Minigame: Balloonatic - 25 Second Timer [Airsola]
|
$Minigame: Balloonatic - 25 Second Timer [Airsola]
|
||||||
|
|
|
@ -1,4 +1,5 @@
|
||||||
# GVSE8P, GVSP8P - Virtua Striker 3 ver. 2002
|
# GVSP8P, GVSE8P, GVSJ8P - Virtua Striker 2002 (GC)
|
||||||
|
# GVSJ8P - Virtua Striker 2002 (Triforce), Virtua Striker 4, Virtua Striker 4 ver. 2006
|
||||||
|
|
||||||
[Core]
|
[Core]
|
||||||
# Values set here will override the main Dolphin settings.
|
# Values set here will override the main Dolphin settings.
|
||||||
|
@ -10,3 +11,7 @@ FPRF = True
|
||||||
[ActionReplay]
|
[ActionReplay]
|
||||||
# Add action replay cheats here.
|
# Add action replay cheats here.
|
||||||
|
|
||||||
|
[Video]
|
||||||
|
# Add memory patches to be applied every frame here.
|
||||||
|
|
||||||
|
[Video_Settings]
|
||||||
|
|
|
@ -1,18 +0,0 @@
|
||||||
# GVS46E, GVS46J - Virtua Striker 4 ver. 2006
|
|
||||||
# Because Triforce games have weird IDs, properties are inherited from GVS.ini (Virtua Striker 3 ver. 2002)!
|
|
||||||
|
|
||||||
[Core]
|
|
||||||
# Values set here will override the main Dolphin settings.
|
|
||||||
FPRF = True
|
|
||||||
|
|
||||||
[OnFrame]
|
|
||||||
# Add memory patches to be applied every frame here.
|
|
||||||
|
|
||||||
[ActionReplay]
|
|
||||||
# Add action replay cheats here.
|
|
||||||
|
|
||||||
[Video]
|
|
||||||
# Add memory patches to be applied every frame here.
|
|
||||||
|
|
||||||
[Video_Settings]
|
|
||||||
|
|
|
@ -1,18 +0,0 @@
|
||||||
# GVS46E, GVS46J - Virtua Striker 4 ver. 2006
|
|
||||||
# Because Triforce games have weird IDs, properties are inherited from GVS.ini (Virtua Striker 3 ver. 2002)!
|
|
||||||
|
|
||||||
[Core]
|
|
||||||
# Values set here will override the main Dolphin settings.
|
|
||||||
FPRF = True
|
|
||||||
|
|
||||||
[OnFrame]
|
|
||||||
# Add memory patches to be applied every frame here.
|
|
||||||
|
|
||||||
[ActionReplay]
|
|
||||||
# Add action replay cheats here.
|
|
||||||
|
|
||||||
[Video]
|
|
||||||
# Add memory patches to be applied every frame here.
|
|
||||||
|
|
||||||
[Video_Settings]
|
|
||||||
|
|
|
@ -362,7 +362,7 @@ $Can Walk Ontop of Deep Snow (Twilight Spectre)
|
||||||
$Run Normal Speed With Iron Boots On (brkirch)
|
$Run Normal Speed With Iron Boots On (brkirch)
|
||||||
040BB53C 38600000
|
040BB53C 38600000
|
||||||
040B2D18 4800004C
|
040B2D18 4800004C
|
||||||
$Alywas Preform Dive When Jumping (brkirch)
|
$Always Perform Dive When Jumping (brkirch)
|
||||||
040B6618 60000000
|
040B6618 60000000
|
||||||
$Can Always Flourish Sword (brkirch)
|
$Can Always Flourish Sword (brkirch)
|
||||||
040B9B68 60000000
|
040B9B68 60000000
|
||||||
|
@ -514,7 +514,7 @@ $Mute BG Music (Twilight Spectre)
|
||||||
043DC3D0 00000000
|
043DC3D0 00000000
|
||||||
$BG music muted v2 (Twilight Spectre)
|
$BG music muted v2 (Twilight Spectre)
|
||||||
044507F4 00000000
|
044507F4 00000000
|
||||||
$Enviornment muted (Twilight Spectre)
|
$Environment muted (Twilight Spectre)
|
||||||
04450814 00000000
|
04450814 00000000
|
||||||
$Link makes no noise (Twilight Spectre)
|
$Link makes no noise (Twilight Spectre)
|
||||||
044507FC 00000000
|
044507FC 00000000
|
||||||
|
|
|
@ -7,7 +7,7 @@
|
||||||
# Add action replay cheats here.
|
# Add action replay cheats here.
|
||||||
$==========The Legend of Zelda==========
|
$==========The Legend of Zelda==========
|
||||||
001D73B0 000000FB
|
001D73B0 000000FB
|
||||||
$Max/Infinte Health
|
$Max/Infinite Health
|
||||||
001D73AF 000000FF
|
001D73AF 000000FF
|
||||||
001D73B0 000000FB
|
001D73B0 000000FB
|
||||||
$Max/Infinite Rupees
|
$Max/Infinite Rupees
|
||||||
|
|
|
@ -1,18 +0,0 @@
|
||||||
# RELJAB - SegaBoot
|
|
||||||
|
|
||||||
[Core]
|
|
||||||
# Values set here will override the main Dolphin settings.
|
|
||||||
|
|
||||||
[OnFrame]
|
|
||||||
# Add memory patches to be applied every frame here.
|
|
||||||
$DI Seed Blanker
|
|
||||||
0x80000000:dword:0x00000000
|
|
||||||
0x80000004:dword:0x00000000
|
|
||||||
0x80000008:dword:0x00000000
|
|
||||||
|
|
||||||
[Patches_RetroAchievements_Verified]
|
|
||||||
$DI Seed Blanker
|
|
||||||
|
|
||||||
[ActionReplay]
|
|
||||||
# Add action replay cheats here.
|
|
||||||
|
|
|
@ -1,5 +1,5 @@
|
||||||
# RLIE64, RLIP64 - Lego Indiana Jones: The Original Adventures
|
# RLIE64, RLIP64 - Lego Indiana Jones: The Original Adventures
|
||||||
|
|
||||||
[Video_Hacks]
|
[Video_Hacks]
|
||||||
# Fixes the alpha value of glpyh puzzles; see https://bugs.dolphin-emu.org/issues/12987
|
# Fixes the alpha value of glyph puzzles; see https://bugs.dolphin-emu.org/issues/12987
|
||||||
MissingColorValue = 0xFFFFFF82
|
MissingColorValue = 0xFFFFFF82
|
||||||
|
|
|
@ -542,7 +542,7 @@ de000000 80008180
|
||||||
30012d2c 2c000000
|
30012d2c 2c000000
|
||||||
14012d54 38030000
|
14012d54 38030000
|
||||||
e0000000 80008000
|
e0000000 80008000
|
||||||
*Carry Infinite Boosts instad of 3 in the minigame Cosmic Slalom
|
*Carry Infinite Boosts instead of 3 in the minigame Cosmic Slalom
|
||||||
|
|
||||||
$Minigame - Lob to Rob: All Targets Worth 30 Points [gamemasterplc]
|
$Minigame - Lob to Rob: All Targets Worth 30 Points [gamemasterplc]
|
||||||
48000000 800030c8
|
48000000 800030c8
|
||||||
|
|
|
@ -11,3 +11,4 @@
|
||||||
|
|
||||||
[Video_Hacks]
|
[Video_Hacks]
|
||||||
ImmediateXFBEnable = False
|
ImmediateXFBEnable = False
|
||||||
|
EFBAccessEnable = True
|
||||||
|
|
5
Data/Sys/GameSettings/S3C.ini
Normal file
5
Data/Sys/GameSettings/S3C.ini
Normal file
|
@ -0,0 +1,5 @@
|
||||||
|
# S3CENR - Triple Crown Championship Snowboarding
|
||||||
|
|
||||||
|
[Video_Hacks]
|
||||||
|
# Fixes shadows.
|
||||||
|
EFBToTextureEnable = False
|
35
Data/Sys/GameSettings/SDAE5G.ini
Normal file
35
Data/Sys/GameSettings/SDAE5G.ini
Normal file
|
@ -0,0 +1,35 @@
|
||||||
|
# SDAE5G - The Daring Game for Girls
|
||||||
|
|
||||||
|
[OnFrame]
|
||||||
|
# The game registers an AX callback function that uses a pointer which is only
|
||||||
|
# initialized afterwards. The race condition depends on AID interrupt timing.
|
||||||
|
# This patch moves the pointer initialization from 0x801C9E5C to 0x801C9DFC,
|
||||||
|
# shifting the instructions in-between down.
|
||||||
|
$Fix startup crash
|
||||||
|
0x801C9DFC:dword:0x93EDBAB0
|
||||||
|
0x801C9E00:dword:0x48030721
|
||||||
|
0x801C9E04:dword:0x48032B8D
|
||||||
|
0x801C9E08:dword:0x48063A89
|
||||||
|
0x801C9E0C:dword:0x5460063F
|
||||||
|
0x801C9E10:dword:0x41820018
|
||||||
|
0x801C9E14:dword:0x2C000001
|
||||||
|
0x801C9E18:dword:0x41820024
|
||||||
|
0x801C9E1C:dword:0x2C000002
|
||||||
|
0x801C9E20:dword:0x41820030
|
||||||
|
0x801C9E24:dword:0x4800003C
|
||||||
|
0x801C9E28:dword:0x38600000
|
||||||
|
0x801C9E2C:dword:0x4802FF85
|
||||||
|
0x801C9E30:dword:0x38600000
|
||||||
|
0x801C9E34:dword:0x48032C9D
|
||||||
|
0x801C9E38:dword:0x48000028
|
||||||
|
0x801C9E3C:dword:0x38600000
|
||||||
|
0x801C9E40:dword:0x4802FF71
|
||||||
|
0x801C9E44:dword:0x38600001
|
||||||
|
0x801C9E48:dword:0x48032C89
|
||||||
|
0x801C9E4C:dword:0x48000014
|
||||||
|
0x801C9E50:dword:0x38600001
|
||||||
|
0x801C9E54:dword:0x4802FF5D
|
||||||
|
0x801C9E58:dword:0x38600002
|
||||||
|
0x801C9E5C:dword:0x48032C75
|
||||||
|
[OnFrame_Enabled]
|
||||||
|
$Fix startup crash
|
|
@ -165,7 +165,7 @@
|
||||||
|
|
||||||
{
|
{
|
||||||
"type": "draw_started",
|
"type": "draw_started",
|
||||||
"prettyname": "Buttom Prompt Y",
|
"prettyname": "Button Prompt Y",
|
||||||
"texture_filename": "tex1_32x32_15f350b2b7f46481_66860824280a89bf_8"
|
"texture_filename": "tex1_32x32_15f350b2b7f46481_66860824280a89bf_8"
|
||||||
},
|
},
|
||||||
{
|
{
|
||||||
|
@ -180,7 +180,7 @@
|
||||||
},
|
},
|
||||||
{
|
{
|
||||||
"type": "draw_started",
|
"type": "draw_started",
|
||||||
"prettyname": "Buttom Prompt B",
|
"prettyname": "Button Prompt B",
|
||||||
"texture_filename": "tex1_32x32_ce62786fc1170192_70b585e07941e91c_8"
|
"texture_filename": "tex1_32x32_ce62786fc1170192_70b585e07941e91c_8"
|
||||||
},
|
},
|
||||||
{
|
{
|
||||||
|
@ -195,7 +195,7 @@
|
||||||
},
|
},
|
||||||
{
|
{
|
||||||
"type": "draw_started",
|
"type": "draw_started",
|
||||||
"prettyname": "Buttom Prompt X",
|
"prettyname": "Button Prompt X",
|
||||||
"texture_filename": "tex1_32x32_b52817e68be0e2d7_d1b283ce04ce1c7c_8"
|
"texture_filename": "tex1_32x32_b52817e68be0e2d7_d1b283ce04ce1c7c_8"
|
||||||
},
|
},
|
||||||
{
|
{
|
||||||
|
@ -205,7 +205,7 @@
|
||||||
},
|
},
|
||||||
{
|
{
|
||||||
"type": "draw_started",
|
"type": "draw_started",
|
||||||
"prettyname": "Buttom Prompt A",
|
"prettyname": "Button Prompt A",
|
||||||
"texture_filename": "tex1_32x32_630cfa888a9d005a_d95570935377e345_8"
|
"texture_filename": "tex1_32x32_630cfa888a9d005a_d95570935377e345_8"
|
||||||
},
|
},
|
||||||
{
|
{
|
||||||
|
|
BIN
Data/Sys/Resources/Platform_Triforce.png
Normal file
BIN
Data/Sys/Resources/Platform_Triforce.png
Normal file
Binary file not shown.
After Width: | Height: | Size: 2.3 KiB |
BIN
Data/Sys/Resources/Platform_Triforce@2x.png
Normal file
BIN
Data/Sys/Resources/Platform_Triforce@2x.png
Normal file
Binary file not shown.
After Width: | Height: | Size: 4.1 KiB |
BIN
Data/Sys/Resources/Platform_Triforce@4x.png
Normal file
BIN
Data/Sys/Resources/Platform_Triforce@4x.png
Normal file
Binary file not shown.
After Width: | Height: | Size: 8.2 KiB |
|
@ -106,14 +106,14 @@ void main()
|
||||||
// scaling while also being able to use the luminance channel.
|
// scaling while also being able to use the luminance channel.
|
||||||
float4 ictcp_color = LinearRGBToICtCP(color);
|
float4 ictcp_color = LinearRGBToICtCP(color);
|
||||||
|
|
||||||
// Scale the color in perceptual space depending on the percieved luminance.
|
// Scale the color in perceptual space depending on the perceived luminance.
|
||||||
//
|
//
|
||||||
// At low luminances, ~0.0, pow(AMPLIFICATION, ~0.0) ~= 1.0, so the
|
// At low luminances, ~0.0, pow(AMPLIFICATION, ~0.0) ~= 1.0, so the
|
||||||
// color will appear to be unchanged. This is important as we don't want to
|
// color will appear to be unchanged. This is important as we don't want to
|
||||||
// over expose dark colors which would not have otherwise been seen.
|
// over expose dark colors which would not have otherwise been seen.
|
||||||
//
|
//
|
||||||
// At high luminances, ~1.0, pow(AMPLIFICATION, ~1.0) ~= AMPLIFICATION,
|
// At high luminances, ~1.0, pow(AMPLIFICATION, ~1.0) ~= AMPLIFICATION,
|
||||||
// which is equivilant to scaling the color by AMPLIFICATION. This is
|
// which is equivalent to scaling the color by AMPLIFICATION. This is
|
||||||
// important as we want to get the most out of the display, and we want to
|
// important as we want to get the most out of the display, and we want to
|
||||||
// get bright colors to hit their target brightness.
|
// get bright colors to hit their target brightness.
|
||||||
//
|
//
|
||||||
|
|
|
@ -391,7 +391,7 @@ bool supportsSIMD(uint simd_width)
|
||||||
#endif
|
#endif
|
||||||
}
|
}
|
||||||
|
|
||||||
// "Error: The AsciiArt shader requires the missing GPU extention KHR_shader_subgroup."
|
// "Error: The AsciiArt shader requires the missing GPU extension KHR_shader_subgroup."
|
||||||
const uint missing_subgroup_warning_len = 82;
|
const uint missing_subgroup_warning_len = 82;
|
||||||
const uint missing_subgroup_warning[missing_subgroup_warning_len] = {
|
const uint missing_subgroup_warning[missing_subgroup_warning_len] = {
|
||||||
37, 82, 82, 79, 82, 26, 95, 52, 72, 69, 95, 33, 83, 67, 73, 73, 33, 82, 84, 95, 83,
|
37, 82, 82, 79, 82, 26, 95, 52, 72, 69, 95, 33, 83, 67, 73, 73, 33, 82, 84, 95, 83,
|
||||||
|
|
|
@ -353,7 +353,7 @@ void main()
|
||||||
// Doing linear sampling in "gamma space" on linear texture formats isn't correct.
|
// Doing linear sampling in "gamma space" on linear texture formats isn't correct.
|
||||||
// If the source and target resolutions don't match, the GPU will return a color
|
// If the source and target resolutions don't match, the GPU will return a color
|
||||||
// that is the average of 4 gamma space colors, but gamma space colors can't be blended together,
|
// that is the average of 4 gamma space colors, but gamma space colors can't be blended together,
|
||||||
// gamma neeeds to be de-applied first. This makes a big difference if colors change
|
// gamma needs to be de-applied first. This makes a big difference if colors change
|
||||||
// drastically between two pixels.
|
// drastically between two pixels.
|
||||||
|
|
||||||
color = LinearGammaCorrectedSample(game_gamma);
|
color = LinearGammaCorrectedSample(game_gamma);
|
||||||
|
|
|
@ -40,7 +40,7 @@ void main()
|
||||||
|
|
||||||
/*****inline square root routines*****/
|
/*****inline square root routines*****/
|
||||||
// bit of a performance bottleneck.
|
// bit of a performance bottleneck.
|
||||||
// neccessary to make the darkened area rounded
|
// necessary to make the darkened area rounded
|
||||||
// instead of rhombus-shaped.
|
// instead of rhombus-shaped.
|
||||||
float sqrt = x / 10.0;
|
float sqrt = x / 10.0;
|
||||||
|
|
||||||
|
|
|
@ -50,7 +50,7 @@ void main()
|
||||||
|
|
||||||
//****inline square root routines*****/
|
//****inline square root routines*****/
|
||||||
// bit of a performance bottleneck.
|
// bit of a performance bottleneck.
|
||||||
// neccessary to make the darkened area rounded
|
// necessary to make the darkened area rounded
|
||||||
// instead of rhombus-shaped.
|
// instead of rhombus-shaped.
|
||||||
float sqrt = x / 10.0;
|
float sqrt = x / 10.0;
|
||||||
while ((sqrt*sqrt) < x)
|
while ((sqrt*sqrt) < x)
|
||||||
|
|
10
Data/Sys/triforcetdb-en.txt
Normal file
10
Data/Sys/triforcetdb-en.txt
Normal file
|
@ -0,0 +1,10 @@
|
||||||
|
TITLES = (type: Triforce language: EN version: 20210908)
|
||||||
|
S000 = Triforce Firmware Update For Compact Flash Box (4.01)
|
||||||
|
SBEY = Virtua Striker 2002
|
||||||
|
SBFX = The Key Of Avalon
|
||||||
|
SBGG = F-Zero AX
|
||||||
|
SBHZ = Virtua Striker 4 (Asia)
|
||||||
|
SBJA = Virtua Striker 4 (Export)
|
||||||
|
SBJN = The Key Of Avalon 2.5: War of the Key
|
||||||
|
SBLK = Virtua Striker 4 Ver.2006 (Japan)
|
||||||
|
SBLL = Virtua Striker 4 Ver.2006 (Export)
|
|
@ -1,7 +1,7 @@
|
||||||
[Desktop Entry]
|
[Desktop Entry]
|
||||||
Version=1.0
|
Version=1.0
|
||||||
Icon=dolphin-emu
|
Icon=dolphin-emu
|
||||||
Exec=env QT_QPA_PLATFORM=xcb dolphin-emu
|
Exec=dolphin-emu
|
||||||
Terminal=false
|
Terminal=false
|
||||||
Type=Application
|
Type=Application
|
||||||
Categories=Game;Emulator;
|
Categories=Game;Emulator;
|
||||||
|
|
35
Externals/SFML/CMakeLists.txt
vendored
35
Externals/SFML/CMakeLists.txt
vendored
|
@ -1,31 +1,34 @@
|
||||||
set(SRC_NETWORK
|
set(SRC_NETWORK
|
||||||
src/SFML/Network/Http.cpp
|
SFML/src/SFML/Network/Http.cpp
|
||||||
src/SFML/Network/IPAddress.cpp
|
SFML/src/SFML/Network/IpAddress.cpp
|
||||||
src/SFML/Network/Packet.cpp
|
SFML/src/SFML/Network/Packet.cpp
|
||||||
src/SFML/Network/Socket.cpp
|
SFML/src/SFML/Network/Socket.cpp
|
||||||
src/SFML/Network/SocketSelector.cpp
|
SFML/src/SFML/Network/SocketSelector.cpp
|
||||||
src/SFML/Network/TcpListener.cpp
|
SFML/src/SFML/Network/TcpListener.cpp
|
||||||
src/SFML/Network/TcpSocket.cpp
|
SFML/src/SFML/Network/TcpSocket.cpp
|
||||||
src/SFML/Network/UdpSocket.cpp
|
SFML/src/SFML/Network/UdpSocket.cpp
|
||||||
)
|
)
|
||||||
|
|
||||||
if(WIN32)
|
if(WIN32)
|
||||||
list(APPEND SRC_NETWORK src/SFML/Network/Win32/SocketImpl.cpp)
|
list(APPEND SRC_NETWORK SFML/src/SFML/Network/Win32/SocketImpl.cpp)
|
||||||
else()
|
else()
|
||||||
list(APPEND SRC_NETWORK src/SFML/Network/Unix/SocketImpl.cpp)
|
list(APPEND SRC_NETWORK SFML/src/SFML/Network/Unix/SocketImpl.cpp)
|
||||||
endif()
|
endif()
|
||||||
|
|
||||||
set(SRC_SYSTEM
|
set(SRC_SYSTEM
|
||||||
src/SFML/System/Err.cpp
|
SFML/src/SFML/System/Err.cpp
|
||||||
src/SFML/System/String.cpp
|
SFML/include/SFML/System/String.hpp
|
||||||
src/SFML/System/Time.cpp
|
SFML/src/SFML/System/String.cpp
|
||||||
|
SFML/src/SFML/System/Utils.cpp
|
||||||
)
|
)
|
||||||
|
|
||||||
add_library(sfml-network STATIC ${SRC_NETWORK})
|
add_library(sfml-network STATIC ${SRC_NETWORK})
|
||||||
add_library(sfml-system STATIC ${SRC_SYSTEM})
|
add_library(sfml-system STATIC ${SRC_SYSTEM})
|
||||||
|
target_compile_features(sfml-network PUBLIC cxx_std_17)
|
||||||
|
target_compile_features(sfml-system PUBLIC cxx_std_17)
|
||||||
target_compile_definitions(sfml-system PUBLIC SFML_STATIC)
|
target_compile_definitions(sfml-system PUBLIC SFML_STATIC)
|
||||||
target_include_directories(sfml-system PUBLIC include PRIVATE src)
|
target_include_directories(sfml-system PUBLIC SFML/include PRIVATE SFML/src)
|
||||||
target_include_directories(sfml-network PUBLIC include PRIVATE src)
|
target_include_directories(sfml-network PUBLIC SFML/include PRIVATE SFML/src)
|
||||||
target_link_libraries(sfml-network PUBLIC sfml-system)
|
target_link_libraries(sfml-network PUBLIC sfml-system)
|
||||||
dolphin_disable_warnings(sfml-network)
|
dolphin_disable_warnings(sfml-network)
|
||||||
dolphin_disable_warnings(sfml-system)
|
dolphin_disable_warnings(sfml-system)
|
1
Externals/SFML/SFML
vendored
Submodule
1
Externals/SFML/SFML
vendored
Submodule
|
@ -0,0 +1 @@
|
||||||
|
Subproject commit 7f1162dfea4969bc17417563ac55d93b72e84c1e
|
67
Externals/SFML/SFML.vcxproj
vendored
Normal file
67
Externals/SFML/SFML.vcxproj
vendored
Normal file
|
@ -0,0 +1,67 @@
|
||||||
|
<?xml version="1.0" encoding="utf-8"?>
|
||||||
|
<Project>
|
||||||
|
<Import Project="..\..\Source\VSProps\Base.Macros.props" />
|
||||||
|
<Import Project="$(VSPropsDir)Base.Targets.props" />
|
||||||
|
<PropertyGroup Label="Globals">
|
||||||
|
<ProjectGuid>{93D73454-2512-424E-9CDA-4BB357FE13DD}</ProjectGuid>
|
||||||
|
</PropertyGroup>
|
||||||
|
<Import Project="$(VCTargetsPath)\Microsoft.Cpp.Default.props" />
|
||||||
|
<Import Project="$(VSPropsDir)Configuration.StaticLibrary.props" />
|
||||||
|
<Import Project="$(VCTargetsPath)\Microsoft.Cpp.props" />
|
||||||
|
<ImportGroup Label="ExtensionSettings" />
|
||||||
|
<ImportGroup Label="PropertySheets">
|
||||||
|
<Import Project="$(UserRootDir)\Microsoft.Cpp.$(Platform).user.props"
|
||||||
|
Condition="exists('$(UserRootDir)\Microsoft.Cpp.$(Platform).user.props')"
|
||||||
|
Label="LocalAppDataPlatform" />
|
||||||
|
<Import Project="$(VSPropsDir)Base.props" />
|
||||||
|
<Import Project="$(VSPropsDir)ClDisableAllWarnings.props" />
|
||||||
|
</ImportGroup>
|
||||||
|
<PropertyGroup Label="UserMacros" />
|
||||||
|
<ItemDefinitionGroup>
|
||||||
|
<ClCompile>
|
||||||
|
<AdditionalIncludeDirectories>SFML\include;SFML\src;%(AdditionalIncludeDirectories)</AdditionalIncludeDirectories>
|
||||||
|
<PreprocessorDefinitions>SFML_STATIC;%(PreprocessorDefinitions)</PreprocessorDefinitions>
|
||||||
|
</ClCompile>
|
||||||
|
</ItemDefinitionGroup>
|
||||||
|
<ItemGroup>
|
||||||
|
<ClCompile Include="SFML\src\SFML\Network\Http.cpp" />
|
||||||
|
<ClCompile Include="SFML\src\SFML\Network\IpAddress.cpp" />
|
||||||
|
<ClCompile Include="SFML\src\SFML\Network\Packet.cpp" />
|
||||||
|
<ClCompile Include="SFML\src\SFML\Network\Socket.cpp" />
|
||||||
|
<ClCompile Include="SFML\src\SFML\Network\SocketSelector.cpp" />
|
||||||
|
<ClCompile Include="SFML\src\SFML\Network\TcpListener.cpp" />
|
||||||
|
<ClCompile Include="SFML\src\SFML\Network\TcpSocket.cpp" />
|
||||||
|
<ClCompile Include="SFML\src\SFML\Network\UdpSocket.cpp" />
|
||||||
|
<ClCompile Include="SFML\src\SFML\Network\Win32\SocketImpl.cpp" />
|
||||||
|
<ClCompile Include="SFML\src\SFML\System\Err.cpp" />
|
||||||
|
<ClCompile Include="SFML\src\SFML\System\String.cpp" />
|
||||||
|
<ClCompile Include="SFML\src\SFML\System\Utils.cpp" />
|
||||||
|
</ItemGroup>
|
||||||
|
<ItemGroup>
|
||||||
|
<ClInclude Include="SFML\include\SFML\Config.hpp" />
|
||||||
|
<ClInclude Include="SFML\include\SFML\Network.hpp" />
|
||||||
|
<ClInclude Include="SFML\include\SFML\Network\Export.hpp" />
|
||||||
|
<ClInclude Include="SFML\include\SFML\Network\Http.hpp" />
|
||||||
|
<ClInclude Include="SFML\include\SFML\Network\IPAddress.hpp" />
|
||||||
|
<ClInclude Include="SFML\include\SFML\Network\Packet.hpp" />
|
||||||
|
<ClInclude Include="SFML\include\SFML\Network\Socket.hpp" />
|
||||||
|
<ClInclude Include="SFML\include\SFML\Network\SocketHandle.hpp" />
|
||||||
|
<ClInclude Include="SFML\include\SFML\Network\SocketSelector.hpp" />
|
||||||
|
<ClInclude Include="SFML\include\SFML\Network\TcpListener.hpp" />
|
||||||
|
<ClInclude Include="SFML\include\SFML\Network\TcpSocket.hpp" />
|
||||||
|
<ClInclude Include="SFML\include\SFML\Network\UdpSocket.hpp" />
|
||||||
|
<ClInclude Include="SFML\include\SFML\System.hpp" />
|
||||||
|
<ClInclude Include="SFML\include\SFML\System\Err.hpp" />
|
||||||
|
<ClInclude Include="SFML\include\SFML\System\Export.hpp" />
|
||||||
|
<ClInclude Include="SFML\include\SFML\System\NonCopyable.hpp" />
|
||||||
|
<ClInclude Include="SFML\include\SFML\System\String.hpp" />
|
||||||
|
<ClInclude Include="SFML\include\SFML\System\String.inl" />
|
||||||
|
<ClInclude Include="SFML\include\SFML\System\Utf.hpp" />
|
||||||
|
<ClInclude Include="SFML\include\SFML\System\Utf.inl" />
|
||||||
|
<ClInclude Include="SFML\src\SFML\Network\SocketImpl.hpp" />
|
||||||
|
<ClInclude Include="SFML\src\SFML\Network\Win32\SocketImpl.hpp" />
|
||||||
|
</ItemGroup>
|
||||||
|
<Import Project="$(VCTargetsPath)\Microsoft.Cpp.targets" />
|
||||||
|
<ImportGroup Label="ExtensionTargets">
|
||||||
|
</ImportGroup>
|
||||||
|
</Project>
|
66
Externals/SFML/build/vc2010/SFML_Network.vcxproj
vendored
66
Externals/SFML/build/vc2010/SFML_Network.vcxproj
vendored
|
@ -1,66 +0,0 @@
|
||||||
<?xml version="1.0" encoding="utf-8"?>
|
|
||||||
<Project>
|
|
||||||
<Import Project="..\..\..\..\Source\VSProps\Base.Macros.props" />
|
|
||||||
<Import Project="$(VSPropsDir)Base.Targets.props" />
|
|
||||||
<PropertyGroup Label="Globals">
|
|
||||||
<ProjectGuid>{93D73454-2512-424E-9CDA-4BB357FE13DD}</ProjectGuid>
|
|
||||||
</PropertyGroup>
|
|
||||||
<Import Project="$(VCTargetsPath)\Microsoft.Cpp.Default.props" />
|
|
||||||
<Import Project="$(VSPropsDir)Configuration.StaticLibrary.props" />
|
|
||||||
<Import Project="$(VCTargetsPath)\Microsoft.Cpp.props" />
|
|
||||||
<ImportGroup Label="ExtensionSettings" />
|
|
||||||
<ImportGroup Label="PropertySheets">
|
|
||||||
<Import Project="$(UserRootDir)\Microsoft.Cpp.$(Platform).user.props" Condition="exists('$(UserRootDir)\Microsoft.Cpp.$(Platform).user.props')" Label="LocalAppDataPlatform" />
|
|
||||||
<Import Project="$(VSPropsDir)Base.props" />
|
|
||||||
<Import Project="$(VSPropsDir)ClDisableAllWarnings.props" />
|
|
||||||
</ImportGroup>
|
|
||||||
<PropertyGroup Label="UserMacros" />
|
|
||||||
<ItemDefinitionGroup>
|
|
||||||
<ClCompile>
|
|
||||||
<AdditionalIncludeDirectories>..\..\include;..\..\src;%(AdditionalIncludeDirectories)</AdditionalIncludeDirectories>
|
|
||||||
<PreprocessorDefinitions>SFML_STATIC;%(PreprocessorDefinitions)</PreprocessorDefinitions>
|
|
||||||
</ClCompile>
|
|
||||||
</ItemDefinitionGroup>
|
|
||||||
<ItemGroup>
|
|
||||||
<ClCompile Include="..\..\src\SFML\Network\Http.cpp" />
|
|
||||||
<ClCompile Include="..\..\src\SFML\Network\IPAddress.cpp" />
|
|
||||||
<ClCompile Include="..\..\src\SFML\Network\Packet.cpp" />
|
|
||||||
<ClCompile Include="..\..\src\SFML\Network\Socket.cpp" />
|
|
||||||
<ClCompile Include="..\..\src\SFML\Network\SocketSelector.cpp" />
|
|
||||||
<ClCompile Include="..\..\src\SFML\Network\TcpListener.cpp" />
|
|
||||||
<ClCompile Include="..\..\src\SFML\Network\TcpSocket.cpp" />
|
|
||||||
<ClCompile Include="..\..\src\SFML\Network\UdpSocket.cpp" />
|
|
||||||
<ClCompile Include="..\..\src\SFML\Network\Win32\SocketImpl.cpp" />
|
|
||||||
<ClCompile Include="..\..\src\SFML\System\Err.cpp" />
|
|
||||||
<ClCompile Include="..\..\src\SFML\System\String.cpp" />
|
|
||||||
<ClCompile Include="..\..\src\SFML\System\Time.cpp" />
|
|
||||||
</ItemGroup>
|
|
||||||
<ItemGroup>
|
|
||||||
<ClInclude Include="..\..\include\SFML\Config.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\Network.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\Network\Export.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\Network\Http.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\Network\IPAddress.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\Network\Packet.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\Network\Socket.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\Network\SocketHandle.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\Network\SocketSelector.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\Network\TcpListener.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\Network\TcpSocket.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\Network\UdpSocket.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\System.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\System\Err.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\System\Export.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\System\NonCopyable.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\System\String.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\System\String.inl" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\System\Time.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\System\Utf.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\System\Utf.inl" />
|
|
||||||
<ClInclude Include="..\..\src\SFML\Network\SocketImpl.hpp" />
|
|
||||||
<ClInclude Include="..\..\src\SFML\Network\Win32\SocketImpl.hpp" />
|
|
||||||
</ItemGroup>
|
|
||||||
<Import Project="$(VCTargetsPath)\Microsoft.Cpp.targets" />
|
|
||||||
<ImportGroup Label="ExtensionTargets">
|
|
||||||
</ImportGroup>
|
|
||||||
</Project>
|
|
|
@ -1,51 +0,0 @@
|
||||||
<?xml version="1.0" encoding="utf-8"?>
|
|
||||||
<Project>
|
|
||||||
<ItemGroup>
|
|
||||||
<ClCompile Include="..\..\src\SFML\Network\Http.cpp" />
|
|
||||||
<ClCompile Include="..\..\src\SFML\Network\IPAddress.cpp" />
|
|
||||||
<ClCompile Include="..\..\src\SFML\Network\Packet.cpp" />
|
|
||||||
<ClCompile Include="..\..\src\SFML\Network\Socket.cpp" />
|
|
||||||
<ClCompile Include="..\..\src\SFML\Network\SocketSelector.cpp" />
|
|
||||||
<ClCompile Include="..\..\src\SFML\Network\TcpListener.cpp" />
|
|
||||||
<ClCompile Include="..\..\src\SFML\Network\TcpSocket.cpp" />
|
|
||||||
<ClCompile Include="..\..\src\SFML\Network\UdpSocket.cpp" />
|
|
||||||
<ClCompile Include="..\..\src\SFML\Network\Win32\SocketImpl.cpp">
|
|
||||||
<Filter>Win32</Filter>
|
|
||||||
</ClCompile>
|
|
||||||
<ClCompile Include="..\..\src\SFML\System\Err.cpp" />
|
|
||||||
<ClCompile Include="..\..\src\SFML\System\String.cpp" />
|
|
||||||
<ClCompile Include="..\..\src\SFML\System\Time.cpp" />
|
|
||||||
</ItemGroup>
|
|
||||||
<ItemGroup>
|
|
||||||
<ClInclude Include="..\..\include\SFML\Config.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\Network.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\Network\Export.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\Network\Http.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\Network\IPAddress.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\Network\Packet.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\Network\Socket.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\Network\SocketHandle.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\Network\SocketSelector.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\Network\TcpListener.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\Network\TcpSocket.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\Network\UdpSocket.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\System.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\System\Err.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\System\Export.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\System\NonCopyable.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\System\String.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\System\String.inl" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\System\Time.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\System\Utf.hpp" />
|
|
||||||
<ClInclude Include="..\..\include\SFML\System\Utf.inl" />
|
|
||||||
<ClInclude Include="..\..\src\SFML\Network\SocketImpl.hpp" />
|
|
||||||
<ClInclude Include="..\..\src\SFML\Network\Win32\SocketImpl.hpp">
|
|
||||||
<Filter>Win32</Filter>
|
|
||||||
</ClInclude>
|
|
||||||
</ItemGroup>
|
|
||||||
<ItemGroup>
|
|
||||||
<Filter Include="Win32">
|
|
||||||
<UniqueIdentifier>{8280ecca-24fc-48a2-b7f5-6aca41826b66}</UniqueIdentifier>
|
|
||||||
</Filter>
|
|
||||||
</ItemGroup>
|
|
||||||
</Project>
|
|
6
Externals/SFML/exports.props
vendored
6
Externals/SFML/exports.props
vendored
|
@ -2,13 +2,13 @@
|
||||||
<Project>
|
<Project>
|
||||||
<ItemDefinitionGroup>
|
<ItemDefinitionGroup>
|
||||||
<ClCompile>
|
<ClCompile>
|
||||||
<AdditionalIncludeDirectories>$(ExternalsDir)SFML\include;%(AdditionalIncludeDirectories)</AdditionalIncludeDirectories>
|
<AdditionalIncludeDirectories>$(ExternalsDir)SFML\SFML\include;%(AdditionalIncludeDirectories)</AdditionalIncludeDirectories>
|
||||||
<PreprocessorDefinitions>SFML_STATIC;%(PreprocessorDefinitions)</PreprocessorDefinitions>
|
<PreprocessorDefinitions>SFML_STATIC;%(PreprocessorDefinitions)</PreprocessorDefinitions>
|
||||||
</ClCompile>
|
</ClCompile>
|
||||||
</ItemDefinitionGroup>
|
</ItemDefinitionGroup>
|
||||||
<ItemGroup>
|
<ItemGroup>
|
||||||
<ProjectReference Include="$(ExternalsDir)SFML\build\vc2010\SFML_Network.vcxproj">
|
<ProjectReference Include="$(ExternalsDir)SFML\SFML.vcxproj">
|
||||||
<Project>{93d73454-2512-424e-9cda-4bb357fe13dd}</Project>
|
<Project>{93d73454-2512-424e-9cda-4bb357fe13dd}</Project>
|
||||||
</ProjectReference>
|
</ProjectReference>
|
||||||
</ItemGroup>
|
</ItemGroup>
|
||||||
</Project>
|
</Project>
|
236
Externals/SFML/include/SFML/Config.hpp
vendored
236
Externals/SFML/include/SFML/Config.hpp
vendored
|
@ -1,236 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#ifndef SFML_CONFIG_HPP
|
|
||||||
#define SFML_CONFIG_HPP
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Define the SFML version
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#define SFML_VERSION_MAJOR 2
|
|
||||||
#define SFML_VERSION_MINOR 5
|
|
||||||
#define SFML_VERSION_PATCH 0
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Identify the operating system
|
|
||||||
// see http://nadeausoftware.com/articles/2012/01/c_c_tip_how_use_compiler_predefined_macros_detect_operating_system
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#if defined(_WIN32)
|
|
||||||
|
|
||||||
// Windows
|
|
||||||
#define SFML_SYSTEM_WINDOWS
|
|
||||||
#ifndef NOMINMAX
|
|
||||||
#define NOMINMAX
|
|
||||||
#endif
|
|
||||||
|
|
||||||
#elif defined(__APPLE__) && defined(__MACH__)
|
|
||||||
|
|
||||||
// Apple platform, see which one it is
|
|
||||||
#include "TargetConditionals.h"
|
|
||||||
|
|
||||||
#if TARGET_OS_IPHONE || TARGET_IPHONE_SIMULATOR
|
|
||||||
|
|
||||||
// iOS
|
|
||||||
#define SFML_SYSTEM_IOS
|
|
||||||
|
|
||||||
#elif TARGET_OS_MAC
|
|
||||||
|
|
||||||
// MacOS
|
|
||||||
#define SFML_SYSTEM_MACOS
|
|
||||||
|
|
||||||
#else
|
|
||||||
|
|
||||||
// Unsupported Apple system
|
|
||||||
#error This Apple operating system is not supported by SFML library
|
|
||||||
|
|
||||||
#endif
|
|
||||||
|
|
||||||
#elif defined(__unix__)
|
|
||||||
|
|
||||||
// UNIX system, see which one it is
|
|
||||||
#if defined(__ANDROID__)
|
|
||||||
|
|
||||||
// Android
|
|
||||||
#define SFML_SYSTEM_ANDROID
|
|
||||||
|
|
||||||
#elif defined(__linux__)
|
|
||||||
|
|
||||||
// Linux
|
|
||||||
#define SFML_SYSTEM_LINUX
|
|
||||||
|
|
||||||
#elif defined(__FreeBSD__) || defined(__FreeBSD_kernel__)
|
|
||||||
|
|
||||||
// FreeBSD
|
|
||||||
#define SFML_SYSTEM_FREEBSD
|
|
||||||
|
|
||||||
#elif defined(__OpenBSD__)
|
|
||||||
|
|
||||||
// OpenBSD
|
|
||||||
#define SFML_SYSTEM_OPENBSD
|
|
||||||
|
|
||||||
#else
|
|
||||||
|
|
||||||
// Unsupported UNIX system
|
|
||||||
#error This UNIX operating system is not supported by SFML library
|
|
||||||
|
|
||||||
#endif
|
|
||||||
|
|
||||||
#else
|
|
||||||
|
|
||||||
// Unsupported system
|
|
||||||
#error This operating system is not supported by SFML library
|
|
||||||
|
|
||||||
#endif
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Define a portable debug macro
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#if !defined(NDEBUG)
|
|
||||||
|
|
||||||
#define SFML_DEBUG
|
|
||||||
|
|
||||||
#endif
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Define helpers to create portable import / export macros for each module
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#if !defined(SFML_STATIC)
|
|
||||||
|
|
||||||
#if defined(SFML_SYSTEM_WINDOWS)
|
|
||||||
|
|
||||||
// Windows compilers need specific (and different) keywords for export and import
|
|
||||||
#define SFML_API_EXPORT __declspec(dllexport)
|
|
||||||
#define SFML_API_IMPORT __declspec(dllimport)
|
|
||||||
|
|
||||||
// For Visual C++ compilers, we also need to turn off this annoying C4251 warning
|
|
||||||
#ifdef _MSC_VER
|
|
||||||
|
|
||||||
#pragma warning(disable: 4251)
|
|
||||||
|
|
||||||
#endif
|
|
||||||
|
|
||||||
#else // Linux, FreeBSD, Mac OS X
|
|
||||||
|
|
||||||
#if __GNUC__ >= 4
|
|
||||||
|
|
||||||
// GCC 4 has special keywords for showing/hidding symbols,
|
|
||||||
// the same keyword is used for both importing and exporting
|
|
||||||
#define SFML_API_EXPORT __attribute__ ((__visibility__ ("default")))
|
|
||||||
#define SFML_API_IMPORT __attribute__ ((__visibility__ ("default")))
|
|
||||||
|
|
||||||
#else
|
|
||||||
|
|
||||||
// GCC < 4 has no mechanism to explicitely hide symbols, everything's exported
|
|
||||||
#define SFML_API_EXPORT
|
|
||||||
#define SFML_API_IMPORT
|
|
||||||
|
|
||||||
#endif
|
|
||||||
|
|
||||||
#endif
|
|
||||||
|
|
||||||
#else
|
|
||||||
|
|
||||||
// Static build doesn't need import/export macros
|
|
||||||
#define SFML_API_EXPORT
|
|
||||||
#define SFML_API_IMPORT
|
|
||||||
|
|
||||||
#endif
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Cross-platform warning for deprecated functions and classes
|
|
||||||
//
|
|
||||||
// Usage:
|
|
||||||
// class SFML_DEPRECATED MyClass
|
|
||||||
// {
|
|
||||||
// SFML_DEPRECATED void memberFunc();
|
|
||||||
// };
|
|
||||||
//
|
|
||||||
// SFML_DEPRECATED void globalFunc();
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#if defined(SFML_NO_DEPRECATED_WARNINGS)
|
|
||||||
|
|
||||||
// User explicitly requests to disable deprecation warnings
|
|
||||||
#define SFML_DEPRECATED
|
|
||||||
|
|
||||||
#elif defined(_MSC_VER)
|
|
||||||
|
|
||||||
// Microsoft C++ compiler
|
|
||||||
// Note: On newer MSVC versions, using deprecated functions causes a compiler error. In order to
|
|
||||||
// trigger a warning instead of an error, the compiler flag /sdl- (instead of /sdl) must be specified.
|
|
||||||
#define SFML_DEPRECATED __declspec(deprecated)
|
|
||||||
|
|
||||||
#elif defined(__GNUC__)
|
|
||||||
|
|
||||||
// g++ and Clang
|
|
||||||
#define SFML_DEPRECATED __attribute__ ((deprecated))
|
|
||||||
|
|
||||||
#else
|
|
||||||
|
|
||||||
// Other compilers are not supported, leave class or function as-is.
|
|
||||||
// With a bit of luck, the #pragma directive works, otherwise users get a warning (no error!) for unrecognized #pragma.
|
|
||||||
#pragma message("SFML_DEPRECATED is not supported for your compiler, please contact the SFML team")
|
|
||||||
#define SFML_DEPRECATED
|
|
||||||
|
|
||||||
#endif
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Define portable fixed-size types
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
namespace sf
|
|
||||||
{
|
|
||||||
// All "common" platforms use the same size for char, short and int
|
|
||||||
// (basically there are 3 types for 3 sizes, so no other match is possible),
|
|
||||||
// we can use them without doing any kind of check
|
|
||||||
|
|
||||||
// 8 bits integer types
|
|
||||||
typedef signed char Int8;
|
|
||||||
typedef unsigned char Uint8;
|
|
||||||
|
|
||||||
// 16 bits integer types
|
|
||||||
typedef signed short Int16;
|
|
||||||
typedef unsigned short Uint16;
|
|
||||||
|
|
||||||
// 32 bits integer types
|
|
||||||
typedef signed int Int32;
|
|
||||||
typedef unsigned int Uint32;
|
|
||||||
|
|
||||||
// 64 bits integer types
|
|
||||||
#if defined(_MSC_VER)
|
|
||||||
typedef signed __int64 Int64;
|
|
||||||
typedef unsigned __int64 Uint64;
|
|
||||||
#else
|
|
||||||
typedef signed long long Int64;
|
|
||||||
typedef unsigned long long Uint64;
|
|
||||||
#endif
|
|
||||||
|
|
||||||
} // namespace sf
|
|
||||||
|
|
||||||
|
|
||||||
#endif // SFML_CONFIG_HPP
|
|
55
Externals/SFML/include/SFML/Network.hpp
vendored
55
Externals/SFML/include/SFML/Network.hpp
vendored
|
@ -1,55 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#ifndef SFML_NETWORK_HPP
|
|
||||||
#define SFML_NETWORK_HPP
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Headers
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#include <SFML/System.hpp>
|
|
||||||
//#include <SFML/Network/Ftp.hpp>
|
|
||||||
#include <SFML/Network/Http.hpp>
|
|
||||||
|
|
||||||
// This file is "IpAddress.hpp" upstream
|
|
||||||
#include <SFML/Network/IPAddress.hpp>
|
|
||||||
#include <SFML/Network/Packet.hpp>
|
|
||||||
#include <SFML/Network/Socket.hpp>
|
|
||||||
#include <SFML/Network/SocketHandle.hpp>
|
|
||||||
#include <SFML/Network/SocketSelector.hpp>
|
|
||||||
#include <SFML/Network/TcpListener.hpp>
|
|
||||||
#include <SFML/Network/TcpSocket.hpp>
|
|
||||||
#include <SFML/Network/UdpSocket.hpp>
|
|
||||||
|
|
||||||
|
|
||||||
#endif // SFML_NETWORK_HPP
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \defgroup network Network module
|
|
||||||
///
|
|
||||||
/// Socket-based communication, utilities and higher-level
|
|
||||||
/// network protocols (HTTP, FTP).
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
48
Externals/SFML/include/SFML/Network/Export.hpp
vendored
48
Externals/SFML/include/SFML/Network/Export.hpp
vendored
|
@ -1,48 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#ifndef SFML_NETWORK_EXPORT_HPP
|
|
||||||
#define SFML_NETWORK_EXPORT_HPP
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Headers
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#include <SFML/Config.hpp>
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Define portable import / export macros
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#if defined(SFML_NETWORK_EXPORTS)
|
|
||||||
|
|
||||||
#define SFML_NETWORK_API SFML_API_EXPORT
|
|
||||||
|
|
||||||
#else
|
|
||||||
|
|
||||||
#define SFML_NETWORK_API SFML_API_IMPORT
|
|
||||||
|
|
||||||
#endif
|
|
||||||
|
|
||||||
|
|
||||||
#endif // SFML_NETWORK_EXPORT_HPP
|
|
482
Externals/SFML/include/SFML/Network/Http.hpp
vendored
482
Externals/SFML/include/SFML/Network/Http.hpp
vendored
|
@ -1,482 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#ifndef SFML_HTTP_HPP
|
|
||||||
#define SFML_HTTP_HPP
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Headers
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#include <SFML/Network/Export.hpp>
|
|
||||||
#include <SFML/Network/IPAddress.hpp>
|
|
||||||
#include <SFML/Network/TcpSocket.hpp>
|
|
||||||
#include <SFML/System/NonCopyable.hpp>
|
|
||||||
#include <SFML/System/Time.hpp>
|
|
||||||
#include <map>
|
|
||||||
#include <string>
|
|
||||||
|
|
||||||
|
|
||||||
namespace sf
|
|
||||||
{
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief A HTTP client
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
class SFML_NETWORK_API Http : NonCopyable
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Define a HTTP request
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
class SFML_NETWORK_API Request
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Enumerate the available HTTP methods for a request
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
enum Method
|
|
||||||
{
|
|
||||||
Get, ///< Request in get mode, standard method to retrieve a page
|
|
||||||
Post, ///< Request in post mode, usually to send data to a page
|
|
||||||
Head, ///< Request a page's header only
|
|
||||||
Put, ///< Request in put mode, useful for a REST API
|
|
||||||
Delete ///< Request in delete mode, useful for a REST API
|
|
||||||
};
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Default constructor
|
|
||||||
///
|
|
||||||
/// This constructor creates a GET request, with the root
|
|
||||||
/// URI ("/") and an empty body.
|
|
||||||
///
|
|
||||||
/// \param uri Target URI
|
|
||||||
/// \param method Method to use for the request
|
|
||||||
/// \param body Content of the request's body
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Request(const std::string& uri = "/", Method method = Get, const std::string& body = "");
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Set the value of a field
|
|
||||||
///
|
|
||||||
/// The field is created if it doesn't exist. The name of
|
|
||||||
/// the field is case-insensitive.
|
|
||||||
/// By default, a request doesn't contain any field (but the
|
|
||||||
/// mandatory fields are added later by the HTTP client when
|
|
||||||
/// sending the request).
|
|
||||||
///
|
|
||||||
/// \param field Name of the field to set
|
|
||||||
/// \param value Value of the field
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void setField(const std::string& field, const std::string& value);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Set the request method
|
|
||||||
///
|
|
||||||
/// See the Method enumeration for a complete list of all
|
|
||||||
/// the availale methods.
|
|
||||||
/// The method is Http::Request::Get by default.
|
|
||||||
///
|
|
||||||
/// \param method Method to use for the request
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void setMethod(Method method);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Set the requested URI
|
|
||||||
///
|
|
||||||
/// The URI is the resource (usually a web page or a file)
|
|
||||||
/// that you want to get or post.
|
|
||||||
/// The URI is "/" (the root page) by default.
|
|
||||||
///
|
|
||||||
/// \param uri URI to request, relative to the host
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void setUri(const std::string& uri);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Set the HTTP version for the request
|
|
||||||
///
|
|
||||||
/// The HTTP version is 1.0 by default.
|
|
||||||
///
|
|
||||||
/// \param major Major HTTP version number
|
|
||||||
/// \param minor Minor HTTP version number
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void setHttpVersion(unsigned int major, unsigned int minor);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Set the body of the request
|
|
||||||
///
|
|
||||||
/// The body of a request is optional and only makes sense
|
|
||||||
/// for POST requests. It is ignored for all other methods.
|
|
||||||
/// The body is empty by default.
|
|
||||||
///
|
|
||||||
/// \param body Content of the body
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void setBody(const std::string& body);
|
|
||||||
|
|
||||||
private:
|
|
||||||
|
|
||||||
friend class Http;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Prepare the final request to send to the server
|
|
||||||
///
|
|
||||||
/// This is used internally by Http before sending the
|
|
||||||
/// request to the web server.
|
|
||||||
///
|
|
||||||
/// \return String containing the request, ready to be sent
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
std::string prepare() const;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Check if the request defines a field
|
|
||||||
///
|
|
||||||
/// This function uses case-insensitive comparisons.
|
|
||||||
///
|
|
||||||
/// \param field Name of the field to test
|
|
||||||
///
|
|
||||||
/// \return True if the field exists, false otherwise
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
bool hasField(const std::string& field) const;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Types
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
typedef std::map<std::string, std::string> FieldTable;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Member data
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
FieldTable m_fields; ///< Fields of the header associated to their value
|
|
||||||
Method m_method; ///< Method to use for the request
|
|
||||||
std::string m_uri; ///< Target URI of the request
|
|
||||||
unsigned int m_majorVersion; ///< Major HTTP version
|
|
||||||
unsigned int m_minorVersion; ///< Minor HTTP version
|
|
||||||
std::string m_body; ///< Body of the request
|
|
||||||
};
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Define a HTTP response
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
class SFML_NETWORK_API Response
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Enumerate all the valid status codes for a response
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
enum Status
|
|
||||||
{
|
|
||||||
// 2xx: success
|
|
||||||
Ok = 200, ///< Most common code returned when operation was successful
|
|
||||||
Created = 201, ///< The resource has successfully been created
|
|
||||||
Accepted = 202, ///< The request has been accepted, but will be processed later by the server
|
|
||||||
NoContent = 204, ///< The server didn't send any data in return
|
|
||||||
ResetContent = 205, ///< The server informs the client that it should clear the view (form) that caused the request to be sent
|
|
||||||
PartialContent = 206, ///< The server has sent a part of the resource, as a response to a partial GET request
|
|
||||||
|
|
||||||
// 3xx: redirection
|
|
||||||
MultipleChoices = 300, ///< The requested page can be accessed from several locations
|
|
||||||
MovedPermanently = 301, ///< The requested page has permanently moved to a new location
|
|
||||||
MovedTemporarily = 302, ///< The requested page has temporarily moved to a new location
|
|
||||||
NotModified = 304, ///< For conditional requests, means the requested page hasn't changed and doesn't need to be refreshed
|
|
||||||
|
|
||||||
// 4xx: client error
|
|
||||||
BadRequest = 400, ///< The server couldn't understand the request (syntax error)
|
|
||||||
Unauthorized = 401, ///< The requested page needs an authentication to be accessed
|
|
||||||
Forbidden = 403, ///< The requested page cannot be accessed at all, even with authentication
|
|
||||||
NotFound = 404, ///< The requested page doesn't exist
|
|
||||||
RangeNotSatisfiable = 407, ///< The server can't satisfy the partial GET request (with a "Range" header field)
|
|
||||||
|
|
||||||
// 5xx: server error
|
|
||||||
InternalServerError = 500, ///< The server encountered an unexpected error
|
|
||||||
NotImplemented = 501, ///< The server doesn't implement a requested feature
|
|
||||||
BadGateway = 502, ///< The gateway server has received an error from the source server
|
|
||||||
ServiceNotAvailable = 503, ///< The server is temporarily unavailable (overloaded, in maintenance, ...)
|
|
||||||
GatewayTimeout = 504, ///< The gateway server couldn't receive a response from the source server
|
|
||||||
VersionNotSupported = 505, ///< The server doesn't support the requested HTTP version
|
|
||||||
|
|
||||||
// 10xx: SFML custom codes
|
|
||||||
InvalidResponse = 1000, ///< Response is not a valid HTTP one
|
|
||||||
ConnectionFailed = 1001 ///< Connection with server failed
|
|
||||||
};
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Default constructor
|
|
||||||
///
|
|
||||||
/// Constructs an empty response.
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Response();
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Get the value of a field
|
|
||||||
///
|
|
||||||
/// If the field \a field is not found in the response header,
|
|
||||||
/// the empty string is returned. This function uses
|
|
||||||
/// case-insensitive comparisons.
|
|
||||||
///
|
|
||||||
/// \param field Name of the field to get
|
|
||||||
///
|
|
||||||
/// \return Value of the field, or empty string if not found
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
const std::string& getField(const std::string& field) const;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Get the response status code
|
|
||||||
///
|
|
||||||
/// The status code should be the first thing to be checked
|
|
||||||
/// after receiving a response, it defines whether it is a
|
|
||||||
/// success, a failure or anything else (see the Status
|
|
||||||
/// enumeration).
|
|
||||||
///
|
|
||||||
/// \return Status code of the response
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Status getStatus() const;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Get the major HTTP version number of the response
|
|
||||||
///
|
|
||||||
/// \return Major HTTP version number
|
|
||||||
///
|
|
||||||
/// \see getMinorHttpVersion
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
unsigned int getMajorHttpVersion() const;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Get the minor HTTP version number of the response
|
|
||||||
///
|
|
||||||
/// \return Minor HTTP version number
|
|
||||||
///
|
|
||||||
/// \see getMajorHttpVersion
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
unsigned int getMinorHttpVersion() const;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Get the body of the response
|
|
||||||
///
|
|
||||||
/// The body of a response may contain:
|
|
||||||
/// \li the requested page (for GET requests)
|
|
||||||
/// \li a response from the server (for POST requests)
|
|
||||||
/// \li nothing (for HEAD requests)
|
|
||||||
/// \li an error message (in case of an error)
|
|
||||||
///
|
|
||||||
/// \return The response body
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
const std::string& getBody() const;
|
|
||||||
|
|
||||||
private:
|
|
||||||
|
|
||||||
friend class Http;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Construct the header from a response string
|
|
||||||
///
|
|
||||||
/// This function is used by Http to build the response
|
|
||||||
/// of a request.
|
|
||||||
///
|
|
||||||
/// \param data Content of the response to parse
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void parse(const std::string& data);
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Read values passed in the answer header
|
|
||||||
///
|
|
||||||
/// This function is used by Http to extract values passed
|
|
||||||
/// in the response.
|
|
||||||
///
|
|
||||||
/// \param in String stream containing the header values
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void parseFields(std::istream &in);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Types
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
typedef std::map<std::string, std::string> FieldTable;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Member data
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
FieldTable m_fields; ///< Fields of the header
|
|
||||||
Status m_status; ///< Status code
|
|
||||||
unsigned int m_majorVersion; ///< Major HTTP version
|
|
||||||
unsigned int m_minorVersion; ///< Minor HTTP version
|
|
||||||
std::string m_body; ///< Body of the response
|
|
||||||
};
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Default constructor
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Http();
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Construct the HTTP client with the target host
|
|
||||||
///
|
|
||||||
/// This is equivalent to calling setHost(host, port).
|
|
||||||
/// The port has a default value of 0, which means that the
|
|
||||||
/// HTTP client will use the right port according to the
|
|
||||||
/// protocol used (80 for HTTP). You should leave it like
|
|
||||||
/// this unless you really need a port other than the
|
|
||||||
/// standard one, or use an unknown protocol.
|
|
||||||
///
|
|
||||||
/// \param host Web server to connect to
|
|
||||||
/// \param port Port to use for connection
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Http(const std::string& host, unsigned short port = 0);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Set the target host
|
|
||||||
///
|
|
||||||
/// This function just stores the host address and port, it
|
|
||||||
/// doesn't actually connect to it until you send a request.
|
|
||||||
/// The port has a default value of 0, which means that the
|
|
||||||
/// HTTP client will use the right port according to the
|
|
||||||
/// protocol used (80 for HTTP). You should leave it like
|
|
||||||
/// this unless you really need a port other than the
|
|
||||||
/// standard one, or use an unknown protocol.
|
|
||||||
///
|
|
||||||
/// \param host Web server to connect to
|
|
||||||
/// \param port Port to use for connection
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void setHost(const std::string& host, unsigned short port = 0);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Send a HTTP request and return the server's response.
|
|
||||||
///
|
|
||||||
/// You must have a valid host before sending a request (see setHost).
|
|
||||||
/// Any missing mandatory header field in the request will be added
|
|
||||||
/// with an appropriate value.
|
|
||||||
/// Warning: this function waits for the server's response and may
|
|
||||||
/// not return instantly; use a thread if you don't want to block your
|
|
||||||
/// application, or use a timeout to limit the time to wait. A value
|
|
||||||
/// of Time::Zero means that the client will use the system default timeout
|
|
||||||
/// (which is usually pretty long).
|
|
||||||
///
|
|
||||||
/// \param request Request to send
|
|
||||||
/// \param timeout Maximum time to wait
|
|
||||||
///
|
|
||||||
/// \return Server's response
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Response sendRequest(const Request& request, Time timeout = Time::Zero);
|
|
||||||
|
|
||||||
private:
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Member data
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
TcpSocket m_connection; ///< Connection to the host
|
|
||||||
IpAddress m_host; ///< Web host address
|
|
||||||
std::string m_hostName; ///< Web host name
|
|
||||||
unsigned short m_port; ///< Port used for connection with host
|
|
||||||
};
|
|
||||||
|
|
||||||
} // namespace sf
|
|
||||||
|
|
||||||
|
|
||||||
#endif // SFML_HTTP_HPP
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \class sf::Http
|
|
||||||
/// \ingroup network
|
|
||||||
///
|
|
||||||
/// sf::Http is a very simple HTTP client that allows you
|
|
||||||
/// to communicate with a web server. You can retrieve
|
|
||||||
/// web pages, send data to an interactive resource,
|
|
||||||
/// download a remote file, etc. The HTTPS protocol is
|
|
||||||
/// not supported.
|
|
||||||
///
|
|
||||||
/// The HTTP client is split into 3 classes:
|
|
||||||
/// \li sf::Http::Request
|
|
||||||
/// \li sf::Http::Response
|
|
||||||
/// \li sf::Http
|
|
||||||
///
|
|
||||||
/// sf::Http::Request builds the request that will be
|
|
||||||
/// sent to the server. A request is made of:
|
|
||||||
/// \li a method (what you want to do)
|
|
||||||
/// \li a target URI (usually the name of the web page or file)
|
|
||||||
/// \li one or more header fields (options that you can pass to the server)
|
|
||||||
/// \li an optional body (for POST requests)
|
|
||||||
///
|
|
||||||
/// sf::Http::Response parse the response from the web server
|
|
||||||
/// and provides getters to read them. The response contains:
|
|
||||||
/// \li a status code
|
|
||||||
/// \li header fields (that may be answers to the ones that you requested)
|
|
||||||
/// \li a body, which contains the contents of the requested resource
|
|
||||||
///
|
|
||||||
/// sf::Http provides a simple function, SendRequest, to send a
|
|
||||||
/// sf::Http::Request and return the corresponding sf::Http::Response
|
|
||||||
/// from the server.
|
|
||||||
///
|
|
||||||
/// Usage example:
|
|
||||||
/// \code
|
|
||||||
/// // Create a new HTTP client
|
|
||||||
/// sf::Http http;
|
|
||||||
///
|
|
||||||
/// // We'll work on http://www.sfml-dev.org
|
|
||||||
/// http.setHost("http://www.sfml-dev.org");
|
|
||||||
///
|
|
||||||
/// // Prepare a request to get the 'features.php' page
|
|
||||||
/// sf::Http::Request request("features.php");
|
|
||||||
///
|
|
||||||
/// // Send the request
|
|
||||||
/// sf::Http::Response response = http.sendRequest(request);
|
|
||||||
///
|
|
||||||
/// // Check the status code and display the result
|
|
||||||
/// sf::Http::Response::Status status = response.getStatus();
|
|
||||||
/// if (status == sf::Http::Response::Ok)
|
|
||||||
/// {
|
|
||||||
/// std::cout << response.getBody() << std::endl;
|
|
||||||
/// }
|
|
||||||
/// else
|
|
||||||
/// {
|
|
||||||
/// std::cout << "Error " << status << std::endl;
|
|
||||||
/// }
|
|
||||||
/// \endcode
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
328
Externals/SFML/include/SFML/Network/IPAddress.hpp
vendored
328
Externals/SFML/include/SFML/Network/IPAddress.hpp
vendored
|
@ -1,328 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#ifndef SFML_IPADDRESS_HPP
|
|
||||||
#define SFML_IPADDRESS_HPP
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Headers
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#include <SFML/Network/Export.hpp>
|
|
||||||
#include <SFML/System/Time.hpp>
|
|
||||||
#include <istream>
|
|
||||||
#include <ostream>
|
|
||||||
#include <string>
|
|
||||||
|
|
||||||
|
|
||||||
namespace sf
|
|
||||||
{
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Encapsulate an IPv4 network address
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
class SFML_NETWORK_API IpAddress
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Default constructor
|
|
||||||
///
|
|
||||||
/// This constructor creates an empty (invalid) address
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
IpAddress();
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Construct the address from a string
|
|
||||||
///
|
|
||||||
/// Here \a address can be either a decimal address
|
|
||||||
/// (ex: "192.168.1.56") or a network name (ex: "localhost").
|
|
||||||
///
|
|
||||||
/// \param address IP address or network name
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
IpAddress(const std::string& address);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Construct the address from a string
|
|
||||||
///
|
|
||||||
/// Here \a address can be either a decimal address
|
|
||||||
/// (ex: "192.168.1.56") or a network name (ex: "localhost").
|
|
||||||
/// This is equivalent to the constructor taking a std::string
|
|
||||||
/// parameter, it is defined for convenience so that the
|
|
||||||
/// implicit conversions from literal strings to IpAddress work.
|
|
||||||
///
|
|
||||||
/// \param address IP address or network name
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
IpAddress(const char* address);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Construct the address from 4 bytes
|
|
||||||
///
|
|
||||||
/// Calling IpAddress(a, b, c, d) is equivalent to calling
|
|
||||||
/// IpAddress("a.b.c.d"), but safer as it doesn't have to
|
|
||||||
/// parse a string to get the address components.
|
|
||||||
///
|
|
||||||
/// \param byte0 First byte of the address
|
|
||||||
/// \param byte1 Second byte of the address
|
|
||||||
/// \param byte2 Third byte of the address
|
|
||||||
/// \param byte3 Fourth byte of the address
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
IpAddress(Uint8 byte0, Uint8 byte1, Uint8 byte2, Uint8 byte3);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Construct the address from a 32-bits integer
|
|
||||||
///
|
|
||||||
/// This constructor uses the internal representation of
|
|
||||||
/// the address directly. It should be used for optimization
|
|
||||||
/// purposes, and only if you got that representation from
|
|
||||||
/// IpAddress::toInteger().
|
|
||||||
///
|
|
||||||
/// \param address 4 bytes of the address packed into a 32-bits integer
|
|
||||||
///
|
|
||||||
/// \see toInteger
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
explicit IpAddress(Uint32 address);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Get a string representation of the address
|
|
||||||
///
|
|
||||||
/// The returned string is the decimal representation of the
|
|
||||||
/// IP address (like "192.168.1.56"), even if it was constructed
|
|
||||||
/// from a host name.
|
|
||||||
///
|
|
||||||
/// \return String representation of the address
|
|
||||||
///
|
|
||||||
/// \see toInteger
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
std::string toString() const;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Get an integer representation of the address
|
|
||||||
///
|
|
||||||
/// The returned number is the internal representation of the
|
|
||||||
/// address, and should be used for optimization purposes only
|
|
||||||
/// (like sending the address through a socket).
|
|
||||||
/// The integer produced by this function can then be converted
|
|
||||||
/// back to a sf::IpAddress with the proper constructor.
|
|
||||||
///
|
|
||||||
/// \return 32-bits unsigned integer representation of the address
|
|
||||||
///
|
|
||||||
/// \see toString
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Uint32 toInteger() const;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Get the computer's local address
|
|
||||||
///
|
|
||||||
/// The local address is the address of the computer from the
|
|
||||||
/// LAN point of view, i.e. something like 192.168.1.56. It is
|
|
||||||
/// meaningful only for communications over the local network.
|
|
||||||
/// Unlike getPublicAddress, this function is fast and may be
|
|
||||||
/// used safely anywhere.
|
|
||||||
///
|
|
||||||
/// \return Local IP address of the computer
|
|
||||||
///
|
|
||||||
/// \see getPublicAddress
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
static IpAddress getLocalAddress();
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Get the computer's public address
|
|
||||||
///
|
|
||||||
/// The public address is the address of the computer from the
|
|
||||||
/// internet point of view, i.e. something like 89.54.1.169.
|
|
||||||
/// It is necessary for communications over the world wide web.
|
|
||||||
/// The only way to get a public address is to ask it to a
|
|
||||||
/// distant website; as a consequence, this function depends on
|
|
||||||
/// both your network connection and the server, and may be
|
|
||||||
/// very slow. You should use it as few as possible. Because
|
|
||||||
/// this function depends on the network connection and on a distant
|
|
||||||
/// server, you may use a time limit if you don't want your program
|
|
||||||
/// to be possibly stuck waiting in case there is a problem; this
|
|
||||||
/// limit is deactivated by default.
|
|
||||||
///
|
|
||||||
/// \param timeout Maximum time to wait
|
|
||||||
///
|
|
||||||
/// \return Public IP address of the computer
|
|
||||||
///
|
|
||||||
/// \see getLocalAddress
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
static IpAddress getPublicAddress(Time timeout = Time::Zero);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Static member data
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
static const IpAddress None; ///< Value representing an empty/invalid address
|
|
||||||
static const IpAddress Any; ///< Value representing any address (0.0.0.0)
|
|
||||||
static const IpAddress LocalHost; ///< The "localhost" address (for connecting a computer to itself locally)
|
|
||||||
static const IpAddress Broadcast; ///< The "broadcast" address (for sending UDP messages to everyone on a local network)
|
|
||||||
|
|
||||||
private:
|
|
||||||
|
|
||||||
friend SFML_NETWORK_API bool operator <(const IpAddress& left, const IpAddress& right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Resolve the given address string
|
|
||||||
///
|
|
||||||
/// \param address Address string
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void resolve(const std::string& address);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Member data
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Uint32 m_address; ///< Address stored as an unsigned 32 bits integer
|
|
||||||
bool m_valid; ///< Is the address valid?
|
|
||||||
};
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Overload of == operator to compare two IP addresses
|
|
||||||
///
|
|
||||||
/// \param left Left operand (a IP address)
|
|
||||||
/// \param right Right operand (a IP address)
|
|
||||||
///
|
|
||||||
/// \return True if both addresses are equal
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_NETWORK_API bool operator ==(const IpAddress& left, const IpAddress& right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Overload of != operator to compare two IP addresses
|
|
||||||
///
|
|
||||||
/// \param left Left operand (a IP address)
|
|
||||||
/// \param right Right operand (a IP address)
|
|
||||||
///
|
|
||||||
/// \return True if both addresses are different
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_NETWORK_API bool operator !=(const IpAddress& left, const IpAddress& right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Overload of < operator to compare two IP addresses
|
|
||||||
///
|
|
||||||
/// \param left Left operand (a IP address)
|
|
||||||
/// \param right Right operand (a IP address)
|
|
||||||
///
|
|
||||||
/// \return True if \a left is lesser than \a right
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_NETWORK_API bool operator <(const IpAddress& left, const IpAddress& right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Overload of > operator to compare two IP addresses
|
|
||||||
///
|
|
||||||
/// \param left Left operand (a IP address)
|
|
||||||
/// \param right Right operand (a IP address)
|
|
||||||
///
|
|
||||||
/// \return True if \a left is greater than \a right
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_NETWORK_API bool operator >(const IpAddress& left, const IpAddress& right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Overload of <= operator to compare two IP addresses
|
|
||||||
///
|
|
||||||
/// \param left Left operand (a IP address)
|
|
||||||
/// \param right Right operand (a IP address)
|
|
||||||
///
|
|
||||||
/// \return True if \a left is lesser or equal than \a right
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_NETWORK_API bool operator <=(const IpAddress& left, const IpAddress& right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Overload of >= operator to compare two IP addresses
|
|
||||||
///
|
|
||||||
/// \param left Left operand (a IP address)
|
|
||||||
/// \param right Right operand (a IP address)
|
|
||||||
///
|
|
||||||
/// \return True if \a left is greater or equal than \a right
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_NETWORK_API bool operator >=(const IpAddress& left, const IpAddress& right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Overload of >> operator to extract an IP address from an input stream
|
|
||||||
///
|
|
||||||
/// \param stream Input stream
|
|
||||||
/// \param address IP address to extract
|
|
||||||
///
|
|
||||||
/// \return Reference to the input stream
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_NETWORK_API std::istream& operator >>(std::istream& stream, IpAddress& address);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Overload of << operator to print an IP address to an output stream
|
|
||||||
///
|
|
||||||
/// \param stream Output stream
|
|
||||||
/// \param address IP address to print
|
|
||||||
///
|
|
||||||
/// \return Reference to the output stream
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_NETWORK_API std::ostream& operator <<(std::ostream& stream, const IpAddress& address);
|
|
||||||
|
|
||||||
} // namespace sf
|
|
||||||
|
|
||||||
|
|
||||||
#endif // SFML_IPADDRESS_HPP
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \class sf::IpAddress
|
|
||||||
/// \ingroup network
|
|
||||||
///
|
|
||||||
/// sf::IpAddress is a utility class for manipulating network
|
|
||||||
/// addresses. It provides a set a implicit constructors and
|
|
||||||
/// conversion functions to easily build or transform an IP
|
|
||||||
/// address from/to various representations.
|
|
||||||
///
|
|
||||||
/// Usage example:
|
|
||||||
/// \code
|
|
||||||
/// sf::IpAddress a0; // an invalid address
|
|
||||||
/// sf::IpAddress a1 = sf::IpAddress::None; // an invalid address (same as a0)
|
|
||||||
/// sf::IpAddress a2("127.0.0.1"); // the local host address
|
|
||||||
/// sf::IpAddress a3 = sf::IpAddress::Broadcast; // the broadcast address
|
|
||||||
/// sf::IpAddress a4(192, 168, 1, 56); // a local address
|
|
||||||
/// sf::IpAddress a5("my_computer"); // a local address created from a network name
|
|
||||||
/// sf::IpAddress a6("89.54.1.169"); // a distant address
|
|
||||||
/// sf::IpAddress a7("www.google.com"); // a distant address created from a network name
|
|
||||||
/// sf::IpAddress a8 = sf::IpAddress::getLocalAddress(); // my address on the local network
|
|
||||||
/// sf::IpAddress a9 = sf::IpAddress::getPublicAddress(); // my address on the internet
|
|
||||||
/// \endcode
|
|
||||||
///
|
|
||||||
/// Note that sf::IpAddress currently doesn't support IPv6
|
|
||||||
/// nor other types of network addresses.
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
532
Externals/SFML/include/SFML/Network/Packet.hpp
vendored
532
Externals/SFML/include/SFML/Network/Packet.hpp
vendored
|
@ -1,532 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#ifndef SFML_PACKET_HPP
|
|
||||||
#define SFML_PACKET_HPP
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Headers
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#include <SFML/Network/Export.hpp>
|
|
||||||
#include <string>
|
|
||||||
#include <vector>
|
|
||||||
|
|
||||||
|
|
||||||
namespace sf
|
|
||||||
{
|
|
||||||
class String;
|
|
||||||
class TcpSocket;
|
|
||||||
class UdpSocket;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Utility class to build blocks of data to transfer
|
|
||||||
/// over the network
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
class SFML_NETWORK_API Packet
|
|
||||||
{
|
|
||||||
// A bool-like type that cannot be converted to integer or pointer types
|
|
||||||
typedef bool (Packet::*BoolType)(std::size_t);
|
|
||||||
|
|
||||||
public:
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Default constructor
|
|
||||||
///
|
|
||||||
/// Creates an empty packet.
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet();
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Virtual destructor
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
virtual ~Packet();
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Append data to the end of the packet
|
|
||||||
///
|
|
||||||
/// \param data Pointer to the sequence of bytes to append
|
|
||||||
/// \param sizeInBytes Number of bytes to append
|
|
||||||
///
|
|
||||||
/// \see clear
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void append(const void* data, std::size_t sizeInBytes);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Clear the packet
|
|
||||||
///
|
|
||||||
/// After calling Clear, the packet is empty.
|
|
||||||
///
|
|
||||||
/// \see append
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void clear();
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Get a pointer to the data contained in the packet
|
|
||||||
///
|
|
||||||
/// Warning: the returned pointer may become invalid after
|
|
||||||
/// you append data to the packet, therefore it should never
|
|
||||||
/// be stored.
|
|
||||||
/// The return pointer is NULL if the packet is empty.
|
|
||||||
///
|
|
||||||
/// \return Pointer to the data
|
|
||||||
///
|
|
||||||
/// \see getDataSize
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
const void* getData() const;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Get the size of the data contained in the packet
|
|
||||||
///
|
|
||||||
/// This function returns the number of bytes pointed to by
|
|
||||||
/// what getData returns.
|
|
||||||
///
|
|
||||||
/// \return Data size, in bytes
|
|
||||||
///
|
|
||||||
/// \see getData
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
std::size_t getDataSize() const;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Tell if the reading position has reached the
|
|
||||||
/// end of the packet
|
|
||||||
///
|
|
||||||
/// This function is useful to know if there is some data
|
|
||||||
/// left to be read, without actually reading it.
|
|
||||||
///
|
|
||||||
/// \return True if all data was read, false otherwise
|
|
||||||
///
|
|
||||||
/// \see operator bool
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
bool endOfPacket() const;
|
|
||||||
|
|
||||||
public:
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Test the validity of the packet, for reading
|
|
||||||
///
|
|
||||||
/// This operator allows to test the packet as a boolean
|
|
||||||
/// variable, to check if a reading operation was successful.
|
|
||||||
///
|
|
||||||
/// A packet will be in an invalid state if it has no more
|
|
||||||
/// data to read.
|
|
||||||
///
|
|
||||||
/// This behavior is the same as standard C++ streams.
|
|
||||||
///
|
|
||||||
/// Usage example:
|
|
||||||
/// \code
|
|
||||||
/// float x;
|
|
||||||
/// packet >> x;
|
|
||||||
/// if (packet)
|
|
||||||
/// {
|
|
||||||
/// // ok, x was extracted successfully
|
|
||||||
/// }
|
|
||||||
///
|
|
||||||
/// // -- or --
|
|
||||||
///
|
|
||||||
/// float x;
|
|
||||||
/// if (packet >> x)
|
|
||||||
/// {
|
|
||||||
/// // ok, x was extracted successfully
|
|
||||||
/// }
|
|
||||||
/// \endcode
|
|
||||||
///
|
|
||||||
/// Don't focus on the return type, it's equivalent to bool but
|
|
||||||
/// it disallows unwanted implicit conversions to integer or
|
|
||||||
/// pointer types.
|
|
||||||
///
|
|
||||||
/// \return True if last data extraction from packet was successful
|
|
||||||
///
|
|
||||||
/// \see endOfPacket
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
operator BoolType() const;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// Overload of operator >> to read data from the packet
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& operator >>(bool& data);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \overload
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& operator >>(Int8& data);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \overload
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& operator >>(Uint8& data);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \overload
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& operator >>(Int16& data);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \overload
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& operator >>(Uint16& data);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \overload
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& operator >>(Int32& data);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \overload
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& operator >>(Uint32& data);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \overload
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& operator >>(Int64& data);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \overload
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& operator >>(Uint64& data);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \overload
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& operator >>(float& data);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \overload
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& operator >>(double& data);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \overload
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& operator >>(char* data);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \overload
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& operator >>(std::string& data);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \overload
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& operator >>(wchar_t* data);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \overload
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& operator >>(std::wstring& data);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \overload
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& operator >>(String& data);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// Overload of operator << to write data into the packet
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& operator <<(bool data);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \overload
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& operator <<(Int8 data);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \overload
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& operator <<(Uint8 data);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \overload
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& operator <<(Int16 data);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \overload
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& operator <<(Uint16 data);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \overload
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& operator <<(Int32 data);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \overload
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& operator <<(Uint32 data);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \overload
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& operator <<(Int64 data);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \overload
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& operator <<(Uint64 data);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \overload
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& operator <<(float data);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \overload
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& operator <<(double data);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \overload
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& operator <<(const char* data);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \overload
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& operator <<(const std::string& data);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \overload
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& operator <<(const wchar_t* data);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \overload
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& operator <<(const std::wstring& data);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \overload
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& operator <<(const String& data);
|
|
||||||
|
|
||||||
protected:
|
|
||||||
|
|
||||||
friend class TcpSocket;
|
|
||||||
friend class UdpSocket;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Called before the packet is sent over the network
|
|
||||||
///
|
|
||||||
/// This function can be defined by derived classes to
|
|
||||||
/// transform the data before it is sent; this can be
|
|
||||||
/// used for compression, encryption, etc.
|
|
||||||
/// The function must return a pointer to the modified data,
|
|
||||||
/// as well as the number of bytes pointed.
|
|
||||||
/// The default implementation provides the packet's data
|
|
||||||
/// without transforming it.
|
|
||||||
///
|
|
||||||
/// \param size Variable to fill with the size of data to send
|
|
||||||
///
|
|
||||||
/// \return Pointer to the array of bytes to send
|
|
||||||
///
|
|
||||||
/// \see onReceive
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
virtual const void* onSend(std::size_t& size);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Called after the packet is received over the network
|
|
||||||
///
|
|
||||||
/// This function can be defined by derived classes to
|
|
||||||
/// transform the data after it is received; this can be
|
|
||||||
/// used for decompression, decryption, etc.
|
|
||||||
/// The function receives a pointer to the received data,
|
|
||||||
/// and must fill the packet with the transformed bytes.
|
|
||||||
/// The default implementation fills the packet directly
|
|
||||||
/// without transforming the data.
|
|
||||||
///
|
|
||||||
/// \param data Pointer to the received bytes
|
|
||||||
/// \param size Number of bytes
|
|
||||||
///
|
|
||||||
/// \see onSend
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
virtual void onReceive(const void* data, std::size_t size);
|
|
||||||
|
|
||||||
private:
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// Disallow comparisons between packets
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
bool operator ==(const Packet& right) const;
|
|
||||||
bool operator !=(const Packet& right) const;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Check if the packet can extract a given number of bytes
|
|
||||||
///
|
|
||||||
/// This function updates accordingly the state of the packet.
|
|
||||||
///
|
|
||||||
/// \param size Size to check
|
|
||||||
///
|
|
||||||
/// \return True if \a size bytes can be read from the packet
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
bool checkSize(std::size_t size);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Member data
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
std::vector<char> m_data; ///< Data stored in the packet
|
|
||||||
std::size_t m_readPos; ///< Current reading position in the packet
|
|
||||||
std::size_t m_sendPos; ///< Current send position in the packet (for handling partial sends)
|
|
||||||
bool m_isValid; ///< Reading state of the packet
|
|
||||||
};
|
|
||||||
|
|
||||||
} // namespace sf
|
|
||||||
|
|
||||||
|
|
||||||
#endif // SFML_PACKET_HPP
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \class sf::Packet
|
|
||||||
/// \ingroup network
|
|
||||||
///
|
|
||||||
/// Packets provide a safe and easy way to serialize data,
|
|
||||||
/// in order to send it over the network using sockets
|
|
||||||
/// (sf::TcpSocket, sf::UdpSocket).
|
|
||||||
///
|
|
||||||
/// Packets solve 2 fundamental problems that arise when
|
|
||||||
/// transferring data over the network:
|
|
||||||
/// \li data is interpreted correctly according to the endianness
|
|
||||||
/// \li the bounds of the packet are preserved (one send == one receive)
|
|
||||||
///
|
|
||||||
/// The sf::Packet class provides both input and output modes.
|
|
||||||
/// It is designed to follow the behavior of standard C++ streams,
|
|
||||||
/// using operators >> and << to extract and insert data.
|
|
||||||
///
|
|
||||||
/// It is recommended to use only fixed-size types (like sf::Int32, etc.),
|
|
||||||
/// to avoid possible differences between the sender and the receiver.
|
|
||||||
/// Indeed, the native C++ types may have different sizes on two platforms
|
|
||||||
/// and your data may be corrupted if that happens.
|
|
||||||
///
|
|
||||||
/// Usage example:
|
|
||||||
/// \code
|
|
||||||
/// sf::Uint32 x = 24;
|
|
||||||
/// std::string s = "hello";
|
|
||||||
/// double d = 5.89;
|
|
||||||
///
|
|
||||||
/// // Group the variables to send into a packet
|
|
||||||
/// sf::Packet packet;
|
|
||||||
/// packet << x << s << d;
|
|
||||||
///
|
|
||||||
/// // Send it over the network (socket is a valid sf::TcpSocket)
|
|
||||||
/// socket.send(packet);
|
|
||||||
///
|
|
||||||
/// -----------------------------------------------------------------
|
|
||||||
///
|
|
||||||
/// // Receive the packet at the other end
|
|
||||||
/// sf::Packet packet;
|
|
||||||
/// socket.receive(packet);
|
|
||||||
///
|
|
||||||
/// // Extract the variables contained in the packet
|
|
||||||
/// sf::Uint32 x;
|
|
||||||
/// std::string s;
|
|
||||||
/// double d;
|
|
||||||
/// if (packet >> x >> s >> d)
|
|
||||||
/// {
|
|
||||||
/// // Data extracted successfully...
|
|
||||||
/// }
|
|
||||||
/// \endcode
|
|
||||||
///
|
|
||||||
/// Packets have built-in operator >> and << overloads for
|
|
||||||
/// standard types:
|
|
||||||
/// \li bool
|
|
||||||
/// \li fixed-size integer types (sf::Int8/16/32, sf::Uint8/16/32)
|
|
||||||
/// \li floating point numbers (float, double)
|
|
||||||
/// \li string types (char*, wchar_t*, std::string, std::wstring, sf::String)
|
|
||||||
///
|
|
||||||
/// Like standard streams, it is also possible to define your own
|
|
||||||
/// overloads of operators >> and << in order to handle your
|
|
||||||
/// custom types.
|
|
||||||
///
|
|
||||||
/// \code
|
|
||||||
/// struct MyStruct
|
|
||||||
/// {
|
|
||||||
/// float number;
|
|
||||||
/// sf::Int8 integer;
|
|
||||||
/// std::string str;
|
|
||||||
/// };
|
|
||||||
///
|
|
||||||
/// sf::Packet& operator <<(sf::Packet& packet, const MyStruct& m)
|
|
||||||
/// {
|
|
||||||
/// return packet << m.number << m.integer << m.str;
|
|
||||||
/// }
|
|
||||||
///
|
|
||||||
/// sf::Packet& operator >>(sf::Packet& packet, MyStruct& m)
|
|
||||||
/// {
|
|
||||||
/// return packet >> m.number >> m.integer >> m.str;
|
|
||||||
/// }
|
|
||||||
/// \endcode
|
|
||||||
///
|
|
||||||
/// Packets also provide an extra feature that allows to apply
|
|
||||||
/// custom transformations to the data before it is sent,
|
|
||||||
/// and after it is received. This is typically used to
|
|
||||||
/// handle automatic compression or encryption of the data.
|
|
||||||
/// This is achieved by inheriting from sf::Packet, and overriding
|
|
||||||
/// the onSend and onReceive functions.
|
|
||||||
///
|
|
||||||
/// Here is an example:
|
|
||||||
/// \code
|
|
||||||
/// class ZipPacket : public sf::Packet
|
|
||||||
/// {
|
|
||||||
/// virtual const void* onSend(std::size_t& size)
|
|
||||||
/// {
|
|
||||||
/// const void* srcData = getData();
|
|
||||||
/// std::size_t srcSize = getDataSize();
|
|
||||||
///
|
|
||||||
/// return MySuperZipFunction(srcData, srcSize, &size);
|
|
||||||
/// }
|
|
||||||
///
|
|
||||||
/// virtual void onReceive(const void* data, std::size_t size)
|
|
||||||
/// {
|
|
||||||
/// std::size_t dstSize;
|
|
||||||
/// const void* dstData = MySuperUnzipFunction(data, size, &dstSize);
|
|
||||||
///
|
|
||||||
/// append(dstData, dstSize);
|
|
||||||
/// }
|
|
||||||
/// };
|
|
||||||
///
|
|
||||||
/// // Use like regular packets:
|
|
||||||
/// ZipPacket packet;
|
|
||||||
/// packet << x << s << d;
|
|
||||||
/// ...
|
|
||||||
/// \endcode
|
|
||||||
///
|
|
||||||
/// \see sf::TcpSocket, sf::UdpSocket
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
219
Externals/SFML/include/SFML/Network/Socket.hpp
vendored
219
Externals/SFML/include/SFML/Network/Socket.hpp
vendored
|
@ -1,219 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#ifndef SFML_SOCKET_HPP
|
|
||||||
#define SFML_SOCKET_HPP
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Headers
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#include <SFML/Network/Export.hpp>
|
|
||||||
#include <SFML/Network/SocketHandle.hpp>
|
|
||||||
#include <SFML/System/NonCopyable.hpp>
|
|
||||||
#include <vector>
|
|
||||||
|
|
||||||
|
|
||||||
namespace sf
|
|
||||||
{
|
|
||||||
class SocketSelector;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Base class for all the socket types
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
class SFML_NETWORK_API Socket : NonCopyable
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Status codes that may be returned by socket functions
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
enum Status
|
|
||||||
{
|
|
||||||
Done, ///< The socket has sent / received the data
|
|
||||||
NotReady, ///< The socket is not ready to send / receive data yet
|
|
||||||
Partial, ///< The socket sent a part of the data
|
|
||||||
Disconnected, ///< The TCP socket has been disconnected
|
|
||||||
Error ///< An unexpected error happened
|
|
||||||
};
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Some special values used by sockets
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
enum
|
|
||||||
{
|
|
||||||
AnyPort = 0 ///< Special value that tells the system to pick any available port
|
|
||||||
};
|
|
||||||
|
|
||||||
public:
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Destructor
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
virtual ~Socket();
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Set the blocking state of the socket
|
|
||||||
///
|
|
||||||
/// In blocking mode, calls will not return until they have
|
|
||||||
/// completed their task. For example, a call to Receive in
|
|
||||||
/// blocking mode won't return until some data was actually
|
|
||||||
/// received.
|
|
||||||
/// In non-blocking mode, calls will always return immediately,
|
|
||||||
/// using the return code to signal whether there was data
|
|
||||||
/// available or not.
|
|
||||||
/// By default, all sockets are blocking.
|
|
||||||
///
|
|
||||||
/// \param blocking True to set the socket as blocking, false for non-blocking
|
|
||||||
///
|
|
||||||
/// \see isBlocking
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void setBlocking(bool blocking);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Tell whether the socket is in blocking or non-blocking mode
|
|
||||||
///
|
|
||||||
/// \return True if the socket is blocking, false otherwise
|
|
||||||
///
|
|
||||||
/// \see setBlocking
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
bool isBlocking() const;
|
|
||||||
|
|
||||||
protected:
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Types of protocols that the socket can use
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
enum Type
|
|
||||||
{
|
|
||||||
Tcp, ///< TCP protocol
|
|
||||||
Udp ///< UDP protocol
|
|
||||||
};
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Default constructor
|
|
||||||
///
|
|
||||||
/// This constructor can only be accessed by derived classes.
|
|
||||||
///
|
|
||||||
/// \param type Type of the socket (TCP or UDP)
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Socket(Type type);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Return the internal handle of the socket
|
|
||||||
///
|
|
||||||
/// The returned handle may be invalid if the socket
|
|
||||||
/// was not created yet (or already destroyed).
|
|
||||||
/// This function can only be accessed by derived classes.
|
|
||||||
///
|
|
||||||
/// \return The internal (OS-specific) handle of the socket
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SocketHandle getHandle() const;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Create the internal representation of the socket
|
|
||||||
///
|
|
||||||
/// This function can only be accessed by derived classes.
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void create();
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Create the internal representation of the socket
|
|
||||||
/// from a socket handle
|
|
||||||
///
|
|
||||||
/// This function can only be accessed by derived classes.
|
|
||||||
///
|
|
||||||
/// \param handle OS-specific handle of the socket to wrap
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void create(SocketHandle handle);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Close the socket gracefully
|
|
||||||
///
|
|
||||||
/// This function can only be accessed by derived classes.
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void close();
|
|
||||||
|
|
||||||
private:
|
|
||||||
|
|
||||||
friend class SocketSelector;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Member data
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Type m_type; ///< Type of the socket (TCP or UDP)
|
|
||||||
SocketHandle m_socket; ///< Socket descriptor
|
|
||||||
bool m_isBlocking; ///< Current blocking mode of the socket
|
|
||||||
};
|
|
||||||
|
|
||||||
} // namespace sf
|
|
||||||
|
|
||||||
|
|
||||||
#endif // SFML_SOCKET_HPP
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \class sf::Socket
|
|
||||||
/// \ingroup network
|
|
||||||
///
|
|
||||||
/// This class mainly defines internal stuff to be used by
|
|
||||||
/// derived classes.
|
|
||||||
///
|
|
||||||
/// The only public features that it defines, and which
|
|
||||||
/// is therefore common to all the socket classes, is the
|
|
||||||
/// blocking state. All sockets can be set as blocking or
|
|
||||||
/// non-blocking.
|
|
||||||
///
|
|
||||||
/// In blocking mode, socket functions will hang until
|
|
||||||
/// the operation completes, which means that the entire
|
|
||||||
/// program (well, in fact the current thread if you use
|
|
||||||
/// multiple ones) will be stuck waiting for your socket
|
|
||||||
/// operation to complete.
|
|
||||||
///
|
|
||||||
/// In non-blocking mode, all the socket functions will
|
|
||||||
/// return immediately. If the socket is not ready to complete
|
|
||||||
/// the requested operation, the function simply returns
|
|
||||||
/// the proper status code (Socket::NotReady).
|
|
||||||
///
|
|
||||||
/// The default mode, which is blocking, is the one that is
|
|
||||||
/// generally used, in combination with threads or selectors.
|
|
||||||
/// The non-blocking mode is rather used in real-time
|
|
||||||
/// applications that run an endless loop that can poll
|
|
||||||
/// the socket often enough, and cannot afford blocking
|
|
||||||
/// this loop.
|
|
||||||
///
|
|
||||||
/// \see sf::TcpListener, sf::TcpSocket, sf::UdpSocket
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
|
@ -1,57 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#ifndef SFML_SOCKETHANDLE_HPP
|
|
||||||
#define SFML_SOCKETHANDLE_HPP
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Headers
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#include <SFML/Config.hpp>
|
|
||||||
|
|
||||||
#if defined(SFML_SYSTEM_WINDOWS)
|
|
||||||
#include <basetsd.h>
|
|
||||||
#endif
|
|
||||||
|
|
||||||
|
|
||||||
namespace sf
|
|
||||||
{
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Define the low-level socket handle type, specific to
|
|
||||||
// each platform
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#if defined(SFML_SYSTEM_WINDOWS)
|
|
||||||
|
|
||||||
typedef UINT_PTR SocketHandle;
|
|
||||||
|
|
||||||
#else
|
|
||||||
|
|
||||||
typedef int SocketHandle;
|
|
||||||
|
|
||||||
#endif
|
|
||||||
|
|
||||||
} // namespace sf
|
|
||||||
|
|
||||||
|
|
||||||
#endif // SFML_SOCKETHANDLE_HPP
|
|
|
@ -1,263 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#ifndef SFML_SOCKETSELECTOR_HPP
|
|
||||||
#define SFML_SOCKETSELECTOR_HPP
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Headers
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#include <SFML/Network/Export.hpp>
|
|
||||||
#include <SFML/System/Time.hpp>
|
|
||||||
|
|
||||||
|
|
||||||
namespace sf
|
|
||||||
{
|
|
||||||
class Socket;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Multiplexer that allows to read from multiple sockets
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
class SFML_NETWORK_API SocketSelector
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Default constructor
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SocketSelector();
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Copy constructor
|
|
||||||
///
|
|
||||||
/// \param copy Instance to copy
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SocketSelector(const SocketSelector& copy);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Destructor
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
~SocketSelector();
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Add a new socket to the selector
|
|
||||||
///
|
|
||||||
/// This function keeps a weak reference to the socket,
|
|
||||||
/// so you have to make sure that the socket is not destroyed
|
|
||||||
/// while it is stored in the selector.
|
|
||||||
/// This function does nothing if the socket is not valid.
|
|
||||||
///
|
|
||||||
/// \param socket Reference to the socket to add
|
|
||||||
///
|
|
||||||
/// \see remove, clear
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void add(Socket& socket);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Remove a socket from the selector
|
|
||||||
///
|
|
||||||
/// This function doesn't destroy the socket, it simply
|
|
||||||
/// removes the reference that the selector has to it.
|
|
||||||
///
|
|
||||||
/// \param socket Reference to the socket to remove
|
|
||||||
///
|
|
||||||
/// \see add, clear
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void remove(Socket& socket);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Remove all the sockets stored in the selector
|
|
||||||
///
|
|
||||||
/// This function doesn't destroy any instance, it simply
|
|
||||||
/// removes all the references that the selector has to
|
|
||||||
/// external sockets.
|
|
||||||
///
|
|
||||||
/// \see add, remove
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void clear();
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Wait until one or more sockets are ready to receive
|
|
||||||
///
|
|
||||||
/// This function returns as soon as at least one socket has
|
|
||||||
/// some data available to be received. To know which sockets are
|
|
||||||
/// ready, use the isReady function.
|
|
||||||
/// If you use a timeout and no socket is ready before the timeout
|
|
||||||
/// is over, the function returns false.
|
|
||||||
///
|
|
||||||
/// \param timeout Maximum time to wait, (use Time::Zero for infinity)
|
|
||||||
///
|
|
||||||
/// \return True if there are sockets ready, false otherwise
|
|
||||||
///
|
|
||||||
/// \see isReady
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
bool wait(Time timeout = Time::Zero);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Test a socket to know if it is ready to receive data
|
|
||||||
///
|
|
||||||
/// This function must be used after a call to Wait, to know
|
|
||||||
/// which sockets are ready to receive data. If a socket is
|
|
||||||
/// ready, a call to receive will never block because we know
|
|
||||||
/// that there is data available to read.
|
|
||||||
/// Note that if this function returns true for a TcpListener,
|
|
||||||
/// this means that it is ready to accept a new connection.
|
|
||||||
///
|
|
||||||
/// \param socket Socket to test
|
|
||||||
///
|
|
||||||
/// \return True if the socket is ready to read, false otherwise
|
|
||||||
///
|
|
||||||
/// \see isReady
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
bool isReady(Socket& socket) const;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Overload of assignment operator
|
|
||||||
///
|
|
||||||
/// \param right Instance to assign
|
|
||||||
///
|
|
||||||
/// \return Reference to self
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SocketSelector& operator =(const SocketSelector& right);
|
|
||||||
|
|
||||||
private:
|
|
||||||
|
|
||||||
struct SocketSelectorImpl;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Member data
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SocketSelectorImpl* m_impl; ///< Opaque pointer to the implementation (which requires OS-specific types)
|
|
||||||
};
|
|
||||||
|
|
||||||
} // namespace sf
|
|
||||||
|
|
||||||
|
|
||||||
#endif // SFML_SOCKETSELECTOR_HPP
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \class sf::SocketSelector
|
|
||||||
/// \ingroup network
|
|
||||||
///
|
|
||||||
/// Socket selectors provide a way to wait until some data is
|
|
||||||
/// available on a set of sockets, instead of just one. This
|
|
||||||
/// is convenient when you have multiple sockets that may
|
|
||||||
/// possibly receive data, but you don't know which one will
|
|
||||||
/// be ready first. In particular, it avoids to use a thread
|
|
||||||
/// for each socket; with selectors, a single thread can handle
|
|
||||||
/// all the sockets.
|
|
||||||
///
|
|
||||||
/// All types of sockets can be used in a selector:
|
|
||||||
/// \li sf::TcpListener
|
|
||||||
/// \li sf::TcpSocket
|
|
||||||
/// \li sf::UdpSocket
|
|
||||||
///
|
|
||||||
/// A selector doesn't store its own copies of the sockets
|
|
||||||
/// (socket classes are not copyable anyway), it simply keeps
|
|
||||||
/// a reference to the original sockets that you pass to the
|
|
||||||
/// "add" function. Therefore, you can't use the selector as a
|
|
||||||
/// socket container, you must store them outside and make sure
|
|
||||||
/// that they are alive as long as they are used in the selector.
|
|
||||||
///
|
|
||||||
/// Using a selector is simple:
|
|
||||||
/// \li populate the selector with all the sockets that you want to observe
|
|
||||||
/// \li make it wait until there is data available on any of the sockets
|
|
||||||
/// \li test each socket to find out which ones are ready
|
|
||||||
///
|
|
||||||
/// Usage example:
|
|
||||||
/// \code
|
|
||||||
/// // Create a socket to listen to new connections
|
|
||||||
/// sf::TcpListener listener;
|
|
||||||
/// listener.listen(55001);
|
|
||||||
///
|
|
||||||
/// // Create a list to store the future clients
|
|
||||||
/// std::list<sf::TcpSocket*> clients;
|
|
||||||
///
|
|
||||||
/// // Create a selector
|
|
||||||
/// sf::SocketSelector selector;
|
|
||||||
///
|
|
||||||
/// // Add the listener to the selector
|
|
||||||
/// selector.add(listener);
|
|
||||||
///
|
|
||||||
/// // Endless loop that waits for new connections
|
|
||||||
/// while (running)
|
|
||||||
/// {
|
|
||||||
/// // Make the selector wait for data on any socket
|
|
||||||
/// if (selector.wait())
|
|
||||||
/// {
|
|
||||||
/// // Test the listener
|
|
||||||
/// if (selector.isReady(listener))
|
|
||||||
/// {
|
|
||||||
/// // The listener is ready: there is a pending connection
|
|
||||||
/// sf::TcpSocket* client = new sf::TcpSocket;
|
|
||||||
/// if (listener.accept(*client) == sf::Socket::Done)
|
|
||||||
/// {
|
|
||||||
/// // Add the new client to the clients list
|
|
||||||
/// clients.push_back(client);
|
|
||||||
///
|
|
||||||
/// // Add the new client to the selector so that we will
|
|
||||||
/// // be notified when he sends something
|
|
||||||
/// selector.add(*client);
|
|
||||||
/// }
|
|
||||||
/// else
|
|
||||||
/// {
|
|
||||||
/// // Error, we won't get a new connection, delete the socket
|
|
||||||
/// delete client;
|
|
||||||
/// }
|
|
||||||
/// }
|
|
||||||
/// else
|
|
||||||
/// {
|
|
||||||
/// // The listener socket is not ready, test all other sockets (the clients)
|
|
||||||
/// for (std::list<sf::TcpSocket*>::iterator it = clients.begin(); it != clients.end(); ++it)
|
|
||||||
/// {
|
|
||||||
/// sf::TcpSocket& client = **it;
|
|
||||||
/// if (selector.isReady(client))
|
|
||||||
/// {
|
|
||||||
/// // The client has sent some data, we can receive it
|
|
||||||
/// sf::Packet packet;
|
|
||||||
/// if (client.receive(packet) == sf::Socket::Done)
|
|
||||||
/// {
|
|
||||||
/// ...
|
|
||||||
/// }
|
|
||||||
/// }
|
|
||||||
/// }
|
|
||||||
/// }
|
|
||||||
/// }
|
|
||||||
/// }
|
|
||||||
/// \endcode
|
|
||||||
///
|
|
||||||
/// \see sf::Socket
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
166
Externals/SFML/include/SFML/Network/TcpListener.hpp
vendored
166
Externals/SFML/include/SFML/Network/TcpListener.hpp
vendored
|
@ -1,166 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#ifndef SFML_TCPLISTENER_HPP
|
|
||||||
#define SFML_TCPLISTENER_HPP
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Headers
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#include <SFML/Network/Export.hpp>
|
|
||||||
#include <SFML/Network/Socket.hpp>
|
|
||||||
#include <SFML/Network/IPAddress.hpp>
|
|
||||||
|
|
||||||
|
|
||||||
namespace sf
|
|
||||||
{
|
|
||||||
class TcpSocket;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Socket that listens to new TCP connections
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
class SFML_NETWORK_API TcpListener : public Socket
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Default constructor
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
TcpListener();
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Get the port to which the socket is bound locally
|
|
||||||
///
|
|
||||||
/// If the socket is not listening to a port, this function
|
|
||||||
/// returns 0.
|
|
||||||
///
|
|
||||||
/// \return Port to which the socket is bound
|
|
||||||
///
|
|
||||||
/// \see listen
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
unsigned short getLocalPort() const;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Start listening for incoming connection attempts
|
|
||||||
///
|
|
||||||
/// This function makes the socket start listening on the
|
|
||||||
/// specified port, waiting for incoming connection attempts.
|
|
||||||
///
|
|
||||||
/// If the socket is already listening on a port when this
|
|
||||||
/// function is called, it will stop listening on the old
|
|
||||||
/// port before starting to listen on the new port.
|
|
||||||
///
|
|
||||||
/// \param port Port to listen on for incoming connection attempts
|
|
||||||
/// \param address Address of the interface to listen on
|
|
||||||
///
|
|
||||||
/// \return Status code
|
|
||||||
///
|
|
||||||
/// \see accept, close
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Status listen(unsigned short port, const IpAddress& address = IpAddress::Any);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Stop listening and close the socket
|
|
||||||
///
|
|
||||||
/// This function gracefully stops the listener. If the
|
|
||||||
/// socket is not listening, this function has no effect.
|
|
||||||
///
|
|
||||||
/// \see listen
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void close();
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Accept a new connection
|
|
||||||
///
|
|
||||||
/// If the socket is in blocking mode, this function will
|
|
||||||
/// not return until a connection is actually received.
|
|
||||||
///
|
|
||||||
/// \param socket Socket that will hold the new connection
|
|
||||||
///
|
|
||||||
/// \return Status code
|
|
||||||
///
|
|
||||||
/// \see listen
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Status accept(TcpSocket& socket);
|
|
||||||
};
|
|
||||||
|
|
||||||
|
|
||||||
} // namespace sf
|
|
||||||
|
|
||||||
|
|
||||||
#endif // SFML_TCPLISTENER_HPP
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \class sf::TcpListener
|
|
||||||
/// \ingroup network
|
|
||||||
///
|
|
||||||
/// A listener socket is a special type of socket that listens to
|
|
||||||
/// a given port and waits for connections on that port.
|
|
||||||
/// This is all it can do.
|
|
||||||
///
|
|
||||||
/// When a new connection is received, you must call accept and
|
|
||||||
/// the listener returns a new instance of sf::TcpSocket that
|
|
||||||
/// is properly initialized and can be used to communicate with
|
|
||||||
/// the new client.
|
|
||||||
///
|
|
||||||
/// Listener sockets are specific to the TCP protocol,
|
|
||||||
/// UDP sockets are connectionless and can therefore communicate
|
|
||||||
/// directly. As a consequence, a listener socket will always
|
|
||||||
/// return the new connections as sf::TcpSocket instances.
|
|
||||||
///
|
|
||||||
/// A listener is automatically closed on destruction, like all
|
|
||||||
/// other types of socket. However if you want to stop listening
|
|
||||||
/// before the socket is destroyed, you can call its close()
|
|
||||||
/// function.
|
|
||||||
///
|
|
||||||
/// Usage example:
|
|
||||||
/// \code
|
|
||||||
/// // Create a listener socket and make it wait for new
|
|
||||||
/// // connections on port 55001
|
|
||||||
/// sf::TcpListener listener;
|
|
||||||
/// listener.listen(55001);
|
|
||||||
///
|
|
||||||
/// // Endless loop that waits for new connections
|
|
||||||
/// while (running)
|
|
||||||
/// {
|
|
||||||
/// sf::TcpSocket client;
|
|
||||||
/// if (listener.accept(client) == sf::Socket::Done)
|
|
||||||
/// {
|
|
||||||
/// // A new client just connected!
|
|
||||||
/// std::cout << "New connection received from " << client.getRemoteAddress() << std::endl;
|
|
||||||
/// doSomethingWith(client);
|
|
||||||
/// }
|
|
||||||
/// }
|
|
||||||
/// \endcode
|
|
||||||
///
|
|
||||||
/// \see sf::TcpSocket, sf::Socket
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
316
Externals/SFML/include/SFML/Network/TcpSocket.hpp
vendored
316
Externals/SFML/include/SFML/Network/TcpSocket.hpp
vendored
|
@ -1,316 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#ifndef SFML_TCPSOCKET_HPP
|
|
||||||
#define SFML_TCPSOCKET_HPP
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Headers
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#include <SFML/Network/Export.hpp>
|
|
||||||
#include <SFML/Network/Socket.hpp>
|
|
||||||
#include <SFML/System/Time.hpp>
|
|
||||||
|
|
||||||
|
|
||||||
namespace sf
|
|
||||||
{
|
|
||||||
class TcpListener;
|
|
||||||
class IpAddress;
|
|
||||||
class Packet;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Specialized socket using the TCP protocol
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
class SFML_NETWORK_API TcpSocket : public Socket
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Default constructor
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
TcpSocket();
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Get the port to which the socket is bound locally
|
|
||||||
///
|
|
||||||
/// If the socket is not connected, this function returns 0.
|
|
||||||
///
|
|
||||||
/// \return Port to which the socket is bound
|
|
||||||
///
|
|
||||||
/// \see connect, getRemotePort
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
unsigned short getLocalPort() const;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Get the address of the connected peer
|
|
||||||
///
|
|
||||||
/// It the socket is not connected, this function returns
|
|
||||||
/// sf::IpAddress::None.
|
|
||||||
///
|
|
||||||
/// \return Address of the remote peer
|
|
||||||
///
|
|
||||||
/// \see getRemotePort
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
IpAddress getRemoteAddress() const;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Get the port of the connected peer to which
|
|
||||||
/// the socket is connected
|
|
||||||
///
|
|
||||||
/// If the socket is not connected, this function returns 0.
|
|
||||||
///
|
|
||||||
/// \return Remote port to which the socket is connected
|
|
||||||
///
|
|
||||||
/// \see getRemoteAddress
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
unsigned short getRemotePort() const;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Connect the socket to a remote peer
|
|
||||||
///
|
|
||||||
/// In blocking mode, this function may take a while, especially
|
|
||||||
/// if the remote peer is not reachable. The last parameter allows
|
|
||||||
/// you to stop trying to connect after a given timeout.
|
|
||||||
/// If the socket is already connected, the connection is
|
|
||||||
/// forcibly disconnected before attempting to connect again.
|
|
||||||
///
|
|
||||||
/// \param remoteAddress Address of the remote peer
|
|
||||||
/// \param remotePort Port of the remote peer
|
|
||||||
/// \param timeout Optional maximum time to wait
|
|
||||||
///
|
|
||||||
/// \return Status code
|
|
||||||
///
|
|
||||||
/// \see disconnect
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Status connect(const IpAddress& remoteAddress, unsigned short remotePort, Time timeout = Time::Zero);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Disconnect the socket from its remote peer
|
|
||||||
///
|
|
||||||
/// This function gracefully closes the connection. If the
|
|
||||||
/// socket is not connected, this function has no effect.
|
|
||||||
///
|
|
||||||
/// \see connect
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void disconnect();
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Send raw data to the remote peer
|
|
||||||
///
|
|
||||||
/// To be able to handle partial sends over non-blocking
|
|
||||||
/// sockets, use the send(const void*, std::size_t, std::size_t&)
|
|
||||||
/// overload instead.
|
|
||||||
/// This function will fail if the socket is not connected.
|
|
||||||
///
|
|
||||||
/// \param data Pointer to the sequence of bytes to send
|
|
||||||
/// \param size Number of bytes to send
|
|
||||||
///
|
|
||||||
/// \return Status code
|
|
||||||
///
|
|
||||||
/// \see receive
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Status send(const void* data, std::size_t size);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Send raw data to the remote peer
|
|
||||||
///
|
|
||||||
/// This function will fail if the socket is not connected.
|
|
||||||
///
|
|
||||||
/// \param data Pointer to the sequence of bytes to send
|
|
||||||
/// \param size Number of bytes to send
|
|
||||||
/// \param sent The number of bytes sent will be written here
|
|
||||||
///
|
|
||||||
/// \return Status code
|
|
||||||
///
|
|
||||||
/// \see receive
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Status send(const void* data, std::size_t size, std::size_t& sent);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Receive raw data from the remote peer
|
|
||||||
///
|
|
||||||
/// In blocking mode, this function will wait until some
|
|
||||||
/// bytes are actually received.
|
|
||||||
/// This function will fail if the socket is not connected.
|
|
||||||
///
|
|
||||||
/// \param data Pointer to the array to fill with the received bytes
|
|
||||||
/// \param size Maximum number of bytes that can be received
|
|
||||||
/// \param received This variable is filled with the actual number of bytes received
|
|
||||||
///
|
|
||||||
/// \return Status code
|
|
||||||
///
|
|
||||||
/// \see send
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Status receive(void* data, std::size_t size, std::size_t& received);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Send a formatted packet of data to the remote peer
|
|
||||||
///
|
|
||||||
/// In non-blocking mode, if this function returns sf::Socket::Partial,
|
|
||||||
/// you \em must retry sending the same unmodified packet before sending
|
|
||||||
/// anything else in order to guarantee the packet arrives at the remote
|
|
||||||
/// peer uncorrupted.
|
|
||||||
/// This function will fail if the socket is not connected.
|
|
||||||
///
|
|
||||||
/// \param packet Packet to send
|
|
||||||
///
|
|
||||||
/// \return Status code
|
|
||||||
///
|
|
||||||
/// \see receive
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Status send(Packet& packet);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Receive a formatted packet of data from the remote peer
|
|
||||||
///
|
|
||||||
/// In blocking mode, this function will wait until the whole packet
|
|
||||||
/// has been received.
|
|
||||||
/// This function will fail if the socket is not connected.
|
|
||||||
///
|
|
||||||
/// \param packet Packet to fill with the received data
|
|
||||||
///
|
|
||||||
/// \return Status code
|
|
||||||
///
|
|
||||||
/// \see send
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Status receive(Packet& packet);
|
|
||||||
|
|
||||||
private:
|
|
||||||
|
|
||||||
friend class TcpListener;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Structure holding the data of a pending packet
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
struct PendingPacket
|
|
||||||
{
|
|
||||||
PendingPacket();
|
|
||||||
|
|
||||||
Uint32 Size; ///< Data of packet size
|
|
||||||
std::size_t SizeReceived; ///< Number of size bytes received so far
|
|
||||||
std::vector<char> Data; ///< Data of the packet
|
|
||||||
};
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Member data
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
PendingPacket m_pendingPacket; ///< Temporary data of the packet currently being received
|
|
||||||
};
|
|
||||||
|
|
||||||
} // namespace sf
|
|
||||||
|
|
||||||
|
|
||||||
#endif // SFML_TCPSOCKET_HPP
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \class sf::TcpSocket
|
|
||||||
/// \ingroup network
|
|
||||||
///
|
|
||||||
/// TCP is a connected protocol, which means that a TCP
|
|
||||||
/// socket can only communicate with the host it is connected
|
|
||||||
/// to. It can't send or receive anything if it is not connected.
|
|
||||||
///
|
|
||||||
/// The TCP protocol is reliable but adds a slight overhead.
|
|
||||||
/// It ensures that your data will always be received in order
|
|
||||||
/// and without errors (no data corrupted, lost or duplicated).
|
|
||||||
///
|
|
||||||
/// When a socket is connected to a remote host, you can
|
|
||||||
/// retrieve informations about this host with the
|
|
||||||
/// getRemoteAddress and getRemotePort functions. You can
|
|
||||||
/// also get the local port to which the socket is bound
|
|
||||||
/// (which is automatically chosen when the socket is connected),
|
|
||||||
/// with the getLocalPort function.
|
|
||||||
///
|
|
||||||
/// Sending and receiving data can use either the low-level
|
|
||||||
/// or the high-level functions. The low-level functions
|
|
||||||
/// process a raw sequence of bytes, and cannot ensure that
|
|
||||||
/// one call to Send will exactly match one call to Receive
|
|
||||||
/// at the other end of the socket.
|
|
||||||
///
|
|
||||||
/// The high-level interface uses packets (see sf::Packet),
|
|
||||||
/// which are easier to use and provide more safety regarding
|
|
||||||
/// the data that is exchanged. You can look at the sf::Packet
|
|
||||||
/// class to get more details about how they work.
|
|
||||||
///
|
|
||||||
/// The socket is automatically disconnected when it is destroyed,
|
|
||||||
/// but if you want to explicitly close the connection while
|
|
||||||
/// the socket instance is still alive, you can call disconnect.
|
|
||||||
///
|
|
||||||
/// Usage example:
|
|
||||||
/// \code
|
|
||||||
/// // ----- The client -----
|
|
||||||
///
|
|
||||||
/// // Create a socket and connect it to 192.168.1.50 on port 55001
|
|
||||||
/// sf::TcpSocket socket;
|
|
||||||
/// socket.connect("192.168.1.50", 55001);
|
|
||||||
///
|
|
||||||
/// // Send a message to the connected host
|
|
||||||
/// std::string message = "Hi, I am a client";
|
|
||||||
/// socket.send(message.c_str(), message.size() + 1);
|
|
||||||
///
|
|
||||||
/// // Receive an answer from the server
|
|
||||||
/// char buffer[1024];
|
|
||||||
/// std::size_t received = 0;
|
|
||||||
/// socket.receive(buffer, sizeof(buffer), received);
|
|
||||||
/// std::cout << "The server said: " << buffer << std::endl;
|
|
||||||
///
|
|
||||||
/// // ----- The server -----
|
|
||||||
///
|
|
||||||
/// // Create a listener to wait for incoming connections on port 55001
|
|
||||||
/// sf::TcpListener listener;
|
|
||||||
/// listener.listen(55001);
|
|
||||||
///
|
|
||||||
/// // Wait for a connection
|
|
||||||
/// sf::TcpSocket socket;
|
|
||||||
/// listener.accept(socket);
|
|
||||||
/// std::cout << "New client connected: " << socket.getRemoteAddress() << std::endl;
|
|
||||||
///
|
|
||||||
/// // Receive a message from the client
|
|
||||||
/// char buffer[1024];
|
|
||||||
/// std::size_t received = 0;
|
|
||||||
/// socket.receive(buffer, sizeof(buffer), received);
|
|
||||||
/// std::cout << "The client said: " << buffer << std::endl;
|
|
||||||
///
|
|
||||||
/// // Send an answer
|
|
||||||
/// std::string message = "Welcome, client";
|
|
||||||
/// socket.send(message.c_str(), message.size() + 1);
|
|
||||||
/// \endcode
|
|
||||||
///
|
|
||||||
/// \see sf::Socket, sf::UdpSocket, sf::Packet
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
291
Externals/SFML/include/SFML/Network/UdpSocket.hpp
vendored
291
Externals/SFML/include/SFML/Network/UdpSocket.hpp
vendored
|
@ -1,291 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#ifndef SFML_UDPSOCKET_HPP
|
|
||||||
#define SFML_UDPSOCKET_HPP
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Headers
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#include <SFML/Network/Export.hpp>
|
|
||||||
#include <SFML/Network/Socket.hpp>
|
|
||||||
#include <SFML/Network/IPAddress.hpp>
|
|
||||||
#include <vector>
|
|
||||||
|
|
||||||
|
|
||||||
namespace sf
|
|
||||||
{
|
|
||||||
class Packet;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Specialized socket using the UDP protocol
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
class SFML_NETWORK_API UdpSocket : public Socket
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Constants
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
enum
|
|
||||||
{
|
|
||||||
MaxDatagramSize = 65507 ///< The maximum number of bytes that can be sent in a single UDP datagram
|
|
||||||
};
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Default constructor
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
UdpSocket();
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Get the port to which the socket is bound locally
|
|
||||||
///
|
|
||||||
/// If the socket is not bound to a port, this function
|
|
||||||
/// returns 0.
|
|
||||||
///
|
|
||||||
/// \return Port to which the socket is bound
|
|
||||||
///
|
|
||||||
/// \see bind
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
unsigned short getLocalPort() const;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Bind the socket to a specific port
|
|
||||||
///
|
|
||||||
/// Binding the socket to a port is necessary for being
|
|
||||||
/// able to receive data on that port.
|
|
||||||
/// You can use the special value Socket::AnyPort to tell the
|
|
||||||
/// system to automatically pick an available port, and then
|
|
||||||
/// call getLocalPort to retrieve the chosen port.
|
|
||||||
///
|
|
||||||
/// Since the socket can only be bound to a single port at
|
|
||||||
/// any given moment, if it is already bound when this
|
|
||||||
/// function is called, it will be unbound from the previous
|
|
||||||
/// port before being bound to the new one.
|
|
||||||
///
|
|
||||||
/// \param port Port to bind the socket to
|
|
||||||
/// \param address Address of the interface to bind to
|
|
||||||
///
|
|
||||||
/// \return Status code
|
|
||||||
///
|
|
||||||
/// \see unbind, getLocalPort
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Status bind(unsigned short port, const IpAddress& address = IpAddress::Any);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Unbind the socket from the local port to which it is bound
|
|
||||||
///
|
|
||||||
/// The port that the socket was previously bound to is immediately
|
|
||||||
/// made available to the operating system after this function is called.
|
|
||||||
/// This means that a subsequent call to bind() will be able to re-bind
|
|
||||||
/// the port if no other process has done so in the mean time.
|
|
||||||
/// If the socket is not bound to a port, this function has no effect.
|
|
||||||
///
|
|
||||||
/// \see bind
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void unbind();
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Send raw data to a remote peer
|
|
||||||
///
|
|
||||||
/// Make sure that \a size is not greater than
|
|
||||||
/// UdpSocket::MaxDatagramSize, otherwise this function will
|
|
||||||
/// fail and no data will be sent.
|
|
||||||
///
|
|
||||||
/// \param data Pointer to the sequence of bytes to send
|
|
||||||
/// \param size Number of bytes to send
|
|
||||||
/// \param remoteAddress Address of the receiver
|
|
||||||
/// \param remotePort Port of the receiver to send the data to
|
|
||||||
///
|
|
||||||
/// \return Status code
|
|
||||||
///
|
|
||||||
/// \see receive
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Status send(const void* data, std::size_t size, const IpAddress& remoteAddress, unsigned short remotePort);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Receive raw data from a remote peer
|
|
||||||
///
|
|
||||||
/// In blocking mode, this function will wait until some
|
|
||||||
/// bytes are actually received.
|
|
||||||
/// Be careful to use a buffer which is large enough for
|
|
||||||
/// the data that you intend to receive, if it is too small
|
|
||||||
/// then an error will be returned and *all* the data will
|
|
||||||
/// be lost.
|
|
||||||
///
|
|
||||||
/// \param data Pointer to the array to fill with the received bytes
|
|
||||||
/// \param size Maximum number of bytes that can be received
|
|
||||||
/// \param received This variable is filled with the actual number of bytes received
|
|
||||||
/// \param remoteAddress Address of the peer that sent the data
|
|
||||||
/// \param remotePort Port of the peer that sent the data
|
|
||||||
///
|
|
||||||
/// \return Status code
|
|
||||||
///
|
|
||||||
/// \see send
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Status receive(void* data, std::size_t size, std::size_t& received, IpAddress& remoteAddress, unsigned short& remotePort);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Send a formatted packet of data to a remote peer
|
|
||||||
///
|
|
||||||
/// Make sure that the packet size is not greater than
|
|
||||||
/// UdpSocket::MaxDatagramSize, otherwise this function will
|
|
||||||
/// fail and no data will be sent.
|
|
||||||
///
|
|
||||||
/// \param packet Packet to send
|
|
||||||
/// \param remoteAddress Address of the receiver
|
|
||||||
/// \param remotePort Port of the receiver to send the data to
|
|
||||||
///
|
|
||||||
/// \return Status code
|
|
||||||
///
|
|
||||||
/// \see receive
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Status send(Packet& packet, const IpAddress& remoteAddress, unsigned short remotePort);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Receive a formatted packet of data from a remote peer
|
|
||||||
///
|
|
||||||
/// In blocking mode, this function will wait until the whole packet
|
|
||||||
/// has been received.
|
|
||||||
///
|
|
||||||
/// \param packet Packet to fill with the received data
|
|
||||||
/// \param remoteAddress Address of the peer that sent the data
|
|
||||||
/// \param remotePort Port of the peer that sent the data
|
|
||||||
///
|
|
||||||
/// \return Status code
|
|
||||||
///
|
|
||||||
/// \see send
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Status receive(Packet& packet, IpAddress& remoteAddress, unsigned short& remotePort);
|
|
||||||
|
|
||||||
private:
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Member data
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
std::vector<char> m_buffer; ///< Temporary buffer holding the received data in Receive(Packet)
|
|
||||||
};
|
|
||||||
|
|
||||||
} // namespace sf
|
|
||||||
|
|
||||||
|
|
||||||
#endif // SFML_UDPSOCKET_HPP
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \class sf::UdpSocket
|
|
||||||
/// \ingroup network
|
|
||||||
///
|
|
||||||
/// A UDP socket is a connectionless socket. Instead of
|
|
||||||
/// connecting once to a remote host, like TCP sockets,
|
|
||||||
/// it can send to and receive from any host at any time.
|
|
||||||
///
|
|
||||||
/// It is a datagram protocol: bounded blocks of data (datagrams)
|
|
||||||
/// are transfered over the network rather than a continuous
|
|
||||||
/// stream of data (TCP). Therefore, one call to send will always
|
|
||||||
/// match one call to receive (if the datagram is not lost),
|
|
||||||
/// with the same data that was sent.
|
|
||||||
///
|
|
||||||
/// The UDP protocol is lightweight but unreliable. Unreliable
|
|
||||||
/// means that datagrams may be duplicated, be lost or
|
|
||||||
/// arrive reordered. However, if a datagram arrives, its
|
|
||||||
/// data is guaranteed to be valid.
|
|
||||||
///
|
|
||||||
/// UDP is generally used for real-time communication
|
|
||||||
/// (audio or video streaming, real-time games, etc.) where
|
|
||||||
/// speed is crucial and lost data doesn't matter much.
|
|
||||||
///
|
|
||||||
/// Sending and receiving data can use either the low-level
|
|
||||||
/// or the high-level functions. The low-level functions
|
|
||||||
/// process a raw sequence of bytes, whereas the high-level
|
|
||||||
/// interface uses packets (see sf::Packet), which are easier
|
|
||||||
/// to use and provide more safety regarding the data that is
|
|
||||||
/// exchanged. You can look at the sf::Packet class to get
|
|
||||||
/// more details about how they work.
|
|
||||||
///
|
|
||||||
/// It is important to note that UdpSocket is unable to send
|
|
||||||
/// datagrams bigger than MaxDatagramSize. In this case, it
|
|
||||||
/// returns an error and doesn't send anything. This applies
|
|
||||||
/// to both raw data and packets. Indeed, even packets are
|
|
||||||
/// unable to split and recompose data, due to the unreliability
|
|
||||||
/// of the protocol (dropped, mixed or duplicated datagrams may
|
|
||||||
/// lead to a big mess when trying to recompose a packet).
|
|
||||||
///
|
|
||||||
/// If the socket is bound to a port, it is automatically
|
|
||||||
/// unbound from it when the socket is destroyed. However,
|
|
||||||
/// you can unbind the socket explicitly with the Unbind
|
|
||||||
/// function if necessary, to stop receiving messages or
|
|
||||||
/// make the port available for other sockets.
|
|
||||||
///
|
|
||||||
/// Usage example:
|
|
||||||
/// \code
|
|
||||||
/// // ----- The client -----
|
|
||||||
///
|
|
||||||
/// // Create a socket and bind it to the port 55001
|
|
||||||
/// sf::UdpSocket socket;
|
|
||||||
/// socket.bind(55001);
|
|
||||||
///
|
|
||||||
/// // Send a message to 192.168.1.50 on port 55002
|
|
||||||
/// std::string message = "Hi, I am " + sf::IpAddress::getLocalAddress().toString();
|
|
||||||
/// socket.send(message.c_str(), message.size() + 1, "192.168.1.50", 55002);
|
|
||||||
///
|
|
||||||
/// // Receive an answer (most likely from 192.168.1.50, but could be anyone else)
|
|
||||||
/// char buffer[1024];
|
|
||||||
/// std::size_t received = 0;
|
|
||||||
/// sf::IpAddress sender;
|
|
||||||
/// unsigned short port;
|
|
||||||
/// socket.receive(buffer, sizeof(buffer), received, sender, port);
|
|
||||||
/// std::cout << sender.ToString() << " said: " << buffer << std::endl;
|
|
||||||
///
|
|
||||||
/// // ----- The server -----
|
|
||||||
///
|
|
||||||
/// // Create a socket and bind it to the port 55002
|
|
||||||
/// sf::UdpSocket socket;
|
|
||||||
/// socket.bind(55002);
|
|
||||||
///
|
|
||||||
/// // Receive a message from anyone
|
|
||||||
/// char buffer[1024];
|
|
||||||
/// std::size_t received = 0;
|
|
||||||
/// sf::IpAddress sender;
|
|
||||||
/// unsigned short port;
|
|
||||||
/// socket.receive(buffer, sizeof(buffer), received, sender, port);
|
|
||||||
/// std::cout << sender.ToString() << " said: " << buffer << std::endl;
|
|
||||||
///
|
|
||||||
/// // Send an answer
|
|
||||||
/// std::string message = "Welcome " + sender.toString();
|
|
||||||
/// socket.send(message.c_str(), message.size() + 1, sender, port);
|
|
||||||
/// \endcode
|
|
||||||
///
|
|
||||||
/// \see sf::Socket, sf::TcpSocket, sf::Packet
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
58
Externals/SFML/include/SFML/System.hpp
vendored
58
Externals/SFML/include/SFML/System.hpp
vendored
|
@ -1,58 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#ifndef SFML_SYSTEM_HPP
|
|
||||||
#define SFML_SYSTEM_HPP
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Headers
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#include <SFML/Config.hpp>
|
|
||||||
//#include <SFML/System/Clock.hpp>
|
|
||||||
#include <SFML/System/Err.hpp>
|
|
||||||
//#include <SFML/System/InputStream.hpp>
|
|
||||||
//#include <SFML/System/Lock.hpp>
|
|
||||||
//#include <SFML/System/Mutex.hpp>
|
|
||||||
//#include <SFML/System/Sleep.hpp>
|
|
||||||
#include <SFML/System/NonCopyable.hpp>
|
|
||||||
#include <SFML/System/String.hpp>
|
|
||||||
//#include <SFML/System/Thread.hpp>
|
|
||||||
//#include <SFML/System/ThreadLocal.hpp>
|
|
||||||
//#include <SFML/System/ThreadLocalPtr.hpp>
|
|
||||||
#include <SFML/System/Time.hpp>
|
|
||||||
#include <SFML/System/Utf.hpp>
|
|
||||||
//#include <SFML/System/Vector2.hpp>
|
|
||||||
//#include <SFML/System/Vector3.hpp>
|
|
||||||
|
|
||||||
#endif // SFML_SYSTEM_HPP
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \defgroup system System module
|
|
||||||
///
|
|
||||||
/// Base module of SFML, defining various utilities. It provides
|
|
||||||
/// vector classes, Unicode strings and conversion functions,
|
|
||||||
/// threads and mutexes, timing classes.
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
80
Externals/SFML/include/SFML/System/Err.hpp
vendored
80
Externals/SFML/include/SFML/System/Err.hpp
vendored
|
@ -1,80 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#ifndef SFML_ERR_HPP
|
|
||||||
#define SFML_ERR_HPP
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Headers
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#include <SFML/System/Export.hpp>
|
|
||||||
#include <ostream>
|
|
||||||
|
|
||||||
|
|
||||||
namespace sf
|
|
||||||
{
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Standard stream used by SFML to output warnings and errors
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_SYSTEM_API std::ostream& err();
|
|
||||||
|
|
||||||
} // namespace sf
|
|
||||||
|
|
||||||
|
|
||||||
#endif // SFML_ERR_HPP
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \fn sf::err
|
|
||||||
/// \ingroup system
|
|
||||||
///
|
|
||||||
/// By default, sf::err() outputs to the same location as std::cerr,
|
|
||||||
/// (-> the stderr descriptor) which is the console if there's
|
|
||||||
/// one available.
|
|
||||||
///
|
|
||||||
/// It is a standard std::ostream instance, so it supports all the
|
|
||||||
/// insertion operations defined by the STL
|
|
||||||
/// (operator <<, manipulators, etc.).
|
|
||||||
///
|
|
||||||
/// sf::err() can be redirected to write to another output, independently
|
|
||||||
/// of std::cerr, by using the rdbuf() function provided by the
|
|
||||||
/// std::ostream class.
|
|
||||||
///
|
|
||||||
/// Example:
|
|
||||||
/// \code
|
|
||||||
/// // Redirect to a file
|
|
||||||
/// std::ofstream file("sfml-log.txt");
|
|
||||||
/// std::streambuf* previous = sf::err().rdbuf(file.rdbuf());
|
|
||||||
///
|
|
||||||
/// // Redirect to nothing
|
|
||||||
/// sf::err().rdbuf(NULL);
|
|
||||||
///
|
|
||||||
/// // Restore the original output
|
|
||||||
/// sf::err().rdbuf(previous);
|
|
||||||
/// \endcode
|
|
||||||
///
|
|
||||||
/// \return Reference to std::ostream representing the SFML error stream
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
48
Externals/SFML/include/SFML/System/Export.hpp
vendored
48
Externals/SFML/include/SFML/System/Export.hpp
vendored
|
@ -1,48 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#ifndef SFML_SYSTEM_EXPORT_HPP
|
|
||||||
#define SFML_SYSTEM_EXPORT_HPP
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Headers
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#include <SFML/Config.hpp>
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Define portable import / export macros
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#if defined(SFML_SYSTEM_EXPORTS)
|
|
||||||
|
|
||||||
#define SFML_SYSTEM_API SFML_API_EXPORT
|
|
||||||
|
|
||||||
#else
|
|
||||||
|
|
||||||
#define SFML_SYSTEM_API SFML_API_IMPORT
|
|
||||||
|
|
||||||
#endif
|
|
||||||
|
|
||||||
|
|
||||||
#endif // SFML_SYSTEM_EXPORT_HPP
|
|
129
Externals/SFML/include/SFML/System/NonCopyable.hpp
vendored
129
Externals/SFML/include/SFML/System/NonCopyable.hpp
vendored
|
@ -1,129 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#ifndef SFML_NONCOPYABLE_HPP
|
|
||||||
#define SFML_NONCOPYABLE_HPP
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Headers
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#include <SFML/System/Export.hpp>
|
|
||||||
|
|
||||||
|
|
||||||
namespace sf
|
|
||||||
{
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Utility class that makes any derived
|
|
||||||
/// class non-copyable
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
class SFML_SYSTEM_API NonCopyable
|
|
||||||
{
|
|
||||||
protected:
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Default constructor
|
|
||||||
///
|
|
||||||
/// Because this class has a copy constructor, the compiler
|
|
||||||
/// will not automatically generate the default constructor.
|
|
||||||
/// That's why we must define it explicitly.
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
NonCopyable() {}
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Default destructor
|
|
||||||
///
|
|
||||||
/// By declaring a protected destructor it's impossible to
|
|
||||||
/// call delete on a pointer of sf::NonCopyable, thus
|
|
||||||
/// preventing possible resource leaks.
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
~NonCopyable() {}
|
|
||||||
|
|
||||||
private:
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Disabled copy constructor
|
|
||||||
///
|
|
||||||
/// By making the copy constructor private, the compiler will
|
|
||||||
/// trigger an error if anyone outside tries to use it.
|
|
||||||
/// To prevent NonCopyable or friend classes from using it,
|
|
||||||
/// we also give no definition, so that the linker will
|
|
||||||
/// produce an error if the first protection was inefficient.
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
NonCopyable(const NonCopyable&);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Disabled assignment operator
|
|
||||||
///
|
|
||||||
/// By making the assignment operator private, the compiler will
|
|
||||||
/// trigger an error if anyone outside tries to use it.
|
|
||||||
/// To prevent NonCopyable or friend classes from using it,
|
|
||||||
/// we also give no definition, so that the linker will
|
|
||||||
/// produce an error if the first protection was inefficient.
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
NonCopyable& operator =(const NonCopyable&);
|
|
||||||
};
|
|
||||||
|
|
||||||
} // namespace sf
|
|
||||||
|
|
||||||
|
|
||||||
#endif // SFML_NONCOPYABLE_HPP
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \class sf::NonCopyable
|
|
||||||
/// \ingroup system
|
|
||||||
///
|
|
||||||
/// This class makes its instances non-copyable, by explicitly
|
|
||||||
/// disabling its copy constructor and its assignment operator.
|
|
||||||
///
|
|
||||||
/// To create a non-copyable class, simply inherit from
|
|
||||||
/// sf::NonCopyable.
|
|
||||||
///
|
|
||||||
/// The type of inheritance (public or private) doesn't matter,
|
|
||||||
/// the copy constructor and assignment operator are declared private
|
|
||||||
/// in sf::NonCopyable so they will end up being inaccessible in both
|
|
||||||
/// cases. Thus you can use a shorter syntax for inheriting from it
|
|
||||||
/// (see below).
|
|
||||||
///
|
|
||||||
/// Usage example:
|
|
||||||
/// \code
|
|
||||||
/// class MyNonCopyableClass : sf::NonCopyable
|
|
||||||
/// {
|
|
||||||
/// ...
|
|
||||||
/// };
|
|
||||||
/// \endcode
|
|
||||||
///
|
|
||||||
/// Deciding whether the instances of a class can be copied
|
|
||||||
/// or not is a very important design choice. You are strongly
|
|
||||||
/// encouraged to think about it before writing a class,
|
|
||||||
/// and to use sf::NonCopyable when necessary to prevent
|
|
||||||
/// many potential future errors when using it. This is also
|
|
||||||
/// a very important indication to users of your class.
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
669
Externals/SFML/include/SFML/System/String.hpp
vendored
669
Externals/SFML/include/SFML/System/String.hpp
vendored
|
@ -1,669 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#ifndef SFML_STRING_HPP
|
|
||||||
#define SFML_STRING_HPP
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Headers
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#include <SFML/System/Export.hpp>
|
|
||||||
#include <SFML/System/Utf.hpp>
|
|
||||||
#include <iterator>
|
|
||||||
#include <locale>
|
|
||||||
#include <string>
|
|
||||||
|
|
||||||
|
|
||||||
namespace sf
|
|
||||||
{
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Utility string class that automatically handles
|
|
||||||
/// conversions between types and encodings
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
class SFML_SYSTEM_API String
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Types
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
typedef std::basic_string<Uint32>::iterator Iterator; ///< Iterator type
|
|
||||||
typedef std::basic_string<Uint32>::const_iterator ConstIterator; ///< Read-only iterator type
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Static member data
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
static const std::size_t InvalidPos; ///< Represents an invalid position in the string
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Default constructor
|
|
||||||
///
|
|
||||||
/// This constructor creates an empty string.
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
String();
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Construct from a single ANSI character and a locale
|
|
||||||
///
|
|
||||||
/// The source character is converted to UTF-32 according
|
|
||||||
/// to the given locale.
|
|
||||||
///
|
|
||||||
/// \param ansiChar ANSI character to convert
|
|
||||||
/// \param locale Locale to use for conversion
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
String(char ansiChar, const std::locale& locale = std::locale());
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Construct from single wide character
|
|
||||||
///
|
|
||||||
/// \param wideChar Wide character to convert
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
String(wchar_t wideChar);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Construct from single UTF-32 character
|
|
||||||
///
|
|
||||||
/// \param utf32Char UTF-32 character to convert
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
String(Uint32 utf32Char);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Construct from a null-terminated C-style ANSI string and a locale
|
|
||||||
///
|
|
||||||
/// The source string is converted to UTF-32 according
|
|
||||||
/// to the given locale.
|
|
||||||
///
|
|
||||||
/// \param ansiString ANSI string to convert
|
|
||||||
/// \param locale Locale to use for conversion
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
String(const char* ansiString, const std::locale& locale = std::locale());
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Construct from an ANSI string and a locale
|
|
||||||
///
|
|
||||||
/// The source string is converted to UTF-32 according
|
|
||||||
/// to the given locale.
|
|
||||||
///
|
|
||||||
/// \param ansiString ANSI string to convert
|
|
||||||
/// \param locale Locale to use for conversion
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
String(const std::string& ansiString, const std::locale& locale = std::locale());
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Construct from null-terminated C-style wide string
|
|
||||||
///
|
|
||||||
/// \param wideString Wide string to convert
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
String(const wchar_t* wideString);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Construct from a wide string
|
|
||||||
///
|
|
||||||
/// \param wideString Wide string to convert
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
String(const std::wstring& wideString);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Construct from a null-terminated C-style UTF-32 string
|
|
||||||
///
|
|
||||||
/// \param utf32String UTF-32 string to assign
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
String(const Uint32* utf32String);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Construct from an UTF-32 string
|
|
||||||
///
|
|
||||||
/// \param utf32String UTF-32 string to assign
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
String(const std::basic_string<Uint32>& utf32String);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Copy constructor
|
|
||||||
///
|
|
||||||
/// \param copy Instance to copy
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
String(const String& copy);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Create a new sf::String from a UTF-8 encoded string
|
|
||||||
///
|
|
||||||
/// \param begin Forward iterator to the beginning of the UTF-8 sequence
|
|
||||||
/// \param end Forward iterator to the end of the UTF-8 sequence
|
|
||||||
///
|
|
||||||
/// \return A sf::String containing the source string
|
|
||||||
///
|
|
||||||
/// \see fromUtf16, fromUtf32
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename T>
|
|
||||||
static String fromUtf8(T begin, T end);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Create a new sf::String from a UTF-16 encoded string
|
|
||||||
///
|
|
||||||
/// \param begin Forward iterator to the beginning of the UTF-16 sequence
|
|
||||||
/// \param end Forward iterator to the end of the UTF-16 sequence
|
|
||||||
///
|
|
||||||
/// \return A sf::String containing the source string
|
|
||||||
///
|
|
||||||
/// \see fromUtf8, fromUtf32
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename T>
|
|
||||||
static String fromUtf16(T begin, T end);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Create a new sf::String from a UTF-32 encoded string
|
|
||||||
///
|
|
||||||
/// This function is provided for consistency, it is equivalent to
|
|
||||||
/// using the constructors that takes a const sf::Uint32* or
|
|
||||||
/// a std::basic_string<sf::Uint32>.
|
|
||||||
///
|
|
||||||
/// \param begin Forward iterator to the beginning of the UTF-32 sequence
|
|
||||||
/// \param end Forward iterator to the end of the UTF-32 sequence
|
|
||||||
///
|
|
||||||
/// \return A sf::String containing the source string
|
|
||||||
///
|
|
||||||
/// \see fromUtf8, fromUtf16
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename T>
|
|
||||||
static String fromUtf32(T begin, T end);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Implicit conversion operator to std::string (ANSI string)
|
|
||||||
///
|
|
||||||
/// The current global locale is used for conversion. If you
|
|
||||||
/// want to explicitly specify a locale, see toAnsiString.
|
|
||||||
/// Characters that do not fit in the target encoding are
|
|
||||||
/// discarded from the returned string.
|
|
||||||
/// This operator is defined for convenience, and is equivalent
|
|
||||||
/// to calling toAnsiString().
|
|
||||||
///
|
|
||||||
/// \return Converted ANSI string
|
|
||||||
///
|
|
||||||
/// \see toAnsiString, operator std::wstring
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
operator std::string() const;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Implicit conversion operator to std::wstring (wide string)
|
|
||||||
///
|
|
||||||
/// Characters that do not fit in the target encoding are
|
|
||||||
/// discarded from the returned string.
|
|
||||||
/// This operator is defined for convenience, and is equivalent
|
|
||||||
/// to calling toWideString().
|
|
||||||
///
|
|
||||||
/// \return Converted wide string
|
|
||||||
///
|
|
||||||
/// \see toWideString, operator std::string
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
operator std::wstring() const;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Convert the Unicode string to an ANSI string
|
|
||||||
///
|
|
||||||
/// The UTF-32 string is converted to an ANSI string in
|
|
||||||
/// the encoding defined by \a locale.
|
|
||||||
/// Characters that do not fit in the target encoding are
|
|
||||||
/// discarded from the returned string.
|
|
||||||
///
|
|
||||||
/// \param locale Locale to use for conversion
|
|
||||||
///
|
|
||||||
/// \return Converted ANSI string
|
|
||||||
///
|
|
||||||
/// \see toWideString, operator std::string
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
std::string toAnsiString(const std::locale& locale = std::locale()) const;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Convert the Unicode string to a wide string
|
|
||||||
///
|
|
||||||
/// Characters that do not fit in the target encoding are
|
|
||||||
/// discarded from the returned string.
|
|
||||||
///
|
|
||||||
/// \return Converted wide string
|
|
||||||
///
|
|
||||||
/// \see toAnsiString, operator std::wstring
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
std::wstring toWideString() const;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Convert the Unicode string to a UTF-8 string
|
|
||||||
///
|
|
||||||
/// \return Converted UTF-8 string
|
|
||||||
///
|
|
||||||
/// \see toUtf16, toUtf32
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
std::basic_string<Uint8> toUtf8() const;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Convert the Unicode string to a UTF-16 string
|
|
||||||
///
|
|
||||||
/// \return Converted UTF-16 string
|
|
||||||
///
|
|
||||||
/// \see toUtf8, toUtf32
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
std::basic_string<Uint16> toUtf16() const;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Convert the Unicode string to a UTF-32 string
|
|
||||||
///
|
|
||||||
/// This function doesn't perform any conversion, since the
|
|
||||||
/// string is already stored as UTF-32 internally.
|
|
||||||
///
|
|
||||||
/// \return Converted UTF-32 string
|
|
||||||
///
|
|
||||||
/// \see toUtf8, toUtf16
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
std::basic_string<Uint32> toUtf32() const;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Overload of assignment operator
|
|
||||||
///
|
|
||||||
/// \param right Instance to assign
|
|
||||||
///
|
|
||||||
/// \return Reference to self
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
String& operator =(const String& right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Overload of += operator to append an UTF-32 string
|
|
||||||
///
|
|
||||||
/// \param right String to append
|
|
||||||
///
|
|
||||||
/// \return Reference to self
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
String& operator +=(const String& right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Overload of [] operator to access a character by its position
|
|
||||||
///
|
|
||||||
/// This function provides read-only access to characters.
|
|
||||||
/// Note: the behavior is undefined if \a index is out of range.
|
|
||||||
///
|
|
||||||
/// \param index Index of the character to get
|
|
||||||
///
|
|
||||||
/// \return Character at position \a index
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Uint32 operator [](std::size_t index) const;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Overload of [] operator to access a character by its position
|
|
||||||
///
|
|
||||||
/// This function provides read and write access to characters.
|
|
||||||
/// Note: the behavior is undefined if \a index is out of range.
|
|
||||||
///
|
|
||||||
/// \param index Index of the character to get
|
|
||||||
///
|
|
||||||
/// \return Reference to the character at position \a index
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Uint32& operator [](std::size_t index);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Clear the string
|
|
||||||
///
|
|
||||||
/// This function removes all the characters from the string.
|
|
||||||
///
|
|
||||||
/// \see isEmpty, erase
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void clear();
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Get the size of the string
|
|
||||||
///
|
|
||||||
/// \return Number of characters in the string
|
|
||||||
///
|
|
||||||
/// \see isEmpty
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
std::size_t getSize() const;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Check whether the string is empty or not
|
|
||||||
///
|
|
||||||
/// \return True if the string is empty (i.e. contains no character)
|
|
||||||
///
|
|
||||||
/// \see clear, getSize
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
bool isEmpty() const;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Erase one or more characters from the string
|
|
||||||
///
|
|
||||||
/// This function removes a sequence of \a count characters
|
|
||||||
/// starting from \a position.
|
|
||||||
///
|
|
||||||
/// \param position Position of the first character to erase
|
|
||||||
/// \param count Number of characters to erase
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void erase(std::size_t position, std::size_t count = 1);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Insert one or more characters into the string
|
|
||||||
///
|
|
||||||
/// This function inserts the characters of \a str
|
|
||||||
/// into the string, starting from \a position.
|
|
||||||
///
|
|
||||||
/// \param position Position of insertion
|
|
||||||
/// \param str Characters to insert
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void insert(std::size_t position, const String& str);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Find a sequence of one or more characters in the string
|
|
||||||
///
|
|
||||||
/// This function searches for the characters of \a str
|
|
||||||
/// in the string, starting from \a start.
|
|
||||||
///
|
|
||||||
/// \param str Characters to find
|
|
||||||
/// \param start Where to begin searching
|
|
||||||
///
|
|
||||||
/// \return Position of \a str in the string, or String::InvalidPos if not found
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
std::size_t find(const String& str, std::size_t start = 0) const;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Replace a substring with another string
|
|
||||||
///
|
|
||||||
/// This function replaces the substring that starts at index \a position
|
|
||||||
/// and spans \a length characters with the string \a replaceWith.
|
|
||||||
///
|
|
||||||
/// \param position Index of the first character to be replaced
|
|
||||||
/// \param length Number of characters to replace. You can pass InvalidPos to
|
|
||||||
/// replace all characters until the end of the string.
|
|
||||||
/// \param replaceWith String that replaces the given substring.
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void replace(std::size_t position, std::size_t length, const String& replaceWith);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Replace all occurrences of a substring with a replacement string
|
|
||||||
///
|
|
||||||
/// This function replaces all occurrences of \a searchFor in this string
|
|
||||||
/// with the string \a replaceWith.
|
|
||||||
///
|
|
||||||
/// \param searchFor The value being searched for
|
|
||||||
/// \param replaceWith The value that replaces found \a searchFor values
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void replace(const String& searchFor, const String& replaceWith);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Return a part of the string
|
|
||||||
///
|
|
||||||
/// This function returns the substring that starts at index \a position
|
|
||||||
/// and spans \a length characters.
|
|
||||||
///
|
|
||||||
/// \param position Index of the first character
|
|
||||||
/// \param length Number of characters to include in the substring (if
|
|
||||||
/// the string is shorter, as many characters as possible
|
|
||||||
/// are included). \ref InvalidPos can be used to include all
|
|
||||||
/// characters until the end of the string.
|
|
||||||
///
|
|
||||||
/// \return String object containing a substring of this object
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
String substring(std::size_t position, std::size_t length = InvalidPos) const;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Get a pointer to the C-style array of characters
|
|
||||||
///
|
|
||||||
/// This functions provides a read-only access to a
|
|
||||||
/// null-terminated C-style representation of the string.
|
|
||||||
/// The returned pointer is temporary and is meant only for
|
|
||||||
/// immediate use, thus it is not recommended to store it.
|
|
||||||
///
|
|
||||||
/// \return Read-only pointer to the array of characters
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
const Uint32* getData() const;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Return an iterator to the beginning of the string
|
|
||||||
///
|
|
||||||
/// \return Read-write iterator to the beginning of the string characters
|
|
||||||
///
|
|
||||||
/// \see end
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Iterator begin();
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Return an iterator to the beginning of the string
|
|
||||||
///
|
|
||||||
/// \return Read-only iterator to the beginning of the string characters
|
|
||||||
///
|
|
||||||
/// \see end
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
ConstIterator begin() const;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Return an iterator to the end of the string
|
|
||||||
///
|
|
||||||
/// The end iterator refers to 1 position past the last character;
|
|
||||||
/// thus it represents an invalid character and should never be
|
|
||||||
/// accessed.
|
|
||||||
///
|
|
||||||
/// \return Read-write iterator to the end of the string characters
|
|
||||||
///
|
|
||||||
/// \see begin
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Iterator end();
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Return an iterator to the end of the string
|
|
||||||
///
|
|
||||||
/// The end iterator refers to 1 position past the last character;
|
|
||||||
/// thus it represents an invalid character and should never be
|
|
||||||
/// accessed.
|
|
||||||
///
|
|
||||||
/// \return Read-only iterator to the end of the string characters
|
|
||||||
///
|
|
||||||
/// \see begin
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
ConstIterator end() const;
|
|
||||||
|
|
||||||
private:
|
|
||||||
|
|
||||||
friend SFML_SYSTEM_API bool operator ==(const String& left, const String& right);
|
|
||||||
friend SFML_SYSTEM_API bool operator <(const String& left, const String& right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Member data
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
std::basic_string<Uint32> m_string; ///< Internal string of UTF-32 characters
|
|
||||||
};
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \relates String
|
|
||||||
/// \brief Overload of == operator to compare two UTF-32 strings
|
|
||||||
///
|
|
||||||
/// \param left Left operand (a string)
|
|
||||||
/// \param right Right operand (a string)
|
|
||||||
///
|
|
||||||
/// \return True if both strings are equal
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_SYSTEM_API bool operator ==(const String& left, const String& right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \relates String
|
|
||||||
/// \brief Overload of != operator to compare two UTF-32 strings
|
|
||||||
///
|
|
||||||
/// \param left Left operand (a string)
|
|
||||||
/// \param right Right operand (a string)
|
|
||||||
///
|
|
||||||
/// \return True if both strings are different
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_SYSTEM_API bool operator !=(const String& left, const String& right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \relates String
|
|
||||||
/// \brief Overload of < operator to compare two UTF-32 strings
|
|
||||||
///
|
|
||||||
/// \param left Left operand (a string)
|
|
||||||
/// \param right Right operand (a string)
|
|
||||||
///
|
|
||||||
/// \return True if \a left is lexicographically before \a right
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_SYSTEM_API bool operator <(const String& left, const String& right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \relates String
|
|
||||||
/// \brief Overload of > operator to compare two UTF-32 strings
|
|
||||||
///
|
|
||||||
/// \param left Left operand (a string)
|
|
||||||
/// \param right Right operand (a string)
|
|
||||||
///
|
|
||||||
/// \return True if \a left is lexicographically after \a right
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_SYSTEM_API bool operator >(const String& left, const String& right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \relates String
|
|
||||||
/// \brief Overload of <= operator to compare two UTF-32 strings
|
|
||||||
///
|
|
||||||
/// \param left Left operand (a string)
|
|
||||||
/// \param right Right operand (a string)
|
|
||||||
///
|
|
||||||
/// \return True if \a left is lexicographically before or equivalent to \a right
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_SYSTEM_API bool operator <=(const String& left, const String& right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \relates String
|
|
||||||
/// \brief Overload of >= operator to compare two UTF-32 strings
|
|
||||||
///
|
|
||||||
/// \param left Left operand (a string)
|
|
||||||
/// \param right Right operand (a string)
|
|
||||||
///
|
|
||||||
/// \return True if \a left is lexicographically after or equivalent to \a right
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_SYSTEM_API bool operator >=(const String& left, const String& right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \relates String
|
|
||||||
/// \brief Overload of binary + operator to concatenate two strings
|
|
||||||
///
|
|
||||||
/// \param left Left operand (a string)
|
|
||||||
/// \param right Right operand (a string)
|
|
||||||
///
|
|
||||||
/// \return Concatenated string
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_SYSTEM_API String operator +(const String& left, const String& right);
|
|
||||||
|
|
||||||
#include <SFML/System/String.inl>
|
|
||||||
|
|
||||||
} // namespace sf
|
|
||||||
|
|
||||||
|
|
||||||
#endif // SFML_STRING_HPP
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \class sf::String
|
|
||||||
/// \ingroup system
|
|
||||||
///
|
|
||||||
/// sf::String is a utility string class defined mainly for
|
|
||||||
/// convenience. It is a Unicode string (implemented using
|
|
||||||
/// UTF-32), thus it can store any character in the world
|
|
||||||
/// (European, Chinese, Arabic, Hebrew, etc.).
|
|
||||||
///
|
|
||||||
/// It automatically handles conversions from/to ANSI and
|
|
||||||
/// wide strings, so that you can work with standard string
|
|
||||||
/// classes and still be compatible with functions taking a
|
|
||||||
/// sf::String.
|
|
||||||
///
|
|
||||||
/// \code
|
|
||||||
/// sf::String s;
|
|
||||||
///
|
|
||||||
/// std::string s1 = s; // automatically converted to ANSI string
|
|
||||||
/// std::wstring s2 = s; // automatically converted to wide string
|
|
||||||
/// s = "hello"; // automatically converted from ANSI string
|
|
||||||
/// s = L"hello"; // automatically converted from wide string
|
|
||||||
/// s += 'a'; // automatically converted from ANSI string
|
|
||||||
/// s += L'a'; // automatically converted from wide string
|
|
||||||
/// \endcode
|
|
||||||
///
|
|
||||||
/// Conversions involving ANSI strings use the default user locale. However
|
|
||||||
/// it is possible to use a custom locale if necessary:
|
|
||||||
/// \code
|
|
||||||
/// std::locale locale;
|
|
||||||
/// sf::String s;
|
|
||||||
/// ...
|
|
||||||
/// std::string s1 = s.toAnsiString(locale);
|
|
||||||
/// s = sf::String("hello", locale);
|
|
||||||
/// \endcode
|
|
||||||
///
|
|
||||||
/// sf::String defines the most important functions of the
|
|
||||||
/// standard std::string class: removing, random access, iterating,
|
|
||||||
/// appending, comparing, etc. However it is a simple class
|
|
||||||
/// provided for convenience, and you may have to consider using
|
|
||||||
/// a more optimized class if your program requires complex string
|
|
||||||
/// handling. The automatic conversion functions will then take
|
|
||||||
/// care of converting your string to sf::String whenever SFML
|
|
||||||
/// requires it.
|
|
||||||
///
|
|
||||||
/// Please note that SFML also defines a low-level, generic
|
|
||||||
/// interface for Unicode handling, see the sf::Utf classes.
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
53
Externals/SFML/include/SFML/System/String.inl
vendored
53
Externals/SFML/include/SFML/System/String.inl
vendored
|
@ -1,53 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename T>
|
|
||||||
String String::fromUtf8(T begin, T end)
|
|
||||||
{
|
|
||||||
String string;
|
|
||||||
Utf8::toUtf32(begin, end, std::back_inserter(string.m_string));
|
|
||||||
return string;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename T>
|
|
||||||
String String::fromUtf16(T begin, T end)
|
|
||||||
{
|
|
||||||
String string;
|
|
||||||
Utf16::toUtf32(begin, end, std::back_inserter(string.m_string));
|
|
||||||
return string;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename T>
|
|
||||||
String String::fromUtf32(T begin, T end)
|
|
||||||
{
|
|
||||||
String string;
|
|
||||||
string.m_string.assign(begin, end);
|
|
||||||
return string;
|
|
||||||
}
|
|
488
Externals/SFML/include/SFML/System/Time.hpp
vendored
488
Externals/SFML/include/SFML/System/Time.hpp
vendored
|
@ -1,488 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#ifndef SFML_TIME_HPP
|
|
||||||
#define SFML_TIME_HPP
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Headers
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#include <SFML/System/Export.hpp>
|
|
||||||
|
|
||||||
|
|
||||||
namespace sf
|
|
||||||
{
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Represents a time value
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
class SFML_SYSTEM_API Time
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Default constructor
|
|
||||||
///
|
|
||||||
/// Sets the time value to zero.
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Time();
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Return the time value as a number of seconds
|
|
||||||
///
|
|
||||||
/// \return Time in seconds
|
|
||||||
///
|
|
||||||
/// \see asMilliseconds, asMicroseconds
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
float asSeconds() const;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Return the time value as a number of milliseconds
|
|
||||||
///
|
|
||||||
/// \return Time in milliseconds
|
|
||||||
///
|
|
||||||
/// \see asSeconds, asMicroseconds
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Int32 asMilliseconds() const;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Return the time value as a number of microseconds
|
|
||||||
///
|
|
||||||
/// \return Time in microseconds
|
|
||||||
///
|
|
||||||
/// \see asSeconds, asMilliseconds
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Int64 asMicroseconds() const;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Static member data
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
static const Time Zero; ///< Predefined "zero" time value
|
|
||||||
|
|
||||||
private:
|
|
||||||
|
|
||||||
friend SFML_SYSTEM_API Time seconds(float);
|
|
||||||
friend SFML_SYSTEM_API Time milliseconds(Int32);
|
|
||||||
friend SFML_SYSTEM_API Time microseconds(Int64);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Construct from a number of microseconds
|
|
||||||
///
|
|
||||||
/// This function is internal. To construct time values,
|
|
||||||
/// use sf::seconds, sf::milliseconds or sf::microseconds instead.
|
|
||||||
///
|
|
||||||
/// \param microseconds Number of microseconds
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
explicit Time(Int64 microseconds);
|
|
||||||
|
|
||||||
private:
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Member data
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Int64 m_microseconds; ///< Time value stored as microseconds
|
|
||||||
};
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \relates Time
|
|
||||||
/// \brief Construct a time value from a number of seconds
|
|
||||||
///
|
|
||||||
/// \param amount Number of seconds
|
|
||||||
///
|
|
||||||
/// \return Time value constructed from the amount of seconds
|
|
||||||
///
|
|
||||||
/// \see milliseconds, microseconds
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_SYSTEM_API Time seconds(float amount);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \relates Time
|
|
||||||
/// \brief Construct a time value from a number of milliseconds
|
|
||||||
///
|
|
||||||
/// \param amount Number of milliseconds
|
|
||||||
///
|
|
||||||
/// \return Time value constructed from the amount of milliseconds
|
|
||||||
///
|
|
||||||
/// \see seconds, microseconds
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_SYSTEM_API Time milliseconds(Int32 amount);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \relates Time
|
|
||||||
/// \brief Construct a time value from a number of microseconds
|
|
||||||
///
|
|
||||||
/// \param amount Number of microseconds
|
|
||||||
///
|
|
||||||
/// \return Time value constructed from the amount of microseconds
|
|
||||||
///
|
|
||||||
/// \see seconds, milliseconds
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_SYSTEM_API Time microseconds(Int64 amount);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \relates Time
|
|
||||||
/// \brief Overload of == operator to compare two time values
|
|
||||||
///
|
|
||||||
/// \param left Left operand (a time)
|
|
||||||
/// \param right Right operand (a time)
|
|
||||||
///
|
|
||||||
/// \return True if both time values are equal
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_SYSTEM_API bool operator ==(Time left, Time right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \relates Time
|
|
||||||
/// \brief Overload of != operator to compare two time values
|
|
||||||
///
|
|
||||||
/// \param left Left operand (a time)
|
|
||||||
/// \param right Right operand (a time)
|
|
||||||
///
|
|
||||||
/// \return True if both time values are different
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_SYSTEM_API bool operator !=(Time left, Time right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \relates Time
|
|
||||||
/// \brief Overload of < operator to compare two time values
|
|
||||||
///
|
|
||||||
/// \param left Left operand (a time)
|
|
||||||
/// \param right Right operand (a time)
|
|
||||||
///
|
|
||||||
/// \return True if \a left is lesser than \a right
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_SYSTEM_API bool operator <(Time left, Time right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \relates Time
|
|
||||||
/// \brief Overload of > operator to compare two time values
|
|
||||||
///
|
|
||||||
/// \param left Left operand (a time)
|
|
||||||
/// \param right Right operand (a time)
|
|
||||||
///
|
|
||||||
/// \return True if \a left is greater than \a right
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_SYSTEM_API bool operator >(Time left, Time right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \relates Time
|
|
||||||
/// \brief Overload of <= operator to compare two time values
|
|
||||||
///
|
|
||||||
/// \param left Left operand (a time)
|
|
||||||
/// \param right Right operand (a time)
|
|
||||||
///
|
|
||||||
/// \return True if \a left is lesser or equal than \a right
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_SYSTEM_API bool operator <=(Time left, Time right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \relates Time
|
|
||||||
/// \brief Overload of >= operator to compare two time values
|
|
||||||
///
|
|
||||||
/// \param left Left operand (a time)
|
|
||||||
/// \param right Right operand (a time)
|
|
||||||
///
|
|
||||||
/// \return True if \a left is greater or equal than \a right
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_SYSTEM_API bool operator >=(Time left, Time right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \relates Time
|
|
||||||
/// \brief Overload of unary - operator to negate a time value
|
|
||||||
///
|
|
||||||
/// \param right Right operand (a time)
|
|
||||||
///
|
|
||||||
/// \return Opposite of the time value
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_SYSTEM_API Time operator -(Time right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \relates Time
|
|
||||||
/// \brief Overload of binary + operator to add two time values
|
|
||||||
///
|
|
||||||
/// \param left Left operand (a time)
|
|
||||||
/// \param right Right operand (a time)
|
|
||||||
///
|
|
||||||
/// \return Sum of the two times values
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_SYSTEM_API Time operator +(Time left, Time right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \relates Time
|
|
||||||
/// \brief Overload of binary += operator to add/assign two time values
|
|
||||||
///
|
|
||||||
/// \param left Left operand (a time)
|
|
||||||
/// \param right Right operand (a time)
|
|
||||||
///
|
|
||||||
/// \return Sum of the two times values
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_SYSTEM_API Time& operator +=(Time& left, Time right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \relates Time
|
|
||||||
/// \brief Overload of binary - operator to subtract two time values
|
|
||||||
///
|
|
||||||
/// \param left Left operand (a time)
|
|
||||||
/// \param right Right operand (a time)
|
|
||||||
///
|
|
||||||
/// \return Difference of the two times values
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_SYSTEM_API Time operator -(Time left, Time right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \relates Time
|
|
||||||
/// \brief Overload of binary -= operator to subtract/assign two time values
|
|
||||||
///
|
|
||||||
/// \param left Left operand (a time)
|
|
||||||
/// \param right Right operand (a time)
|
|
||||||
///
|
|
||||||
/// \return Difference of the two times values
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_SYSTEM_API Time& operator -=(Time& left, Time right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \relates Time
|
|
||||||
/// \brief Overload of binary * operator to scale a time value
|
|
||||||
///
|
|
||||||
/// \param left Left operand (a time)
|
|
||||||
/// \param right Right operand (a number)
|
|
||||||
///
|
|
||||||
/// \return \a left multiplied by \a right
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_SYSTEM_API Time operator *(Time left, float right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \relates Time
|
|
||||||
/// \brief Overload of binary * operator to scale a time value
|
|
||||||
///
|
|
||||||
/// \param left Left operand (a time)
|
|
||||||
/// \param right Right operand (a number)
|
|
||||||
///
|
|
||||||
/// \return \a left multiplied by \a right
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_SYSTEM_API Time operator *(Time left, Int64 right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \relates Time
|
|
||||||
/// \brief Overload of binary * operator to scale a time value
|
|
||||||
///
|
|
||||||
/// \param left Left operand (a number)
|
|
||||||
/// \param right Right operand (a time)
|
|
||||||
///
|
|
||||||
/// \return \a left multiplied by \a right
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_SYSTEM_API Time operator *(float left, Time right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \relates Time
|
|
||||||
/// \brief Overload of binary * operator to scale a time value
|
|
||||||
///
|
|
||||||
/// \param left Left operand (a number)
|
|
||||||
/// \param right Right operand (a time)
|
|
||||||
///
|
|
||||||
/// \return \a left multiplied by \a right
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_SYSTEM_API Time operator *(Int64 left, Time right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \relates Time
|
|
||||||
/// \brief Overload of binary *= operator to scale/assign a time value
|
|
||||||
///
|
|
||||||
/// \param left Left operand (a time)
|
|
||||||
/// \param right Right operand (a number)
|
|
||||||
///
|
|
||||||
/// \return \a left multiplied by \a right
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_SYSTEM_API Time& operator *=(Time& left, float right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \relates Time
|
|
||||||
/// \brief Overload of binary *= operator to scale/assign a time value
|
|
||||||
///
|
|
||||||
/// \param left Left operand (a time)
|
|
||||||
/// \param right Right operand (a number)
|
|
||||||
///
|
|
||||||
/// \return \a left multiplied by \a right
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_SYSTEM_API Time& operator *=(Time& left, Int64 right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \relates Time
|
|
||||||
/// \brief Overload of binary / operator to scale a time value
|
|
||||||
///
|
|
||||||
/// \param left Left operand (a time)
|
|
||||||
/// \param right Right operand (a number)
|
|
||||||
///
|
|
||||||
/// \return \a left divided by \a right
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_SYSTEM_API Time operator /(Time left, float right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \relates Time
|
|
||||||
/// \brief Overload of binary / operator to scale a time value
|
|
||||||
///
|
|
||||||
/// \param left Left operand (a time)
|
|
||||||
/// \param right Right operand (a number)
|
|
||||||
///
|
|
||||||
/// \return \a left divided by \a right
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_SYSTEM_API Time operator /(Time left, Int64 right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \relates Time
|
|
||||||
/// \brief Overload of binary /= operator to scale/assign a time value
|
|
||||||
///
|
|
||||||
/// \param left Left operand (a time)
|
|
||||||
/// \param right Right operand (a number)
|
|
||||||
///
|
|
||||||
/// \return \a left divided by \a right
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_SYSTEM_API Time& operator /=(Time& left, float right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \relates Time
|
|
||||||
/// \brief Overload of binary /= operator to scale/assign a time value
|
|
||||||
///
|
|
||||||
/// \param left Left operand (a time)
|
|
||||||
/// \param right Right operand (a number)
|
|
||||||
///
|
|
||||||
/// \return \a left divided by \a right
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_SYSTEM_API Time& operator /=(Time& left, Int64 right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \relates Time
|
|
||||||
/// \brief Overload of binary / operator to compute the ratio of two time values
|
|
||||||
///
|
|
||||||
/// \param left Left operand (a time)
|
|
||||||
/// \param right Right operand (a time)
|
|
||||||
///
|
|
||||||
/// \return \a left divided by \a right
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_SYSTEM_API float operator /(Time left, Time right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \relates Time
|
|
||||||
/// \brief Overload of binary % operator to compute remainder of a time value
|
|
||||||
///
|
|
||||||
/// \param left Left operand (a time)
|
|
||||||
/// \param right Right operand (a time)
|
|
||||||
///
|
|
||||||
/// \return \a left modulo \a right
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_SYSTEM_API Time operator %(Time left, Time right);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \relates Time
|
|
||||||
/// \brief Overload of binary %= operator to compute/assign remainder of a time value
|
|
||||||
///
|
|
||||||
/// \param left Left operand (a time)
|
|
||||||
/// \param right Right operand (a time)
|
|
||||||
///
|
|
||||||
/// \return \a left modulo \a right
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SFML_SYSTEM_API Time& operator %=(Time& left, Time right);
|
|
||||||
|
|
||||||
} // namespace sf
|
|
||||||
|
|
||||||
|
|
||||||
#endif // SFML_TIME_HPP
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \class sf::Time
|
|
||||||
/// \ingroup system
|
|
||||||
///
|
|
||||||
/// sf::Time encapsulates a time value in a flexible way.
|
|
||||||
/// It allows to define a time value either as a number of
|
|
||||||
/// seconds, milliseconds or microseconds. It also works the
|
|
||||||
/// other way round: you can read a time value as either
|
|
||||||
/// a number of seconds, milliseconds or microseconds.
|
|
||||||
///
|
|
||||||
/// By using such a flexible interface, the API doesn't
|
|
||||||
/// impose any fixed type or resolution for time values,
|
|
||||||
/// and let the user choose its own favorite representation.
|
|
||||||
///
|
|
||||||
/// Time values support the usual mathematical operations:
|
|
||||||
/// you can add or subtract two times, multiply or divide
|
|
||||||
/// a time by a number, compare two times, etc.
|
|
||||||
///
|
|
||||||
/// Since they represent a time span and not an absolute time
|
|
||||||
/// value, times can also be negative.
|
|
||||||
///
|
|
||||||
/// Usage example:
|
|
||||||
/// \code
|
|
||||||
/// sf::Time t1 = sf::seconds(0.1f);
|
|
||||||
/// Int32 milli = t1.asMilliseconds(); // 100
|
|
||||||
///
|
|
||||||
/// sf::Time t2 = sf::milliseconds(30);
|
|
||||||
/// Int64 micro = t2.asMicroseconds(); // 30000
|
|
||||||
///
|
|
||||||
/// sf::Time t3 = sf::microseconds(-800000);
|
|
||||||
/// float sec = t3.asSeconds(); // -0.8
|
|
||||||
/// \endcode
|
|
||||||
///
|
|
||||||
/// \code
|
|
||||||
/// void update(sf::Time elapsed)
|
|
||||||
/// {
|
|
||||||
/// position += speed * elapsed.asSeconds();
|
|
||||||
/// }
|
|
||||||
///
|
|
||||||
/// update(sf::milliseconds(100));
|
|
||||||
/// \endcode
|
|
||||||
///
|
|
||||||
/// \see sf::Clock
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
763
Externals/SFML/include/SFML/System/Utf.hpp
vendored
763
Externals/SFML/include/SFML/System/Utf.hpp
vendored
|
@ -1,763 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#ifndef SFML_UTF_HPP
|
|
||||||
#define SFML_UTF_HPP
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Headers
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#include <SFML/Config.hpp>
|
|
||||||
#include <algorithm>
|
|
||||||
#include <locale>
|
|
||||||
#include <string>
|
|
||||||
#include <cstdlib>
|
|
||||||
|
|
||||||
|
|
||||||
namespace sf
|
|
||||||
{
|
|
||||||
template <unsigned int N>
|
|
||||||
class Utf;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Specialization of the Utf template for UTF-8
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <>
|
|
||||||
class Utf<8>
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Decode a single UTF-8 character
|
|
||||||
///
|
|
||||||
/// Decoding a character means finding its unique 32-bits
|
|
||||||
/// code (called the codepoint) in the Unicode standard.
|
|
||||||
///
|
|
||||||
/// \param begin Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param end Iterator pointing to the end of the input sequence
|
|
||||||
/// \param output Codepoint of the decoded UTF-8 character
|
|
||||||
/// \param replacement Replacement character to use in case the UTF-8 sequence is invalid
|
|
||||||
///
|
|
||||||
/// \return Iterator pointing to one past the last read element of the input sequence
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In>
|
|
||||||
static In decode(In begin, In end, Uint32& output, Uint32 replacement = 0);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Encode a single UTF-8 character
|
|
||||||
///
|
|
||||||
/// Encoding a character means converting a unique 32-bits
|
|
||||||
/// code (called the codepoint) in the target encoding, UTF-8.
|
|
||||||
///
|
|
||||||
/// \param input Codepoint to encode as UTF-8
|
|
||||||
/// \param output Iterator pointing to the beginning of the output sequence
|
|
||||||
/// \param replacement Replacement for characters not convertible to UTF-8 (use 0 to skip them)
|
|
||||||
///
|
|
||||||
/// \return Iterator to the end of the output sequence which has been written
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename Out>
|
|
||||||
static Out encode(Uint32 input, Out output, Uint8 replacement = 0);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Advance to the next UTF-8 character
|
|
||||||
///
|
|
||||||
/// This function is necessary for multi-elements encodings, as
|
|
||||||
/// a single character may use more than 1 storage element.
|
|
||||||
///
|
|
||||||
/// \param begin Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param end Iterator pointing to the end of the input sequence
|
|
||||||
///
|
|
||||||
/// \return Iterator pointing to one past the last read element of the input sequence
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In>
|
|
||||||
static In next(In begin, In end);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Count the number of characters of a UTF-8 sequence
|
|
||||||
///
|
|
||||||
/// This function is necessary for multi-elements encodings, as
|
|
||||||
/// a single character may use more than 1 storage element, thus the
|
|
||||||
/// total size can be different from (begin - end).
|
|
||||||
///
|
|
||||||
/// \param begin Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param end Iterator pointing to the end of the input sequence
|
|
||||||
///
|
|
||||||
/// \return Iterator pointing to one past the last read element of the input sequence
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In>
|
|
||||||
static std::size_t count(In begin, In end);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Convert an ANSI characters range to UTF-8
|
|
||||||
///
|
|
||||||
/// The current global locale will be used by default, unless you
|
|
||||||
/// pass a custom one in the \a locale parameter.
|
|
||||||
///
|
|
||||||
/// \param begin Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param end Iterator pointing to the end of the input sequence
|
|
||||||
/// \param output Iterator pointing to the beginning of the output sequence
|
|
||||||
/// \param locale Locale to use for conversion
|
|
||||||
///
|
|
||||||
/// \return Iterator to the end of the output sequence which has been written
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
static Out fromAnsi(In begin, In end, Out output, const std::locale& locale = std::locale());
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Convert a wide characters range to UTF-8
|
|
||||||
///
|
|
||||||
/// \param begin Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param end Iterator pointing to the end of the input sequence
|
|
||||||
/// \param output Iterator pointing to the beginning of the output sequence
|
|
||||||
///
|
|
||||||
/// \return Iterator to the end of the output sequence which has been written
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
static Out fromWide(In begin, In end, Out output);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Convert a latin-1 (ISO-5589-1) characters range to UTF-8
|
|
||||||
///
|
|
||||||
/// \param begin Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param end Iterator pointing to the end of the input sequence
|
|
||||||
/// \param output Iterator pointing to the beginning of the output sequence
|
|
||||||
///
|
|
||||||
/// \return Iterator to the end of the output sequence which has been written
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
static Out fromLatin1(In begin, In end, Out output);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Convert an UTF-8 characters range to ANSI characters
|
|
||||||
///
|
|
||||||
/// The current global locale will be used by default, unless you
|
|
||||||
/// pass a custom one in the \a locale parameter.
|
|
||||||
///
|
|
||||||
/// \param begin Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param end Iterator pointing to the end of the input sequence
|
|
||||||
/// \param output Iterator pointing to the beginning of the output sequence
|
|
||||||
/// \param replacement Replacement for characters not convertible to ANSI (use 0 to skip them)
|
|
||||||
/// \param locale Locale to use for conversion
|
|
||||||
///
|
|
||||||
/// \return Iterator to the end of the output sequence which has been written
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
static Out toAnsi(In begin, In end, Out output, char replacement = 0, const std::locale& locale = std::locale());
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Convert an UTF-8 characters range to wide characters
|
|
||||||
///
|
|
||||||
/// \param begin Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param end Iterator pointing to the end of the input sequence
|
|
||||||
/// \param output Iterator pointing to the beginning of the output sequence
|
|
||||||
/// \param replacement Replacement for characters not convertible to wide (use 0 to skip them)
|
|
||||||
///
|
|
||||||
/// \return Iterator to the end of the output sequence which has been written
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
static Out toWide(In begin, In end, Out output, wchar_t replacement = 0);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Convert an UTF-8 characters range to latin-1 (ISO-5589-1) characters
|
|
||||||
///
|
|
||||||
/// \param begin Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param end Iterator pointing to the end of the input sequence
|
|
||||||
/// \param output Iterator pointing to the beginning of the output sequence
|
|
||||||
/// \param replacement Replacement for characters not convertible to wide (use 0 to skip them)
|
|
||||||
///
|
|
||||||
/// \return Iterator to the end of the output sequence which has been written
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
static Out toLatin1(In begin, In end, Out output, char replacement = 0);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Convert a UTF-8 characters range to UTF-8
|
|
||||||
///
|
|
||||||
/// This functions does nothing more than a direct copy;
|
|
||||||
/// it is defined only to provide the same interface as other
|
|
||||||
/// specializations of the sf::Utf<> template, and allow
|
|
||||||
/// generic code to be written on top of it.
|
|
||||||
///
|
|
||||||
/// \param begin Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param end Iterator pointing to the end of the input sequence
|
|
||||||
/// \param output Iterator pointing to the beginning of the output sequence
|
|
||||||
///
|
|
||||||
/// \return Iterator to the end of the output sequence which has been written
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
static Out toUtf8(In begin, In end, Out output);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Convert a UTF-8 characters range to UTF-16
|
|
||||||
///
|
|
||||||
/// \param begin Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param end Iterator pointing to the end of the input sequence
|
|
||||||
/// \param output Iterator pointing to the beginning of the output sequence
|
|
||||||
///
|
|
||||||
/// \return Iterator to the end of the output sequence which has been written
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
static Out toUtf16(In begin, In end, Out output);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Convert a UTF-8 characters range to UTF-32
|
|
||||||
///
|
|
||||||
/// \param begin Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param end Iterator pointing to the end of the input sequence
|
|
||||||
/// \param output Iterator pointing to the beginning of the output sequence
|
|
||||||
///
|
|
||||||
/// \return Iterator to the end of the output sequence which has been written
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
static Out toUtf32(In begin, In end, Out output);
|
|
||||||
};
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Specialization of the Utf template for UTF-16
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <>
|
|
||||||
class Utf<16>
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Decode a single UTF-16 character
|
|
||||||
///
|
|
||||||
/// Decoding a character means finding its unique 32-bits
|
|
||||||
/// code (called the codepoint) in the Unicode standard.
|
|
||||||
///
|
|
||||||
/// \param begin Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param end Iterator pointing to the end of the input sequence
|
|
||||||
/// \param output Codepoint of the decoded UTF-16 character
|
|
||||||
/// \param replacement Replacement character to use in case the UTF-8 sequence is invalid
|
|
||||||
///
|
|
||||||
/// \return Iterator pointing to one past the last read element of the input sequence
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In>
|
|
||||||
static In decode(In begin, In end, Uint32& output, Uint32 replacement = 0);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Encode a single UTF-16 character
|
|
||||||
///
|
|
||||||
/// Encoding a character means converting a unique 32-bits
|
|
||||||
/// code (called the codepoint) in the target encoding, UTF-16.
|
|
||||||
///
|
|
||||||
/// \param input Codepoint to encode as UTF-16
|
|
||||||
/// \param output Iterator pointing to the beginning of the output sequence
|
|
||||||
/// \param replacement Replacement for characters not convertible to UTF-16 (use 0 to skip them)
|
|
||||||
///
|
|
||||||
/// \return Iterator to the end of the output sequence which has been written
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename Out>
|
|
||||||
static Out encode(Uint32 input, Out output, Uint16 replacement = 0);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Advance to the next UTF-16 character
|
|
||||||
///
|
|
||||||
/// This function is necessary for multi-elements encodings, as
|
|
||||||
/// a single character may use more than 1 storage element.
|
|
||||||
///
|
|
||||||
/// \param begin Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param end Iterator pointing to the end of the input sequence
|
|
||||||
///
|
|
||||||
/// \return Iterator pointing to one past the last read element of the input sequence
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In>
|
|
||||||
static In next(In begin, In end);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Count the number of characters of a UTF-16 sequence
|
|
||||||
///
|
|
||||||
/// This function is necessary for multi-elements encodings, as
|
|
||||||
/// a single character may use more than 1 storage element, thus the
|
|
||||||
/// total size can be different from (begin - end).
|
|
||||||
///
|
|
||||||
/// \param begin Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param end Iterator pointing to the end of the input sequence
|
|
||||||
///
|
|
||||||
/// \return Iterator pointing to one past the last read element of the input sequence
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In>
|
|
||||||
static std::size_t count(In begin, In end);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Convert an ANSI characters range to UTF-16
|
|
||||||
///
|
|
||||||
/// The current global locale will be used by default, unless you
|
|
||||||
/// pass a custom one in the \a locale parameter.
|
|
||||||
///
|
|
||||||
/// \param begin Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param end Iterator pointing to the end of the input sequence
|
|
||||||
/// \param output Iterator pointing to the beginning of the output sequence
|
|
||||||
/// \param locale Locale to use for conversion
|
|
||||||
///
|
|
||||||
/// \return Iterator to the end of the output sequence which has been written
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
static Out fromAnsi(In begin, In end, Out output, const std::locale& locale = std::locale());
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Convert a wide characters range to UTF-16
|
|
||||||
///
|
|
||||||
/// \param begin Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param end Iterator pointing to the end of the input sequence
|
|
||||||
/// \param output Iterator pointing to the beginning of the output sequence
|
|
||||||
///
|
|
||||||
/// \return Iterator to the end of the output sequence which has been written
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
static Out fromWide(In begin, In end, Out output);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Convert a latin-1 (ISO-5589-1) characters range to UTF-16
|
|
||||||
///
|
|
||||||
/// \param begin Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param end Iterator pointing to the end of the input sequence
|
|
||||||
/// \param output Iterator pointing to the beginning of the output sequence
|
|
||||||
///
|
|
||||||
/// \return Iterator to the end of the output sequence which has been written
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
static Out fromLatin1(In begin, In end, Out output);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Convert an UTF-16 characters range to ANSI characters
|
|
||||||
///
|
|
||||||
/// The current global locale will be used by default, unless you
|
|
||||||
/// pass a custom one in the \a locale parameter.
|
|
||||||
///
|
|
||||||
/// \param begin Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param end Iterator pointing to the end of the input sequence
|
|
||||||
/// \param output Iterator pointing to the beginning of the output sequence
|
|
||||||
/// \param replacement Replacement for characters not convertible to ANSI (use 0 to skip them)
|
|
||||||
/// \param locale Locale to use for conversion
|
|
||||||
///
|
|
||||||
/// \return Iterator to the end of the output sequence which has been written
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
static Out toAnsi(In begin, In end, Out output, char replacement = 0, const std::locale& locale = std::locale());
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Convert an UTF-16 characters range to wide characters
|
|
||||||
///
|
|
||||||
/// \param begin Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param end Iterator pointing to the end of the input sequence
|
|
||||||
/// \param output Iterator pointing to the beginning of the output sequence
|
|
||||||
/// \param replacement Replacement for characters not convertible to wide (use 0 to skip them)
|
|
||||||
///
|
|
||||||
/// \return Iterator to the end of the output sequence which has been written
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
static Out toWide(In begin, In end, Out output, wchar_t replacement = 0);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Convert an UTF-16 characters range to latin-1 (ISO-5589-1) characters
|
|
||||||
///
|
|
||||||
/// \param begin Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param end Iterator pointing to the end of the input sequence
|
|
||||||
/// \param output Iterator pointing to the beginning of the output sequence
|
|
||||||
/// \param replacement Replacement for characters not convertible to wide (use 0 to skip them)
|
|
||||||
///
|
|
||||||
/// \return Iterator to the end of the output sequence which has been written
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
static Out toLatin1(In begin, In end, Out output, char replacement = 0);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Convert a UTF-16 characters range to UTF-8
|
|
||||||
///
|
|
||||||
/// \param begin Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param end Iterator pointing to the end of the input sequence
|
|
||||||
/// \param output Iterator pointing to the beginning of the output sequence
|
|
||||||
///
|
|
||||||
/// \return Iterator to the end of the output sequence which has been written
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
static Out toUtf8(In begin, In end, Out output);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Convert a UTF-16 characters range to UTF-16
|
|
||||||
///
|
|
||||||
/// This functions does nothing more than a direct copy;
|
|
||||||
/// it is defined only to provide the same interface as other
|
|
||||||
/// specializations of the sf::Utf<> template, and allow
|
|
||||||
/// generic code to be written on top of it.
|
|
||||||
///
|
|
||||||
/// \param begin Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param end Iterator pointing to the end of the input sequence
|
|
||||||
/// \param output Iterator pointing to the beginning of the output sequence
|
|
||||||
///
|
|
||||||
/// \return Iterator to the end of the output sequence which has been written
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
static Out toUtf16(In begin, In end, Out output);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Convert a UTF-16 characters range to UTF-32
|
|
||||||
///
|
|
||||||
/// \param begin Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param end Iterator pointing to the end of the input sequence
|
|
||||||
/// \param output Iterator pointing to the beginning of the output sequence
|
|
||||||
///
|
|
||||||
/// \return Iterator to the end of the output sequence which has been written
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
static Out toUtf32(In begin, In end, Out output);
|
|
||||||
};
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Specialization of the Utf template for UTF-32
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <>
|
|
||||||
class Utf<32>
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Decode a single UTF-32 character
|
|
||||||
///
|
|
||||||
/// Decoding a character means finding its unique 32-bits
|
|
||||||
/// code (called the codepoint) in the Unicode standard.
|
|
||||||
/// For UTF-32, the character value is the same as the codepoint.
|
|
||||||
///
|
|
||||||
/// \param begin Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param end Iterator pointing to the end of the input sequence
|
|
||||||
/// \param output Codepoint of the decoded UTF-32 character
|
|
||||||
/// \param replacement Replacement character to use in case the UTF-8 sequence is invalid
|
|
||||||
///
|
|
||||||
/// \return Iterator pointing to one past the last read element of the input sequence
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In>
|
|
||||||
static In decode(In begin, In end, Uint32& output, Uint32 replacement = 0);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Encode a single UTF-32 character
|
|
||||||
///
|
|
||||||
/// Encoding a character means converting a unique 32-bits
|
|
||||||
/// code (called the codepoint) in the target encoding, UTF-32.
|
|
||||||
/// For UTF-32, the codepoint is the same as the character value.
|
|
||||||
///
|
|
||||||
/// \param input Codepoint to encode as UTF-32
|
|
||||||
/// \param output Iterator pointing to the beginning of the output sequence
|
|
||||||
/// \param replacement Replacement for characters not convertible to UTF-32 (use 0 to skip them)
|
|
||||||
///
|
|
||||||
/// \return Iterator to the end of the output sequence which has been written
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename Out>
|
|
||||||
static Out encode(Uint32 input, Out output, Uint32 replacement = 0);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Advance to the next UTF-32 character
|
|
||||||
///
|
|
||||||
/// This function is trivial for UTF-32, which can store
|
|
||||||
/// every character in a single storage element.
|
|
||||||
///
|
|
||||||
/// \param begin Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param end Iterator pointing to the end of the input sequence
|
|
||||||
///
|
|
||||||
/// \return Iterator pointing to one past the last read element of the input sequence
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In>
|
|
||||||
static In next(In begin, In end);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Count the number of characters of a UTF-32 sequence
|
|
||||||
///
|
|
||||||
/// This function is trivial for UTF-32, which can store
|
|
||||||
/// every character in a single storage element.
|
|
||||||
///
|
|
||||||
/// \param begin Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param end Iterator pointing to the end of the input sequence
|
|
||||||
///
|
|
||||||
/// \return Iterator pointing to one past the last read element of the input sequence
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In>
|
|
||||||
static std::size_t count(In begin, In end);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Convert an ANSI characters range to UTF-32
|
|
||||||
///
|
|
||||||
/// The current global locale will be used by default, unless you
|
|
||||||
/// pass a custom one in the \a locale parameter.
|
|
||||||
///
|
|
||||||
/// \param begin Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param end Iterator pointing to the end of the input sequence
|
|
||||||
/// \param output Iterator pointing to the beginning of the output sequence
|
|
||||||
/// \param locale Locale to use for conversion
|
|
||||||
///
|
|
||||||
/// \return Iterator to the end of the output sequence which has been written
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
static Out fromAnsi(In begin, In end, Out output, const std::locale& locale = std::locale());
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Convert a wide characters range to UTF-32
|
|
||||||
///
|
|
||||||
/// \param begin Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param end Iterator pointing to the end of the input sequence
|
|
||||||
/// \param output Iterator pointing to the beginning of the output sequence
|
|
||||||
///
|
|
||||||
/// \return Iterator to the end of the output sequence which has been written
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
static Out fromWide(In begin, In end, Out output);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Convert a latin-1 (ISO-5589-1) characters range to UTF-32
|
|
||||||
///
|
|
||||||
/// \param begin Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param end Iterator pointing to the end of the input sequence
|
|
||||||
/// \param output Iterator pointing to the beginning of the output sequence
|
|
||||||
///
|
|
||||||
/// \return Iterator to the end of the output sequence which has been written
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
static Out fromLatin1(In begin, In end, Out output);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Convert an UTF-32 characters range to ANSI characters
|
|
||||||
///
|
|
||||||
/// The current global locale will be used by default, unless you
|
|
||||||
/// pass a custom one in the \a locale parameter.
|
|
||||||
///
|
|
||||||
/// \param begin Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param end Iterator pointing to the end of the input sequence
|
|
||||||
/// \param output Iterator pointing to the beginning of the output sequence
|
|
||||||
/// \param replacement Replacement for characters not convertible to ANSI (use 0 to skip them)
|
|
||||||
/// \param locale Locale to use for conversion
|
|
||||||
///
|
|
||||||
/// \return Iterator to the end of the output sequence which has been written
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
static Out toAnsi(In begin, In end, Out output, char replacement = 0, const std::locale& locale = std::locale());
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Convert an UTF-32 characters range to wide characters
|
|
||||||
///
|
|
||||||
/// \param begin Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param end Iterator pointing to the end of the input sequence
|
|
||||||
/// \param output Iterator pointing to the beginning of the output sequence
|
|
||||||
/// \param replacement Replacement for characters not convertible to wide (use 0 to skip them)
|
|
||||||
///
|
|
||||||
/// \return Iterator to the end of the output sequence which has been written
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
static Out toWide(In begin, In end, Out output, wchar_t replacement = 0);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Convert an UTF-16 characters range to latin-1 (ISO-5589-1) characters
|
|
||||||
///
|
|
||||||
/// \param begin Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param end Iterator pointing to the end of the input sequence
|
|
||||||
/// \param output Iterator pointing to the beginning of the output sequence
|
|
||||||
/// \param replacement Replacement for characters not convertible to wide (use 0 to skip them)
|
|
||||||
///
|
|
||||||
/// \return Iterator to the end of the output sequence which has been written
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
static Out toLatin1(In begin, In end, Out output, char replacement = 0);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Convert a UTF-32 characters range to UTF-8
|
|
||||||
///
|
|
||||||
/// \param begin Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param end Iterator pointing to the end of the input sequence
|
|
||||||
/// \param output Iterator pointing to the beginning of the output sequence
|
|
||||||
///
|
|
||||||
/// \return Iterator to the end of the output sequence which has been written
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
static Out toUtf8(In begin, In end, Out output);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Convert a UTF-32 characters range to UTF-16
|
|
||||||
///
|
|
||||||
/// \param begin Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param end Iterator pointing to the end of the input sequence
|
|
||||||
/// \param output Iterator pointing to the beginning of the output sequence
|
|
||||||
///
|
|
||||||
/// \return Iterator to the end of the output sequence which has been written
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
static Out toUtf16(In begin, In end, Out output);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Convert a UTF-32 characters range to UTF-32
|
|
||||||
///
|
|
||||||
/// This functions does nothing more than a direct copy;
|
|
||||||
/// it is defined only to provide the same interface as other
|
|
||||||
/// specializations of the sf::Utf<> template, and allow
|
|
||||||
/// generic code to be written on top of it.
|
|
||||||
///
|
|
||||||
/// \param begin Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param end Iterator pointing to the end of the input sequence
|
|
||||||
/// \param output Iterator pointing to the beginning of the output sequence
|
|
||||||
///
|
|
||||||
/// \return Iterator to the end of the output sequence which has been written
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
static Out toUtf32(In begin, In end, Out output);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Decode a single ANSI character to UTF-32
|
|
||||||
///
|
|
||||||
/// This function does not exist in other specializations
|
|
||||||
/// of sf::Utf<>, it is defined for convenience (it is used by
|
|
||||||
/// several other conversion functions).
|
|
||||||
///
|
|
||||||
/// \param input Input ANSI character
|
|
||||||
/// \param locale Locale to use for conversion
|
|
||||||
///
|
|
||||||
/// \return Converted character
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In>
|
|
||||||
static Uint32 decodeAnsi(In input, const std::locale& locale = std::locale());
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Decode a single wide character to UTF-32
|
|
||||||
///
|
|
||||||
/// This function does not exist in other specializations
|
|
||||||
/// of sf::Utf<>, it is defined for convenience (it is used by
|
|
||||||
/// several other conversion functions).
|
|
||||||
///
|
|
||||||
/// \param input Input wide character
|
|
||||||
///
|
|
||||||
/// \return Converted character
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In>
|
|
||||||
static Uint32 decodeWide(In input);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Encode a single UTF-32 character to ANSI
|
|
||||||
///
|
|
||||||
/// This function does not exist in other specializations
|
|
||||||
/// of sf::Utf<>, it is defined for convenience (it is used by
|
|
||||||
/// several other conversion functions).
|
|
||||||
///
|
|
||||||
/// \param codepoint Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param output Iterator pointing to the beginning of the output sequence
|
|
||||||
/// \param replacement Replacement if the input character is not convertible to ANSI (use 0 to skip it)
|
|
||||||
/// \param locale Locale to use for conversion
|
|
||||||
///
|
|
||||||
/// \return Iterator to the end of the output sequence which has been written
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename Out>
|
|
||||||
static Out encodeAnsi(Uint32 codepoint, Out output, char replacement = 0, const std::locale& locale = std::locale());
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Encode a single UTF-32 character to wide
|
|
||||||
///
|
|
||||||
/// This function does not exist in other specializations
|
|
||||||
/// of sf::Utf<>, it is defined for convenience (it is used by
|
|
||||||
/// several other conversion functions).
|
|
||||||
///
|
|
||||||
/// \param codepoint Iterator pointing to the beginning of the input sequence
|
|
||||||
/// \param output Iterator pointing to the beginning of the output sequence
|
|
||||||
/// \param replacement Replacement if the input character is not convertible to wide (use 0 to skip it)
|
|
||||||
///
|
|
||||||
/// \return Iterator to the end of the output sequence which has been written
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename Out>
|
|
||||||
static Out encodeWide(Uint32 codepoint, Out output, wchar_t replacement = 0);
|
|
||||||
};
|
|
||||||
|
|
||||||
#include <SFML/System/Utf.inl>
|
|
||||||
|
|
||||||
// Make typedefs to get rid of the template syntax
|
|
||||||
typedef Utf<8> Utf8;
|
|
||||||
typedef Utf<16> Utf16;
|
|
||||||
typedef Utf<32> Utf32;
|
|
||||||
|
|
||||||
} // namespace sf
|
|
||||||
|
|
||||||
|
|
||||||
#endif // SFML_UTF_HPP
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \class sf::Utf
|
|
||||||
/// \ingroup system
|
|
||||||
///
|
|
||||||
/// Utility class providing generic functions for UTF conversions.
|
|
||||||
///
|
|
||||||
/// sf::Utf is a low-level, generic interface for counting, iterating,
|
|
||||||
/// encoding and decoding Unicode characters and strings. It is able
|
|
||||||
/// to handle ANSI, wide, latin-1, UTF-8, UTF-16 and UTF-32 encodings.
|
|
||||||
///
|
|
||||||
/// sf::Utf<X> functions are all static, these classes are not meant to
|
|
||||||
/// be instantiated. All the functions are template, so that you
|
|
||||||
/// can use any character / string type for a given encoding.
|
|
||||||
///
|
|
||||||
/// It has 3 specializations:
|
|
||||||
/// \li sf::Utf<8> (typedef'd to sf::Utf8)
|
|
||||||
/// \li sf::Utf<16> (typedef'd to sf::Utf16)
|
|
||||||
/// \li sf::Utf<32> (typedef'd to sf::Utf32)
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
752
Externals/SFML/include/SFML/System/Utf.inl
vendored
752
Externals/SFML/include/SFML/System/Utf.inl
vendored
|
@ -1,752 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// References:
|
|
||||||
//
|
|
||||||
// https://www.unicode.org/
|
|
||||||
// https://www.unicode.org/Public/PROGRAMS/CVTUTF/ConvertUTF.c
|
|
||||||
// https://www.unicode.org/Public/PROGRAMS/CVTUTF/ConvertUTF.h
|
|
||||||
// https://people.w3.org/rishida/scripts/uniview/conversion
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In>
|
|
||||||
In Utf<8>::decode(In begin, In end, Uint32& output, Uint32 replacement)
|
|
||||||
{
|
|
||||||
// Some useful precomputed data
|
|
||||||
static const int trailing[256] =
|
|
||||||
{
|
|
||||||
0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
|
|
||||||
0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
|
|
||||||
0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
|
|
||||||
0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
|
|
||||||
0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
|
|
||||||
0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
|
|
||||||
1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
|
|
||||||
2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 3, 3, 3, 3, 3, 3, 3, 3, 4, 4, 4, 4, 5, 5, 5, 5
|
|
||||||
};
|
|
||||||
static const Uint32 offsets[6] =
|
|
||||||
{
|
|
||||||
0x00000000, 0x00003080, 0x000E2080, 0x03C82080, 0xFA082080, 0x82082080
|
|
||||||
};
|
|
||||||
|
|
||||||
// decode the character
|
|
||||||
int trailingBytes = trailing[static_cast<Uint8>(*begin)];
|
|
||||||
if (begin + trailingBytes < end)
|
|
||||||
{
|
|
||||||
output = 0;
|
|
||||||
switch (trailingBytes)
|
|
||||||
{
|
|
||||||
case 5: output += static_cast<Uint8>(*begin++); output <<= 6;
|
|
||||||
case 4: output += static_cast<Uint8>(*begin++); output <<= 6;
|
|
||||||
case 3: output += static_cast<Uint8>(*begin++); output <<= 6;
|
|
||||||
case 2: output += static_cast<Uint8>(*begin++); output <<= 6;
|
|
||||||
case 1: output += static_cast<Uint8>(*begin++); output <<= 6;
|
|
||||||
case 0: output += static_cast<Uint8>(*begin++);
|
|
||||||
}
|
|
||||||
output -= offsets[trailingBytes];
|
|
||||||
}
|
|
||||||
else
|
|
||||||
{
|
|
||||||
// Incomplete character
|
|
||||||
begin = end;
|
|
||||||
output = replacement;
|
|
||||||
}
|
|
||||||
|
|
||||||
return begin;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename Out>
|
|
||||||
Out Utf<8>::encode(Uint32 input, Out output, Uint8 replacement)
|
|
||||||
{
|
|
||||||
// Some useful precomputed data
|
|
||||||
static const Uint8 firstBytes[7] =
|
|
||||||
{
|
|
||||||
0x00, 0x00, 0xC0, 0xE0, 0xF0, 0xF8, 0xFC
|
|
||||||
};
|
|
||||||
|
|
||||||
// encode the character
|
|
||||||
if ((input > 0x0010FFFF) || ((input >= 0xD800) && (input <= 0xDBFF)))
|
|
||||||
{
|
|
||||||
// Invalid character
|
|
||||||
if (replacement)
|
|
||||||
*output++ = replacement;
|
|
||||||
}
|
|
||||||
else
|
|
||||||
{
|
|
||||||
// Valid character
|
|
||||||
|
|
||||||
// Get the number of bytes to write
|
|
||||||
std::size_t bytestoWrite = 1;
|
|
||||||
if (input < 0x80) bytestoWrite = 1;
|
|
||||||
else if (input < 0x800) bytestoWrite = 2;
|
|
||||||
else if (input < 0x10000) bytestoWrite = 3;
|
|
||||||
else if (input <= 0x0010FFFF) bytestoWrite = 4;
|
|
||||||
|
|
||||||
// Extract the bytes to write
|
|
||||||
Uint8 bytes[4];
|
|
||||||
switch (bytestoWrite)
|
|
||||||
{
|
|
||||||
case 4: bytes[3] = static_cast<Uint8>((input | 0x80) & 0xBF); input >>= 6;
|
|
||||||
case 3: bytes[2] = static_cast<Uint8>((input | 0x80) & 0xBF); input >>= 6;
|
|
||||||
case 2: bytes[1] = static_cast<Uint8>((input | 0x80) & 0xBF); input >>= 6;
|
|
||||||
case 1: bytes[0] = static_cast<Uint8> (input | firstBytes[bytestoWrite]);
|
|
||||||
}
|
|
||||||
|
|
||||||
// Add them to the output
|
|
||||||
output = std::copy(bytes, bytes + bytestoWrite, output);
|
|
||||||
}
|
|
||||||
|
|
||||||
return output;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In>
|
|
||||||
In Utf<8>::next(In begin, In end)
|
|
||||||
{
|
|
||||||
Uint32 codepoint;
|
|
||||||
return decode(begin, end, codepoint);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In>
|
|
||||||
std::size_t Utf<8>::count(In begin, In end)
|
|
||||||
{
|
|
||||||
std::size_t length = 0;
|
|
||||||
while (begin < end)
|
|
||||||
{
|
|
||||||
begin = next(begin, end);
|
|
||||||
++length;
|
|
||||||
}
|
|
||||||
|
|
||||||
return length;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
Out Utf<8>::fromAnsi(In begin, In end, Out output, const std::locale& locale)
|
|
||||||
{
|
|
||||||
while (begin < end)
|
|
||||||
{
|
|
||||||
Uint32 codepoint = Utf<32>::decodeAnsi(*begin++, locale);
|
|
||||||
output = encode(codepoint, output);
|
|
||||||
}
|
|
||||||
|
|
||||||
return output;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
Out Utf<8>::fromWide(In begin, In end, Out output)
|
|
||||||
{
|
|
||||||
while (begin < end)
|
|
||||||
{
|
|
||||||
Uint32 codepoint = Utf<32>::decodeWide(*begin++);
|
|
||||||
output = encode(codepoint, output);
|
|
||||||
}
|
|
||||||
|
|
||||||
return output;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
Out Utf<8>::fromLatin1(In begin, In end, Out output)
|
|
||||||
{
|
|
||||||
// Latin-1 is directly compatible with Unicode encodings,
|
|
||||||
// and can thus be treated as (a sub-range of) UTF-32
|
|
||||||
while (begin < end)
|
|
||||||
output = encode(*begin++, output);
|
|
||||||
|
|
||||||
return output;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
Out Utf<8>::toAnsi(In begin, In end, Out output, char replacement, const std::locale& locale)
|
|
||||||
{
|
|
||||||
while (begin < end)
|
|
||||||
{
|
|
||||||
Uint32 codepoint;
|
|
||||||
begin = decode(begin, end, codepoint);
|
|
||||||
output = Utf<32>::encodeAnsi(codepoint, output, replacement, locale);
|
|
||||||
}
|
|
||||||
|
|
||||||
return output;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
Out Utf<8>::toWide(In begin, In end, Out output, wchar_t replacement)
|
|
||||||
{
|
|
||||||
while (begin < end)
|
|
||||||
{
|
|
||||||
Uint32 codepoint;
|
|
||||||
begin = decode(begin, end, codepoint);
|
|
||||||
output = Utf<32>::encodeWide(codepoint, output, replacement);
|
|
||||||
}
|
|
||||||
|
|
||||||
return output;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
Out Utf<8>::toLatin1(In begin, In end, Out output, char replacement)
|
|
||||||
{
|
|
||||||
// Latin-1 is directly compatible with Unicode encodings,
|
|
||||||
// and can thus be treated as (a sub-range of) UTF-32
|
|
||||||
while (begin < end)
|
|
||||||
{
|
|
||||||
Uint32 codepoint;
|
|
||||||
begin = decode(begin, end, codepoint);
|
|
||||||
*output++ = codepoint < 256 ? static_cast<char>(codepoint) : replacement;
|
|
||||||
}
|
|
||||||
|
|
||||||
return output;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
Out Utf<8>::toUtf8(In begin, In end, Out output)
|
|
||||||
{
|
|
||||||
return std::copy(begin, end, output);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
Out Utf<8>::toUtf16(In begin, In end, Out output)
|
|
||||||
{
|
|
||||||
while (begin < end)
|
|
||||||
{
|
|
||||||
Uint32 codepoint;
|
|
||||||
begin = decode(begin, end, codepoint);
|
|
||||||
output = Utf<16>::encode(codepoint, output);
|
|
||||||
}
|
|
||||||
|
|
||||||
return output;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
Out Utf<8>::toUtf32(In begin, In end, Out output)
|
|
||||||
{
|
|
||||||
while (begin < end)
|
|
||||||
{
|
|
||||||
Uint32 codepoint;
|
|
||||||
begin = decode(begin, end, codepoint);
|
|
||||||
*output++ = codepoint;
|
|
||||||
}
|
|
||||||
|
|
||||||
return output;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In>
|
|
||||||
In Utf<16>::decode(In begin, In end, Uint32& output, Uint32 replacement)
|
|
||||||
{
|
|
||||||
Uint16 first = *begin++;
|
|
||||||
|
|
||||||
// If it's a surrogate pair, first convert to a single UTF-32 character
|
|
||||||
if ((first >= 0xD800) && (first <= 0xDBFF))
|
|
||||||
{
|
|
||||||
if (begin < end)
|
|
||||||
{
|
|
||||||
Uint32 second = *begin++;
|
|
||||||
if ((second >= 0xDC00) && (second <= 0xDFFF))
|
|
||||||
{
|
|
||||||
// The second element is valid: convert the two elements to a UTF-32 character
|
|
||||||
output = static_cast<Uint32>(((first - 0xD800) << 10) + (second - 0xDC00) + 0x0010000);
|
|
||||||
}
|
|
||||||
else
|
|
||||||
{
|
|
||||||
// Invalid character
|
|
||||||
output = replacement;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
else
|
|
||||||
{
|
|
||||||
// Invalid character
|
|
||||||
begin = end;
|
|
||||||
output = replacement;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
else
|
|
||||||
{
|
|
||||||
// We can make a direct copy
|
|
||||||
output = first;
|
|
||||||
}
|
|
||||||
|
|
||||||
return begin;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename Out>
|
|
||||||
Out Utf<16>::encode(Uint32 input, Out output, Uint16 replacement)
|
|
||||||
{
|
|
||||||
if (input <= 0xFFFF)
|
|
||||||
{
|
|
||||||
// The character can be copied directly, we just need to check if it's in the valid range
|
|
||||||
if ((input >= 0xD800) && (input <= 0xDFFF))
|
|
||||||
{
|
|
||||||
// Invalid character (this range is reserved)
|
|
||||||
if (replacement)
|
|
||||||
*output++ = replacement;
|
|
||||||
}
|
|
||||||
else
|
|
||||||
{
|
|
||||||
// Valid character directly convertible to a single UTF-16 character
|
|
||||||
*output++ = static_cast<Uint16>(input);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
else if (input > 0x0010FFFF)
|
|
||||||
{
|
|
||||||
// Invalid character (greater than the maximum Unicode value)
|
|
||||||
if (replacement)
|
|
||||||
*output++ = replacement;
|
|
||||||
}
|
|
||||||
else
|
|
||||||
{
|
|
||||||
// The input character will be converted to two UTF-16 elements
|
|
||||||
input -= 0x0010000;
|
|
||||||
*output++ = static_cast<Uint16>((input >> 10) + 0xD800);
|
|
||||||
*output++ = static_cast<Uint16>((input & 0x3FFUL) + 0xDC00);
|
|
||||||
}
|
|
||||||
|
|
||||||
return output;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In>
|
|
||||||
In Utf<16>::next(In begin, In end)
|
|
||||||
{
|
|
||||||
Uint32 codepoint;
|
|
||||||
return decode(begin, end, codepoint);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In>
|
|
||||||
std::size_t Utf<16>::count(In begin, In end)
|
|
||||||
{
|
|
||||||
std::size_t length = 0;
|
|
||||||
while (begin < end)
|
|
||||||
{
|
|
||||||
begin = next(begin, end);
|
|
||||||
++length;
|
|
||||||
}
|
|
||||||
|
|
||||||
return length;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
Out Utf<16>::fromAnsi(In begin, In end, Out output, const std::locale& locale)
|
|
||||||
{
|
|
||||||
while (begin < end)
|
|
||||||
{
|
|
||||||
Uint32 codepoint = Utf<32>::decodeAnsi(*begin++, locale);
|
|
||||||
output = encode(codepoint, output);
|
|
||||||
}
|
|
||||||
|
|
||||||
return output;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
Out Utf<16>::fromWide(In begin, In end, Out output)
|
|
||||||
{
|
|
||||||
while (begin < end)
|
|
||||||
{
|
|
||||||
Uint32 codepoint = Utf<32>::decodeWide(*begin++);
|
|
||||||
output = encode(codepoint, output);
|
|
||||||
}
|
|
||||||
|
|
||||||
return output;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
Out Utf<16>::fromLatin1(In begin, In end, Out output)
|
|
||||||
{
|
|
||||||
// Latin-1 is directly compatible with Unicode encodings,
|
|
||||||
// and can thus be treated as (a sub-range of) UTF-32
|
|
||||||
return std::copy(begin, end, output);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
Out Utf<16>::toAnsi(In begin, In end, Out output, char replacement, const std::locale& locale)
|
|
||||||
{
|
|
||||||
while (begin < end)
|
|
||||||
{
|
|
||||||
Uint32 codepoint;
|
|
||||||
begin = decode(begin, end, codepoint);
|
|
||||||
output = Utf<32>::encodeAnsi(codepoint, output, replacement, locale);
|
|
||||||
}
|
|
||||||
|
|
||||||
return output;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
Out Utf<16>::toWide(In begin, In end, Out output, wchar_t replacement)
|
|
||||||
{
|
|
||||||
while (begin < end)
|
|
||||||
{
|
|
||||||
Uint32 codepoint;
|
|
||||||
begin = decode(begin, end, codepoint);
|
|
||||||
output = Utf<32>::encodeWide(codepoint, output, replacement);
|
|
||||||
}
|
|
||||||
|
|
||||||
return output;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
Out Utf<16>::toLatin1(In begin, In end, Out output, char replacement)
|
|
||||||
{
|
|
||||||
// Latin-1 is directly compatible with Unicode encodings,
|
|
||||||
// and can thus be treated as (a sub-range of) UTF-32
|
|
||||||
while (begin < end)
|
|
||||||
{
|
|
||||||
*output++ = *begin < 256 ? static_cast<char>(*begin) : replacement;
|
|
||||||
begin++;
|
|
||||||
}
|
|
||||||
|
|
||||||
return output;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
Out Utf<16>::toUtf8(In begin, In end, Out output)
|
|
||||||
{
|
|
||||||
while (begin < end)
|
|
||||||
{
|
|
||||||
Uint32 codepoint;
|
|
||||||
begin = decode(begin, end, codepoint);
|
|
||||||
output = Utf<8>::encode(codepoint, output);
|
|
||||||
}
|
|
||||||
|
|
||||||
return output;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
Out Utf<16>::toUtf16(In begin, In end, Out output)
|
|
||||||
{
|
|
||||||
return std::copy(begin, end, output);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
Out Utf<16>::toUtf32(In begin, In end, Out output)
|
|
||||||
{
|
|
||||||
while (begin < end)
|
|
||||||
{
|
|
||||||
Uint32 codepoint;
|
|
||||||
begin = decode(begin, end, codepoint);
|
|
||||||
*output++ = codepoint;
|
|
||||||
}
|
|
||||||
|
|
||||||
return output;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In>
|
|
||||||
In Utf<32>::decode(In begin, In /*end*/, Uint32& output, Uint32 /*replacement*/)
|
|
||||||
{
|
|
||||||
output = *begin++;
|
|
||||||
return begin;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename Out>
|
|
||||||
Out Utf<32>::encode(Uint32 input, Out output, Uint32 /*replacement*/)
|
|
||||||
{
|
|
||||||
*output++ = input;
|
|
||||||
return output;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In>
|
|
||||||
In Utf<32>::next(In begin, In /*end*/)
|
|
||||||
{
|
|
||||||
return ++begin;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In>
|
|
||||||
std::size_t Utf<32>::count(In begin, In end)
|
|
||||||
{
|
|
||||||
return begin - end;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
Out Utf<32>::fromAnsi(In begin, In end, Out output, const std::locale& locale)
|
|
||||||
{
|
|
||||||
while (begin < end)
|
|
||||||
*output++ = decodeAnsi(*begin++, locale);
|
|
||||||
|
|
||||||
return output;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
Out Utf<32>::fromWide(In begin, In end, Out output)
|
|
||||||
{
|
|
||||||
while (begin < end)
|
|
||||||
*output++ = decodeWide(*begin++);
|
|
||||||
|
|
||||||
return output;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
Out Utf<32>::fromLatin1(In begin, In end, Out output)
|
|
||||||
{
|
|
||||||
// Latin-1 is directly compatible with Unicode encodings,
|
|
||||||
// and can thus be treated as (a sub-range of) UTF-32
|
|
||||||
return std::copy(begin, end, output);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
Out Utf<32>::toAnsi(In begin, In end, Out output, char replacement, const std::locale& locale)
|
|
||||||
{
|
|
||||||
while (begin < end)
|
|
||||||
output = encodeAnsi(*begin++, output, replacement, locale);
|
|
||||||
|
|
||||||
return output;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
Out Utf<32>::toWide(In begin, In end, Out output, wchar_t replacement)
|
|
||||||
{
|
|
||||||
while (begin < end)
|
|
||||||
output = encodeWide(*begin++, output, replacement);
|
|
||||||
|
|
||||||
return output;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
Out Utf<32>::toLatin1(In begin, In end, Out output, char replacement)
|
|
||||||
{
|
|
||||||
// Latin-1 is directly compatible with Unicode encodings,
|
|
||||||
// and can thus be treated as (a sub-range of) UTF-32
|
|
||||||
while (begin < end)
|
|
||||||
{
|
|
||||||
*output++ = *begin < 256 ? static_cast<char>(*begin) : replacement;
|
|
||||||
begin++;
|
|
||||||
}
|
|
||||||
|
|
||||||
return output;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
Out Utf<32>::toUtf8(In begin, In end, Out output)
|
|
||||||
{
|
|
||||||
while (begin < end)
|
|
||||||
output = Utf<8>::encode(*begin++, output);
|
|
||||||
|
|
||||||
return output;
|
|
||||||
}
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
Out Utf<32>::toUtf16(In begin, In end, Out output)
|
|
||||||
{
|
|
||||||
while (begin < end)
|
|
||||||
output = Utf<16>::encode(*begin++, output);
|
|
||||||
|
|
||||||
return output;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In, typename Out>
|
|
||||||
Out Utf<32>::toUtf32(In begin, In end, Out output)
|
|
||||||
{
|
|
||||||
return std::copy(begin, end, output);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In>
|
|
||||||
Uint32 Utf<32>::decodeAnsi(In input, const std::locale& locale)
|
|
||||||
{
|
|
||||||
// On Windows, GCC's standard library (glibc++) has almost
|
|
||||||
// no support for Unicode stuff. As a consequence, in this
|
|
||||||
// context we can only use the default locale and ignore
|
|
||||||
// the one passed as parameter.
|
|
||||||
|
|
||||||
#if defined(SFML_SYSTEM_WINDOWS) && /* if Windows ... */ \
|
|
||||||
(defined(__GLIBCPP__) || defined (__GLIBCXX__)) && /* ... and standard library is glibc++ ... */ \
|
|
||||||
!(defined(__SGI_STL_PORT) || defined(_STLPORT_VERSION)) /* ... and STLPort is not used on top of it */
|
|
||||||
|
|
||||||
(void)locale; // to avoid warnings
|
|
||||||
|
|
||||||
wchar_t character = 0;
|
|
||||||
mbtowc(&character, &input, 1);
|
|
||||||
return static_cast<Uint32>(character);
|
|
||||||
|
|
||||||
#else
|
|
||||||
|
|
||||||
// Get the facet of the locale which deals with character conversion
|
|
||||||
const std::ctype<wchar_t>& facet = std::use_facet< std::ctype<wchar_t> >(locale);
|
|
||||||
|
|
||||||
// Use the facet to convert each character of the input string
|
|
||||||
return static_cast<Uint32>(facet.widen(input));
|
|
||||||
|
|
||||||
#endif
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename In>
|
|
||||||
Uint32 Utf<32>::decodeWide(In input)
|
|
||||||
{
|
|
||||||
// The encoding of wide characters is not well defined and is left to the system;
|
|
||||||
// however we can safely assume that it is UCS-2 on Windows and
|
|
||||||
// UCS-4 on Unix systems.
|
|
||||||
// In both cases, a simple copy is enough (UCS-2 is a subset of UCS-4,
|
|
||||||
// and UCS-4 *is* UTF-32).
|
|
||||||
|
|
||||||
return input;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename Out>
|
|
||||||
Out Utf<32>::encodeAnsi(Uint32 codepoint, Out output, char replacement, const std::locale& locale)
|
|
||||||
{
|
|
||||||
// On Windows, gcc's standard library (glibc++) has almost
|
|
||||||
// no support for Unicode stuff. As a consequence, in this
|
|
||||||
// context we can only use the default locale and ignore
|
|
||||||
// the one passed as parameter.
|
|
||||||
|
|
||||||
#if defined(SFML_SYSTEM_WINDOWS) && /* if Windows ... */ \
|
|
||||||
(defined(__GLIBCPP__) || defined (__GLIBCXX__)) && /* ... and standard library is glibc++ ... */ \
|
|
||||||
!(defined(__SGI_STL_PORT) || defined(_STLPORT_VERSION)) /* ... and STLPort is not used on top of it */
|
|
||||||
|
|
||||||
(void)locale; // to avoid warnings
|
|
||||||
|
|
||||||
char character = 0;
|
|
||||||
if (wctomb(&character, static_cast<wchar_t>(codepoint)) >= 0)
|
|
||||||
*output++ = character;
|
|
||||||
else if (replacement)
|
|
||||||
*output++ = replacement;
|
|
||||||
|
|
||||||
return output;
|
|
||||||
|
|
||||||
#else
|
|
||||||
|
|
||||||
// Get the facet of the locale which deals with character conversion
|
|
||||||
const std::ctype<wchar_t>& facet = std::use_facet< std::ctype<wchar_t> >(locale);
|
|
||||||
|
|
||||||
// Use the facet to convert each character of the input string
|
|
||||||
*output++ = facet.narrow(static_cast<wchar_t>(codepoint), replacement);
|
|
||||||
|
|
||||||
return output;
|
|
||||||
|
|
||||||
#endif
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
template <typename Out>
|
|
||||||
Out Utf<32>::encodeWide(Uint32 codepoint, Out output, wchar_t replacement)
|
|
||||||
{
|
|
||||||
// The encoding of wide characters is not well defined and is left to the system;
|
|
||||||
// however we can safely assume that it is UCS-2 on Windows and
|
|
||||||
// UCS-4 on Unix systems.
|
|
||||||
// For UCS-2 we need to check if the source characters fits in (UCS-2 is a subset of UCS-4).
|
|
||||||
// For UCS-4 we can do a direct copy (UCS-4 *is* UTF-32).
|
|
||||||
|
|
||||||
switch (sizeof(wchar_t))
|
|
||||||
{
|
|
||||||
case 4:
|
|
||||||
{
|
|
||||||
*output++ = static_cast<wchar_t>(codepoint);
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
|
|
||||||
default:
|
|
||||||
{
|
|
||||||
if ((codepoint <= 0xFFFF) && ((codepoint < 0xD800) || (codepoint > 0xDFFF)))
|
|
||||||
{
|
|
||||||
*output++ = static_cast<wchar_t>(codepoint);
|
|
||||||
}
|
|
||||||
else if (replacement)
|
|
||||||
{
|
|
||||||
*output++ = replacement;
|
|
||||||
}
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
return output;
|
|
||||||
}
|
|
415
Externals/SFML/src/SFML/Network/Http.cpp
vendored
415
Externals/SFML/src/SFML/Network/Http.cpp
vendored
|
@ -1,415 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Headers
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#include <SFML/Network/Http.hpp>
|
|
||||||
#include <SFML/System/Err.hpp>
|
|
||||||
#include <cctype>
|
|
||||||
#include <algorithm>
|
|
||||||
#include <iterator>
|
|
||||||
#include <sstream>
|
|
||||||
#include <limits>
|
|
||||||
|
|
||||||
|
|
||||||
namespace
|
|
||||||
{
|
|
||||||
// Convert a string to lower case
|
|
||||||
std::string toLower(std::string str)
|
|
||||||
{
|
|
||||||
for (std::string::iterator i = str.begin(); i != str.end(); ++i)
|
|
||||||
*i = static_cast<char>(std::tolower(*i));
|
|
||||||
return str;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
namespace sf
|
|
||||||
{
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Http::Request::Request(const std::string& uri, Method method, const std::string& body)
|
|
||||||
{
|
|
||||||
setMethod(method);
|
|
||||||
setUri(uri);
|
|
||||||
setHttpVersion(1, 0);
|
|
||||||
setBody(body);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void Http::Request::setField(const std::string& field, const std::string& value)
|
|
||||||
{
|
|
||||||
m_fields[toLower(field)] = value;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void Http::Request::setMethod(Http::Request::Method method)
|
|
||||||
{
|
|
||||||
m_method = method;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void Http::Request::setUri(const std::string& uri)
|
|
||||||
{
|
|
||||||
m_uri = uri;
|
|
||||||
|
|
||||||
// Make sure it starts with a '/'
|
|
||||||
if (m_uri.empty() || (m_uri[0] != '/'))
|
|
||||||
m_uri.insert(0, "/");
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void Http::Request::setHttpVersion(unsigned int major, unsigned int minor)
|
|
||||||
{
|
|
||||||
m_majorVersion = major;
|
|
||||||
m_minorVersion = minor;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void Http::Request::setBody(const std::string& body)
|
|
||||||
{
|
|
||||||
m_body = body;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
std::string Http::Request::prepare() const
|
|
||||||
{
|
|
||||||
std::ostringstream out;
|
|
||||||
|
|
||||||
// Convert the method to its string representation
|
|
||||||
std::string method;
|
|
||||||
switch (m_method)
|
|
||||||
{
|
|
||||||
case Get: method = "GET"; break;
|
|
||||||
case Post: method = "POST"; break;
|
|
||||||
case Head: method = "HEAD"; break;
|
|
||||||
case Put: method = "PUT"; break;
|
|
||||||
case Delete: method = "DELETE"; break;
|
|
||||||
}
|
|
||||||
|
|
||||||
// Write the first line containing the request type
|
|
||||||
out << method << " " << m_uri << " ";
|
|
||||||
out << "HTTP/" << m_majorVersion << "." << m_minorVersion << "\r\n";
|
|
||||||
|
|
||||||
// Write fields
|
|
||||||
for (FieldTable::const_iterator i = m_fields.begin(); i != m_fields.end(); ++i)
|
|
||||||
{
|
|
||||||
out << i->first << ": " << i->second << "\r\n";
|
|
||||||
}
|
|
||||||
|
|
||||||
// Use an extra \r\n to separate the header from the body
|
|
||||||
out << "\r\n";
|
|
||||||
|
|
||||||
// Add the body
|
|
||||||
out << m_body;
|
|
||||||
|
|
||||||
return out.str();
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
bool Http::Request::hasField(const std::string& field) const
|
|
||||||
{
|
|
||||||
return m_fields.find(toLower(field)) != m_fields.end();
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Http::Response::Response() :
|
|
||||||
m_status (ConnectionFailed),
|
|
||||||
m_majorVersion(0),
|
|
||||||
m_minorVersion(0)
|
|
||||||
{
|
|
||||||
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
const std::string& Http::Response::getField(const std::string& field) const
|
|
||||||
{
|
|
||||||
FieldTable::const_iterator it = m_fields.find(toLower(field));
|
|
||||||
if (it != m_fields.end())
|
|
||||||
{
|
|
||||||
return it->second;
|
|
||||||
}
|
|
||||||
else
|
|
||||||
{
|
|
||||||
static const std::string empty = "";
|
|
||||||
return empty;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Http::Response::Status Http::Response::getStatus() const
|
|
||||||
{
|
|
||||||
return m_status;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
unsigned int Http::Response::getMajorHttpVersion() const
|
|
||||||
{
|
|
||||||
return m_majorVersion;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
unsigned int Http::Response::getMinorHttpVersion() const
|
|
||||||
{
|
|
||||||
return m_minorVersion;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
const std::string& Http::Response::getBody() const
|
|
||||||
{
|
|
||||||
return m_body;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void Http::Response::parse(const std::string& data)
|
|
||||||
{
|
|
||||||
std::istringstream in(data);
|
|
||||||
|
|
||||||
// Extract the HTTP version from the first line
|
|
||||||
std::string version;
|
|
||||||
if (in >> version)
|
|
||||||
{
|
|
||||||
if ((version.size() >= 8) && (version[6] == '.') &&
|
|
||||||
(toLower(version.substr(0, 5)) == "http/") &&
|
|
||||||
isdigit(version[5]) && isdigit(version[7]))
|
|
||||||
{
|
|
||||||
m_majorVersion = version[5] - '0';
|
|
||||||
m_minorVersion = version[7] - '0';
|
|
||||||
}
|
|
||||||
else
|
|
||||||
{
|
|
||||||
// Invalid HTTP version
|
|
||||||
m_status = InvalidResponse;
|
|
||||||
return;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
// Extract the status code from the first line
|
|
||||||
int status;
|
|
||||||
if (in >> status)
|
|
||||||
{
|
|
||||||
m_status = static_cast<Status>(status);
|
|
||||||
}
|
|
||||||
else
|
|
||||||
{
|
|
||||||
// Invalid status code
|
|
||||||
m_status = InvalidResponse;
|
|
||||||
return;
|
|
||||||
}
|
|
||||||
|
|
||||||
// Ignore the end of the first line
|
|
||||||
in.ignore(std::numeric_limits<std::streamsize>::max(), '\n');
|
|
||||||
|
|
||||||
// Parse the other lines, which contain fields, one by one
|
|
||||||
parseFields(in);
|
|
||||||
|
|
||||||
m_body.clear();
|
|
||||||
|
|
||||||
// Determine whether the transfer is chunked
|
|
||||||
if (toLower(getField("transfer-encoding")) != "chunked")
|
|
||||||
{
|
|
||||||
// Not chunked - just read everything at once
|
|
||||||
std::copy(std::istreambuf_iterator<char>(in), std::istreambuf_iterator<char>(), std::back_inserter(m_body));
|
|
||||||
}
|
|
||||||
else
|
|
||||||
{
|
|
||||||
// Chunked - have to read chunk by chunk
|
|
||||||
std::size_t length;
|
|
||||||
|
|
||||||
// Read all chunks, identified by a chunk-size not being 0
|
|
||||||
while (in >> std::hex >> length)
|
|
||||||
{
|
|
||||||
// Drop the rest of the line (chunk-extension)
|
|
||||||
in.ignore(std::numeric_limits<std::streamsize>::max(), '\n');
|
|
||||||
|
|
||||||
// Copy the actual content data
|
|
||||||
std::istreambuf_iterator<char> it(in);
|
|
||||||
std::istreambuf_iterator<char> itEnd;
|
|
||||||
for (std::size_t i = 0; ((i < length) && (it != itEnd)); i++)
|
|
||||||
m_body.push_back(*it++);
|
|
||||||
}
|
|
||||||
|
|
||||||
// Drop the rest of the line (chunk-extension)
|
|
||||||
in.ignore(std::numeric_limits<std::streamsize>::max(), '\n');
|
|
||||||
|
|
||||||
// Read all trailers (if present)
|
|
||||||
parseFields(in);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void Http::Response::parseFields(std::istream &in)
|
|
||||||
{
|
|
||||||
std::string line;
|
|
||||||
while (std::getline(in, line) && (line.size() > 2))
|
|
||||||
{
|
|
||||||
std::string::size_type pos = line.find(": ");
|
|
||||||
if (pos != std::string::npos)
|
|
||||||
{
|
|
||||||
// Extract the field name and its value
|
|
||||||
std::string field = line.substr(0, pos);
|
|
||||||
std::string value = line.substr(pos + 2);
|
|
||||||
|
|
||||||
// Remove any trailing \r
|
|
||||||
if (!value.empty() && (*value.rbegin() == '\r'))
|
|
||||||
value.erase(value.size() - 1);
|
|
||||||
|
|
||||||
// Add the field
|
|
||||||
m_fields[toLower(field)] = value;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Http::Http() :
|
|
||||||
m_host(),
|
|
||||||
m_port(0)
|
|
||||||
{
|
|
||||||
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Http::Http(const std::string& host, unsigned short port)
|
|
||||||
{
|
|
||||||
setHost(host, port);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void Http::setHost(const std::string& host, unsigned short port)
|
|
||||||
{
|
|
||||||
// Check the protocol
|
|
||||||
if (toLower(host.substr(0, 7)) == "http://")
|
|
||||||
{
|
|
||||||
// HTTP protocol
|
|
||||||
m_hostName = host.substr(7);
|
|
||||||
m_port = (port != 0 ? port : 80);
|
|
||||||
}
|
|
||||||
else if (toLower(host.substr(0, 8)) == "https://")
|
|
||||||
{
|
|
||||||
// HTTPS protocol -- unsupported (requires encryption and certificates and stuff...)
|
|
||||||
err() << "HTTPS protocol is not supported by sf::Http" << std::endl;
|
|
||||||
m_hostName = "";
|
|
||||||
m_port = 0;
|
|
||||||
}
|
|
||||||
else
|
|
||||||
{
|
|
||||||
// Undefined protocol - use HTTP
|
|
||||||
m_hostName = host;
|
|
||||||
m_port = (port != 0 ? port : 80);
|
|
||||||
}
|
|
||||||
|
|
||||||
// Remove any trailing '/' from the host name
|
|
||||||
if (!m_hostName.empty() && (*m_hostName.rbegin() == '/'))
|
|
||||||
m_hostName.erase(m_hostName.size() - 1);
|
|
||||||
|
|
||||||
m_host = IpAddress(m_hostName);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Http::Response Http::sendRequest(const Http::Request& request, Time timeout)
|
|
||||||
{
|
|
||||||
// First make sure that the request is valid -- add missing mandatory fields
|
|
||||||
Request toSend(request);
|
|
||||||
if (!toSend.hasField("From"))
|
|
||||||
{
|
|
||||||
toSend.setField("From", "user@sfml-dev.org");
|
|
||||||
}
|
|
||||||
if (!toSend.hasField("User-Agent"))
|
|
||||||
{
|
|
||||||
toSend.setField("User-Agent", "libsfml-network/2.x");
|
|
||||||
}
|
|
||||||
if (!toSend.hasField("Host"))
|
|
||||||
{
|
|
||||||
toSend.setField("Host", m_hostName);
|
|
||||||
}
|
|
||||||
if (!toSend.hasField("Content-Length"))
|
|
||||||
{
|
|
||||||
std::ostringstream out;
|
|
||||||
out << toSend.m_body.size();
|
|
||||||
toSend.setField("Content-Length", out.str());
|
|
||||||
}
|
|
||||||
if ((toSend.m_method == Request::Post) && !toSend.hasField("Content-Type"))
|
|
||||||
{
|
|
||||||
toSend.setField("Content-Type", "application/x-www-form-urlencoded");
|
|
||||||
}
|
|
||||||
if ((toSend.m_majorVersion * 10 + toSend.m_minorVersion >= 11) && !toSend.hasField("Connection"))
|
|
||||||
{
|
|
||||||
toSend.setField("Connection", "close");
|
|
||||||
}
|
|
||||||
|
|
||||||
// Prepare the response
|
|
||||||
Response received;
|
|
||||||
|
|
||||||
// Connect the socket to the host
|
|
||||||
if (m_connection.connect(m_host, m_port, timeout) == Socket::Done)
|
|
||||||
{
|
|
||||||
// Convert the request to string and send it through the connected socket
|
|
||||||
std::string requestStr = toSend.prepare();
|
|
||||||
|
|
||||||
if (!requestStr.empty())
|
|
||||||
{
|
|
||||||
// Send it through the socket
|
|
||||||
if (m_connection.send(requestStr.c_str(), requestStr.size()) == Socket::Done)
|
|
||||||
{
|
|
||||||
// Wait for the server's response
|
|
||||||
std::string receivedStr;
|
|
||||||
std::size_t size = 0;
|
|
||||||
char buffer[1024];
|
|
||||||
while (m_connection.receive(buffer, sizeof(buffer), size) == Socket::Done)
|
|
||||||
{
|
|
||||||
receivedStr.append(buffer, buffer + size);
|
|
||||||
}
|
|
||||||
|
|
||||||
// Build the Response object from the received data
|
|
||||||
received.parse(receivedStr);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
// Close the connection
|
|
||||||
m_connection.disconnect();
|
|
||||||
}
|
|
||||||
|
|
||||||
return received;
|
|
||||||
}
|
|
||||||
|
|
||||||
} // namespace sf
|
|
271
Externals/SFML/src/SFML/Network/IPAddress.cpp
vendored
271
Externals/SFML/src/SFML/Network/IPAddress.cpp
vendored
|
@ -1,271 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Headers
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#include <SFML/Network/IPAddress.hpp>
|
|
||||||
#include <SFML/Network/Http.hpp>
|
|
||||||
#include <SFML/Network/SocketImpl.hpp>
|
|
||||||
#include <cstring>
|
|
||||||
#include <utility>
|
|
||||||
|
|
||||||
|
|
||||||
namespace sf
|
|
||||||
{
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
const IpAddress IpAddress::None;
|
|
||||||
const IpAddress IpAddress::Any(0, 0, 0, 0);
|
|
||||||
const IpAddress IpAddress::LocalHost(127, 0, 0, 1);
|
|
||||||
const IpAddress IpAddress::Broadcast(255, 255, 255, 255);
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
IpAddress::IpAddress() :
|
|
||||||
m_address(0),
|
|
||||||
m_valid (false)
|
|
||||||
{
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
IpAddress::IpAddress(const std::string& address) :
|
|
||||||
m_address(0),
|
|
||||||
m_valid (false)
|
|
||||||
{
|
|
||||||
resolve(address);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
IpAddress::IpAddress(const char* address) :
|
|
||||||
m_address(0),
|
|
||||||
m_valid (false)
|
|
||||||
{
|
|
||||||
resolve(address);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
IpAddress::IpAddress(Uint8 byte0, Uint8 byte1, Uint8 byte2, Uint8 byte3) :
|
|
||||||
m_address(htonl((byte0 << 24) | (byte1 << 16) | (byte2 << 8) | byte3)),
|
|
||||||
m_valid (true)
|
|
||||||
{
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
IpAddress::IpAddress(Uint32 address) :
|
|
||||||
m_address(htonl(address)),
|
|
||||||
m_valid (true)
|
|
||||||
{
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
std::string IpAddress::toString() const
|
|
||||||
{
|
|
||||||
in_addr address;
|
|
||||||
address.s_addr = m_address;
|
|
||||||
|
|
||||||
return inet_ntoa(address);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Uint32 IpAddress::toInteger() const
|
|
||||||
{
|
|
||||||
return ntohl(m_address);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
IpAddress IpAddress::getLocalAddress()
|
|
||||||
{
|
|
||||||
// The method here is to connect a UDP socket to anyone (here to localhost),
|
|
||||||
// and get the local socket address with the getsockname function.
|
|
||||||
// UDP connection will not send anything to the network, so this function won't cause any overhead.
|
|
||||||
|
|
||||||
IpAddress localAddress;
|
|
||||||
|
|
||||||
// Create the socket
|
|
||||||
SocketHandle sock = socket(PF_INET, SOCK_DGRAM, 0);
|
|
||||||
if (sock == priv::SocketImpl::invalidSocket())
|
|
||||||
return localAddress;
|
|
||||||
|
|
||||||
// Connect the socket to localhost on any port
|
|
||||||
sockaddr_in address = priv::SocketImpl::createAddress(ntohl(INADDR_LOOPBACK), 9);
|
|
||||||
if (connect(sock, reinterpret_cast<sockaddr*>(&address), sizeof(address)) == -1)
|
|
||||||
{
|
|
||||||
priv::SocketImpl::close(sock);
|
|
||||||
return localAddress;
|
|
||||||
}
|
|
||||||
|
|
||||||
// Get the local address of the socket connection
|
|
||||||
priv::SocketImpl::AddrLength size = sizeof(address);
|
|
||||||
if (getsockname(sock, reinterpret_cast<sockaddr*>(&address), &size) == -1)
|
|
||||||
{
|
|
||||||
priv::SocketImpl::close(sock);
|
|
||||||
return localAddress;
|
|
||||||
}
|
|
||||||
|
|
||||||
// Close the socket
|
|
||||||
priv::SocketImpl::close(sock);
|
|
||||||
|
|
||||||
// Finally build the IP address
|
|
||||||
localAddress = IpAddress(ntohl(address.sin_addr.s_addr));
|
|
||||||
|
|
||||||
return localAddress;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
IpAddress IpAddress::getPublicAddress(Time timeout)
|
|
||||||
{
|
|
||||||
// The trick here is more complicated, because the only way
|
|
||||||
// to get our public IP address is to get it from a distant computer.
|
|
||||||
// Here we get the web page from http://www.sfml-dev.org/ip-provider.php
|
|
||||||
// and parse the result to extract our IP address
|
|
||||||
// (not very hard: the web page contains only our IP address).
|
|
||||||
|
|
||||||
Http server("www.sfml-dev.org");
|
|
||||||
Http::Request request("/ip-provider.php", Http::Request::Get);
|
|
||||||
Http::Response page = server.sendRequest(request, timeout);
|
|
||||||
if (page.getStatus() == Http::Response::Ok)
|
|
||||||
return IpAddress(page.getBody());
|
|
||||||
|
|
||||||
// Something failed: return an invalid address
|
|
||||||
return IpAddress();
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void IpAddress::resolve(const std::string& address)
|
|
||||||
{
|
|
||||||
m_address = 0;
|
|
||||||
m_valid = false;
|
|
||||||
|
|
||||||
if (address == "255.255.255.255")
|
|
||||||
{
|
|
||||||
// The broadcast address needs to be handled explicitly,
|
|
||||||
// because it is also the value returned by inet_addr on error
|
|
||||||
m_address = INADDR_BROADCAST;
|
|
||||||
m_valid = true;
|
|
||||||
}
|
|
||||||
else if (address == "0.0.0.0")
|
|
||||||
{
|
|
||||||
m_address = INADDR_ANY;
|
|
||||||
m_valid = true;
|
|
||||||
}
|
|
||||||
else
|
|
||||||
{
|
|
||||||
// Try to convert the address as a byte representation ("xxx.xxx.xxx.xxx")
|
|
||||||
Uint32 ip = inet_addr(address.c_str());
|
|
||||||
if (ip != INADDR_NONE)
|
|
||||||
{
|
|
||||||
m_address = ip;
|
|
||||||
m_valid = true;
|
|
||||||
}
|
|
||||||
else
|
|
||||||
{
|
|
||||||
// Not a valid address, try to convert it as a host name
|
|
||||||
addrinfo hints;
|
|
||||||
std::memset(&hints, 0, sizeof(hints));
|
|
||||||
hints.ai_family = AF_INET;
|
|
||||||
addrinfo* result = NULL;
|
|
||||||
if (getaddrinfo(address.c_str(), NULL, &hints, &result) == 0)
|
|
||||||
{
|
|
||||||
if (result)
|
|
||||||
{
|
|
||||||
ip = reinterpret_cast<sockaddr_in*>(result->ai_addr)->sin_addr.s_addr;
|
|
||||||
freeaddrinfo(result);
|
|
||||||
m_address = ip;
|
|
||||||
m_valid = true;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
bool operator ==(const IpAddress& left, const IpAddress& right)
|
|
||||||
{
|
|
||||||
return !(left < right) && !(right < left);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
bool operator !=(const IpAddress& left, const IpAddress& right)
|
|
||||||
{
|
|
||||||
return !(left == right);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
bool operator <(const IpAddress& left, const IpAddress& right)
|
|
||||||
{
|
|
||||||
return std::make_pair(left.m_valid, left.m_address) < std::make_pair(right.m_valid, right.m_address);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
bool operator >(const IpAddress& left, const IpAddress& right)
|
|
||||||
{
|
|
||||||
return right < left;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
bool operator <=(const IpAddress& left, const IpAddress& right)
|
|
||||||
{
|
|
||||||
return !(right < left);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
bool operator >=(const IpAddress& left, const IpAddress& right)
|
|
||||||
{
|
|
||||||
return !(left < right);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
std::istream& operator >>(std::istream& stream, IpAddress& address)
|
|
||||||
{
|
|
||||||
std::string str;
|
|
||||||
stream >> str;
|
|
||||||
address = IpAddress(str);
|
|
||||||
|
|
||||||
return stream;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
std::ostream& operator <<(std::ostream& stream, const IpAddress& address)
|
|
||||||
{
|
|
||||||
return stream << address.toString();
|
|
||||||
}
|
|
||||||
|
|
||||||
} // namespace sf
|
|
596
Externals/SFML/src/SFML/Network/Packet.cpp
vendored
596
Externals/SFML/src/SFML/Network/Packet.cpp
vendored
|
@ -1,596 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Headers
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#include <SFML/Network/Packet.hpp>
|
|
||||||
#include <SFML/Network/SocketImpl.hpp>
|
|
||||||
#include <SFML/System/String.hpp>
|
|
||||||
#include <cstring>
|
|
||||||
#include <cwchar>
|
|
||||||
|
|
||||||
|
|
||||||
namespace sf
|
|
||||||
{
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet::Packet() :
|
|
||||||
m_readPos(0),
|
|
||||||
m_sendPos(0),
|
|
||||||
m_isValid(true)
|
|
||||||
{
|
|
||||||
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet::~Packet()
|
|
||||||
{
|
|
||||||
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void Packet::append(const void* data, std::size_t sizeInBytes)
|
|
||||||
{
|
|
||||||
if (data && (sizeInBytes > 0))
|
|
||||||
{
|
|
||||||
std::size_t start = m_data.size();
|
|
||||||
m_data.resize(start + sizeInBytes);
|
|
||||||
std::memcpy(&m_data[start], data, sizeInBytes);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void Packet::clear()
|
|
||||||
{
|
|
||||||
m_data.clear();
|
|
||||||
m_readPos = 0;
|
|
||||||
m_isValid = true;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
const void* Packet::getData() const
|
|
||||||
{
|
|
||||||
return !m_data.empty() ? &m_data[0] : NULL;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
std::size_t Packet::getDataSize() const
|
|
||||||
{
|
|
||||||
return m_data.size();
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
bool Packet::endOfPacket() const
|
|
||||||
{
|
|
||||||
return m_readPos >= m_data.size();
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet::operator BoolType() const
|
|
||||||
{
|
|
||||||
return m_isValid ? &Packet::checkSize : NULL;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& Packet::operator >>(bool& data)
|
|
||||||
{
|
|
||||||
Uint8 value;
|
|
||||||
if (*this >> value)
|
|
||||||
data = (value != 0);
|
|
||||||
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& Packet::operator >>(Int8& data)
|
|
||||||
{
|
|
||||||
if (checkSize(sizeof(data)))
|
|
||||||
{
|
|
||||||
data = *reinterpret_cast<const Int8*>(&m_data[m_readPos]);
|
|
||||||
m_readPos += sizeof(data);
|
|
||||||
}
|
|
||||||
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& Packet::operator >>(Uint8& data)
|
|
||||||
{
|
|
||||||
if (checkSize(sizeof(data)))
|
|
||||||
{
|
|
||||||
data = *reinterpret_cast<const Uint8*>(&m_data[m_readPos]);
|
|
||||||
m_readPos += sizeof(data);
|
|
||||||
}
|
|
||||||
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& Packet::operator >>(Int16& data)
|
|
||||||
{
|
|
||||||
if (checkSize(sizeof(data)))
|
|
||||||
{
|
|
||||||
data = ntohs(*reinterpret_cast<const Int16*>(&m_data[m_readPos]));
|
|
||||||
m_readPos += sizeof(data);
|
|
||||||
}
|
|
||||||
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& Packet::operator >>(Uint16& data)
|
|
||||||
{
|
|
||||||
if (checkSize(sizeof(data)))
|
|
||||||
{
|
|
||||||
data = ntohs(*reinterpret_cast<const Uint16*>(&m_data[m_readPos]));
|
|
||||||
m_readPos += sizeof(data);
|
|
||||||
}
|
|
||||||
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& Packet::operator >>(Int32& data)
|
|
||||||
{
|
|
||||||
if (checkSize(sizeof(data)))
|
|
||||||
{
|
|
||||||
data = ntohl(*reinterpret_cast<const Int32*>(&m_data[m_readPos]));
|
|
||||||
m_readPos += sizeof(data);
|
|
||||||
}
|
|
||||||
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& Packet::operator >>(Uint32& data)
|
|
||||||
{
|
|
||||||
if (checkSize(sizeof(data)))
|
|
||||||
{
|
|
||||||
data = ntohl(*reinterpret_cast<const Uint32*>(&m_data[m_readPos]));
|
|
||||||
m_readPos += sizeof(data);
|
|
||||||
}
|
|
||||||
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& Packet::operator >>(Int64& data)
|
|
||||||
{
|
|
||||||
if (checkSize(sizeof(data)))
|
|
||||||
{
|
|
||||||
// Since ntohll is not available everywhere, we have to convert
|
|
||||||
// to network byte order (big endian) manually
|
|
||||||
const Uint8* bytes = reinterpret_cast<const Uint8*>(&m_data[m_readPos]);
|
|
||||||
data = (static_cast<Int64>(bytes[0]) << 56) |
|
|
||||||
(static_cast<Int64>(bytes[1]) << 48) |
|
|
||||||
(static_cast<Int64>(bytes[2]) << 40) |
|
|
||||||
(static_cast<Int64>(bytes[3]) << 32) |
|
|
||||||
(static_cast<Int64>(bytes[4]) << 24) |
|
|
||||||
(static_cast<Int64>(bytes[5]) << 16) |
|
|
||||||
(static_cast<Int64>(bytes[6]) << 8) |
|
|
||||||
(static_cast<Int64>(bytes[7]) );
|
|
||||||
m_readPos += sizeof(data);
|
|
||||||
}
|
|
||||||
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& Packet::operator >>(Uint64& data)
|
|
||||||
{
|
|
||||||
if (checkSize(sizeof(data)))
|
|
||||||
{
|
|
||||||
// Since ntohll is not available everywhere, we have to convert
|
|
||||||
// to network byte order (big endian) manually
|
|
||||||
const Uint8* bytes = reinterpret_cast<const Uint8*>(&m_data[m_readPos]);
|
|
||||||
data = (static_cast<Uint64>(bytes[0]) << 56) |
|
|
||||||
(static_cast<Uint64>(bytes[1]) << 48) |
|
|
||||||
(static_cast<Uint64>(bytes[2]) << 40) |
|
|
||||||
(static_cast<Uint64>(bytes[3]) << 32) |
|
|
||||||
(static_cast<Uint64>(bytes[4]) << 24) |
|
|
||||||
(static_cast<Uint64>(bytes[5]) << 16) |
|
|
||||||
(static_cast<Uint64>(bytes[6]) << 8) |
|
|
||||||
(static_cast<Uint64>(bytes[7]) );
|
|
||||||
m_readPos += sizeof(data);
|
|
||||||
}
|
|
||||||
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& Packet::operator >>(float& data)
|
|
||||||
{
|
|
||||||
if (checkSize(sizeof(data)))
|
|
||||||
{
|
|
||||||
data = *reinterpret_cast<const float*>(&m_data[m_readPos]);
|
|
||||||
m_readPos += sizeof(data);
|
|
||||||
}
|
|
||||||
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& Packet::operator >>(double& data)
|
|
||||||
{
|
|
||||||
if (checkSize(sizeof(data)))
|
|
||||||
{
|
|
||||||
data = *reinterpret_cast<const double*>(&m_data[m_readPos]);
|
|
||||||
m_readPos += sizeof(data);
|
|
||||||
}
|
|
||||||
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& Packet::operator >>(char* data)
|
|
||||||
{
|
|
||||||
// First extract string length
|
|
||||||
Uint32 length = 0;
|
|
||||||
*this >> length;
|
|
||||||
|
|
||||||
if ((length > 0) && checkSize(length))
|
|
||||||
{
|
|
||||||
// Then extract characters
|
|
||||||
std::memcpy(data, &m_data[m_readPos], length);
|
|
||||||
data[length] = '\0';
|
|
||||||
|
|
||||||
// Update reading position
|
|
||||||
m_readPos += length;
|
|
||||||
}
|
|
||||||
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& Packet::operator >>(std::string& data)
|
|
||||||
{
|
|
||||||
// First extract string length
|
|
||||||
Uint32 length = 0;
|
|
||||||
*this >> length;
|
|
||||||
|
|
||||||
data.clear();
|
|
||||||
if ((length > 0) && checkSize(length))
|
|
||||||
{
|
|
||||||
// Then extract characters
|
|
||||||
data.assign(&m_data[m_readPos], length);
|
|
||||||
|
|
||||||
// Update reading position
|
|
||||||
m_readPos += length;
|
|
||||||
}
|
|
||||||
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& Packet::operator >>(wchar_t* data)
|
|
||||||
{
|
|
||||||
// First extract string length
|
|
||||||
Uint32 length = 0;
|
|
||||||
*this >> length;
|
|
||||||
|
|
||||||
if ((length > 0) && checkSize(length * sizeof(Uint32)))
|
|
||||||
{
|
|
||||||
// Then extract characters
|
|
||||||
for (Uint32 i = 0; i < length; ++i)
|
|
||||||
{
|
|
||||||
Uint32 character = 0;
|
|
||||||
*this >> character;
|
|
||||||
data[i] = static_cast<wchar_t>(character);
|
|
||||||
}
|
|
||||||
data[length] = L'\0';
|
|
||||||
}
|
|
||||||
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& Packet::operator >>(std::wstring& data)
|
|
||||||
{
|
|
||||||
// First extract string length
|
|
||||||
Uint32 length = 0;
|
|
||||||
*this >> length;
|
|
||||||
|
|
||||||
data.clear();
|
|
||||||
if ((length > 0) && checkSize(length * sizeof(Uint32)))
|
|
||||||
{
|
|
||||||
// Then extract characters
|
|
||||||
for (Uint32 i = 0; i < length; ++i)
|
|
||||||
{
|
|
||||||
Uint32 character = 0;
|
|
||||||
*this >> character;
|
|
||||||
data += static_cast<wchar_t>(character);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& Packet::operator >>(String& data)
|
|
||||||
{
|
|
||||||
// First extract the string length
|
|
||||||
Uint32 length = 0;
|
|
||||||
*this >> length;
|
|
||||||
|
|
||||||
data.clear();
|
|
||||||
if ((length > 0) && checkSize(length * sizeof(Uint32)))
|
|
||||||
{
|
|
||||||
// Then extract characters
|
|
||||||
for (Uint32 i = 0; i < length; ++i)
|
|
||||||
{
|
|
||||||
Uint32 character = 0;
|
|
||||||
*this >> character;
|
|
||||||
data += character;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& Packet::operator <<(bool data)
|
|
||||||
{
|
|
||||||
*this << static_cast<Uint8>(data);
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& Packet::operator <<(Int8 data)
|
|
||||||
{
|
|
||||||
append(&data, sizeof(data));
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& Packet::operator <<(Uint8 data)
|
|
||||||
{
|
|
||||||
append(&data, sizeof(data));
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& Packet::operator <<(Int16 data)
|
|
||||||
{
|
|
||||||
Int16 toWrite = htons(data);
|
|
||||||
append(&toWrite, sizeof(toWrite));
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& Packet::operator <<(Uint16 data)
|
|
||||||
{
|
|
||||||
Uint16 toWrite = htons(data);
|
|
||||||
append(&toWrite, sizeof(toWrite));
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& Packet::operator <<(Int32 data)
|
|
||||||
{
|
|
||||||
Int32 toWrite = htonl(data);
|
|
||||||
append(&toWrite, sizeof(toWrite));
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& Packet::operator <<(Uint32 data)
|
|
||||||
{
|
|
||||||
Uint32 toWrite = htonl(data);
|
|
||||||
append(&toWrite, sizeof(toWrite));
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& Packet::operator <<(Int64 data)
|
|
||||||
{
|
|
||||||
// Since htonll is not available everywhere, we have to convert
|
|
||||||
// to network byte order (big endian) manually
|
|
||||||
Uint8 toWrite[] =
|
|
||||||
{
|
|
||||||
static_cast<Uint8>((data >> 56) & 0xFF),
|
|
||||||
static_cast<Uint8>((data >> 48) & 0xFF),
|
|
||||||
static_cast<Uint8>((data >> 40) & 0xFF),
|
|
||||||
static_cast<Uint8>((data >> 32) & 0xFF),
|
|
||||||
static_cast<Uint8>((data >> 24) & 0xFF),
|
|
||||||
static_cast<Uint8>((data >> 16) & 0xFF),
|
|
||||||
static_cast<Uint8>((data >> 8) & 0xFF),
|
|
||||||
static_cast<Uint8>((data ) & 0xFF)
|
|
||||||
};
|
|
||||||
append(&toWrite, sizeof(toWrite));
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& Packet::operator <<(Uint64 data)
|
|
||||||
{
|
|
||||||
// Since htonll is not available everywhere, we have to convert
|
|
||||||
// to network byte order (big endian) manually
|
|
||||||
Uint8 toWrite[] =
|
|
||||||
{
|
|
||||||
static_cast<Uint8>((data >> 56) & 0xFF),
|
|
||||||
static_cast<Uint8>((data >> 48) & 0xFF),
|
|
||||||
static_cast<Uint8>((data >> 40) & 0xFF),
|
|
||||||
static_cast<Uint8>((data >> 32) & 0xFF),
|
|
||||||
static_cast<Uint8>((data >> 24) & 0xFF),
|
|
||||||
static_cast<Uint8>((data >> 16) & 0xFF),
|
|
||||||
static_cast<Uint8>((data >> 8) & 0xFF),
|
|
||||||
static_cast<Uint8>((data ) & 0xFF)
|
|
||||||
};
|
|
||||||
append(&toWrite, sizeof(toWrite));
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& Packet::operator <<(float data)
|
|
||||||
{
|
|
||||||
append(&data, sizeof(data));
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& Packet::operator <<(double data)
|
|
||||||
{
|
|
||||||
append(&data, sizeof(data));
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& Packet::operator <<(const char* data)
|
|
||||||
{
|
|
||||||
// First insert string length
|
|
||||||
Uint32 length = static_cast<Uint32>(std::strlen(data));
|
|
||||||
*this << length;
|
|
||||||
|
|
||||||
// Then insert characters
|
|
||||||
append(data, length * sizeof(char));
|
|
||||||
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& Packet::operator <<(const std::string& data)
|
|
||||||
{
|
|
||||||
// First insert string length
|
|
||||||
Uint32 length = static_cast<Uint32>(data.size());
|
|
||||||
*this << length;
|
|
||||||
|
|
||||||
// Then insert characters
|
|
||||||
if (length > 0)
|
|
||||||
append(data.c_str(), length * sizeof(std::string::value_type));
|
|
||||||
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& Packet::operator <<(const wchar_t* data)
|
|
||||||
{
|
|
||||||
// First insert string length
|
|
||||||
Uint32 length = static_cast<Uint32>(std::wcslen(data));
|
|
||||||
*this << length;
|
|
||||||
|
|
||||||
// Then insert characters
|
|
||||||
for (const wchar_t* c = data; *c != L'\0'; ++c)
|
|
||||||
*this << static_cast<Uint32>(*c);
|
|
||||||
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& Packet::operator <<(const std::wstring& data)
|
|
||||||
{
|
|
||||||
// First insert string length
|
|
||||||
Uint32 length = static_cast<Uint32>(data.size());
|
|
||||||
*this << length;
|
|
||||||
|
|
||||||
// Then insert characters
|
|
||||||
if (length > 0)
|
|
||||||
{
|
|
||||||
for (std::wstring::const_iterator c = data.begin(); c != data.end(); ++c)
|
|
||||||
*this << static_cast<Uint32>(*c);
|
|
||||||
}
|
|
||||||
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Packet& Packet::operator <<(const String& data)
|
|
||||||
{
|
|
||||||
// First insert the string length
|
|
||||||
Uint32 length = static_cast<Uint32>(data.getSize());
|
|
||||||
*this << length;
|
|
||||||
|
|
||||||
// Then insert characters
|
|
||||||
if (length > 0)
|
|
||||||
{
|
|
||||||
for (String::ConstIterator c = data.begin(); c != data.end(); ++c)
|
|
||||||
*this << *c;
|
|
||||||
}
|
|
||||||
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
bool Packet::checkSize(std::size_t size)
|
|
||||||
{
|
|
||||||
m_isValid = m_isValid && (m_readPos + size <= m_data.size());
|
|
||||||
|
|
||||||
return m_isValid;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
const void* Packet::onSend(std::size_t& size)
|
|
||||||
{
|
|
||||||
size = getDataSize();
|
|
||||||
return getData();
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void Packet::onReceive(const void* data, std::size_t size)
|
|
||||||
{
|
|
||||||
append(data, size);
|
|
||||||
}
|
|
||||||
|
|
||||||
} // namespace sf
|
|
151
Externals/SFML/src/SFML/Network/Socket.cpp
vendored
151
Externals/SFML/src/SFML/Network/Socket.cpp
vendored
|
@ -1,151 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Headers
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#include <SFML/Network/Socket.hpp>
|
|
||||||
#include <SFML/Network/SocketImpl.hpp>
|
|
||||||
#include <SFML/System/Err.hpp>
|
|
||||||
|
|
||||||
|
|
||||||
namespace sf
|
|
||||||
{
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Socket::Socket(Type type) :
|
|
||||||
m_type (type),
|
|
||||||
m_socket (priv::SocketImpl::invalidSocket()),
|
|
||||||
m_isBlocking(true)
|
|
||||||
{
|
|
||||||
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Socket::~Socket()
|
|
||||||
{
|
|
||||||
// Close the socket before it gets destructed
|
|
||||||
close();
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void Socket::setBlocking(bool blocking)
|
|
||||||
{
|
|
||||||
// Apply if the socket is already created
|
|
||||||
if (m_socket != priv::SocketImpl::invalidSocket())
|
|
||||||
priv::SocketImpl::setBlocking(m_socket, blocking);
|
|
||||||
|
|
||||||
m_isBlocking = blocking;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
bool Socket::isBlocking() const
|
|
||||||
{
|
|
||||||
return m_isBlocking;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SocketHandle Socket::getHandle() const
|
|
||||||
{
|
|
||||||
return m_socket;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void Socket::create()
|
|
||||||
{
|
|
||||||
// Don't create the socket if it already exists
|
|
||||||
if (m_socket == priv::SocketImpl::invalidSocket())
|
|
||||||
{
|
|
||||||
SocketHandle handle = socket(PF_INET, m_type == Tcp ? SOCK_STREAM : SOCK_DGRAM, 0);
|
|
||||||
|
|
||||||
if (handle == priv::SocketImpl::invalidSocket())
|
|
||||||
{
|
|
||||||
err() << "Failed to create socket" << std::endl;
|
|
||||||
return;
|
|
||||||
}
|
|
||||||
|
|
||||||
create(handle);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void Socket::create(SocketHandle handle)
|
|
||||||
{
|
|
||||||
// Don't create the socket if it already exists
|
|
||||||
if (m_socket == priv::SocketImpl::invalidSocket())
|
|
||||||
{
|
|
||||||
// Assign the new handle
|
|
||||||
m_socket = handle;
|
|
||||||
|
|
||||||
// Set the current blocking state
|
|
||||||
setBlocking(m_isBlocking);
|
|
||||||
|
|
||||||
if (m_type == Tcp)
|
|
||||||
{
|
|
||||||
// Disable the Nagle algorithm (i.e. removes buffering of TCP packets)
|
|
||||||
int yes = 1;
|
|
||||||
if (setsockopt(m_socket, IPPROTO_TCP, TCP_NODELAY, reinterpret_cast<char*>(&yes), sizeof(yes)) == -1)
|
|
||||||
{
|
|
||||||
err() << "Failed to set socket option \"TCP_NODELAY\" ; "
|
|
||||||
<< "all your TCP packets will be buffered" << std::endl;
|
|
||||||
}
|
|
||||||
|
|
||||||
// On Mac OS X, disable the SIGPIPE signal on disconnection
|
|
||||||
#ifdef SFML_SYSTEM_MACOS
|
|
||||||
if (setsockopt(m_socket, SOL_SOCKET, SO_NOSIGPIPE, reinterpret_cast<char*>(&yes), sizeof(yes)) == -1)
|
|
||||||
{
|
|
||||||
err() << "Failed to set socket option \"SO_NOSIGPIPE\"" << std::endl;
|
|
||||||
}
|
|
||||||
#endif
|
|
||||||
}
|
|
||||||
else
|
|
||||||
{
|
|
||||||
// Enable broadcast by default for UDP sockets
|
|
||||||
int yes = 1;
|
|
||||||
if (setsockopt(m_socket, SOL_SOCKET, SO_BROADCAST, reinterpret_cast<char*>(&yes), sizeof(yes)) == -1)
|
|
||||||
{
|
|
||||||
err() << "Failed to enable broadcast on UDP socket" << std::endl;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void Socket::close()
|
|
||||||
{
|
|
||||||
// Close the socket
|
|
||||||
if (m_socket != priv::SocketImpl::invalidSocket())
|
|
||||||
{
|
|
||||||
priv::SocketImpl::close(m_socket);
|
|
||||||
m_socket = priv::SocketImpl::invalidSocket();
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
} // namespace sf
|
|
39
Externals/SFML/src/SFML/Network/SocketImpl.hpp
vendored
39
Externals/SFML/src/SFML/Network/SocketImpl.hpp
vendored
|
@ -1,39 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Headers
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#include <SFML/Config.hpp>
|
|
||||||
|
|
||||||
|
|
||||||
#if defined(SFML_SYSTEM_WINDOWS)
|
|
||||||
|
|
||||||
#include <SFML/Network/Win32/SocketImpl.hpp>
|
|
||||||
|
|
||||||
#else
|
|
||||||
|
|
||||||
#include <SFML/Network/Unix/SocketImpl.hpp>
|
|
||||||
|
|
||||||
#endif
|
|
205
Externals/SFML/src/SFML/Network/SocketSelector.cpp
vendored
205
Externals/SFML/src/SFML/Network/SocketSelector.cpp
vendored
|
@ -1,205 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Headers
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#include <SFML/Network/SocketSelector.hpp>
|
|
||||||
#include <SFML/Network/Socket.hpp>
|
|
||||||
#include <SFML/Network/SocketImpl.hpp>
|
|
||||||
#include <SFML/System/Err.hpp>
|
|
||||||
#include <algorithm>
|
|
||||||
#include <utility>
|
|
||||||
|
|
||||||
#ifdef _MSC_VER
|
|
||||||
#pragma warning(disable: 4127) // "conditional expression is constant" generated by the FD_SET macro
|
|
||||||
#endif
|
|
||||||
|
|
||||||
|
|
||||||
namespace sf
|
|
||||||
{
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
struct SocketSelector::SocketSelectorImpl
|
|
||||||
{
|
|
||||||
fd_set allSockets; ///< Set containing all the sockets handles
|
|
||||||
fd_set socketsReady; ///< Set containing handles of the sockets that are ready
|
|
||||||
int maxSocket; ///< Maximum socket handle
|
|
||||||
int socketCount; ///< Number of socket handles
|
|
||||||
};
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SocketSelector::SocketSelector() :
|
|
||||||
m_impl(new SocketSelectorImpl)
|
|
||||||
{
|
|
||||||
clear();
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SocketSelector::SocketSelector(const SocketSelector& copy) :
|
|
||||||
m_impl(new SocketSelectorImpl(*copy.m_impl))
|
|
||||||
{
|
|
||||||
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SocketSelector::~SocketSelector()
|
|
||||||
{
|
|
||||||
delete m_impl;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void SocketSelector::add(Socket& socket)
|
|
||||||
{
|
|
||||||
SocketHandle handle = socket.getHandle();
|
|
||||||
if (handle != priv::SocketImpl::invalidSocket())
|
|
||||||
{
|
|
||||||
|
|
||||||
#if defined(SFML_SYSTEM_WINDOWS)
|
|
||||||
|
|
||||||
if (m_impl->socketCount >= FD_SETSIZE)
|
|
||||||
{
|
|
||||||
err() << "The socket can't be added to the selector because the "
|
|
||||||
<< "selector is full. This is a limitation of your operating "
|
|
||||||
<< "system's FD_SETSIZE setting.";
|
|
||||||
return;
|
|
||||||
}
|
|
||||||
|
|
||||||
if (FD_ISSET(handle, &m_impl->allSockets))
|
|
||||||
return;
|
|
||||||
|
|
||||||
m_impl->socketCount++;
|
|
||||||
|
|
||||||
#else
|
|
||||||
|
|
||||||
if (handle >= FD_SETSIZE)
|
|
||||||
{
|
|
||||||
err() << "The socket can't be added to the selector because its "
|
|
||||||
<< "ID is too high. This is a limitation of your operating "
|
|
||||||
<< "system's FD_SETSIZE setting.";
|
|
||||||
return;
|
|
||||||
}
|
|
||||||
|
|
||||||
// SocketHandle is an int in POSIX
|
|
||||||
m_impl->maxSocket = std::max(m_impl->maxSocket, handle);
|
|
||||||
|
|
||||||
#endif
|
|
||||||
|
|
||||||
FD_SET(handle, &m_impl->allSockets);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void SocketSelector::remove(Socket& socket)
|
|
||||||
{
|
|
||||||
SocketHandle handle = socket.getHandle();
|
|
||||||
if (handle != priv::SocketImpl::invalidSocket())
|
|
||||||
{
|
|
||||||
|
|
||||||
#if defined(SFML_SYSTEM_WINDOWS)
|
|
||||||
|
|
||||||
if (!FD_ISSET(handle, &m_impl->allSockets))
|
|
||||||
return;
|
|
||||||
|
|
||||||
m_impl->socketCount--;
|
|
||||||
|
|
||||||
#else
|
|
||||||
|
|
||||||
if (handle >= FD_SETSIZE)
|
|
||||||
return;
|
|
||||||
|
|
||||||
#endif
|
|
||||||
|
|
||||||
FD_CLR(handle, &m_impl->allSockets);
|
|
||||||
FD_CLR(handle, &m_impl->socketsReady);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void SocketSelector::clear()
|
|
||||||
{
|
|
||||||
FD_ZERO(&m_impl->allSockets);
|
|
||||||
FD_ZERO(&m_impl->socketsReady);
|
|
||||||
|
|
||||||
m_impl->maxSocket = 0;
|
|
||||||
m_impl->socketCount = 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
bool SocketSelector::wait(Time timeout)
|
|
||||||
{
|
|
||||||
// Setup the timeout
|
|
||||||
timeval time;
|
|
||||||
time.tv_sec = static_cast<long>(timeout.asMicroseconds() / 1000000);
|
|
||||||
time.tv_usec = static_cast<long>(timeout.asMicroseconds() % 1000000);
|
|
||||||
|
|
||||||
// Initialize the set that will contain the sockets that are ready
|
|
||||||
m_impl->socketsReady = m_impl->allSockets;
|
|
||||||
|
|
||||||
// Wait until one of the sockets is ready for reading, or timeout is reached
|
|
||||||
// The first parameter is ignored on Windows
|
|
||||||
int count = select(m_impl->maxSocket + 1, &m_impl->socketsReady, NULL, NULL, timeout != Time::Zero ? &time : NULL);
|
|
||||||
|
|
||||||
return count > 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
bool SocketSelector::isReady(Socket& socket) const
|
|
||||||
{
|
|
||||||
SocketHandle handle = socket.getHandle();
|
|
||||||
if (handle != priv::SocketImpl::invalidSocket())
|
|
||||||
{
|
|
||||||
|
|
||||||
#if !defined(SFML_SYSTEM_WINDOWS)
|
|
||||||
|
|
||||||
if (handle >= FD_SETSIZE)
|
|
||||||
return false;
|
|
||||||
|
|
||||||
#endif
|
|
||||||
|
|
||||||
return FD_ISSET(handle, &m_impl->socketsReady) != 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SocketSelector& SocketSelector::operator =(const SocketSelector& right)
|
|
||||||
{
|
|
||||||
SocketSelector temp(right);
|
|
||||||
|
|
||||||
std::swap(m_impl, temp.m_impl);
|
|
||||||
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
} // namespace sf
|
|
131
Externals/SFML/src/SFML/Network/TcpListener.cpp
vendored
131
Externals/SFML/src/SFML/Network/TcpListener.cpp
vendored
|
@ -1,131 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Headers
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#include <SFML/Network/TcpListener.hpp>
|
|
||||||
#include <SFML/Network/TcpSocket.hpp>
|
|
||||||
#include <SFML/Network/SocketImpl.hpp>
|
|
||||||
#include <SFML/System/Err.hpp>
|
|
||||||
|
|
||||||
|
|
||||||
namespace sf
|
|
||||||
{
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
TcpListener::TcpListener() :
|
|
||||||
Socket(Tcp)
|
|
||||||
{
|
|
||||||
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
unsigned short TcpListener::getLocalPort() const
|
|
||||||
{
|
|
||||||
if (getHandle() != priv::SocketImpl::invalidSocket())
|
|
||||||
{
|
|
||||||
// Retrieve informations about the local end of the socket
|
|
||||||
sockaddr_in address;
|
|
||||||
priv::SocketImpl::AddrLength size = sizeof(address);
|
|
||||||
if (getsockname(getHandle(), reinterpret_cast<sockaddr*>(&address), &size) != -1)
|
|
||||||
{
|
|
||||||
return ntohs(address.sin_port);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
// We failed to retrieve the port
|
|
||||||
return 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Socket::Status TcpListener::listen(unsigned short port, const IpAddress& address)
|
|
||||||
{
|
|
||||||
// Close the socket if it is already bound
|
|
||||||
close();
|
|
||||||
|
|
||||||
// Create the internal socket if it doesn't exist
|
|
||||||
create();
|
|
||||||
|
|
||||||
// Check if the address is valid
|
|
||||||
if ((address == IpAddress::None) || (address == IpAddress::Broadcast))
|
|
||||||
return Error;
|
|
||||||
|
|
||||||
// Bind the socket to the specified port
|
|
||||||
sockaddr_in addr = priv::SocketImpl::createAddress(address.toInteger(), port);
|
|
||||||
if (bind(getHandle(), reinterpret_cast<sockaddr*>(&addr), sizeof(addr)) == -1)
|
|
||||||
{
|
|
||||||
// Not likely to happen, but...
|
|
||||||
err() << "Failed to bind listener socket to port " << port << std::endl;
|
|
||||||
return Error;
|
|
||||||
}
|
|
||||||
|
|
||||||
// Listen to the bound port
|
|
||||||
if (::listen(getHandle(), SOMAXCONN) == -1)
|
|
||||||
{
|
|
||||||
// Oops, socket is deaf
|
|
||||||
err() << "Failed to listen to port " << port << std::endl;
|
|
||||||
return Error;
|
|
||||||
}
|
|
||||||
|
|
||||||
return Done;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void TcpListener::close()
|
|
||||||
{
|
|
||||||
// Simply close the socket
|
|
||||||
Socket::close();
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Socket::Status TcpListener::accept(TcpSocket& socket)
|
|
||||||
{
|
|
||||||
// Make sure that we're listening
|
|
||||||
if (getHandle() == priv::SocketImpl::invalidSocket())
|
|
||||||
{
|
|
||||||
err() << "Failed to accept a new connection, the socket is not listening" << std::endl;
|
|
||||||
return Error;
|
|
||||||
}
|
|
||||||
|
|
||||||
// Accept a new connection
|
|
||||||
sockaddr_in address;
|
|
||||||
priv::SocketImpl::AddrLength length = sizeof(address);
|
|
||||||
SocketHandle remote = ::accept(getHandle(), reinterpret_cast<sockaddr*>(&address), &length);
|
|
||||||
|
|
||||||
// Check for errors
|
|
||||||
if (remote == priv::SocketImpl::invalidSocket())
|
|
||||||
return priv::SocketImpl::getErrorStatus();
|
|
||||||
|
|
||||||
// Initialize the new connected socket
|
|
||||||
socket.close();
|
|
||||||
socket.create(remote);
|
|
||||||
|
|
||||||
return Done;
|
|
||||||
}
|
|
||||||
|
|
||||||
} // namespace sf
|
|
416
Externals/SFML/src/SFML/Network/TcpSocket.cpp
vendored
416
Externals/SFML/src/SFML/Network/TcpSocket.cpp
vendored
|
@ -1,416 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Headers
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#include <SFML/Network/TcpSocket.hpp>
|
|
||||||
#include <SFML/Network/IPAddress.hpp>
|
|
||||||
#include <SFML/Network/Packet.hpp>
|
|
||||||
#include <SFML/Network/SocketImpl.hpp>
|
|
||||||
#include <SFML/System/Err.hpp>
|
|
||||||
#include <algorithm>
|
|
||||||
#include <cstring>
|
|
||||||
|
|
||||||
#ifdef _MSC_VER
|
|
||||||
#pragma warning(disable: 4127) // "conditional expression is constant" generated by the FD_SET macro
|
|
||||||
#endif
|
|
||||||
|
|
||||||
|
|
||||||
namespace
|
|
||||||
{
|
|
||||||
// Define the low-level send/receive flags, which depend on the OS
|
|
||||||
#ifdef SFML_SYSTEM_LINUX
|
|
||||||
const int flags = MSG_NOSIGNAL;
|
|
||||||
#else
|
|
||||||
const int flags = 0;
|
|
||||||
#endif
|
|
||||||
}
|
|
||||||
|
|
||||||
namespace sf
|
|
||||||
{
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
TcpSocket::TcpSocket() :
|
|
||||||
Socket(Tcp)
|
|
||||||
{
|
|
||||||
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
unsigned short TcpSocket::getLocalPort() const
|
|
||||||
{
|
|
||||||
if (getHandle() != priv::SocketImpl::invalidSocket())
|
|
||||||
{
|
|
||||||
// Retrieve informations about the local end of the socket
|
|
||||||
sockaddr_in address;
|
|
||||||
priv::SocketImpl::AddrLength size = sizeof(address);
|
|
||||||
if (getsockname(getHandle(), reinterpret_cast<sockaddr*>(&address), &size) != -1)
|
|
||||||
{
|
|
||||||
return ntohs(address.sin_port);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
// We failed to retrieve the port
|
|
||||||
return 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
IpAddress TcpSocket::getRemoteAddress() const
|
|
||||||
{
|
|
||||||
if (getHandle() != priv::SocketImpl::invalidSocket())
|
|
||||||
{
|
|
||||||
// Retrieve informations about the remote end of the socket
|
|
||||||
sockaddr_in address;
|
|
||||||
priv::SocketImpl::AddrLength size = sizeof(address);
|
|
||||||
if (getpeername(getHandle(), reinterpret_cast<sockaddr*>(&address), &size) != -1)
|
|
||||||
{
|
|
||||||
return IpAddress(ntohl(address.sin_addr.s_addr));
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
// We failed to retrieve the address
|
|
||||||
return IpAddress::None;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
unsigned short TcpSocket::getRemotePort() const
|
|
||||||
{
|
|
||||||
if (getHandle() != priv::SocketImpl::invalidSocket())
|
|
||||||
{
|
|
||||||
// Retrieve informations about the remote end of the socket
|
|
||||||
sockaddr_in address;
|
|
||||||
priv::SocketImpl::AddrLength size = sizeof(address);
|
|
||||||
if (getpeername(getHandle(), reinterpret_cast<sockaddr*>(&address), &size) != -1)
|
|
||||||
{
|
|
||||||
return ntohs(address.sin_port);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
// We failed to retrieve the port
|
|
||||||
return 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Socket::Status TcpSocket::connect(const IpAddress& remoteAddress, unsigned short remotePort, Time timeout)
|
|
||||||
{
|
|
||||||
// Disconnect the socket if it is already connected
|
|
||||||
disconnect();
|
|
||||||
|
|
||||||
// Create the internal socket if it doesn't exist
|
|
||||||
create();
|
|
||||||
|
|
||||||
// Create the remote address
|
|
||||||
sockaddr_in address = priv::SocketImpl::createAddress(remoteAddress.toInteger(), remotePort);
|
|
||||||
|
|
||||||
if (timeout <= Time::Zero)
|
|
||||||
{
|
|
||||||
// ----- We're not using a timeout: just try to connect -----
|
|
||||||
|
|
||||||
// Connect the socket
|
|
||||||
if (::connect(getHandle(), reinterpret_cast<sockaddr*>(&address), sizeof(address)) == -1)
|
|
||||||
return priv::SocketImpl::getErrorStatus();
|
|
||||||
|
|
||||||
// Connection succeeded
|
|
||||||
return Done;
|
|
||||||
}
|
|
||||||
else
|
|
||||||
{
|
|
||||||
// ----- We're using a timeout: we'll need a few tricks to make it work -----
|
|
||||||
|
|
||||||
// Save the previous blocking state
|
|
||||||
bool blocking = isBlocking();
|
|
||||||
|
|
||||||
// Switch to non-blocking to enable our connection timeout
|
|
||||||
if (blocking)
|
|
||||||
setBlocking(false);
|
|
||||||
|
|
||||||
// Try to connect to the remote address
|
|
||||||
if (::connect(getHandle(), reinterpret_cast<sockaddr*>(&address), sizeof(address)) >= 0)
|
|
||||||
{
|
|
||||||
// We got instantly connected! (it may no happen a lot...)
|
|
||||||
setBlocking(blocking);
|
|
||||||
return Done;
|
|
||||||
}
|
|
||||||
|
|
||||||
// Get the error status
|
|
||||||
Status status = priv::SocketImpl::getErrorStatus();
|
|
||||||
|
|
||||||
// If we were in non-blocking mode, return immediately
|
|
||||||
if (!blocking)
|
|
||||||
return status;
|
|
||||||
|
|
||||||
// Otherwise, wait until something happens to our socket (success, timeout or error)
|
|
||||||
if (status == Socket::NotReady)
|
|
||||||
{
|
|
||||||
// Setup the selector
|
|
||||||
fd_set selector;
|
|
||||||
FD_ZERO(&selector);
|
|
||||||
FD_SET(getHandle(), &selector);
|
|
||||||
|
|
||||||
// Setup the timeout
|
|
||||||
timeval time;
|
|
||||||
time.tv_sec = static_cast<long>(timeout.asMicroseconds() / 1000000);
|
|
||||||
time.tv_usec = static_cast<long>(timeout.asMicroseconds() % 1000000);
|
|
||||||
|
|
||||||
// Wait for something to write on our socket (which means that the connection request has returned)
|
|
||||||
if (select(static_cast<int>(getHandle() + 1), NULL, &selector, NULL, &time) > 0)
|
|
||||||
{
|
|
||||||
// At this point the connection may have been either accepted or refused.
|
|
||||||
// To know whether it's a success or a failure, we must check the address of the connected peer
|
|
||||||
if (getRemoteAddress() != IpAddress::None)
|
|
||||||
{
|
|
||||||
// Connection accepted
|
|
||||||
status = Done;
|
|
||||||
}
|
|
||||||
else
|
|
||||||
{
|
|
||||||
// Connection refused
|
|
||||||
status = priv::SocketImpl::getErrorStatus();
|
|
||||||
}
|
|
||||||
}
|
|
||||||
else
|
|
||||||
{
|
|
||||||
// Failed to connect before timeout is over
|
|
||||||
status = priv::SocketImpl::getErrorStatus();
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
// Switch back to blocking mode
|
|
||||||
setBlocking(true);
|
|
||||||
|
|
||||||
return status;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void TcpSocket::disconnect()
|
|
||||||
{
|
|
||||||
// Close the socket
|
|
||||||
close();
|
|
||||||
|
|
||||||
// Reset the pending packet data
|
|
||||||
m_pendingPacket = PendingPacket();
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Socket::Status TcpSocket::send(const void* data, std::size_t size)
|
|
||||||
{
|
|
||||||
if (!isBlocking())
|
|
||||||
err() << "Warning: Partial sends might not be handled properly." << std::endl;
|
|
||||||
|
|
||||||
std::size_t sent;
|
|
||||||
|
|
||||||
return send(data, size, sent);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Socket::Status TcpSocket::send(const void* data, std::size_t size, std::size_t& sent)
|
|
||||||
{
|
|
||||||
// Check the parameters
|
|
||||||
if (!data || (size == 0))
|
|
||||||
{
|
|
||||||
err() << "Cannot send data over the network (no data to send)" << std::endl;
|
|
||||||
return Error;
|
|
||||||
}
|
|
||||||
|
|
||||||
// Loop until every byte has been sent
|
|
||||||
int result = 0;
|
|
||||||
for (sent = 0; sent < size; sent += result)
|
|
||||||
{
|
|
||||||
// Send a chunk of data
|
|
||||||
result = ::send(getHandle(), static_cast<const char*>(data) + sent, size - sent, flags);
|
|
||||||
|
|
||||||
// Check for errors
|
|
||||||
if (result < 0)
|
|
||||||
{
|
|
||||||
Status status = priv::SocketImpl::getErrorStatus();
|
|
||||||
|
|
||||||
if ((status == NotReady) && sent)
|
|
||||||
return Partial;
|
|
||||||
|
|
||||||
return status;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
return Done;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Socket::Status TcpSocket::receive(void* data, std::size_t size, std::size_t& received)
|
|
||||||
{
|
|
||||||
// First clear the variables to fill
|
|
||||||
received = 0;
|
|
||||||
|
|
||||||
// Check the destination buffer
|
|
||||||
if (!data)
|
|
||||||
{
|
|
||||||
err() << "Cannot receive data from the network (the destination buffer is invalid)" << std::endl;
|
|
||||||
return Error;
|
|
||||||
}
|
|
||||||
|
|
||||||
// Receive a chunk of bytes
|
|
||||||
int sizeReceived = recv(getHandle(), static_cast<char*>(data), static_cast<int>(size), flags);
|
|
||||||
|
|
||||||
// Check the number of bytes received
|
|
||||||
if (sizeReceived > 0)
|
|
||||||
{
|
|
||||||
received = static_cast<std::size_t>(sizeReceived);
|
|
||||||
return Done;
|
|
||||||
}
|
|
||||||
else if (sizeReceived == 0)
|
|
||||||
{
|
|
||||||
return Socket::Disconnected;
|
|
||||||
}
|
|
||||||
else
|
|
||||||
{
|
|
||||||
return priv::SocketImpl::getErrorStatus();
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Socket::Status TcpSocket::send(Packet& packet)
|
|
||||||
{
|
|
||||||
// TCP is a stream protocol, it doesn't preserve messages boundaries.
|
|
||||||
// This means that we have to send the packet size first, so that the
|
|
||||||
// receiver knows the actual end of the packet in the data stream.
|
|
||||||
|
|
||||||
// We allocate an extra memory block so that the size can be sent
|
|
||||||
// together with the data in a single call. This may seem inefficient,
|
|
||||||
// but it is actually required to avoid partial send, which could cause
|
|
||||||
// data corruption on the receiving end.
|
|
||||||
|
|
||||||
// Get the data to send from the packet
|
|
||||||
std::size_t size = 0;
|
|
||||||
const void* data = packet.onSend(size);
|
|
||||||
|
|
||||||
// First convert the packet size to network byte order
|
|
||||||
Uint32 packetSize = htonl(static_cast<Uint32>(size));
|
|
||||||
|
|
||||||
// Allocate memory for the data block to send
|
|
||||||
std::vector<char> blockToSend(sizeof(packetSize) + size);
|
|
||||||
|
|
||||||
// Copy the packet size and data into the block to send
|
|
||||||
std::memcpy(&blockToSend[0], &packetSize, sizeof(packetSize));
|
|
||||||
if (size > 0)
|
|
||||||
std::memcpy(&blockToSend[0] + sizeof(packetSize), data, size);
|
|
||||||
|
|
||||||
// Send the data block
|
|
||||||
std::size_t sent;
|
|
||||||
Status status = send(&blockToSend[0] + packet.m_sendPos, blockToSend.size() - packet.m_sendPos, sent);
|
|
||||||
|
|
||||||
// In the case of a partial send, record the location to resume from
|
|
||||||
if (status == Partial)
|
|
||||||
{
|
|
||||||
packet.m_sendPos += sent;
|
|
||||||
}
|
|
||||||
else if (status == Done)
|
|
||||||
{
|
|
||||||
packet.m_sendPos = 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
return status;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Socket::Status TcpSocket::receive(Packet& packet)
|
|
||||||
{
|
|
||||||
// First clear the variables to fill
|
|
||||||
packet.clear();
|
|
||||||
|
|
||||||
// We start by getting the size of the incoming packet
|
|
||||||
Uint32 packetSize = 0;
|
|
||||||
std::size_t received = 0;
|
|
||||||
if (m_pendingPacket.SizeReceived < sizeof(m_pendingPacket.Size))
|
|
||||||
{
|
|
||||||
// Loop until we've received the entire size of the packet
|
|
||||||
// (even a 4 byte variable may be received in more than one call)
|
|
||||||
while (m_pendingPacket.SizeReceived < sizeof(m_pendingPacket.Size))
|
|
||||||
{
|
|
||||||
char* data = reinterpret_cast<char*>(&m_pendingPacket.Size) + m_pendingPacket.SizeReceived;
|
|
||||||
Status status = receive(data, sizeof(m_pendingPacket.Size) - m_pendingPacket.SizeReceived, received);
|
|
||||||
m_pendingPacket.SizeReceived += received;
|
|
||||||
|
|
||||||
if (status != Done)
|
|
||||||
return status;
|
|
||||||
}
|
|
||||||
|
|
||||||
// The packet size has been fully received
|
|
||||||
packetSize = ntohl(m_pendingPacket.Size);
|
|
||||||
}
|
|
||||||
else
|
|
||||||
{
|
|
||||||
// The packet size has already been received in a previous call
|
|
||||||
packetSize = ntohl(m_pendingPacket.Size);
|
|
||||||
}
|
|
||||||
|
|
||||||
// Loop until we receive all the packet data
|
|
||||||
char buffer[1024];
|
|
||||||
while (m_pendingPacket.Data.size() < packetSize)
|
|
||||||
{
|
|
||||||
// Receive a chunk of data
|
|
||||||
std::size_t sizeToGet = std::min(static_cast<std::size_t>(packetSize - m_pendingPacket.Data.size()), sizeof(buffer));
|
|
||||||
Status status = receive(buffer, sizeToGet, received);
|
|
||||||
if (status != Done)
|
|
||||||
return status;
|
|
||||||
|
|
||||||
// Append it into the packet
|
|
||||||
if (received > 0)
|
|
||||||
{
|
|
||||||
m_pendingPacket.Data.resize(m_pendingPacket.Data.size() + received);
|
|
||||||
char* begin = &m_pendingPacket.Data[0] + m_pendingPacket.Data.size() - received;
|
|
||||||
std::memcpy(begin, buffer, received);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
// We have received all the packet data: we can copy it to the user packet
|
|
||||||
if (!m_pendingPacket.Data.empty())
|
|
||||||
packet.onReceive(&m_pendingPacket.Data[0], m_pendingPacket.Data.size());
|
|
||||||
|
|
||||||
// Clear the pending packet data
|
|
||||||
m_pendingPacket = PendingPacket();
|
|
||||||
|
|
||||||
return Done;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
TcpSocket::PendingPacket::PendingPacket() :
|
|
||||||
Size (0),
|
|
||||||
SizeReceived(0),
|
|
||||||
Data ()
|
|
||||||
{
|
|
||||||
|
|
||||||
}
|
|
||||||
|
|
||||||
} // namespace sf
|
|
200
Externals/SFML/src/SFML/Network/UdpSocket.cpp
vendored
200
Externals/SFML/src/SFML/Network/UdpSocket.cpp
vendored
|
@ -1,200 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Headers
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#include <SFML/Network/UdpSocket.hpp>
|
|
||||||
#include <SFML/Network/IPAddress.hpp>
|
|
||||||
#include <SFML/Network/Packet.hpp>
|
|
||||||
#include <SFML/Network/SocketImpl.hpp>
|
|
||||||
#include <SFML/System/Err.hpp>
|
|
||||||
#include <algorithm>
|
|
||||||
|
|
||||||
|
|
||||||
namespace sf
|
|
||||||
{
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
UdpSocket::UdpSocket() :
|
|
||||||
Socket (Udp),
|
|
||||||
m_buffer(MaxDatagramSize)
|
|
||||||
{
|
|
||||||
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
unsigned short UdpSocket::getLocalPort() const
|
|
||||||
{
|
|
||||||
if (getHandle() != priv::SocketImpl::invalidSocket())
|
|
||||||
{
|
|
||||||
// Retrieve informations about the local end of the socket
|
|
||||||
sockaddr_in address;
|
|
||||||
priv::SocketImpl::AddrLength size = sizeof(address);
|
|
||||||
if (getsockname(getHandle(), reinterpret_cast<sockaddr*>(&address), &size) != -1)
|
|
||||||
{
|
|
||||||
return ntohs(address.sin_port);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
// We failed to retrieve the port
|
|
||||||
return 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Socket::Status UdpSocket::bind(unsigned short port, const IpAddress& address)
|
|
||||||
{
|
|
||||||
// Close the socket if it is already bound
|
|
||||||
close();
|
|
||||||
|
|
||||||
// Create the internal socket if it doesn't exist
|
|
||||||
create();
|
|
||||||
|
|
||||||
// Check if the address is valid
|
|
||||||
if ((address == IpAddress::None) || (address == IpAddress::Broadcast))
|
|
||||||
return Error;
|
|
||||||
|
|
||||||
// Bind the socket
|
|
||||||
sockaddr_in addr = priv::SocketImpl::createAddress(address.toInteger(), port);
|
|
||||||
if (::bind(getHandle(), reinterpret_cast<sockaddr*>(&addr), sizeof(addr)) == -1)
|
|
||||||
{
|
|
||||||
err() << "Failed to bind socket to port " << port << std::endl;
|
|
||||||
return Error;
|
|
||||||
}
|
|
||||||
|
|
||||||
return Done;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void UdpSocket::unbind()
|
|
||||||
{
|
|
||||||
// Simply close the socket
|
|
||||||
close();
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Socket::Status UdpSocket::send(const void* data, std::size_t size, const IpAddress& remoteAddress, unsigned short remotePort)
|
|
||||||
{
|
|
||||||
// Create the internal socket if it doesn't exist
|
|
||||||
create();
|
|
||||||
|
|
||||||
// Make sure that all the data will fit in one datagram
|
|
||||||
if (size > MaxDatagramSize)
|
|
||||||
{
|
|
||||||
err() << "Cannot send data over the network "
|
|
||||||
<< "(the number of bytes to send is greater than sf::UdpSocket::MaxDatagramSize)" << std::endl;
|
|
||||||
return Error;
|
|
||||||
}
|
|
||||||
|
|
||||||
// Build the target address
|
|
||||||
sockaddr_in address = priv::SocketImpl::createAddress(remoteAddress.toInteger(), remotePort);
|
|
||||||
|
|
||||||
// Send the data (unlike TCP, all the data is always sent in one call)
|
|
||||||
int sent = sendto(getHandle(), static_cast<const char*>(data), static_cast<int>(size), 0, reinterpret_cast<sockaddr*>(&address), sizeof(address));
|
|
||||||
|
|
||||||
// Check for errors
|
|
||||||
if (sent < 0)
|
|
||||||
return priv::SocketImpl::getErrorStatus();
|
|
||||||
|
|
||||||
return Done;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Socket::Status UdpSocket::receive(void* data, std::size_t size, std::size_t& received, IpAddress& remoteAddress, unsigned short& remotePort)
|
|
||||||
{
|
|
||||||
// First clear the variables to fill
|
|
||||||
received = 0;
|
|
||||||
remoteAddress = IpAddress();
|
|
||||||
remotePort = 0;
|
|
||||||
|
|
||||||
// Check the destination buffer
|
|
||||||
if (!data)
|
|
||||||
{
|
|
||||||
err() << "Cannot receive data from the network (the destination buffer is invalid)" << std::endl;
|
|
||||||
return Error;
|
|
||||||
}
|
|
||||||
|
|
||||||
// Data that will be filled with the other computer's address
|
|
||||||
sockaddr_in address = priv::SocketImpl::createAddress(INADDR_ANY, 0);
|
|
||||||
|
|
||||||
// Receive a chunk of bytes
|
|
||||||
priv::SocketImpl::AddrLength addressSize = sizeof(address);
|
|
||||||
int sizeReceived = recvfrom(getHandle(), static_cast<char*>(data), static_cast<int>(size), 0, reinterpret_cast<sockaddr*>(&address), &addressSize);
|
|
||||||
|
|
||||||
// Check for errors
|
|
||||||
if (sizeReceived < 0)
|
|
||||||
return priv::SocketImpl::getErrorStatus();
|
|
||||||
|
|
||||||
// Fill the sender informations
|
|
||||||
received = static_cast<std::size_t>(sizeReceived);
|
|
||||||
remoteAddress = IpAddress(ntohl(address.sin_addr.s_addr));
|
|
||||||
remotePort = ntohs(address.sin_port);
|
|
||||||
|
|
||||||
return Done;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Socket::Status UdpSocket::send(Packet& packet, const IpAddress& remoteAddress, unsigned short remotePort)
|
|
||||||
{
|
|
||||||
// UDP is a datagram-oriented protocol (as opposed to TCP which is a stream protocol).
|
|
||||||
// Sending one datagram is almost safe: it may be lost but if it's received, then its data
|
|
||||||
// is guaranteed to be ok. However, splitting a packet into multiple datagrams would be highly
|
|
||||||
// unreliable, since datagrams may be reordered, dropped or mixed between different sources.
|
|
||||||
// That's why SFML imposes a limit on packet size so that they can be sent in a single datagram.
|
|
||||||
// This also removes the overhead associated to packets -- there's no size to send in addition
|
|
||||||
// to the packet's data.
|
|
||||||
|
|
||||||
// Get the data to send from the packet
|
|
||||||
std::size_t size = 0;
|
|
||||||
const void* data = packet.onSend(size);
|
|
||||||
|
|
||||||
// Send it
|
|
||||||
return send(data, size, remoteAddress, remotePort);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Socket::Status UdpSocket::receive(Packet& packet, IpAddress& remoteAddress, unsigned short& remotePort)
|
|
||||||
{
|
|
||||||
// See the detailed comment in send(Packet) above.
|
|
||||||
|
|
||||||
// Receive the datagram
|
|
||||||
std::size_t received = 0;
|
|
||||||
Status status = receive(&m_buffer[0], m_buffer.size(), received, remoteAddress, remotePort);
|
|
||||||
|
|
||||||
// If we received valid data, we can copy it to the user packet
|
|
||||||
packet.clear();
|
|
||||||
if ((status == Done) && (received > 0))
|
|
||||||
packet.onReceive(&m_buffer[0], received);
|
|
||||||
|
|
||||||
return status;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
} // namespace sf
|
|
112
Externals/SFML/src/SFML/Network/Unix/SocketImpl.cpp
vendored
112
Externals/SFML/src/SFML/Network/Unix/SocketImpl.cpp
vendored
|
@ -1,112 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Headers
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#include <SFML/Network/Unix/SocketImpl.hpp>
|
|
||||||
#include <SFML/System/Err.hpp>
|
|
||||||
#include <errno.h>
|
|
||||||
#include <fcntl.h>
|
|
||||||
#include <cstring>
|
|
||||||
|
|
||||||
|
|
||||||
namespace sf
|
|
||||||
{
|
|
||||||
namespace priv
|
|
||||||
{
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
sockaddr_in SocketImpl::createAddress(Uint32 address, unsigned short port)
|
|
||||||
{
|
|
||||||
sockaddr_in addr;
|
|
||||||
std::memset(&addr, 0, sizeof(addr));
|
|
||||||
addr.sin_addr.s_addr = htonl(address);
|
|
||||||
addr.sin_family = AF_INET;
|
|
||||||
addr.sin_port = htons(port);
|
|
||||||
|
|
||||||
#if defined(SFML_SYSTEM_MACOS)
|
|
||||||
addr.sin_len = sizeof(addr);
|
|
||||||
#endif
|
|
||||||
|
|
||||||
return addr;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SocketHandle SocketImpl::invalidSocket()
|
|
||||||
{
|
|
||||||
return -1;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void SocketImpl::close(SocketHandle sock)
|
|
||||||
{
|
|
||||||
::close(sock);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void SocketImpl::setBlocking(SocketHandle sock, bool block)
|
|
||||||
{
|
|
||||||
int status = fcntl(sock, F_GETFL);
|
|
||||||
if (block)
|
|
||||||
{
|
|
||||||
if (fcntl(sock, F_SETFL, status & ~O_NONBLOCK) == -1)
|
|
||||||
err() << "Failed to set file status flags: " << errno << std::endl;
|
|
||||||
}
|
|
||||||
else
|
|
||||||
{
|
|
||||||
if (fcntl(sock, F_SETFL, status | O_NONBLOCK) == -1)
|
|
||||||
err() << "Failed to set file status flags: " << errno << std::endl;
|
|
||||||
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Socket::Status SocketImpl::getErrorStatus()
|
|
||||||
{
|
|
||||||
// The followings are sometimes equal to EWOULDBLOCK,
|
|
||||||
// so we have to make a special case for them in order
|
|
||||||
// to avoid having double values in the switch case
|
|
||||||
if ((errno == EAGAIN) || (errno == EINPROGRESS))
|
|
||||||
return Socket::NotReady;
|
|
||||||
|
|
||||||
switch (errno)
|
|
||||||
{
|
|
||||||
case EWOULDBLOCK: return Socket::NotReady;
|
|
||||||
case ECONNABORTED: return Socket::Disconnected;
|
|
||||||
case ECONNRESET: return Socket::Disconnected;
|
|
||||||
case ETIMEDOUT: return Socket::Disconnected;
|
|
||||||
case ENETRESET: return Socket::Disconnected;
|
|
||||||
case ENOTCONN: return Socket::Disconnected;
|
|
||||||
case EPIPE: return Socket::Disconnected;
|
|
||||||
default: return Socket::Error;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
} // namespace priv
|
|
||||||
|
|
||||||
} // namespace sf
|
|
109
Externals/SFML/src/SFML/Network/Unix/SocketImpl.hpp
vendored
109
Externals/SFML/src/SFML/Network/Unix/SocketImpl.hpp
vendored
|
@ -1,109 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#ifndef SFML_SOCKETIMPL_HPP
|
|
||||||
#define SFML_SOCKETIMPL_HPP
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Headers
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#include <SFML/Network/Socket.hpp>
|
|
||||||
#include <sys/types.h>
|
|
||||||
#include <sys/socket.h>
|
|
||||||
#include <netinet/in.h>
|
|
||||||
#include <netinet/tcp.h>
|
|
||||||
#include <arpa/inet.h>
|
|
||||||
#include <netdb.h>
|
|
||||||
#include <unistd.h>
|
|
||||||
|
|
||||||
|
|
||||||
namespace sf
|
|
||||||
{
|
|
||||||
namespace priv
|
|
||||||
{
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Helper class implementing all the non-portable
|
|
||||||
/// socket stuff; this is the Unix version
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
class SocketImpl
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Types
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
typedef socklen_t AddrLength;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Create an internal sockaddr_in address
|
|
||||||
///
|
|
||||||
/// \param address Target address
|
|
||||||
/// \param port Target port
|
|
||||||
///
|
|
||||||
/// \return sockaddr_in ready to be used by socket functions
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
static sockaddr_in createAddress(Uint32 address, unsigned short port);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Return the value of the invalid socket
|
|
||||||
///
|
|
||||||
/// \return Special value of the invalid socket
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
static SocketHandle invalidSocket();
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Close and destroy a socket
|
|
||||||
///
|
|
||||||
/// \param sock Handle of the socket to close
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
static void close(SocketHandle sock);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Set a socket as blocking or non-blocking
|
|
||||||
///
|
|
||||||
/// \param sock Handle of the socket
|
|
||||||
/// \param block New blocking state of the socket
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
static void setBlocking(SocketHandle sock, bool block);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// Get the last socket error status
|
|
||||||
///
|
|
||||||
/// \return Status corresponding to the last socket error
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
static Socket::Status getErrorStatus();
|
|
||||||
};
|
|
||||||
|
|
||||||
} // namespace priv
|
|
||||||
|
|
||||||
} // namespace sf
|
|
||||||
|
|
||||||
|
|
||||||
#endif // SFML_SOCKETIMPL_HPP
|
|
112
Externals/SFML/src/SFML/Network/Win32/SocketImpl.cpp
vendored
112
Externals/SFML/src/SFML/Network/Win32/SocketImpl.cpp
vendored
|
@ -1,112 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Headers
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#include <SFML/Network/Win32/SocketImpl.hpp>
|
|
||||||
#include <cstring>
|
|
||||||
|
|
||||||
|
|
||||||
namespace sf
|
|
||||||
{
|
|
||||||
namespace priv
|
|
||||||
{
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
sockaddr_in SocketImpl::createAddress(Uint32 address, unsigned short port)
|
|
||||||
{
|
|
||||||
sockaddr_in addr;
|
|
||||||
std::memset(&addr, 0, sizeof(addr));
|
|
||||||
addr.sin_addr.s_addr = htonl(address);
|
|
||||||
addr.sin_family = AF_INET;
|
|
||||||
addr.sin_port = htons(port);
|
|
||||||
|
|
||||||
return addr;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
SocketHandle SocketImpl::invalidSocket()
|
|
||||||
{
|
|
||||||
return INVALID_SOCKET;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void SocketImpl::close(SocketHandle sock)
|
|
||||||
{
|
|
||||||
closesocket(sock);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void SocketImpl::setBlocking(SocketHandle sock, bool block)
|
|
||||||
{
|
|
||||||
u_long blocking = block ? 0 : 1;
|
|
||||||
ioctlsocket(sock, FIONBIO, &blocking);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Socket::Status SocketImpl::getErrorStatus()
|
|
||||||
{
|
|
||||||
switch (WSAGetLastError())
|
|
||||||
{
|
|
||||||
case WSAEWOULDBLOCK: return Socket::NotReady;
|
|
||||||
case WSAEALREADY: return Socket::NotReady;
|
|
||||||
case WSAECONNABORTED: return Socket::Disconnected;
|
|
||||||
case WSAECONNRESET: return Socket::Disconnected;
|
|
||||||
case WSAETIMEDOUT: return Socket::Disconnected;
|
|
||||||
case WSAENETRESET: return Socket::Disconnected;
|
|
||||||
case WSAENOTCONN: return Socket::Disconnected;
|
|
||||||
case WSAEISCONN: return Socket::Done; // when connecting a non-blocking socket
|
|
||||||
default: return Socket::Error;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Windows needs some initialization and cleanup to get
|
|
||||||
// sockets working properly... so let's create a class that will
|
|
||||||
// do it automatically
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
struct SocketInitializer
|
|
||||||
{
|
|
||||||
SocketInitializer()
|
|
||||||
{
|
|
||||||
WSADATA init;
|
|
||||||
WSAStartup(MAKEWORD(2, 2), &init);
|
|
||||||
}
|
|
||||||
|
|
||||||
~SocketInitializer()
|
|
||||||
{
|
|
||||||
WSACleanup();
|
|
||||||
}
|
|
||||||
};
|
|
||||||
|
|
||||||
SocketInitializer globalInitializer;
|
|
||||||
|
|
||||||
} // namespace priv
|
|
||||||
|
|
||||||
} // namespace sf
|
|
112
Externals/SFML/src/SFML/Network/Win32/SocketImpl.hpp
vendored
112
Externals/SFML/src/SFML/Network/Win32/SocketImpl.hpp
vendored
|
@ -1,112 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#ifndef SFML_SOCKETIMPL_HPP
|
|
||||||
#define SFML_SOCKETIMPL_HPP
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Headers
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#ifdef _WIN32_WINDOWS
|
|
||||||
#undef _WIN32_WINDOWS
|
|
||||||
#endif
|
|
||||||
#ifdef _WIN32_WINNT
|
|
||||||
#undef _WIN32_WINNT
|
|
||||||
#endif
|
|
||||||
#define _WIN32_WINDOWS 0x0501
|
|
||||||
#define _WIN32_WINNT 0x0501
|
|
||||||
#include <SFML/Network/Socket.hpp>
|
|
||||||
#include <winsock2.h>
|
|
||||||
#include <ws2tcpip.h>
|
|
||||||
|
|
||||||
|
|
||||||
namespace sf
|
|
||||||
{
|
|
||||||
namespace priv
|
|
||||||
{
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Helper class implementing all the non-portable
|
|
||||||
/// socket stuff; this is the Windows version
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
class SocketImpl
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Types
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
typedef int AddrLength;
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Create an internal sockaddr_in address
|
|
||||||
///
|
|
||||||
/// \param address Target address
|
|
||||||
/// \param port Target port
|
|
||||||
///
|
|
||||||
/// \return sockaddr_in ready to be used by socket functions
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
static sockaddr_in createAddress(Uint32 address, unsigned short port);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Return the value of the invalid socket
|
|
||||||
///
|
|
||||||
/// \return Special value of the invalid socket
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
static SocketHandle invalidSocket();
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Close and destroy a socket
|
|
||||||
///
|
|
||||||
/// \param sock Handle of the socket to close
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
static void close(SocketHandle sock);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// \brief Set a socket as blocking or non-blocking
|
|
||||||
///
|
|
||||||
/// \param sock Handle of the socket
|
|
||||||
/// \param block New blocking state of the socket
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
static void setBlocking(SocketHandle sock, bool block);
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
/// Get the last socket error status
|
|
||||||
///
|
|
||||||
/// \return Status corresponding to the last socket error
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
static Socket::Status getErrorStatus();
|
|
||||||
};
|
|
||||||
|
|
||||||
} // namespace priv
|
|
||||||
|
|
||||||
} // namespace sf
|
|
||||||
|
|
||||||
|
|
||||||
#endif // SFML_SOCKETIMPL_HPP
|
|
110
Externals/SFML/src/SFML/System/Err.cpp
vendored
110
Externals/SFML/src/SFML/System/Err.cpp
vendored
|
@ -1,110 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Headers
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#include <SFML/System/Err.hpp>
|
|
||||||
#include <streambuf>
|
|
||||||
#include <cstdio>
|
|
||||||
|
|
||||||
|
|
||||||
namespace
|
|
||||||
{
|
|
||||||
// This class will be used as the default streambuf of sf::Err,
|
|
||||||
// it outputs to stderr by default (to keep the default behavior)
|
|
||||||
class DefaultErrStreamBuf : public std::streambuf
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
|
|
||||||
DefaultErrStreamBuf()
|
|
||||||
{
|
|
||||||
// Allocate the write buffer
|
|
||||||
static const int size = 64;
|
|
||||||
char* buffer = new char[size];
|
|
||||||
setp(buffer, buffer + size);
|
|
||||||
}
|
|
||||||
|
|
||||||
~DefaultErrStreamBuf()
|
|
||||||
{
|
|
||||||
// Synchronize
|
|
||||||
sync();
|
|
||||||
|
|
||||||
// Delete the write buffer
|
|
||||||
delete[] pbase();
|
|
||||||
}
|
|
||||||
|
|
||||||
private:
|
|
||||||
|
|
||||||
virtual int overflow(int character)
|
|
||||||
{
|
|
||||||
if ((character != EOF) && (pptr() != epptr()))
|
|
||||||
{
|
|
||||||
// Valid character
|
|
||||||
return sputc(static_cast<char>(character));
|
|
||||||
}
|
|
||||||
else if (character != EOF)
|
|
||||||
{
|
|
||||||
// Not enough space in the buffer: synchronize output and try again
|
|
||||||
sync();
|
|
||||||
return overflow(character);
|
|
||||||
}
|
|
||||||
else
|
|
||||||
{
|
|
||||||
// Invalid character: synchronize output
|
|
||||||
return sync();
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
virtual int sync()
|
|
||||||
{
|
|
||||||
// Check if there is something into the write buffer
|
|
||||||
if (pbase() != pptr())
|
|
||||||
{
|
|
||||||
// Print the contents of the write buffer into the standard error output
|
|
||||||
std::size_t size = static_cast<int>(pptr() - pbase());
|
|
||||||
fwrite(pbase(), 1, size, stderr);
|
|
||||||
|
|
||||||
// Reset the pointer position to the beginning of the write buffer
|
|
||||||
setp(pbase(), epptr());
|
|
||||||
}
|
|
||||||
|
|
||||||
return 0;
|
|
||||||
}
|
|
||||||
};
|
|
||||||
}
|
|
||||||
|
|
||||||
namespace sf
|
|
||||||
{
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
std::ostream& err()
|
|
||||||
{
|
|
||||||
static DefaultErrStreamBuf buffer;
|
|
||||||
static std::ostream stream(&buffer);
|
|
||||||
|
|
||||||
return stream;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
} // namespace sf
|
|
400
Externals/SFML/src/SFML/System/String.cpp
vendored
400
Externals/SFML/src/SFML/System/String.cpp
vendored
|
@ -1,400 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Headers
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#include <SFML/System/String.hpp>
|
|
||||||
#include <SFML/System/Utf.hpp>
|
|
||||||
#include <iterator>
|
|
||||||
#include <cstring>
|
|
||||||
|
|
||||||
|
|
||||||
namespace sf
|
|
||||||
{
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
const std::size_t String::InvalidPos = std::basic_string<Uint32>::npos;
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
String::String()
|
|
||||||
{
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
String::String(char ansiChar, const std::locale& locale)
|
|
||||||
{
|
|
||||||
m_string += Utf32::decodeAnsi(ansiChar, locale);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
String::String(wchar_t wideChar)
|
|
||||||
{
|
|
||||||
m_string += Utf32::decodeWide(wideChar);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
String::String(Uint32 utf32Char)
|
|
||||||
{
|
|
||||||
m_string += utf32Char;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
String::String(const char* ansiString, const std::locale& locale)
|
|
||||||
{
|
|
||||||
if (ansiString)
|
|
||||||
{
|
|
||||||
std::size_t length = strlen(ansiString);
|
|
||||||
if (length > 0)
|
|
||||||
{
|
|
||||||
m_string.reserve(length + 1);
|
|
||||||
Utf32::fromAnsi(ansiString, ansiString + length, std::back_inserter(m_string), locale);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
String::String(const std::string& ansiString, const std::locale& locale)
|
|
||||||
{
|
|
||||||
m_string.reserve(ansiString.length() + 1);
|
|
||||||
Utf32::fromAnsi(ansiString.begin(), ansiString.end(), std::back_inserter(m_string), locale);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
String::String(const wchar_t* wideString)
|
|
||||||
{
|
|
||||||
if (wideString)
|
|
||||||
{
|
|
||||||
std::size_t length = std::wcslen(wideString);
|
|
||||||
if (length > 0)
|
|
||||||
{
|
|
||||||
m_string.reserve(length + 1);
|
|
||||||
Utf32::fromWide(wideString, wideString + length, std::back_inserter(m_string));
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
String::String(const std::wstring& wideString)
|
|
||||||
{
|
|
||||||
m_string.reserve(wideString.length() + 1);
|
|
||||||
Utf32::fromWide(wideString.begin(), wideString.end(), std::back_inserter(m_string));
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
String::String(const Uint32* utf32String)
|
|
||||||
{
|
|
||||||
if (utf32String)
|
|
||||||
m_string = utf32String;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
String::String(const std::basic_string<Uint32>& utf32String) :
|
|
||||||
m_string(utf32String)
|
|
||||||
{
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
String::String(const String& copy) :
|
|
||||||
m_string(copy.m_string)
|
|
||||||
{
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
String::operator std::string() const
|
|
||||||
{
|
|
||||||
return toAnsiString();
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
String::operator std::wstring() const
|
|
||||||
{
|
|
||||||
return toWideString();
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
std::string String::toAnsiString(const std::locale& locale) const
|
|
||||||
{
|
|
||||||
// Prepare the output string
|
|
||||||
std::string output;
|
|
||||||
output.reserve(m_string.length() + 1);
|
|
||||||
|
|
||||||
// Convert
|
|
||||||
Utf32::toAnsi(m_string.begin(), m_string.end(), std::back_inserter(output), 0, locale);
|
|
||||||
|
|
||||||
return output;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
std::wstring String::toWideString() const
|
|
||||||
{
|
|
||||||
// Prepare the output string
|
|
||||||
std::wstring output;
|
|
||||||
output.reserve(m_string.length() + 1);
|
|
||||||
|
|
||||||
// Convert
|
|
||||||
Utf32::toWide(m_string.begin(), m_string.end(), std::back_inserter(output), 0);
|
|
||||||
|
|
||||||
return output;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
std::basic_string<Uint8> String::toUtf8() const
|
|
||||||
{
|
|
||||||
// Prepare the output string
|
|
||||||
std::basic_string<Uint8> output;
|
|
||||||
output.reserve(m_string.length());
|
|
||||||
|
|
||||||
// Convert
|
|
||||||
Utf32::toUtf8(m_string.begin(), m_string.end(), std::back_inserter(output));
|
|
||||||
|
|
||||||
return output;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
std::basic_string<Uint16> String::toUtf16() const
|
|
||||||
{
|
|
||||||
// Prepare the output string
|
|
||||||
std::basic_string<Uint16> output;
|
|
||||||
output.reserve(m_string.length());
|
|
||||||
|
|
||||||
// Convert
|
|
||||||
Utf32::toUtf16(m_string.begin(), m_string.end(), std::back_inserter(output));
|
|
||||||
|
|
||||||
return output;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
std::basic_string<Uint32> String::toUtf32() const
|
|
||||||
{
|
|
||||||
return m_string;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
String& String::operator =(const String& right)
|
|
||||||
{
|
|
||||||
m_string = right.m_string;
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
String& String::operator +=(const String& right)
|
|
||||||
{
|
|
||||||
m_string += right.m_string;
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Uint32 String::operator [](std::size_t index) const
|
|
||||||
{
|
|
||||||
return m_string[index];
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Uint32& String::operator [](std::size_t index)
|
|
||||||
{
|
|
||||||
return m_string[index];
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void String::clear()
|
|
||||||
{
|
|
||||||
m_string.clear();
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
std::size_t String::getSize() const
|
|
||||||
{
|
|
||||||
return m_string.size();
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
bool String::isEmpty() const
|
|
||||||
{
|
|
||||||
return m_string.empty();
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void String::erase(std::size_t position, std::size_t count)
|
|
||||||
{
|
|
||||||
m_string.erase(position, count);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void String::insert(std::size_t position, const String& str)
|
|
||||||
{
|
|
||||||
m_string.insert(position, str.m_string);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
std::size_t String::find(const String& str, std::size_t start) const
|
|
||||||
{
|
|
||||||
return m_string.find(str.m_string, start);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void String::replace(std::size_t position, std::size_t length, const String& replaceWith)
|
|
||||||
{
|
|
||||||
m_string.replace(position, length, replaceWith.m_string);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
void String::replace(const String& searchFor, const String& replaceWith)
|
|
||||||
{
|
|
||||||
std::size_t step = replaceWith.getSize();
|
|
||||||
std::size_t len = searchFor.getSize();
|
|
||||||
std::size_t pos = find(searchFor);
|
|
||||||
|
|
||||||
// Replace each occurrence of search
|
|
||||||
while (pos != InvalidPos)
|
|
||||||
{
|
|
||||||
replace(pos, len, replaceWith);
|
|
||||||
pos = find(searchFor, pos + step);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
String String::substring(std::size_t position, std::size_t length) const
|
|
||||||
{
|
|
||||||
return m_string.substr(position, length);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
const Uint32* String::getData() const
|
|
||||||
{
|
|
||||||
return m_string.c_str();
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
String::Iterator String::begin()
|
|
||||||
{
|
|
||||||
return m_string.begin();
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
String::ConstIterator String::begin() const
|
|
||||||
{
|
|
||||||
return m_string.begin();
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
String::Iterator String::end()
|
|
||||||
{
|
|
||||||
return m_string.end();
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
String::ConstIterator String::end() const
|
|
||||||
{
|
|
||||||
return m_string.end();
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
bool operator ==(const String& left, const String& right)
|
|
||||||
{
|
|
||||||
return left.m_string == right.m_string;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
bool operator !=(const String& left, const String& right)
|
|
||||||
{
|
|
||||||
return !(left == right);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
bool operator <(const String& left, const String& right)
|
|
||||||
{
|
|
||||||
return left.m_string < right.m_string;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
bool operator >(const String& left, const String& right)
|
|
||||||
{
|
|
||||||
return right < left;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
bool operator <=(const String& left, const String& right)
|
|
||||||
{
|
|
||||||
return !(right < left);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
bool operator >=(const String& left, const String& right)
|
|
||||||
{
|
|
||||||
return !(left < right);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
String operator +(const String& left, const String& right)
|
|
||||||
{
|
|
||||||
String string = left;
|
|
||||||
string += right;
|
|
||||||
|
|
||||||
return string;
|
|
||||||
}
|
|
||||||
|
|
||||||
} // namespace sf
|
|
260
Externals/SFML/src/SFML/System/Time.cpp
vendored
260
Externals/SFML/src/SFML/System/Time.cpp
vendored
|
@ -1,260 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// SFML - Simple and Fast Multimedia Library
|
|
||||||
// Copyright (C) 2007-2018 Laurent Gomila (laurent@sfml-dev.org)
|
|
||||||
//
|
|
||||||
// This software is provided 'as-is', without any express or implied warranty.
|
|
||||||
// In no event will the authors be held liable for any damages arising from the use of this software.
|
|
||||||
//
|
|
||||||
// Permission is granted to anyone to use this software for any purpose,
|
|
||||||
// including commercial applications, and to alter it and redistribute it freely,
|
|
||||||
// subject to the following restrictions:
|
|
||||||
//
|
|
||||||
// 1. The origin of this software must not be misrepresented;
|
|
||||||
// you must not claim that you wrote the original software.
|
|
||||||
// If you use this software in a product, an acknowledgment
|
|
||||||
// in the product documentation would be appreciated but is not required.
|
|
||||||
//
|
|
||||||
// 2. Altered source versions must be plainly marked as such,
|
|
||||||
// and must not be misrepresented as being the original software.
|
|
||||||
//
|
|
||||||
// 3. This notice may not be removed or altered from any source distribution.
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
// Headers
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
#include <SFML/System/Time.hpp>
|
|
||||||
|
|
||||||
|
|
||||||
namespace sf
|
|
||||||
{
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
const Time Time::Zero;
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Time::Time() :
|
|
||||||
m_microseconds(0)
|
|
||||||
{
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
float Time::asSeconds() const
|
|
||||||
{
|
|
||||||
return m_microseconds / 1000000.f;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Int32 Time::asMilliseconds() const
|
|
||||||
{
|
|
||||||
return static_cast<Int32>(m_microseconds / 1000);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Int64 Time::asMicroseconds() const
|
|
||||||
{
|
|
||||||
return m_microseconds;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Time::Time(Int64 microseconds) :
|
|
||||||
m_microseconds(microseconds)
|
|
||||||
{
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Time seconds(float amount)
|
|
||||||
{
|
|
||||||
return Time(static_cast<Int64>(amount * 1000000));
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Time milliseconds(Int32 amount)
|
|
||||||
{
|
|
||||||
return Time(static_cast<Int64>(amount) * 1000);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Time microseconds(Int64 amount)
|
|
||||||
{
|
|
||||||
return Time(amount);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
bool operator ==(Time left, Time right)
|
|
||||||
{
|
|
||||||
return left.asMicroseconds() == right.asMicroseconds();
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
bool operator !=(Time left, Time right)
|
|
||||||
{
|
|
||||||
return left.asMicroseconds() != right.asMicroseconds();
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
bool operator <(Time left, Time right)
|
|
||||||
{
|
|
||||||
return left.asMicroseconds() < right.asMicroseconds();
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
bool operator >(Time left, Time right)
|
|
||||||
{
|
|
||||||
return left.asMicroseconds() > right.asMicroseconds();
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
bool operator <=(Time left, Time right)
|
|
||||||
{
|
|
||||||
return left.asMicroseconds() <= right.asMicroseconds();
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
bool operator >=(Time left, Time right)
|
|
||||||
{
|
|
||||||
return left.asMicroseconds() >= right.asMicroseconds();
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Time operator -(Time right)
|
|
||||||
{
|
|
||||||
return microseconds(-right.asMicroseconds());
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Time operator +(Time left, Time right)
|
|
||||||
{
|
|
||||||
return microseconds(left.asMicroseconds() + right.asMicroseconds());
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Time& operator +=(Time& left, Time right)
|
|
||||||
{
|
|
||||||
return left = left + right;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Time operator -(Time left, Time right)
|
|
||||||
{
|
|
||||||
return microseconds(left.asMicroseconds() - right.asMicroseconds());
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Time& operator -=(Time& left, Time right)
|
|
||||||
{
|
|
||||||
return left = left - right;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Time operator *(Time left, float right)
|
|
||||||
{
|
|
||||||
return seconds(left.asSeconds() * right);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Time operator *(Time left, Int64 right)
|
|
||||||
{
|
|
||||||
return microseconds(left.asMicroseconds() * right);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Time operator *(float left, Time right)
|
|
||||||
{
|
|
||||||
return right * left;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Time operator *(Int64 left, Time right)
|
|
||||||
{
|
|
||||||
return right * left;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Time& operator *=(Time& left, float right)
|
|
||||||
{
|
|
||||||
return left = left * right;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Time& operator *=(Time& left, Int64 right)
|
|
||||||
{
|
|
||||||
return left = left * right;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Time operator /(Time left, float right)
|
|
||||||
{
|
|
||||||
return seconds(left.asSeconds() / right);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Time operator /(Time left, Int64 right)
|
|
||||||
{
|
|
||||||
return microseconds(left.asMicroseconds() / right);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Time& operator /=(Time& left, float right)
|
|
||||||
{
|
|
||||||
return left = left / right;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Time& operator /=(Time& left, Int64 right)
|
|
||||||
{
|
|
||||||
return left = left / right;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
float operator /(Time left, Time right)
|
|
||||||
{
|
|
||||||
return left.asSeconds() / right.asSeconds();
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Time operator %(Time left, Time right)
|
|
||||||
{
|
|
||||||
return microseconds(left.asMicroseconds() % right.asMicroseconds());
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////
|
|
||||||
Time& operator %=(Time& left, Time right)
|
|
||||||
{
|
|
||||||
return left = left % right;
|
|
||||||
}
|
|
||||||
|
|
||||||
} // namespace sf
|
|
2
Externals/licenses.md
vendored
2
Externals/licenses.md
vendored
|
@ -68,8 +68,6 @@ Dolphin includes or links code of the following third-party software projects:
|
||||||
[zlib license](http://hg.libsdl.org/SDL/file/tip/COPYING.txt)
|
[zlib license](http://hg.libsdl.org/SDL/file/tip/COPYING.txt)
|
||||||
- [SFML](http://www.sfml-dev.org/):
|
- [SFML](http://www.sfml-dev.org/):
|
||||||
[zlib license](http://www.sfml-dev.org/license.php)
|
[zlib license](http://www.sfml-dev.org/license.php)
|
||||||
- [SoundTouch](http://www.surina.net/soundtouch/):
|
|
||||||
[LGPLv2+](http://www.surina.net/soundtouch/license.html)
|
|
||||||
- [TAP-Windows](https://openvpn.net/):
|
- [TAP-Windows](https://openvpn.net/):
|
||||||
header only
|
header only
|
||||||
- [Windows Implementation Libraries](https://github.com/microsoft/wil):
|
- [Windows Implementation Libraries](https://github.com/microsoft/wil):
|
||||||
|
|
8
Externals/rcheevos/CMakeLists.txt
vendored
8
Externals/rcheevos/CMakeLists.txt
vendored
|
@ -43,9 +43,12 @@ add_library(rcheevos
|
||||||
rcheevos/src/rhash/hash.c
|
rcheevos/src/rhash/hash.c
|
||||||
rcheevos/src/rhash/md5.c
|
rcheevos/src/rhash/md5.c
|
||||||
rcheevos/src/rhash/md5.h
|
rcheevos/src/rhash/md5.h
|
||||||
|
rcheevos/src/rhash/rc_hash_internal.h
|
||||||
rcheevos/src/rurl/url.c
|
rcheevos/src/rurl/url.c
|
||||||
rcheevos/src/rc_client.c
|
rcheevos/src/rc_client.c
|
||||||
|
rcheevos/src/rc_client_external.c
|
||||||
rcheevos/src/rc_client_external.h
|
rcheevos/src/rc_client_external.h
|
||||||
|
rcheevos/src/rc_client_external_versions.h
|
||||||
rcheevos/src/rc_client_internal.h
|
rcheevos/src/rc_client_internal.h
|
||||||
rcheevos/src/rc_client_raintegration.c
|
rcheevos/src/rc_client_raintegration.c
|
||||||
rcheevos/src/rc_client_raintegration_internal.h
|
rcheevos/src/rc_client_raintegration_internal.h
|
||||||
|
@ -61,6 +64,11 @@ target_include_directories(rcheevos PRIVATE "${CMAKE_CURRENT_SOURCE_DIR}/rcheevo
|
||||||
target_include_directories(rcheevos INTERFACE "${CMAKE_CURRENT_SOURCE_DIR}")
|
target_include_directories(rcheevos INTERFACE "${CMAKE_CURRENT_SOURCE_DIR}")
|
||||||
target_compile_definitions(rcheevos PRIVATE "RC_DISABLE_LUA=1" "RCHEEVOS_URL_SSL")
|
target_compile_definitions(rcheevos PRIVATE "RC_DISABLE_LUA=1" "RCHEEVOS_URL_SSL")
|
||||||
target_compile_definitions(rcheevos PRIVATE "RC_CLIENT_SUPPORTS_HASH")
|
target_compile_definitions(rcheevos PRIVATE "RC_CLIENT_SUPPORTS_HASH")
|
||||||
|
target_compile_definitions(rcheevos PRIVATE "RC_CLIENT_SUPPORTS_EXTERNAL")
|
||||||
|
target_compile_definitions(rcheevos PRIVATE "RC_HASH_NO_ENCRYPTED")
|
||||||
|
target_compile_definitions(rcheevos PRIVATE "RC_HASH_NO_ROM")
|
||||||
|
target_compile_definitions(rcheevos PRIVATE "RC_HASH_NO_ZIP")
|
||||||
if(CMAKE_SYSTEM_NAME MATCHES "Windows")
|
if(CMAKE_SYSTEM_NAME MATCHES "Windows")
|
||||||
|
target_compile_definitions(rcheevos PRIVATE "RC_CLIENT_SUPPORTS_RAINTEGRATION")
|
||||||
target_compile_definitions(rcheevos PRIVATE "_CRT_SECURE_NO_WARNINGS")
|
target_compile_definitions(rcheevos PRIVATE "_CRT_SECURE_NO_WARNINGS")
|
||||||
endif()
|
endif()
|
||||||
|
|
2
Externals/rcheevos/rcheevos
vendored
2
Externals/rcheevos/rcheevos
vendored
|
@ -1 +1 @@
|
||||||
Subproject commit d54cf8f1059cebc90a6f5ecdf03df69259f22054
|
Subproject commit 022ac70cff6cf60c8957de63d6297998904a6f05
|
5
Externals/rcheevos/rcheevos.vcxproj
vendored
5
Externals/rcheevos/rcheevos.vcxproj
vendored
|
@ -41,6 +41,7 @@
|
||||||
<ClCompile Include="rcheevos\src\rhash\md5.c" />
|
<ClCompile Include="rcheevos\src\rhash\md5.c" />
|
||||||
<ClCompile Include="rcheevos\src\rurl\url.c" />
|
<ClCompile Include="rcheevos\src\rurl\url.c" />
|
||||||
<ClCompile Include="rcheevos\src\rc_client.c" />
|
<ClCompile Include="rcheevos\src\rc_client.c" />
|
||||||
|
<ClCompile Include="rcheevos\src\rc_client_external.c" />
|
||||||
<ClCompile Include="rcheevos\src\rc_client_raintegration.c" />
|
<ClCompile Include="rcheevos\src\rc_client_raintegration.c" />
|
||||||
<ClCompile Include="rcheevos\src\rc_compat.c" />
|
<ClCompile Include="rcheevos\src\rc_compat.c" />
|
||||||
<ClCompile Include="rcheevos\src\rc_util.c" />
|
<ClCompile Include="rcheevos\src\rc_util.c" />
|
||||||
|
@ -68,7 +69,9 @@
|
||||||
<ClInclude Include="rcheevos\src\rcheevos\rc_validate.h" />
|
<ClInclude Include="rcheevos\src\rcheevos\rc_validate.h" />
|
||||||
<ClInclude Include="rcheevos\src\rhash\aes.h" />
|
<ClInclude Include="rcheevos\src\rhash\aes.h" />
|
||||||
<ClInclude Include="rcheevos\src\rhash\md5.h" />
|
<ClInclude Include="rcheevos\src\rhash\md5.h" />
|
||||||
|
<ClInclude Include="rcheevos\src\rhash\rc_hash_internal.h" />
|
||||||
<ClInclude Include="rcheevos\src\rc_client_external.h" />
|
<ClInclude Include="rcheevos\src\rc_client_external.h" />
|
||||||
|
<ClInclude Include="rcheevos\src\rc_client_external_versions.h" />
|
||||||
<ClInclude Include="rcheevos\src\rc_client_internal.h" />
|
<ClInclude Include="rcheevos\src\rc_client_internal.h" />
|
||||||
<ClInclude Include="rcheevos\src\rc_client_raintegration_internal.h" />
|
<ClInclude Include="rcheevos\src\rc_client_raintegration_internal.h" />
|
||||||
<ClInclude Include="rcheevos\src\rc_compat.h" />
|
<ClInclude Include="rcheevos\src\rc_compat.h" />
|
||||||
|
@ -76,7 +79,7 @@
|
||||||
</ItemGroup>
|
</ItemGroup>
|
||||||
<ItemDefinitionGroup>
|
<ItemDefinitionGroup>
|
||||||
<ClCompile>
|
<ClCompile>
|
||||||
<PreprocessorDefinitions>RC_DISABLE_LUA;RCHEEVOS_URL_SSL;RC_CLIENT_SUPPORTS_HASH;%(PreprocessorDefinitions)</PreprocessorDefinitions>
|
<PreprocessorDefinitions>RC_DISABLE_LUA;RCHEEVOS_URL_SSL;RC_CLIENT_SUPPORTS_HASH;RC_CLIENT_SUPPORTS_EXTERNAL;RC_CLIENT_SUPPORTS_RAINTEGRATION;RC_HASH_NO_ENCRYPTED;RC_HASH_NO_ROM;RC_HASH_NO_ZIP;%(PreprocessorDefinitions)</PreprocessorDefinitions>
|
||||||
<AdditionalIncludeDirectories>$(ProjectDir)rcheevos\include;%(AdditionalIncludeDirectories)</AdditionalIncludeDirectories>
|
<AdditionalIncludeDirectories>$(ProjectDir)rcheevos\include;%(AdditionalIncludeDirectories)</AdditionalIncludeDirectories>
|
||||||
</ClCompile>
|
</ClCompile>
|
||||||
</ItemDefinitionGroup>
|
</ItemDefinitionGroup>
|
||||||
|
|
222
Externals/soundtouch/AAFilter.cpp
vendored
222
Externals/soundtouch/AAFilter.cpp
vendored
|
@ -1,222 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
///
|
|
||||||
/// FIR low-pass (anti-alias) filter with filter coefficient design routine and
|
|
||||||
/// MMX optimization.
|
|
||||||
///
|
|
||||||
/// Anti-alias filter is used to prevent folding of high frequencies when
|
|
||||||
/// transposing the sample rate with interpolation.
|
|
||||||
///
|
|
||||||
/// Author : Copyright (c) Olli Parviainen
|
|
||||||
/// Author e-mail : oparviai 'at' iki.fi
|
|
||||||
/// SoundTouch WWW: http://www.surina.net/soundtouch
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// License :
|
|
||||||
//
|
|
||||||
// SoundTouch audio processing library
|
|
||||||
// Copyright (c) Olli Parviainen
|
|
||||||
//
|
|
||||||
// This library is free software; you can redistribute it and/or
|
|
||||||
// modify it under the terms of the GNU Lesser General Public
|
|
||||||
// License as published by the Free Software Foundation; either
|
|
||||||
// version 2.1 of the License, or (at your option) any later version.
|
|
||||||
//
|
|
||||||
// This library is distributed in the hope that it will be useful,
|
|
||||||
// but WITHOUT ANY WARRANTY; without even the implied warranty of
|
|
||||||
// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
|
||||||
// Lesser General Public License for more details.
|
|
||||||
//
|
|
||||||
// You should have received a copy of the GNU Lesser General Public
|
|
||||||
// License along with this library; if not, write to the Free Software
|
|
||||||
// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#include <memory.h>
|
|
||||||
#include <assert.h>
|
|
||||||
#include <math.h>
|
|
||||||
#include <stdlib.h>
|
|
||||||
#include "AAFilter.h"
|
|
||||||
#include "FIRFilter.h"
|
|
||||||
|
|
||||||
using namespace soundtouch;
|
|
||||||
|
|
||||||
#define PI 3.14159265358979323846
|
|
||||||
#define TWOPI (2 * PI)
|
|
||||||
|
|
||||||
// define this to save AA filter coefficients to a file
|
|
||||||
// #define _DEBUG_SAVE_AAFILTER_COEFFICIENTS 1
|
|
||||||
|
|
||||||
#ifdef _DEBUG_SAVE_AAFILTER_COEFFICIENTS
|
|
||||||
#include <stdio.h>
|
|
||||||
|
|
||||||
static void _DEBUG_SAVE_AAFIR_COEFFS(SAMPLETYPE *coeffs, int len)
|
|
||||||
{
|
|
||||||
FILE *fptr = fopen("aa_filter_coeffs.txt", "wt");
|
|
||||||
if (fptr == nullptr) return;
|
|
||||||
|
|
||||||
for (int i = 0; i < len; i ++)
|
|
||||||
{
|
|
||||||
double temp = coeffs[i];
|
|
||||||
fprintf(fptr, "%lf\n", temp);
|
|
||||||
}
|
|
||||||
fclose(fptr);
|
|
||||||
}
|
|
||||||
|
|
||||||
#else
|
|
||||||
#define _DEBUG_SAVE_AAFIR_COEFFS(x, y)
|
|
||||||
#endif
|
|
||||||
|
|
||||||
/*****************************************************************************
|
|
||||||
*
|
|
||||||
* Implementation of the class 'AAFilter'
|
|
||||||
*
|
|
||||||
*****************************************************************************/
|
|
||||||
|
|
||||||
AAFilter::AAFilter(uint len)
|
|
||||||
{
|
|
||||||
pFIR = FIRFilter::newInstance();
|
|
||||||
cutoffFreq = 0.5;
|
|
||||||
setLength(len);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
AAFilter::~AAFilter()
|
|
||||||
{
|
|
||||||
delete pFIR;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// Sets new anti-alias filter cut-off edge frequency, scaled to
|
|
||||||
// sampling frequency (nyquist frequency = 0.5).
|
|
||||||
// The filter will cut frequencies higher than the given frequency.
|
|
||||||
void AAFilter::setCutoffFreq(double newCutoffFreq)
|
|
||||||
{
|
|
||||||
cutoffFreq = newCutoffFreq;
|
|
||||||
calculateCoeffs();
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// Sets number of FIR filter taps
|
|
||||||
void AAFilter::setLength(uint newLength)
|
|
||||||
{
|
|
||||||
length = newLength;
|
|
||||||
calculateCoeffs();
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// Calculates coefficients for a low-pass FIR filter using Hamming window
|
|
||||||
void AAFilter::calculateCoeffs()
|
|
||||||
{
|
|
||||||
uint i;
|
|
||||||
double cntTemp, temp, tempCoeff,h, w;
|
|
||||||
double wc;
|
|
||||||
double scaleCoeff, sum;
|
|
||||||
double *work;
|
|
||||||
SAMPLETYPE *coeffs;
|
|
||||||
|
|
||||||
assert(length >= 2);
|
|
||||||
assert(length % 4 == 0);
|
|
||||||
assert(cutoffFreq >= 0);
|
|
||||||
assert(cutoffFreq <= 0.5);
|
|
||||||
|
|
||||||
work = new double[length];
|
|
||||||
coeffs = new SAMPLETYPE[length];
|
|
||||||
|
|
||||||
wc = 2.0 * PI * cutoffFreq;
|
|
||||||
tempCoeff = TWOPI / (double)length;
|
|
||||||
|
|
||||||
sum = 0;
|
|
||||||
for (i = 0; i < length; i ++)
|
|
||||||
{
|
|
||||||
cntTemp = (double)i - (double)(length / 2);
|
|
||||||
|
|
||||||
temp = cntTemp * wc;
|
|
||||||
if (temp != 0)
|
|
||||||
{
|
|
||||||
h = sin(temp) / temp; // sinc function
|
|
||||||
}
|
|
||||||
else
|
|
||||||
{
|
|
||||||
h = 1.0;
|
|
||||||
}
|
|
||||||
w = 0.54 + 0.46 * cos(tempCoeff * cntTemp); // hamming window
|
|
||||||
|
|
||||||
temp = w * h;
|
|
||||||
work[i] = temp;
|
|
||||||
|
|
||||||
// calc net sum of coefficients
|
|
||||||
sum += temp;
|
|
||||||
}
|
|
||||||
|
|
||||||
// ensure the sum of coefficients is larger than zero
|
|
||||||
assert(sum > 0);
|
|
||||||
|
|
||||||
// ensure we've really designed a lowpass filter...
|
|
||||||
assert(work[length/2] > 0);
|
|
||||||
assert(work[length/2 + 1] > -1e-6);
|
|
||||||
assert(work[length/2 - 1] > -1e-6);
|
|
||||||
|
|
||||||
// Calculate a scaling coefficient in such a way that the result can be
|
|
||||||
// divided by 16384
|
|
||||||
scaleCoeff = 16384.0f / sum;
|
|
||||||
|
|
||||||
for (i = 0; i < length; i ++)
|
|
||||||
{
|
|
||||||
temp = work[i] * scaleCoeff;
|
|
||||||
// scale & round to nearest integer
|
|
||||||
temp += (temp >= 0) ? 0.5 : -0.5;
|
|
||||||
// ensure no overfloods
|
|
||||||
assert(temp >= -32768 && temp <= 32767);
|
|
||||||
coeffs[i] = (SAMPLETYPE)temp;
|
|
||||||
}
|
|
||||||
|
|
||||||
// Set coefficients. Use divide factor 14 => divide result by 2^14 = 16384
|
|
||||||
pFIR->setCoefficients(coeffs, length, 14);
|
|
||||||
|
|
||||||
_DEBUG_SAVE_AAFIR_COEFFS(coeffs, length);
|
|
||||||
|
|
||||||
delete[] work;
|
|
||||||
delete[] coeffs;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// Applies the filter to the given sequence of samples.
|
|
||||||
// Note : The amount of outputted samples is by value of 'filter length'
|
|
||||||
// smaller than the amount of input samples.
|
|
||||||
uint AAFilter::evaluate(SAMPLETYPE *dest, const SAMPLETYPE *src, uint numSamples, uint numChannels) const
|
|
||||||
{
|
|
||||||
return pFIR->evaluate(dest, src, numSamples, numChannels);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
/// Applies the filter to the given src & dest pipes, so that processed amount of
|
|
||||||
/// samples get removed from src, and produced amount added to dest
|
|
||||||
/// Note : The amount of outputted samples is by value of 'filter length'
|
|
||||||
/// smaller than the amount of input samples.
|
|
||||||
uint AAFilter::evaluate(FIFOSampleBuffer &dest, FIFOSampleBuffer &src) const
|
|
||||||
{
|
|
||||||
SAMPLETYPE *pdest;
|
|
||||||
const SAMPLETYPE *psrc;
|
|
||||||
uint numSrcSamples;
|
|
||||||
uint result;
|
|
||||||
int numChannels = src.getChannels();
|
|
||||||
|
|
||||||
assert(numChannels == dest.getChannels());
|
|
||||||
|
|
||||||
numSrcSamples = src.numSamples();
|
|
||||||
psrc = src.ptrBegin();
|
|
||||||
pdest = dest.ptrEnd(numSrcSamples);
|
|
||||||
result = pFIR->evaluate(pdest, psrc, numSrcSamples, numChannels);
|
|
||||||
src.receiveSamples(result);
|
|
||||||
dest.putSamples(result);
|
|
||||||
|
|
||||||
return result;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
uint AAFilter::getLength() const
|
|
||||||
{
|
|
||||||
return pFIR->getLength();
|
|
||||||
}
|
|
93
Externals/soundtouch/AAFilter.h
vendored
93
Externals/soundtouch/AAFilter.h
vendored
|
@ -1,93 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
///
|
|
||||||
/// Sampled sound tempo changer/time stretch algorithm. Changes the sound tempo
|
|
||||||
/// while maintaining the original pitch by using a time domain WSOLA-like method
|
|
||||||
/// with several performance-increasing tweaks.
|
|
||||||
///
|
|
||||||
/// Anti-alias filter is used to prevent folding of high frequencies when
|
|
||||||
/// transposing the sample rate with interpolation.
|
|
||||||
///
|
|
||||||
/// Author : Copyright (c) Olli Parviainen
|
|
||||||
/// Author e-mail : oparviai 'at' iki.fi
|
|
||||||
/// SoundTouch WWW: http://www.surina.net/soundtouch
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// License :
|
|
||||||
//
|
|
||||||
// SoundTouch audio processing library
|
|
||||||
// Copyright (c) Olli Parviainen
|
|
||||||
//
|
|
||||||
// This library is free software; you can redistribute it and/or
|
|
||||||
// modify it under the terms of the GNU Lesser General Public
|
|
||||||
// License as published by the Free Software Foundation; either
|
|
||||||
// version 2.1 of the License, or (at your option) any later version.
|
|
||||||
//
|
|
||||||
// This library is distributed in the hope that it will be useful,
|
|
||||||
// but WITHOUT ANY WARRANTY; without even the implied warranty of
|
|
||||||
// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
|
||||||
// Lesser General Public License for more details.
|
|
||||||
//
|
|
||||||
// You should have received a copy of the GNU Lesser General Public
|
|
||||||
// License along with this library; if not, write to the Free Software
|
|
||||||
// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#ifndef AAFilter_H
|
|
||||||
#define AAFilter_H
|
|
||||||
|
|
||||||
#include "STTypes.h"
|
|
||||||
#include "FIFOSampleBuffer.h"
|
|
||||||
|
|
||||||
namespace soundtouch
|
|
||||||
{
|
|
||||||
|
|
||||||
class AAFilter
|
|
||||||
{
|
|
||||||
protected:
|
|
||||||
class FIRFilter *pFIR;
|
|
||||||
|
|
||||||
/// Low-pass filter cut-off frequency, negative = invalid
|
|
||||||
double cutoffFreq;
|
|
||||||
|
|
||||||
/// num of filter taps
|
|
||||||
uint length;
|
|
||||||
|
|
||||||
/// Calculate the FIR coefficients realizing the given cutoff-frequency
|
|
||||||
void calculateCoeffs();
|
|
||||||
public:
|
|
||||||
AAFilter(uint length);
|
|
||||||
|
|
||||||
~AAFilter();
|
|
||||||
|
|
||||||
/// Sets new anti-alias filter cut-off edge frequency, scaled to sampling
|
|
||||||
/// frequency (nyquist frequency = 0.5). The filter will cut off the
|
|
||||||
/// frequencies than that.
|
|
||||||
void setCutoffFreq(double newCutoffFreq);
|
|
||||||
|
|
||||||
/// Sets number of FIR filter taps, i.e. ~filter complexity
|
|
||||||
void setLength(uint newLength);
|
|
||||||
|
|
||||||
uint getLength() const;
|
|
||||||
|
|
||||||
/// Applies the filter to the given sequence of samples.
|
|
||||||
/// Note : The amount of outputted samples is by value of 'filter length'
|
|
||||||
/// smaller than the amount of input samples.
|
|
||||||
uint evaluate(SAMPLETYPE *dest,
|
|
||||||
const SAMPLETYPE *src,
|
|
||||||
uint numSamples,
|
|
||||||
uint numChannels) const;
|
|
||||||
|
|
||||||
/// Applies the filter to the given src & dest pipes, so that processed amount of
|
|
||||||
/// samples get removed from src, and produced amount added to dest
|
|
||||||
/// Note : The amount of outputted samples is by value of 'filter length'
|
|
||||||
/// smaller than the amount of input samples.
|
|
||||||
uint evaluate(FIFOSampleBuffer &dest,
|
|
||||||
FIFOSampleBuffer &src) const;
|
|
||||||
|
|
||||||
};
|
|
||||||
|
|
||||||
}
|
|
||||||
|
|
||||||
#endif
|
|
570
Externals/soundtouch/BPMDetect.cpp
vendored
570
Externals/soundtouch/BPMDetect.cpp
vendored
|
@ -1,570 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
///
|
|
||||||
/// Beats-per-minute (BPM) detection routine.
|
|
||||||
///
|
|
||||||
/// The beat detection algorithm works as follows:
|
|
||||||
/// - Use function 'inputSamples' to input a chunks of samples to the class for
|
|
||||||
/// analysis. It's a good idea to enter a large sound file or stream in smallish
|
|
||||||
/// chunks of around few kilosamples in order not to extinguish too much RAM memory.
|
|
||||||
/// - Inputted sound data is decimated to approx 500 Hz to reduce calculation burden,
|
|
||||||
/// which is basically ok as low (bass) frequencies mostly determine the beat rate.
|
|
||||||
/// Simple averaging is used for anti-alias filtering because the resulting signal
|
|
||||||
/// quality isn't of that high importance.
|
|
||||||
/// - Decimated sound data is enveloped, i.e. the amplitude shape is detected by
|
|
||||||
/// taking absolute value that's smoothed by sliding average. Signal levels that
|
|
||||||
/// are below a couple of times the general RMS amplitude level are cut away to
|
|
||||||
/// leave only notable peaks there.
|
|
||||||
/// - Repeating sound patterns (e.g. beats) are detected by calculating short-term
|
|
||||||
/// autocorrelation function of the enveloped signal.
|
|
||||||
/// - After whole sound data file has been analyzed as above, the bpm level is
|
|
||||||
/// detected by function 'getBpm' that finds the highest peak of the autocorrelation
|
|
||||||
/// function, calculates it's precise location and converts this reading to bpm's.
|
|
||||||
///
|
|
||||||
/// Author : Copyright (c) Olli Parviainen
|
|
||||||
/// Author e-mail : oparviai 'at' iki.fi
|
|
||||||
/// SoundTouch WWW: http://www.surina.net/soundtouch
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// License :
|
|
||||||
//
|
|
||||||
// SoundTouch audio processing library
|
|
||||||
// Copyright (c) Olli Parviainen
|
|
||||||
//
|
|
||||||
// This library is free software; you can redistribute it and/or
|
|
||||||
// modify it under the terms of the GNU Lesser General Public
|
|
||||||
// License as published by the Free Software Foundation; either
|
|
||||||
// version 2.1 of the License, or (at your option) any later version.
|
|
||||||
//
|
|
||||||
// This library is distributed in the hope that it will be useful,
|
|
||||||
// but WITHOUT ANY WARRANTY; without even the implied warranty of
|
|
||||||
// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
|
||||||
// Lesser General Public License for more details.
|
|
||||||
//
|
|
||||||
// You should have received a copy of the GNU Lesser General Public
|
|
||||||
// License along with this library; if not, write to the Free Software
|
|
||||||
// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#include <math.h>
|
|
||||||
#include <assert.h>
|
|
||||||
#include <string.h>
|
|
||||||
#include <stdio.h>
|
|
||||||
#include <cfloat>
|
|
||||||
#include "FIFOSampleBuffer.h"
|
|
||||||
#include "PeakFinder.h"
|
|
||||||
#include "BPMDetect.h"
|
|
||||||
|
|
||||||
using namespace soundtouch;
|
|
||||||
|
|
||||||
// algorithm input sample block size
|
|
||||||
static const int INPUT_BLOCK_SIZE = 2048;
|
|
||||||
|
|
||||||
// decimated sample block size
|
|
||||||
static const int DECIMATED_BLOCK_SIZE = 256;
|
|
||||||
|
|
||||||
/// Target sample rate after decimation
|
|
||||||
static const int TARGET_SRATE = 1000;
|
|
||||||
|
|
||||||
/// XCorr update sequence size, update in about 200msec chunks
|
|
||||||
static const int XCORR_UPDATE_SEQUENCE = (int)(TARGET_SRATE / 5);
|
|
||||||
|
|
||||||
/// Moving average N size
|
|
||||||
static const int MOVING_AVERAGE_N = 15;
|
|
||||||
|
|
||||||
/// XCorr decay time constant, decay to half in 30 seconds
|
|
||||||
/// If it's desired to have the system adapt quicker to beat rate
|
|
||||||
/// changes within a continuing music stream, then the
|
|
||||||
/// 'xcorr_decay_time_constant' value can be reduced, yet that
|
|
||||||
/// can increase possibility of glitches in bpm detection.
|
|
||||||
static const double XCORR_DECAY_TIME_CONSTANT = 30.0;
|
|
||||||
|
|
||||||
/// Data overlap factor for beat detection algorithm
|
|
||||||
static const int OVERLAP_FACTOR = 4;
|
|
||||||
|
|
||||||
#define PI 3.14159265358979323846
|
|
||||||
#define TWOPI (2 * PI)
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
// Enable following define to create bpm analysis file:
|
|
||||||
|
|
||||||
//#define _CREATE_BPM_DEBUG_FILE
|
|
||||||
|
|
||||||
#ifdef _CREATE_BPM_DEBUG_FILE
|
|
||||||
|
|
||||||
static void _SaveDebugData(const char *name, const float *data, int minpos, int maxpos, double coeff)
|
|
||||||
{
|
|
||||||
FILE *fptr = fopen(name, "wt");
|
|
||||||
int i;
|
|
||||||
|
|
||||||
if (fptr)
|
|
||||||
{
|
|
||||||
printf("\nWriting BPM debug data into file %s\n", name);
|
|
||||||
for (i = minpos; i < maxpos; i ++)
|
|
||||||
{
|
|
||||||
fprintf(fptr, "%d\t%.1lf\t%f\n", i, coeff / (double)i, data[i]);
|
|
||||||
}
|
|
||||||
fclose(fptr);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
void _SaveDebugBeatPos(const char *name, const std::vector<BEAT> &beats)
|
|
||||||
{
|
|
||||||
printf("\nWriting beat detections data into file %s\n", name);
|
|
||||||
|
|
||||||
FILE *fptr = fopen(name, "wt");
|
|
||||||
if (fptr)
|
|
||||||
{
|
|
||||||
for (uint i = 0; i < beats.size(); i++)
|
|
||||||
{
|
|
||||||
BEAT b = beats[i];
|
|
||||||
fprintf(fptr, "%lf\t%lf\n", b.pos, b.strength);
|
|
||||||
}
|
|
||||||
fclose(fptr);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
#else
|
|
||||||
#define _SaveDebugData(name, a,b,c,d)
|
|
||||||
#define _SaveDebugBeatPos(name, b)
|
|
||||||
#endif
|
|
||||||
|
|
||||||
// Hamming window
|
|
||||||
void hamming(float *w, int N)
|
|
||||||
{
|
|
||||||
for (int i = 0; i < N; i++)
|
|
||||||
{
|
|
||||||
w[i] = (float)(0.54 - 0.46 * cos(TWOPI * i / (N - 1)));
|
|
||||||
}
|
|
||||||
|
|
||||||
}
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// IIR2_filter - 2nd order IIR filter
|
|
||||||
|
|
||||||
IIR2_filter::IIR2_filter(const double *lpf_coeffs)
|
|
||||||
{
|
|
||||||
memcpy(coeffs, lpf_coeffs, 5 * sizeof(double));
|
|
||||||
memset(prev, 0, sizeof(prev));
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
float IIR2_filter::update(float x)
|
|
||||||
{
|
|
||||||
prev[0] = x;
|
|
||||||
double y = x * coeffs[0];
|
|
||||||
|
|
||||||
for (int i = 4; i >= 1; i--)
|
|
||||||
{
|
|
||||||
y += coeffs[i] * prev[i];
|
|
||||||
prev[i] = prev[i - 1];
|
|
||||||
}
|
|
||||||
|
|
||||||
prev[3] = y;
|
|
||||||
return (float)y;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// IIR low-pass filter coefficients, calculated with matlab/octave cheby2(2,40,0.05)
|
|
||||||
const double _LPF_coeffs[5] = { 0.00996655391939, -0.01944529148401, 0.00996655391939, 1.96867605796247, -0.96916387431724 };
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
BPMDetect::BPMDetect(int numChannels, int aSampleRate) :
|
|
||||||
beat_lpf(_LPF_coeffs)
|
|
||||||
{
|
|
||||||
beats.reserve(250); // initial reservation to prevent frequent reallocation
|
|
||||||
|
|
||||||
this->sampleRate = aSampleRate;
|
|
||||||
this->channels = numChannels;
|
|
||||||
|
|
||||||
decimateSum = 0;
|
|
||||||
decimateCount = 0;
|
|
||||||
|
|
||||||
// choose decimation factor so that result is approx. 1000 Hz
|
|
||||||
decimateBy = sampleRate / TARGET_SRATE;
|
|
||||||
if ((decimateBy <= 0) || (decimateBy * DECIMATED_BLOCK_SIZE < INPUT_BLOCK_SIZE))
|
|
||||||
{
|
|
||||||
ST_THROW_RT_ERROR("Too small samplerate");
|
|
||||||
}
|
|
||||||
|
|
||||||
// Calculate window length & starting item according to desired min & max bpms
|
|
||||||
windowLen = (60 * sampleRate) / (decimateBy * MIN_BPM);
|
|
||||||
windowStart = (60 * sampleRate) / (decimateBy * MAX_BPM_RANGE);
|
|
||||||
|
|
||||||
assert(windowLen > windowStart);
|
|
||||||
|
|
||||||
// allocate new working objects
|
|
||||||
xcorr = new float[windowLen];
|
|
||||||
memset(xcorr, 0, windowLen * sizeof(float));
|
|
||||||
|
|
||||||
pos = 0;
|
|
||||||
peakPos = 0;
|
|
||||||
peakVal = 0;
|
|
||||||
init_scaler = 1;
|
|
||||||
beatcorr_ringbuffpos = 0;
|
|
||||||
beatcorr_ringbuff = new float[windowLen];
|
|
||||||
memset(beatcorr_ringbuff, 0, windowLen * sizeof(float));
|
|
||||||
|
|
||||||
// allocate processing buffer
|
|
||||||
buffer = new FIFOSampleBuffer();
|
|
||||||
// we do processing in mono mode
|
|
||||||
buffer->setChannels(1);
|
|
||||||
buffer->clear();
|
|
||||||
|
|
||||||
// calculate hamming windows
|
|
||||||
hamw = new float[XCORR_UPDATE_SEQUENCE];
|
|
||||||
hamming(hamw, XCORR_UPDATE_SEQUENCE);
|
|
||||||
hamw2 = new float[XCORR_UPDATE_SEQUENCE / 2];
|
|
||||||
hamming(hamw2, XCORR_UPDATE_SEQUENCE / 2);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
BPMDetect::~BPMDetect()
|
|
||||||
{
|
|
||||||
delete[] xcorr;
|
|
||||||
delete[] beatcorr_ringbuff;
|
|
||||||
delete[] hamw;
|
|
||||||
delete[] hamw2;
|
|
||||||
delete buffer;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
/// convert to mono, low-pass filter & decimate to about 500 Hz.
|
|
||||||
/// return number of outputted samples.
|
|
||||||
///
|
|
||||||
/// Decimation is used to remove the unnecessary frequencies and thus to reduce
|
|
||||||
/// the amount of data needed to be processed as calculating autocorrelation
|
|
||||||
/// function is a very-very heavy operation.
|
|
||||||
///
|
|
||||||
/// Anti-alias filtering is done simply by averaging the samples. This is really a
|
|
||||||
/// poor-man's anti-alias filtering, but it's not so critical in this kind of application
|
|
||||||
/// (it'd also be difficult to design a high-quality filter with steep cut-off at very
|
|
||||||
/// narrow band)
|
|
||||||
int BPMDetect::decimate(SAMPLETYPE *dest, const SAMPLETYPE *src, int numsamples)
|
|
||||||
{
|
|
||||||
int count, outcount;
|
|
||||||
LONG_SAMPLETYPE out;
|
|
||||||
|
|
||||||
assert(channels > 0);
|
|
||||||
assert(decimateBy > 0);
|
|
||||||
outcount = 0;
|
|
||||||
for (count = 0; count < numsamples; count ++)
|
|
||||||
{
|
|
||||||
int j;
|
|
||||||
|
|
||||||
// convert to mono and accumulate
|
|
||||||
for (j = 0; j < channels; j ++)
|
|
||||||
{
|
|
||||||
decimateSum += src[j];
|
|
||||||
}
|
|
||||||
src += j;
|
|
||||||
|
|
||||||
decimateCount ++;
|
|
||||||
if (decimateCount >= decimateBy)
|
|
||||||
{
|
|
||||||
// Store every Nth sample only
|
|
||||||
out = (LONG_SAMPLETYPE)(decimateSum / (decimateBy * channels));
|
|
||||||
decimateSum = 0;
|
|
||||||
decimateCount = 0;
|
|
||||||
#ifdef SOUNDTOUCH_INTEGER_SAMPLES
|
|
||||||
// check ranges for sure (shouldn't actually be necessary)
|
|
||||||
if (out > 32767)
|
|
||||||
{
|
|
||||||
out = 32767;
|
|
||||||
}
|
|
||||||
else if (out < -32768)
|
|
||||||
{
|
|
||||||
out = -32768;
|
|
||||||
}
|
|
||||||
#endif // SOUNDTOUCH_INTEGER_SAMPLES
|
|
||||||
dest[outcount] = (SAMPLETYPE)out;
|
|
||||||
outcount ++;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
return outcount;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// Calculates autocorrelation function of the sample history buffer
|
|
||||||
void BPMDetect::updateXCorr(int process_samples)
|
|
||||||
{
|
|
||||||
int offs;
|
|
||||||
SAMPLETYPE *pBuffer;
|
|
||||||
|
|
||||||
assert(buffer->numSamples() >= (uint)(process_samples + windowLen));
|
|
||||||
assert(process_samples == XCORR_UPDATE_SEQUENCE);
|
|
||||||
|
|
||||||
pBuffer = buffer->ptrBegin();
|
|
||||||
|
|
||||||
// calculate decay factor for xcorr filtering
|
|
||||||
float xcorr_decay = (float)pow(0.5, 1.0 / (XCORR_DECAY_TIME_CONSTANT * TARGET_SRATE / process_samples));
|
|
||||||
|
|
||||||
// prescale pbuffer
|
|
||||||
float tmp[XCORR_UPDATE_SEQUENCE];
|
|
||||||
for (int i = 0; i < process_samples; i++)
|
|
||||||
{
|
|
||||||
tmp[i] = hamw[i] * hamw[i] * pBuffer[i];
|
|
||||||
}
|
|
||||||
|
|
||||||
#pragma omp parallel for
|
|
||||||
for (offs = windowStart; offs < windowLen; offs ++)
|
|
||||||
{
|
|
||||||
float sum;
|
|
||||||
int i;
|
|
||||||
|
|
||||||
sum = 0;
|
|
||||||
for (i = 0; i < process_samples; i ++)
|
|
||||||
{
|
|
||||||
sum += tmp[i] * pBuffer[i + offs]; // scaling the sub-result shouldn't be necessary
|
|
||||||
}
|
|
||||||
xcorr[offs] *= xcorr_decay; // decay 'xcorr' here with suitable time constant.
|
|
||||||
|
|
||||||
xcorr[offs] += (float)fabs(sum);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// Detect individual beat positions
|
|
||||||
void BPMDetect::updateBeatPos(int process_samples)
|
|
||||||
{
|
|
||||||
SAMPLETYPE *pBuffer;
|
|
||||||
|
|
||||||
assert(buffer->numSamples() >= (uint)(process_samples + windowLen));
|
|
||||||
|
|
||||||
pBuffer = buffer->ptrBegin();
|
|
||||||
assert(process_samples == XCORR_UPDATE_SEQUENCE / 2);
|
|
||||||
|
|
||||||
// static double thr = 0.0003;
|
|
||||||
double posScale = (double)this->decimateBy / (double)this->sampleRate;
|
|
||||||
int resetDur = (int)(0.12 / posScale + 0.5);
|
|
||||||
|
|
||||||
// prescale pbuffer
|
|
||||||
float tmp[XCORR_UPDATE_SEQUENCE / 2];
|
|
||||||
for (int i = 0; i < process_samples; i++)
|
|
||||||
{
|
|
||||||
tmp[i] = hamw2[i] * hamw2[i] * pBuffer[i];
|
|
||||||
}
|
|
||||||
|
|
||||||
#pragma omp parallel for
|
|
||||||
for (int offs = windowStart; offs < windowLen; offs++)
|
|
||||||
{
|
|
||||||
float sum = 0;
|
|
||||||
for (int i = 0; i < process_samples; i++)
|
|
||||||
{
|
|
||||||
sum += tmp[i] * pBuffer[offs + i];
|
|
||||||
}
|
|
||||||
beatcorr_ringbuff[(beatcorr_ringbuffpos + offs) % windowLen] += (float)((sum > 0) ? sum : 0); // accumulate only positive correlations
|
|
||||||
}
|
|
||||||
|
|
||||||
int skipstep = XCORR_UPDATE_SEQUENCE / OVERLAP_FACTOR;
|
|
||||||
|
|
||||||
// compensate empty buffer at beginning by scaling coefficient
|
|
||||||
float scale = (float)windowLen / (float)(skipstep * init_scaler);
|
|
||||||
if (scale > 1.0f)
|
|
||||||
{
|
|
||||||
init_scaler++;
|
|
||||||
}
|
|
||||||
else
|
|
||||||
{
|
|
||||||
scale = 1.0f;
|
|
||||||
}
|
|
||||||
|
|
||||||
// detect beats
|
|
||||||
for (int i = 0; i < skipstep; i++)
|
|
||||||
{
|
|
||||||
float sum = beatcorr_ringbuff[beatcorr_ringbuffpos];
|
|
||||||
sum -= beat_lpf.update(sum);
|
|
||||||
|
|
||||||
if (sum > peakVal)
|
|
||||||
{
|
|
||||||
// found new local largest value
|
|
||||||
peakVal = sum;
|
|
||||||
peakPos = pos;
|
|
||||||
}
|
|
||||||
if (pos > peakPos + resetDur)
|
|
||||||
{
|
|
||||||
// largest value not updated for 200msec => accept as beat
|
|
||||||
peakPos += skipstep;
|
|
||||||
if (peakVal > 0)
|
|
||||||
{
|
|
||||||
// add detected beat to end of "beats" vector
|
|
||||||
BEAT temp = { (float)(peakPos * posScale), (float)(peakVal * scale) };
|
|
||||||
beats.push_back(temp);
|
|
||||||
}
|
|
||||||
|
|
||||||
peakVal = 0;
|
|
||||||
peakPos = pos;
|
|
||||||
}
|
|
||||||
|
|
||||||
beatcorr_ringbuff[beatcorr_ringbuffpos] = 0;
|
|
||||||
pos++;
|
|
||||||
beatcorr_ringbuffpos = (beatcorr_ringbuffpos + 1) % windowLen;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
#define max(x,y) ((x) > (y) ? (x) : (y))
|
|
||||||
|
|
||||||
void BPMDetect::inputSamples(const SAMPLETYPE *samples, int numSamples)
|
|
||||||
{
|
|
||||||
SAMPLETYPE decimated[DECIMATED_BLOCK_SIZE];
|
|
||||||
|
|
||||||
// iterate so that max INPUT_BLOCK_SAMPLES processed per iteration
|
|
||||||
while (numSamples > 0)
|
|
||||||
{
|
|
||||||
int block;
|
|
||||||
int decSamples;
|
|
||||||
|
|
||||||
block = (numSamples > INPUT_BLOCK_SIZE) ? INPUT_BLOCK_SIZE : numSamples;
|
|
||||||
|
|
||||||
// decimate. note that converts to mono at the same time
|
|
||||||
decSamples = decimate(decimated, samples, block);
|
|
||||||
samples += block * channels;
|
|
||||||
numSamples -= block;
|
|
||||||
|
|
||||||
buffer->putSamples(decimated, decSamples);
|
|
||||||
}
|
|
||||||
|
|
||||||
// when the buffer has enough samples for processing...
|
|
||||||
int req = max(windowLen + XCORR_UPDATE_SEQUENCE, 2 * XCORR_UPDATE_SEQUENCE);
|
|
||||||
while ((int)buffer->numSamples() >= req)
|
|
||||||
{
|
|
||||||
// ... update autocorrelations...
|
|
||||||
updateXCorr(XCORR_UPDATE_SEQUENCE);
|
|
||||||
// ...update beat position calculation...
|
|
||||||
updateBeatPos(XCORR_UPDATE_SEQUENCE / 2);
|
|
||||||
// ... and remove proceessed samples from the buffer
|
|
||||||
int n = XCORR_UPDATE_SEQUENCE / OVERLAP_FACTOR;
|
|
||||||
buffer->receiveSamples(n);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
void BPMDetect::removeBias()
|
|
||||||
{
|
|
||||||
int i;
|
|
||||||
|
|
||||||
// Remove linear bias: calculate linear regression coefficient
|
|
||||||
// 1. calc mean of 'xcorr' and 'i'
|
|
||||||
double mean_i = 0;
|
|
||||||
double mean_x = 0;
|
|
||||||
for (i = windowStart; i < windowLen; i++)
|
|
||||||
{
|
|
||||||
mean_x += xcorr[i];
|
|
||||||
}
|
|
||||||
mean_x /= (windowLen - windowStart);
|
|
||||||
mean_i = 0.5 * (windowLen - 1 + windowStart);
|
|
||||||
|
|
||||||
// 2. calculate linear regression coefficient
|
|
||||||
double b = 0;
|
|
||||||
double div = 0;
|
|
||||||
for (i = windowStart; i < windowLen; i++)
|
|
||||||
{
|
|
||||||
double xt = xcorr[i] - mean_x;
|
|
||||||
double xi = i - mean_i;
|
|
||||||
b += xt * xi;
|
|
||||||
div += xi * xi;
|
|
||||||
}
|
|
||||||
b /= div;
|
|
||||||
|
|
||||||
// subtract linear regression and resolve min. value bias
|
|
||||||
float minval = FLT_MAX; // arbitrary large number
|
|
||||||
for (i = windowStart; i < windowLen; i ++)
|
|
||||||
{
|
|
||||||
xcorr[i] -= (float)(b * i);
|
|
||||||
if (xcorr[i] < minval)
|
|
||||||
{
|
|
||||||
minval = xcorr[i];
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
// subtract min.value
|
|
||||||
for (i = windowStart; i < windowLen; i ++)
|
|
||||||
{
|
|
||||||
xcorr[i] -= minval;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// Calculate N-point moving average for "source" values
|
|
||||||
void MAFilter(float *dest, const float *source, int start, int end, int N)
|
|
||||||
{
|
|
||||||
for (int i = start; i < end; i++)
|
|
||||||
{
|
|
||||||
int i1 = i - N / 2;
|
|
||||||
int i2 = i + N / 2 + 1;
|
|
||||||
if (i1 < start) i1 = start;
|
|
||||||
if (i2 > end) i2 = end;
|
|
||||||
|
|
||||||
double sum = 0;
|
|
||||||
for (int j = i1; j < i2; j ++)
|
|
||||||
{
|
|
||||||
sum += source[j];
|
|
||||||
}
|
|
||||||
dest[i] = (float)(sum / (i2 - i1));
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
float BPMDetect::getBpm()
|
|
||||||
{
|
|
||||||
double peakPos;
|
|
||||||
double coeff;
|
|
||||||
PeakFinder peakFinder;
|
|
||||||
|
|
||||||
// remove bias from xcorr data
|
|
||||||
removeBias();
|
|
||||||
|
|
||||||
coeff = 60.0 * ((double)sampleRate / (double)decimateBy);
|
|
||||||
|
|
||||||
// save bpm debug data if debug data writing enabled
|
|
||||||
_SaveDebugData("soundtouch-bpm-xcorr.txt", xcorr, windowStart, windowLen, coeff);
|
|
||||||
|
|
||||||
// Smoothen by N-point moving-average
|
|
||||||
float *data = new float[windowLen];
|
|
||||||
memset(data, 0, sizeof(float) * windowLen);
|
|
||||||
MAFilter(data, xcorr, windowStart, windowLen, MOVING_AVERAGE_N);
|
|
||||||
|
|
||||||
// find peak position
|
|
||||||
peakPos = peakFinder.detectPeak(data, windowStart, windowLen);
|
|
||||||
|
|
||||||
// save bpm debug data if debug data writing enabled
|
|
||||||
_SaveDebugData("soundtouch-bpm-smoothed.txt", data, windowStart, windowLen, coeff);
|
|
||||||
|
|
||||||
delete[] data;
|
|
||||||
|
|
||||||
assert(decimateBy != 0);
|
|
||||||
if (peakPos < 1e-9) return 0.0; // detection failed.
|
|
||||||
|
|
||||||
_SaveDebugBeatPos("soundtouch-detected-beats.txt", beats);
|
|
||||||
|
|
||||||
// calculate BPM
|
|
||||||
float bpm = (float)(coeff / peakPos);
|
|
||||||
return (bpm >= MIN_BPM && bpm <= MAX_BPM_VALID) ? bpm : 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
/// Get beat position arrays. Note: The array includes also really low beat detection values
|
|
||||||
/// in absence of clear strong beats. Consumer may wish to filter low values away.
|
|
||||||
/// - "pos" receive array of beat positions
|
|
||||||
/// - "values" receive array of beat detection strengths
|
|
||||||
/// - max_num indicates max.size of "pos" and "values" array.
|
|
||||||
///
|
|
||||||
/// You can query a suitable array sized by calling this with nullptr in "pos" & "values".
|
|
||||||
///
|
|
||||||
/// \return number of beats in the arrays.
|
|
||||||
int BPMDetect::getBeats(float *pos, float *values, int max_num)
|
|
||||||
{
|
|
||||||
int num = (int)beats.size();
|
|
||||||
if ((!pos) || (!values)) return num; // pos or values nullptr, return just size
|
|
||||||
|
|
||||||
for (int i = 0; (i < num) && (i < max_num); i++)
|
|
||||||
{
|
|
||||||
pos[i] = beats[i].pos;
|
|
||||||
values[i] = beats[i].strength;
|
|
||||||
}
|
|
||||||
return num;
|
|
||||||
}
|
|
205
Externals/soundtouch/BPMDetect.h
vendored
205
Externals/soundtouch/BPMDetect.h
vendored
|
@ -1,205 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
///
|
|
||||||
/// Beats-per-minute (BPM) detection routine.
|
|
||||||
///
|
|
||||||
/// The beat detection algorithm works as follows:
|
|
||||||
/// - Use function 'inputSamples' to input a chunks of samples to the class for
|
|
||||||
/// analysis. It's a good idea to enter a large sound file or stream in smallish
|
|
||||||
/// chunks of around few kilosamples in order not to extinguish too much RAM memory.
|
|
||||||
/// - Input sound data is decimated to approx 500 Hz to reduce calculation burden,
|
|
||||||
/// which is basically ok as low (bass) frequencies mostly determine the beat rate.
|
|
||||||
/// Simple averaging is used for anti-alias filtering because the resulting signal
|
|
||||||
/// quality isn't of that high importance.
|
|
||||||
/// - Decimated sound data is enveloped, i.e. the amplitude shape is detected by
|
|
||||||
/// taking absolute value that's smoothed by sliding average. Signal levels that
|
|
||||||
/// are below a couple of times the general RMS amplitude level are cut away to
|
|
||||||
/// leave only notable peaks there.
|
|
||||||
/// - Repeating sound patterns (e.g. beats) are detected by calculating short-term
|
|
||||||
/// autocorrelation function of the enveloped signal.
|
|
||||||
/// - After whole sound data file has been analyzed as above, the bpm level is
|
|
||||||
/// detected by function 'getBpm' that finds the highest peak of the autocorrelation
|
|
||||||
/// function, calculates it's precise location and converts this reading to bpm's.
|
|
||||||
///
|
|
||||||
/// Author : Copyright (c) Olli Parviainen
|
|
||||||
/// Author e-mail : oparviai 'at' iki.fi
|
|
||||||
/// SoundTouch WWW: http://www.surina.net/soundtouch
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// License :
|
|
||||||
//
|
|
||||||
// SoundTouch audio processing library
|
|
||||||
// Copyright (c) Olli Parviainen
|
|
||||||
//
|
|
||||||
// This library is free software; you can redistribute it and/or
|
|
||||||
// modify it under the terms of the GNU Lesser General Public
|
|
||||||
// License as published by the Free Software Foundation; either
|
|
||||||
// version 2.1 of the License, or (at your option) any later version.
|
|
||||||
//
|
|
||||||
// This library is distributed in the hope that it will be useful,
|
|
||||||
// but WITHOUT ANY WARRANTY; without even the implied warranty of
|
|
||||||
// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
|
||||||
// Lesser General Public License for more details.
|
|
||||||
//
|
|
||||||
// You should have received a copy of the GNU Lesser General Public
|
|
||||||
// License along with this library; if not, write to the Free Software
|
|
||||||
// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#ifndef _BPMDetect_H_
|
|
||||||
#define _BPMDetect_H_
|
|
||||||
|
|
||||||
#include <vector>
|
|
||||||
#include "STTypes.h"
|
|
||||||
#include "FIFOSampleBuffer.h"
|
|
||||||
|
|
||||||
namespace soundtouch
|
|
||||||
{
|
|
||||||
|
|
||||||
/// Minimum allowed BPM rate. Used to restrict accepted result above a reasonable limit.
|
|
||||||
#define MIN_BPM 45
|
|
||||||
|
|
||||||
/// Maximum allowed BPM rate range. Used for calculating algorithm parametrs
|
|
||||||
#define MAX_BPM_RANGE 200
|
|
||||||
|
|
||||||
/// Maximum allowed BPM rate range. Used to restrict accepted result below a reasonable limit.
|
|
||||||
#define MAX_BPM_VALID 190
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
typedef struct
|
|
||||||
{
|
|
||||||
float pos;
|
|
||||||
float strength;
|
|
||||||
} BEAT;
|
|
||||||
|
|
||||||
|
|
||||||
class IIR2_filter
|
|
||||||
{
|
|
||||||
double coeffs[5];
|
|
||||||
double prev[5];
|
|
||||||
|
|
||||||
public:
|
|
||||||
IIR2_filter(const double *lpf_coeffs);
|
|
||||||
float update(float x);
|
|
||||||
};
|
|
||||||
|
|
||||||
|
|
||||||
/// Class for calculating BPM rate for audio data.
|
|
||||||
class BPMDetect
|
|
||||||
{
|
|
||||||
protected:
|
|
||||||
/// Auto-correlation accumulator bins.
|
|
||||||
float *xcorr;
|
|
||||||
|
|
||||||
/// Sample average counter.
|
|
||||||
int decimateCount;
|
|
||||||
|
|
||||||
/// Sample average accumulator for FIFO-like decimation.
|
|
||||||
soundtouch::LONG_SAMPLETYPE decimateSum;
|
|
||||||
|
|
||||||
/// Decimate sound by this coefficient to reach approx. 500 Hz.
|
|
||||||
int decimateBy;
|
|
||||||
|
|
||||||
/// Auto-correlation window length
|
|
||||||
int windowLen;
|
|
||||||
|
|
||||||
/// Number of channels (1 = mono, 2 = stereo)
|
|
||||||
int channels;
|
|
||||||
|
|
||||||
/// sample rate
|
|
||||||
int sampleRate;
|
|
||||||
|
|
||||||
/// Beginning of auto-correlation window: Autocorrelation isn't being updated for
|
|
||||||
/// the first these many correlation bins.
|
|
||||||
int windowStart;
|
|
||||||
|
|
||||||
/// window functions for data preconditioning
|
|
||||||
float *hamw;
|
|
||||||
float *hamw2;
|
|
||||||
|
|
||||||
// beat detection variables
|
|
||||||
int pos;
|
|
||||||
int peakPos;
|
|
||||||
int beatcorr_ringbuffpos;
|
|
||||||
int init_scaler;
|
|
||||||
float peakVal;
|
|
||||||
float *beatcorr_ringbuff;
|
|
||||||
|
|
||||||
/// FIFO-buffer for decimated processing samples.
|
|
||||||
soundtouch::FIFOSampleBuffer *buffer;
|
|
||||||
|
|
||||||
/// Collection of detected beat positions
|
|
||||||
//BeatCollection beats;
|
|
||||||
std::vector<BEAT> beats;
|
|
||||||
|
|
||||||
// 2nd order low-pass-filter
|
|
||||||
IIR2_filter beat_lpf;
|
|
||||||
|
|
||||||
/// Updates auto-correlation function for given number of decimated samples that
|
|
||||||
/// are read from the internal 'buffer' pipe (samples aren't removed from the pipe
|
|
||||||
/// though).
|
|
||||||
void updateXCorr(int process_samples /// How many samples are processed.
|
|
||||||
);
|
|
||||||
|
|
||||||
/// Decimates samples to approx. 500 Hz.
|
|
||||||
///
|
|
||||||
/// \return Number of output samples.
|
|
||||||
int decimate(soundtouch::SAMPLETYPE *dest, ///< Destination buffer
|
|
||||||
const soundtouch::SAMPLETYPE *src, ///< Source sample buffer
|
|
||||||
int numsamples ///< Number of source samples.
|
|
||||||
);
|
|
||||||
|
|
||||||
/// Calculates amplitude envelope for the buffer of samples.
|
|
||||||
/// Result is output to 'samples'.
|
|
||||||
void calcEnvelope(soundtouch::SAMPLETYPE *samples, ///< Pointer to input/output data buffer
|
|
||||||
int numsamples ///< Number of samples in buffer
|
|
||||||
);
|
|
||||||
|
|
||||||
/// remove constant bias from xcorr data
|
|
||||||
void removeBias();
|
|
||||||
|
|
||||||
// Detect individual beat positions
|
|
||||||
void updateBeatPos(int process_samples);
|
|
||||||
|
|
||||||
|
|
||||||
public:
|
|
||||||
/// Constructor.
|
|
||||||
BPMDetect(int numChannels, ///< Number of channels in sample data.
|
|
||||||
int sampleRate ///< Sample rate in Hz.
|
|
||||||
);
|
|
||||||
|
|
||||||
/// Destructor.
|
|
||||||
virtual ~BPMDetect();
|
|
||||||
|
|
||||||
/// Inputs a block of samples for analyzing: Envelopes the samples and then
|
|
||||||
/// updates the autocorrelation estimation. When whole song data has been input
|
|
||||||
/// in smaller blocks using this function, read the resulting bpm with 'getBpm'
|
|
||||||
/// function.
|
|
||||||
///
|
|
||||||
/// Notice that data in 'samples' array can be disrupted in processing.
|
|
||||||
void inputSamples(const soundtouch::SAMPLETYPE *samples, ///< Pointer to input/working data buffer
|
|
||||||
int numSamples ///< Number of samples in buffer
|
|
||||||
);
|
|
||||||
|
|
||||||
/// Analyzes the results and returns the BPM rate. Use this function to read result
|
|
||||||
/// after whole song data has been input to the class by consecutive calls of
|
|
||||||
/// 'inputSamples' function.
|
|
||||||
///
|
|
||||||
/// \return Beats-per-minute rate, or zero if detection failed.
|
|
||||||
float getBpm();
|
|
||||||
|
|
||||||
/// Get beat position arrays. Note: The array includes also really low beat detection values
|
|
||||||
/// in absence of clear strong beats. Consumer may wish to filter low values away.
|
|
||||||
/// - "pos" receive array of beat positions
|
|
||||||
/// - "values" receive array of beat detection strengths
|
|
||||||
/// - max_num indicates max.size of "pos" and "values" array.
|
|
||||||
///
|
|
||||||
/// You can query a suitable array sized by calling this with nullptr in "pos" & "values".
|
|
||||||
///
|
|
||||||
/// \return number of beats in the arrays.
|
|
||||||
int getBeats(float *pos, float *strength, int max_num);
|
|
||||||
};
|
|
||||||
}
|
|
||||||
#endif // _BPMDetect_H_
|
|
22
Externals/soundtouch/CMakeLists.txt
vendored
22
Externals/soundtouch/CMakeLists.txt
vendored
|
@ -1,22 +0,0 @@
|
||||||
# OSX meeds to know
|
|
||||||
check_and_add_flag(CXX11 -std=c++11)
|
|
||||||
|
|
||||||
set(SRCS
|
|
||||||
AAFilter.cpp
|
|
||||||
BPMDetect.cpp
|
|
||||||
cpu_detect_x86.cpp
|
|
||||||
FIFOSampleBuffer.cpp
|
|
||||||
FIRFilter.cpp
|
|
||||||
InterpolateCubic.cpp
|
|
||||||
InterpolateLinear.cpp
|
|
||||||
InterpolateShannon.cpp
|
|
||||||
mmx_optimized.cpp
|
|
||||||
PeakFinder.cpp
|
|
||||||
RateTransposer.cpp
|
|
||||||
SoundTouch.cpp
|
|
||||||
sse_optimized.cpp
|
|
||||||
TDStretch.cpp
|
|
||||||
)
|
|
||||||
|
|
||||||
add_library(SoundTouch STATIC ${SRCS})
|
|
||||||
dolphin_disable_warnings(SoundTouch)
|
|
275
Externals/soundtouch/FIFOSampleBuffer.cpp
vendored
275
Externals/soundtouch/FIFOSampleBuffer.cpp
vendored
|
@ -1,275 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
///
|
|
||||||
/// A buffer class for temporarily storaging sound samples, operates as a
|
|
||||||
/// first-in-first-out pipe.
|
|
||||||
///
|
|
||||||
/// Samples are added to the end of the sample buffer with the 'putSamples'
|
|
||||||
/// function, and are received from the beginning of the buffer by calling
|
|
||||||
/// the 'receiveSamples' function. The class automatically removes the
|
|
||||||
/// outputted samples from the buffer, as well as grows the buffer size
|
|
||||||
/// whenever necessary.
|
|
||||||
///
|
|
||||||
/// Author : Copyright (c) Olli Parviainen
|
|
||||||
/// Author e-mail : oparviai 'at' iki.fi
|
|
||||||
/// SoundTouch WWW: http://www.surina.net/soundtouch
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// License :
|
|
||||||
//
|
|
||||||
// SoundTouch audio processing library
|
|
||||||
// Copyright (c) Olli Parviainen
|
|
||||||
//
|
|
||||||
// This library is free software; you can redistribute it and/or
|
|
||||||
// modify it under the terms of the GNU Lesser General Public
|
|
||||||
// License as published by the Free Software Foundation; either
|
|
||||||
// version 2.1 of the License, or (at your option) any later version.
|
|
||||||
//
|
|
||||||
// This library is distributed in the hope that it will be useful,
|
|
||||||
// but WITHOUT ANY WARRANTY; without even the implied warranty of
|
|
||||||
// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
|
||||||
// Lesser General Public License for more details.
|
|
||||||
//
|
|
||||||
// You should have received a copy of the GNU Lesser General Public
|
|
||||||
// License along with this library; if not, write to the Free Software
|
|
||||||
// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#include <stdlib.h>
|
|
||||||
#include <memory.h>
|
|
||||||
#include <string.h>
|
|
||||||
#include <assert.h>
|
|
||||||
|
|
||||||
#include "FIFOSampleBuffer.h"
|
|
||||||
|
|
||||||
using namespace soundtouch;
|
|
||||||
|
|
||||||
// Constructor
|
|
||||||
FIFOSampleBuffer::FIFOSampleBuffer(int numChannels)
|
|
||||||
{
|
|
||||||
assert(numChannels > 0);
|
|
||||||
sizeInBytes = 0; // reasonable initial value
|
|
||||||
buffer = nullptr;
|
|
||||||
bufferUnaligned = nullptr;
|
|
||||||
samplesInBuffer = 0;
|
|
||||||
bufferPos = 0;
|
|
||||||
channels = (uint)numChannels;
|
|
||||||
ensureCapacity(32); // allocate initial capacity
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// destructor
|
|
||||||
FIFOSampleBuffer::~FIFOSampleBuffer()
|
|
||||||
{
|
|
||||||
delete[] bufferUnaligned;
|
|
||||||
bufferUnaligned = nullptr;
|
|
||||||
buffer = nullptr;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// Sets number of channels, 1 = mono, 2 = stereo
|
|
||||||
void FIFOSampleBuffer::setChannels(int numChannels)
|
|
||||||
{
|
|
||||||
uint usedBytes;
|
|
||||||
|
|
||||||
if (!verifyNumberOfChannels(numChannels)) return;
|
|
||||||
|
|
||||||
usedBytes = channels * samplesInBuffer;
|
|
||||||
channels = (uint)numChannels;
|
|
||||||
samplesInBuffer = usedBytes / channels;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// if output location pointer 'bufferPos' isn't zero, 'rewinds' the buffer and
|
|
||||||
// zeroes this pointer by copying samples from the 'bufferPos' pointer
|
|
||||||
// location on to the beginning of the buffer.
|
|
||||||
void FIFOSampleBuffer::rewind()
|
|
||||||
{
|
|
||||||
if (buffer && bufferPos)
|
|
||||||
{
|
|
||||||
memmove(buffer, ptrBegin(), sizeof(SAMPLETYPE) * channels * samplesInBuffer);
|
|
||||||
bufferPos = 0;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// Adds 'numSamples' pcs of samples from the 'samples' memory position to
|
|
||||||
// the sample buffer.
|
|
||||||
void FIFOSampleBuffer::putSamples(const SAMPLETYPE *samples, uint nSamples)
|
|
||||||
{
|
|
||||||
memcpy(ptrEnd(nSamples), samples, sizeof(SAMPLETYPE) * nSamples * channels);
|
|
||||||
samplesInBuffer += nSamples;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// Increases the number of samples in the buffer without copying any actual
|
|
||||||
// samples.
|
|
||||||
//
|
|
||||||
// This function is used to update the number of samples in the sample buffer
|
|
||||||
// when accessing the buffer directly with 'ptrEnd' function. Please be
|
|
||||||
// careful though!
|
|
||||||
void FIFOSampleBuffer::putSamples(uint nSamples)
|
|
||||||
{
|
|
||||||
uint req;
|
|
||||||
|
|
||||||
req = samplesInBuffer + nSamples;
|
|
||||||
ensureCapacity(req);
|
|
||||||
samplesInBuffer += nSamples;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// Returns a pointer to the end of the used part of the sample buffer (i.e.
|
|
||||||
// where the new samples are to be inserted). This function may be used for
|
|
||||||
// inserting new samples into the sample buffer directly. Please be careful!
|
|
||||||
//
|
|
||||||
// Parameter 'slackCapacity' tells the function how much free capacity (in
|
|
||||||
// terms of samples) there _at least_ should be, in order to the caller to
|
|
||||||
// successfully insert all the required samples to the buffer. When necessary,
|
|
||||||
// the function grows the buffer size to comply with this requirement.
|
|
||||||
//
|
|
||||||
// When using this function as means for inserting new samples, also remember
|
|
||||||
// to increase the sample count afterwards, by calling the
|
|
||||||
// 'putSamples(numSamples)' function.
|
|
||||||
SAMPLETYPE *FIFOSampleBuffer::ptrEnd(uint slackCapacity)
|
|
||||||
{
|
|
||||||
ensureCapacity(samplesInBuffer + slackCapacity);
|
|
||||||
return buffer + samplesInBuffer * channels;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// Returns a pointer to the beginning of the currently non-outputted samples.
|
|
||||||
// This function is provided for accessing the output samples directly.
|
|
||||||
// Please be careful!
|
|
||||||
//
|
|
||||||
// When using this function to output samples, also remember to 'remove' the
|
|
||||||
// outputted samples from the buffer by calling the
|
|
||||||
// 'receiveSamples(numSamples)' function
|
|
||||||
SAMPLETYPE *FIFOSampleBuffer::ptrBegin()
|
|
||||||
{
|
|
||||||
assert(buffer);
|
|
||||||
return buffer + bufferPos * channels;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// Ensures that the buffer has enough capacity, i.e. space for _at least_
|
|
||||||
// 'capacityRequirement' number of samples. The buffer is grown in steps of
|
|
||||||
// 4 kilobytes to eliminate the need for frequently growing up the buffer,
|
|
||||||
// as well as to round the buffer size up to the virtual memory page size.
|
|
||||||
void FIFOSampleBuffer::ensureCapacity(uint capacityRequirement)
|
|
||||||
{
|
|
||||||
SAMPLETYPE *tempUnaligned, *temp;
|
|
||||||
|
|
||||||
if (capacityRequirement > getCapacity())
|
|
||||||
{
|
|
||||||
// enlarge the buffer in 4kbyte steps (round up to next 4k boundary)
|
|
||||||
sizeInBytes = (capacityRequirement * channels * sizeof(SAMPLETYPE) + 4095) & (uint)-4096;
|
|
||||||
assert(sizeInBytes % 2 == 0);
|
|
||||||
tempUnaligned = new SAMPLETYPE[sizeInBytes / sizeof(SAMPLETYPE) + 16 / sizeof(SAMPLETYPE)];
|
|
||||||
if (tempUnaligned == nullptr)
|
|
||||||
{
|
|
||||||
ST_THROW_RT_ERROR("Couldn't allocate memory!\n");
|
|
||||||
}
|
|
||||||
// Align the buffer to begin at 16byte cache line boundary for optimal performance
|
|
||||||
temp = (SAMPLETYPE *)SOUNDTOUCH_ALIGN_POINTER_16(tempUnaligned);
|
|
||||||
if (samplesInBuffer)
|
|
||||||
{
|
|
||||||
memcpy(temp, ptrBegin(), samplesInBuffer * channels * sizeof(SAMPLETYPE));
|
|
||||||
}
|
|
||||||
delete[] bufferUnaligned;
|
|
||||||
buffer = temp;
|
|
||||||
bufferUnaligned = tempUnaligned;
|
|
||||||
bufferPos = 0;
|
|
||||||
}
|
|
||||||
else
|
|
||||||
{
|
|
||||||
// simply rewind the buffer (if necessary)
|
|
||||||
rewind();
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// Returns the current buffer capacity in terms of samples
|
|
||||||
uint FIFOSampleBuffer::getCapacity() const
|
|
||||||
{
|
|
||||||
return sizeInBytes / (channels * sizeof(SAMPLETYPE));
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// Returns the number of samples currently in the buffer
|
|
||||||
uint FIFOSampleBuffer::numSamples() const
|
|
||||||
{
|
|
||||||
return samplesInBuffer;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// Output samples from beginning of the sample buffer. Copies demanded number
|
|
||||||
// of samples to output and removes them from the sample buffer. If there
|
|
||||||
// are less than 'numsample' samples in the buffer, returns all available.
|
|
||||||
//
|
|
||||||
// Returns number of samples copied.
|
|
||||||
uint FIFOSampleBuffer::receiveSamples(SAMPLETYPE *output, uint maxSamples)
|
|
||||||
{
|
|
||||||
uint num;
|
|
||||||
|
|
||||||
num = (maxSamples > samplesInBuffer) ? samplesInBuffer : maxSamples;
|
|
||||||
|
|
||||||
memcpy(output, ptrBegin(), channels * sizeof(SAMPLETYPE) * num);
|
|
||||||
return receiveSamples(num);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// Removes samples from the beginning of the sample buffer without copying them
|
|
||||||
// anywhere. Used to reduce the number of samples in the buffer, when accessing
|
|
||||||
// the sample buffer with the 'ptrBegin' function.
|
|
||||||
uint FIFOSampleBuffer::receiveSamples(uint maxSamples)
|
|
||||||
{
|
|
||||||
if (maxSamples >= samplesInBuffer)
|
|
||||||
{
|
|
||||||
uint temp;
|
|
||||||
|
|
||||||
temp = samplesInBuffer;
|
|
||||||
samplesInBuffer = 0;
|
|
||||||
return temp;
|
|
||||||
}
|
|
||||||
|
|
||||||
samplesInBuffer -= maxSamples;
|
|
||||||
bufferPos += maxSamples;
|
|
||||||
|
|
||||||
return maxSamples;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// Returns nonzero if the sample buffer is empty
|
|
||||||
int FIFOSampleBuffer::isEmpty() const
|
|
||||||
{
|
|
||||||
return (samplesInBuffer == 0) ? 1 : 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// Clears the sample buffer
|
|
||||||
void FIFOSampleBuffer::clear()
|
|
||||||
{
|
|
||||||
samplesInBuffer = 0;
|
|
||||||
bufferPos = 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
/// allow trimming (downwards) amount of samples in pipeline.
|
|
||||||
/// Returns adjusted amount of samples
|
|
||||||
uint FIFOSampleBuffer::adjustAmountOfSamples(uint numSamples)
|
|
||||||
{
|
|
||||||
if (numSamples < samplesInBuffer)
|
|
||||||
{
|
|
||||||
samplesInBuffer = numSamples;
|
|
||||||
}
|
|
||||||
return samplesInBuffer;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
/// Add silence to end of buffer
|
|
||||||
void FIFOSampleBuffer::addSilent(uint nSamples)
|
|
||||||
{
|
|
||||||
memset(ptrEnd(nSamples), 0, sizeof(SAMPLETYPE) * nSamples * channels);
|
|
||||||
samplesInBuffer += nSamples;
|
|
||||||
}
|
|
180
Externals/soundtouch/FIFOSampleBuffer.h
vendored
180
Externals/soundtouch/FIFOSampleBuffer.h
vendored
|
@ -1,180 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
///
|
|
||||||
/// A buffer class for temporarily storaging sound samples, operates as a
|
|
||||||
/// first-in-first-out pipe.
|
|
||||||
///
|
|
||||||
/// Samples are added to the end of the sample buffer with the 'putSamples'
|
|
||||||
/// function, and are received from the beginning of the buffer by calling
|
|
||||||
/// the 'receiveSamples' function. The class automatically removes the
|
|
||||||
/// output samples from the buffer as well as grows the storage size
|
|
||||||
/// whenever necessary.
|
|
||||||
///
|
|
||||||
/// Author : Copyright (c) Olli Parviainen
|
|
||||||
/// Author e-mail : oparviai 'at' iki.fi
|
|
||||||
/// SoundTouch WWW: http://www.surina.net/soundtouch
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// License :
|
|
||||||
//
|
|
||||||
// SoundTouch audio processing library
|
|
||||||
// Copyright (c) Olli Parviainen
|
|
||||||
//
|
|
||||||
// This library is free software; you can redistribute it and/or
|
|
||||||
// modify it under the terms of the GNU Lesser General Public
|
|
||||||
// License as published by the Free Software Foundation; either
|
|
||||||
// version 2.1 of the License, or (at your option) any later version.
|
|
||||||
//
|
|
||||||
// This library is distributed in the hope that it will be useful,
|
|
||||||
// but WITHOUT ANY WARRANTY; without even the implied warranty of
|
|
||||||
// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
|
||||||
// Lesser General Public License for more details.
|
|
||||||
//
|
|
||||||
// You should have received a copy of the GNU Lesser General Public
|
|
||||||
// License along with this library; if not, write to the Free Software
|
|
||||||
// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#ifndef FIFOSampleBuffer_H
|
|
||||||
#define FIFOSampleBuffer_H
|
|
||||||
|
|
||||||
#include "FIFOSamplePipe.h"
|
|
||||||
|
|
||||||
namespace soundtouch
|
|
||||||
{
|
|
||||||
|
|
||||||
/// Sample buffer working in FIFO (first-in-first-out) principle. The class takes
|
|
||||||
/// care of storage size adjustment and data moving during input/output operations.
|
|
||||||
///
|
|
||||||
/// Notice that in case of stereo audio, one sample is considered to consist of
|
|
||||||
/// both channel data.
|
|
||||||
class FIFOSampleBuffer : public FIFOSamplePipe
|
|
||||||
{
|
|
||||||
private:
|
|
||||||
/// Sample buffer.
|
|
||||||
SAMPLETYPE *buffer;
|
|
||||||
|
|
||||||
// Raw unaligned buffer memory. 'buffer' is made aligned by pointing it to first
|
|
||||||
// 16-byte aligned location of this buffer
|
|
||||||
SAMPLETYPE *bufferUnaligned;
|
|
||||||
|
|
||||||
/// Sample buffer size in bytes
|
|
||||||
uint sizeInBytes;
|
|
||||||
|
|
||||||
/// How many samples are currently in buffer.
|
|
||||||
uint samplesInBuffer;
|
|
||||||
|
|
||||||
/// Channels, 1=mono, 2=stereo.
|
|
||||||
uint channels;
|
|
||||||
|
|
||||||
/// Current position pointer to the buffer. This pointer is increased when samples are
|
|
||||||
/// removed from the pipe so that it's necessary to actually rewind buffer (move data)
|
|
||||||
/// only new data when is put to the pipe.
|
|
||||||
uint bufferPos;
|
|
||||||
|
|
||||||
/// Rewind the buffer by moving data from position pointed by 'bufferPos' to real
|
|
||||||
/// beginning of the buffer.
|
|
||||||
void rewind();
|
|
||||||
|
|
||||||
/// Ensures that the buffer has capacity for at least this many samples.
|
|
||||||
void ensureCapacity(uint capacityRequirement);
|
|
||||||
|
|
||||||
/// Returns current capacity.
|
|
||||||
uint getCapacity() const;
|
|
||||||
|
|
||||||
public:
|
|
||||||
|
|
||||||
/// Constructor
|
|
||||||
FIFOSampleBuffer(int numChannels = 2 ///< Number of channels, 1=mono, 2=stereo.
|
|
||||||
///< Default is stereo.
|
|
||||||
);
|
|
||||||
|
|
||||||
/// destructor
|
|
||||||
~FIFOSampleBuffer() override;
|
|
||||||
|
|
||||||
/// Returns a pointer to the beginning of the output samples.
|
|
||||||
/// This function is provided for accessing the output samples directly.
|
|
||||||
/// Please be careful for not to corrupt the book-keeping!
|
|
||||||
///
|
|
||||||
/// When using this function to output samples, also remember to 'remove' the
|
|
||||||
/// output samples from the buffer by calling the
|
|
||||||
/// 'receiveSamples(numSamples)' function
|
|
||||||
virtual SAMPLETYPE *ptrBegin() override;
|
|
||||||
|
|
||||||
/// Returns a pointer to the end of the used part of the sample buffer (i.e.
|
|
||||||
/// where the new samples are to be inserted). This function may be used for
|
|
||||||
/// inserting new samples into the sample buffer directly. Please be careful
|
|
||||||
/// not corrupt the book-keeping!
|
|
||||||
///
|
|
||||||
/// When using this function as means for inserting new samples, also remember
|
|
||||||
/// to increase the sample count afterwards, by calling the
|
|
||||||
/// 'putSamples(numSamples)' function.
|
|
||||||
SAMPLETYPE *ptrEnd(
|
|
||||||
uint slackCapacity ///< How much free capacity (in samples) there _at least_
|
|
||||||
///< should be so that the caller can successfully insert the
|
|
||||||
///< desired samples to the buffer. If necessary, the function
|
|
||||||
///< grows the buffer size to comply with this requirement.
|
|
||||||
);
|
|
||||||
|
|
||||||
/// Adds 'numSamples' pcs of samples from the 'samples' memory position to
|
|
||||||
/// the sample buffer.
|
|
||||||
virtual void putSamples(const SAMPLETYPE *samples, ///< Pointer to samples.
|
|
||||||
uint numSamples ///< Number of samples to insert.
|
|
||||||
) override;
|
|
||||||
|
|
||||||
/// Adjusts the book-keeping to increase number of samples in the buffer without
|
|
||||||
/// copying any actual samples.
|
|
||||||
///
|
|
||||||
/// This function is used to update the number of samples in the sample buffer
|
|
||||||
/// when accessing the buffer directly with 'ptrEnd' function. Please be
|
|
||||||
/// careful though!
|
|
||||||
virtual void putSamples(uint numSamples ///< Number of samples been inserted.
|
|
||||||
);
|
|
||||||
|
|
||||||
/// Output samples from beginning of the sample buffer. Copies requested samples to
|
|
||||||
/// output buffer and removes them from the sample buffer. If there are less than
|
|
||||||
/// 'numsample' samples in the buffer, returns all that available.
|
|
||||||
///
|
|
||||||
/// \return Number of samples returned.
|
|
||||||
virtual uint receiveSamples(SAMPLETYPE *output, ///< Buffer where to copy output samples.
|
|
||||||
uint maxSamples ///< How many samples to receive at max.
|
|
||||||
) override;
|
|
||||||
|
|
||||||
/// Adjusts book-keeping so that given number of samples are removed from beginning of the
|
|
||||||
/// sample buffer without copying them anywhere.
|
|
||||||
///
|
|
||||||
/// Used to reduce the number of samples in the buffer when accessing the sample buffer directly
|
|
||||||
/// with 'ptrBegin' function.
|
|
||||||
virtual uint receiveSamples(uint maxSamples ///< Remove this many samples from the beginning of pipe.
|
|
||||||
) override;
|
|
||||||
|
|
||||||
/// Returns number of samples currently available.
|
|
||||||
virtual uint numSamples() const override;
|
|
||||||
|
|
||||||
/// Sets number of channels, 1 = mono, 2 = stereo.
|
|
||||||
void setChannels(int numChannels);
|
|
||||||
|
|
||||||
/// Get number of channels
|
|
||||||
int getChannels()
|
|
||||||
{
|
|
||||||
return channels;
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Returns nonzero if there aren't any samples available for outputting.
|
|
||||||
virtual int isEmpty() const override;
|
|
||||||
|
|
||||||
/// Clears all the samples.
|
|
||||||
virtual void clear() override;
|
|
||||||
|
|
||||||
/// allow trimming (downwards) amount of samples in pipeline.
|
|
||||||
/// Returns adjusted amount of samples
|
|
||||||
uint adjustAmountOfSamples(uint numSamples) override;
|
|
||||||
|
|
||||||
/// Add silence to end of buffer
|
|
||||||
void addSilent(uint nSamples);
|
|
||||||
};
|
|
||||||
|
|
||||||
}
|
|
||||||
|
|
||||||
#endif
|
|
230
Externals/soundtouch/FIFOSamplePipe.h
vendored
230
Externals/soundtouch/FIFOSamplePipe.h
vendored
|
@ -1,230 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
///
|
|
||||||
/// 'FIFOSamplePipe' : An abstract base class for classes that manipulate sound
|
|
||||||
/// samples by operating like a first-in-first-out pipe: New samples are fed
|
|
||||||
/// into one end of the pipe with the 'putSamples' function, and the processed
|
|
||||||
/// samples are received from the other end with the 'receiveSamples' function.
|
|
||||||
///
|
|
||||||
/// 'FIFOProcessor' : A base class for classes the do signal processing with
|
|
||||||
/// the samples while operating like a first-in-first-out pipe. When samples
|
|
||||||
/// are input with the 'putSamples' function, the class processes them
|
|
||||||
/// and moves the processed samples to the given 'output' pipe object, which
|
|
||||||
/// may be either another processing stage, or a fifo sample buffer object.
|
|
||||||
///
|
|
||||||
/// Author : Copyright (c) Olli Parviainen
|
|
||||||
/// Author e-mail : oparviai 'at' iki.fi
|
|
||||||
/// SoundTouch WWW: http://www.surina.net/soundtouch
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// License :
|
|
||||||
//
|
|
||||||
// SoundTouch audio processing library
|
|
||||||
// Copyright (c) Olli Parviainen
|
|
||||||
//
|
|
||||||
// This library is free software; you can redistribute it and/or
|
|
||||||
// modify it under the terms of the GNU Lesser General Public
|
|
||||||
// License as published by the Free Software Foundation; either
|
|
||||||
// version 2.1 of the License, or (at your option) any later version.
|
|
||||||
//
|
|
||||||
// This library is distributed in the hope that it will be useful,
|
|
||||||
// but WITHOUT ANY WARRANTY; without even the implied warranty of
|
|
||||||
// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
|
||||||
// Lesser General Public License for more details.
|
|
||||||
//
|
|
||||||
// You should have received a copy of the GNU Lesser General Public
|
|
||||||
// License along with this library; if not, write to the Free Software
|
|
||||||
// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#ifndef FIFOSamplePipe_H
|
|
||||||
#define FIFOSamplePipe_H
|
|
||||||
|
|
||||||
#include <assert.h>
|
|
||||||
#include <stdlib.h>
|
|
||||||
#include "STTypes.h"
|
|
||||||
|
|
||||||
namespace soundtouch
|
|
||||||
{
|
|
||||||
|
|
||||||
/// Abstract base class for FIFO (first-in-first-out) sample processing classes.
|
|
||||||
class FIFOSamplePipe
|
|
||||||
{
|
|
||||||
protected:
|
|
||||||
|
|
||||||
bool verifyNumberOfChannels(int nChannels) const
|
|
||||||
{
|
|
||||||
if ((nChannels > 0) && (nChannels <= SOUNDTOUCH_MAX_CHANNELS))
|
|
||||||
{
|
|
||||||
return true;
|
|
||||||
}
|
|
||||||
ST_THROW_RT_ERROR("Error: Illegal number of channels");
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
|
|
||||||
public:
|
|
||||||
// virtual default destructor
|
|
||||||
virtual ~FIFOSamplePipe() {}
|
|
||||||
|
|
||||||
|
|
||||||
/// Returns a pointer to the beginning of the output samples.
|
|
||||||
/// This function is provided for accessing the output samples directly.
|
|
||||||
/// Please be careful for not to corrupt the book-keeping!
|
|
||||||
///
|
|
||||||
/// When using this function to output samples, also remember to 'remove' the
|
|
||||||
/// output samples from the buffer by calling the
|
|
||||||
/// 'receiveSamples(numSamples)' function
|
|
||||||
virtual SAMPLETYPE *ptrBegin() = 0;
|
|
||||||
|
|
||||||
/// Adds 'numSamples' pcs of samples from the 'samples' memory position to
|
|
||||||
/// the sample buffer.
|
|
||||||
virtual void putSamples(const SAMPLETYPE *samples, ///< Pointer to samples.
|
|
||||||
uint numSamples ///< Number of samples to insert.
|
|
||||||
) = 0;
|
|
||||||
|
|
||||||
|
|
||||||
// Moves samples from the 'other' pipe instance to this instance.
|
|
||||||
void moveSamples(FIFOSamplePipe &other ///< Other pipe instance where from the receive the data.
|
|
||||||
)
|
|
||||||
{
|
|
||||||
int oNumSamples = other.numSamples();
|
|
||||||
|
|
||||||
putSamples(other.ptrBegin(), oNumSamples);
|
|
||||||
other.receiveSamples(oNumSamples);
|
|
||||||
};
|
|
||||||
|
|
||||||
/// Output samples from beginning of the sample buffer. Copies requested samples to
|
|
||||||
/// output buffer and removes them from the sample buffer. If there are less than
|
|
||||||
/// 'numsample' samples in the buffer, returns all that available.
|
|
||||||
///
|
|
||||||
/// \return Number of samples returned.
|
|
||||||
virtual uint receiveSamples(SAMPLETYPE *output, ///< Buffer where to copy output samples.
|
|
||||||
uint maxSamples ///< How many samples to receive at max.
|
|
||||||
) = 0;
|
|
||||||
|
|
||||||
/// Adjusts book-keeping so that given number of samples are removed from beginning of the
|
|
||||||
/// sample buffer without copying them anywhere.
|
|
||||||
///
|
|
||||||
/// Used to reduce the number of samples in the buffer when accessing the sample buffer directly
|
|
||||||
/// with 'ptrBegin' function.
|
|
||||||
virtual uint receiveSamples(uint maxSamples ///< Remove this many samples from the beginning of pipe.
|
|
||||||
) = 0;
|
|
||||||
|
|
||||||
/// Returns number of samples currently available.
|
|
||||||
virtual uint numSamples() const = 0;
|
|
||||||
|
|
||||||
// Returns nonzero if there aren't any samples available for outputting.
|
|
||||||
virtual int isEmpty() const = 0;
|
|
||||||
|
|
||||||
/// Clears all the samples.
|
|
||||||
virtual void clear() = 0;
|
|
||||||
|
|
||||||
/// allow trimming (downwards) amount of samples in pipeline.
|
|
||||||
/// Returns adjusted amount of samples
|
|
||||||
virtual uint adjustAmountOfSamples(uint numSamples) = 0;
|
|
||||||
|
|
||||||
};
|
|
||||||
|
|
||||||
|
|
||||||
/// Base-class for sound processing routines working in FIFO principle. With this base
|
|
||||||
/// class it's easy to implement sound processing stages that can be chained together,
|
|
||||||
/// so that samples that are fed into beginning of the pipe automatically go through
|
|
||||||
/// all the processing stages.
|
|
||||||
///
|
|
||||||
/// When samples are input to this class, they're first processed and then put to
|
|
||||||
/// the FIFO pipe that's defined as output of this class. This output pipe can be
|
|
||||||
/// either other processing stage or a FIFO sample buffer.
|
|
||||||
class FIFOProcessor :public FIFOSamplePipe
|
|
||||||
{
|
|
||||||
protected:
|
|
||||||
/// Internal pipe where processed samples are put.
|
|
||||||
FIFOSamplePipe *output;
|
|
||||||
|
|
||||||
/// Sets output pipe.
|
|
||||||
void setOutPipe(FIFOSamplePipe *pOutput)
|
|
||||||
{
|
|
||||||
assert(output == nullptr);
|
|
||||||
assert(pOutput != nullptr);
|
|
||||||
output = pOutput;
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Constructor. Doesn't define output pipe; it has to be set be
|
|
||||||
/// 'setOutPipe' function.
|
|
||||||
FIFOProcessor()
|
|
||||||
{
|
|
||||||
output = nullptr;
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Constructor. Configures output pipe.
|
|
||||||
FIFOProcessor(FIFOSamplePipe *pOutput ///< Output pipe.
|
|
||||||
)
|
|
||||||
{
|
|
||||||
output = pOutput;
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Destructor.
|
|
||||||
virtual ~FIFOProcessor() override
|
|
||||||
{
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Returns a pointer to the beginning of the output samples.
|
|
||||||
/// This function is provided for accessing the output samples directly.
|
|
||||||
/// Please be careful for not to corrupt the book-keeping!
|
|
||||||
///
|
|
||||||
/// When using this function to output samples, also remember to 'remove' the
|
|
||||||
/// output samples from the buffer by calling the
|
|
||||||
/// 'receiveSamples(numSamples)' function
|
|
||||||
virtual SAMPLETYPE *ptrBegin() override
|
|
||||||
{
|
|
||||||
return output->ptrBegin();
|
|
||||||
}
|
|
||||||
|
|
||||||
public:
|
|
||||||
|
|
||||||
/// Output samples from beginning of the sample buffer. Copies requested samples to
|
|
||||||
/// output buffer and removes them from the sample buffer. If there are less than
|
|
||||||
/// 'numsample' samples in the buffer, returns all that available.
|
|
||||||
///
|
|
||||||
/// \return Number of samples returned.
|
|
||||||
virtual uint receiveSamples(SAMPLETYPE *outBuffer, ///< Buffer where to copy output samples.
|
|
||||||
uint maxSamples ///< How many samples to receive at max.
|
|
||||||
) override
|
|
||||||
{
|
|
||||||
return output->receiveSamples(outBuffer, maxSamples);
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Adjusts book-keeping so that given number of samples are removed from beginning of the
|
|
||||||
/// sample buffer without copying them anywhere.
|
|
||||||
///
|
|
||||||
/// Used to reduce the number of samples in the buffer when accessing the sample buffer directly
|
|
||||||
/// with 'ptrBegin' function.
|
|
||||||
virtual uint receiveSamples(uint maxSamples ///< Remove this many samples from the beginning of pipe.
|
|
||||||
) override
|
|
||||||
{
|
|
||||||
return output->receiveSamples(maxSamples);
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Returns number of samples currently available.
|
|
||||||
virtual uint numSamples() const override
|
|
||||||
{
|
|
||||||
return output->numSamples();
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Returns nonzero if there aren't any samples available for outputting.
|
|
||||||
virtual int isEmpty() const override
|
|
||||||
{
|
|
||||||
return output->isEmpty();
|
|
||||||
}
|
|
||||||
|
|
||||||
/// allow trimming (downwards) amount of samples in pipeline.
|
|
||||||
/// Returns adjusted amount of samples
|
|
||||||
virtual uint adjustAmountOfSamples(uint numSamples) override
|
|
||||||
{
|
|
||||||
return output->adjustAmountOfSamples(numSamples);
|
|
||||||
}
|
|
||||||
};
|
|
||||||
|
|
||||||
}
|
|
||||||
|
|
||||||
#endif
|
|
314
Externals/soundtouch/FIRFilter.cpp
vendored
314
Externals/soundtouch/FIRFilter.cpp
vendored
|
@ -1,314 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
///
|
|
||||||
/// General FIR digital filter routines with MMX optimization.
|
|
||||||
///
|
|
||||||
/// Notes : MMX optimized functions reside in a separate, platform-specific file,
|
|
||||||
/// e.g. 'mmx_win.cpp' or 'mmx_gcc.cpp'
|
|
||||||
///
|
|
||||||
/// This source file contains OpenMP optimizations that allow speeding up the
|
|
||||||
/// corss-correlation algorithm by executing it in several threads / CPU cores
|
|
||||||
/// in parallel. See the following article link for more detailed discussion
|
|
||||||
/// about SoundTouch OpenMP optimizations:
|
|
||||||
/// http://www.softwarecoven.com/parallel-computing-in-embedded-mobile-devices
|
|
||||||
///
|
|
||||||
/// Author : Copyright (c) Olli Parviainen
|
|
||||||
/// Author e-mail : oparviai 'at' iki.fi
|
|
||||||
/// SoundTouch WWW: http://www.surina.net/soundtouch
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// License :
|
|
||||||
//
|
|
||||||
// SoundTouch audio processing library
|
|
||||||
// Copyright (c) Olli Parviainen
|
|
||||||
//
|
|
||||||
// This library is free software; you can redistribute it and/or
|
|
||||||
// modify it under the terms of the GNU Lesser General Public
|
|
||||||
// License as published by the Free Software Foundation; either
|
|
||||||
// version 2.1 of the License, or (at your option) any later version.
|
|
||||||
//
|
|
||||||
// This library is distributed in the hope that it will be useful,
|
|
||||||
// but WITHOUT ANY WARRANTY; without even the implied warranty of
|
|
||||||
// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
|
||||||
// Lesser General Public License for more details.
|
|
||||||
//
|
|
||||||
// You should have received a copy of the GNU Lesser General Public
|
|
||||||
// License along with this library; if not, write to the Free Software
|
|
||||||
// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#include <memory.h>
|
|
||||||
#include <assert.h>
|
|
||||||
#include <math.h>
|
|
||||||
#include <stdlib.h>
|
|
||||||
#include "FIRFilter.h"
|
|
||||||
#include "cpu_detect.h"
|
|
||||||
|
|
||||||
using namespace soundtouch;
|
|
||||||
|
|
||||||
/*****************************************************************************
|
|
||||||
*
|
|
||||||
* Implementation of the class 'FIRFilter'
|
|
||||||
*
|
|
||||||
*****************************************************************************/
|
|
||||||
|
|
||||||
FIRFilter::FIRFilter()
|
|
||||||
{
|
|
||||||
resultDivFactor = 0;
|
|
||||||
resultDivider = 0;
|
|
||||||
length = 0;
|
|
||||||
lengthDiv8 = 0;
|
|
||||||
filterCoeffs = nullptr;
|
|
||||||
filterCoeffsStereo = nullptr;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
FIRFilter::~FIRFilter()
|
|
||||||
{
|
|
||||||
delete[] filterCoeffs;
|
|
||||||
delete[] filterCoeffsStereo;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// Usual C-version of the filter routine for stereo sound
|
|
||||||
uint FIRFilter::evaluateFilterStereo(SAMPLETYPE *dest, const SAMPLETYPE *src, uint numSamples) const
|
|
||||||
{
|
|
||||||
int j, end;
|
|
||||||
// hint compiler autovectorization that loop length is divisible by 8
|
|
||||||
uint ilength = length & -8;
|
|
||||||
|
|
||||||
assert((length != 0) && (length == ilength) && (src != nullptr) && (dest != nullptr) && (filterCoeffs != nullptr));
|
|
||||||
assert(numSamples > ilength);
|
|
||||||
|
|
||||||
end = 2 * (numSamples - ilength);
|
|
||||||
|
|
||||||
#pragma omp parallel for
|
|
||||||
for (j = 0; j < end; j += 2)
|
|
||||||
{
|
|
||||||
const SAMPLETYPE *ptr;
|
|
||||||
LONG_SAMPLETYPE suml, sumr;
|
|
||||||
|
|
||||||
suml = sumr = 0;
|
|
||||||
ptr = src + j;
|
|
||||||
|
|
||||||
for (uint i = 0; i < ilength; i ++)
|
|
||||||
{
|
|
||||||
suml += ptr[2 * i] * filterCoeffsStereo[2 * i];
|
|
||||||
sumr += ptr[2 * i + 1] * filterCoeffsStereo[2 * i + 1];
|
|
||||||
}
|
|
||||||
|
|
||||||
#ifdef SOUNDTOUCH_INTEGER_SAMPLES
|
|
||||||
suml >>= resultDivFactor;
|
|
||||||
sumr >>= resultDivFactor;
|
|
||||||
// saturate to 16 bit integer limits
|
|
||||||
suml = (suml < -32768) ? -32768 : (suml > 32767) ? 32767 : suml;
|
|
||||||
// saturate to 16 bit integer limits
|
|
||||||
sumr = (sumr < -32768) ? -32768 : (sumr > 32767) ? 32767 : sumr;
|
|
||||||
#endif // SOUNDTOUCH_INTEGER_SAMPLES
|
|
||||||
dest[j] = (SAMPLETYPE)suml;
|
|
||||||
dest[j + 1] = (SAMPLETYPE)sumr;
|
|
||||||
}
|
|
||||||
return numSamples - ilength;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// Usual C-version of the filter routine for mono sound
|
|
||||||
uint FIRFilter::evaluateFilterMono(SAMPLETYPE *dest, const SAMPLETYPE *src, uint numSamples) const
|
|
||||||
{
|
|
||||||
int j, end;
|
|
||||||
|
|
||||||
// hint compiler autovectorization that loop length is divisible by 8
|
|
||||||
int ilength = length & -8;
|
|
||||||
|
|
||||||
assert(ilength != 0);
|
|
||||||
|
|
||||||
end = numSamples - ilength;
|
|
||||||
#pragma omp parallel for
|
|
||||||
for (j = 0; j < end; j ++)
|
|
||||||
{
|
|
||||||
const SAMPLETYPE *pSrc = src + j;
|
|
||||||
LONG_SAMPLETYPE sum;
|
|
||||||
int i;
|
|
||||||
|
|
||||||
sum = 0;
|
|
||||||
for (i = 0; i < ilength; i ++)
|
|
||||||
{
|
|
||||||
sum += pSrc[i] * filterCoeffs[i];
|
|
||||||
}
|
|
||||||
#ifdef SOUNDTOUCH_INTEGER_SAMPLES
|
|
||||||
sum >>= resultDivFactor;
|
|
||||||
// saturate to 16 bit integer limits
|
|
||||||
sum = (sum < -32768) ? -32768 : (sum > 32767) ? 32767 : sum;
|
|
||||||
#endif // SOUNDTOUCH_INTEGER_SAMPLES
|
|
||||||
dest[j] = (SAMPLETYPE)sum;
|
|
||||||
}
|
|
||||||
return end;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
uint FIRFilter::evaluateFilterMulti(SAMPLETYPE *dest, const SAMPLETYPE *src, uint numSamples, uint numChannels)
|
|
||||||
{
|
|
||||||
int j, end;
|
|
||||||
|
|
||||||
assert(length != 0);
|
|
||||||
assert(src != nullptr);
|
|
||||||
assert(dest != nullptr);
|
|
||||||
assert(filterCoeffs != nullptr);
|
|
||||||
assert(numChannels < 16);
|
|
||||||
|
|
||||||
// hint compiler autovectorization that loop length is divisible by 8
|
|
||||||
int ilength = length & -8;
|
|
||||||
|
|
||||||
end = numChannels * (numSamples - ilength);
|
|
||||||
|
|
||||||
#pragma omp parallel for
|
|
||||||
for (j = 0; j < end; j += numChannels)
|
|
||||||
{
|
|
||||||
const SAMPLETYPE *ptr;
|
|
||||||
LONG_SAMPLETYPE sums[16];
|
|
||||||
uint c;
|
|
||||||
int i;
|
|
||||||
|
|
||||||
for (c = 0; c < numChannels; c ++)
|
|
||||||
{
|
|
||||||
sums[c] = 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
ptr = src + j;
|
|
||||||
|
|
||||||
for (i = 0; i < ilength; i ++)
|
|
||||||
{
|
|
||||||
SAMPLETYPE coef=filterCoeffs[i];
|
|
||||||
for (c = 0; c < numChannels; c ++)
|
|
||||||
{
|
|
||||||
sums[c] += ptr[0] * coef;
|
|
||||||
ptr ++;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
for (c = 0; c < numChannels; c ++)
|
|
||||||
{
|
|
||||||
#ifdef SOUNDTOUCH_INTEGER_SAMPLES
|
|
||||||
sums[c] >>= resultDivFactor;
|
|
||||||
#endif // SOUNDTOUCH_INTEGER_SAMPLES
|
|
||||||
dest[j+c] = (SAMPLETYPE)sums[c];
|
|
||||||
}
|
|
||||||
}
|
|
||||||
return numSamples - ilength;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// Set filter coeffiecients and length.
|
|
||||||
//
|
|
||||||
// Throws an exception if filter length isn't divisible by 8
|
|
||||||
void FIRFilter::setCoefficients(const SAMPLETYPE *coeffs, uint newLength, uint uResultDivFactor)
|
|
||||||
{
|
|
||||||
assert(newLength > 0);
|
|
||||||
if (newLength % 8) ST_THROW_RT_ERROR("FIR filter length not divisible by 8");
|
|
||||||
|
|
||||||
#ifdef SOUNDTOUCH_FLOAT_SAMPLES
|
|
||||||
// scale coefficients already here if using floating samples
|
|
||||||
double scale = 1.0 / resultDivider;
|
|
||||||
#else
|
|
||||||
short scale = 1;
|
|
||||||
#endif
|
|
||||||
|
|
||||||
lengthDiv8 = newLength / 8;
|
|
||||||
length = lengthDiv8 * 8;
|
|
||||||
assert(length == newLength);
|
|
||||||
|
|
||||||
resultDivFactor = uResultDivFactor;
|
|
||||||
resultDivider = (SAMPLETYPE)::pow(2.0, (int)resultDivFactor);
|
|
||||||
|
|
||||||
delete[] filterCoeffs;
|
|
||||||
filterCoeffs = new SAMPLETYPE[length];
|
|
||||||
delete[] filterCoeffsStereo;
|
|
||||||
filterCoeffsStereo = new SAMPLETYPE[length*2];
|
|
||||||
for (uint i = 0; i < length; i ++)
|
|
||||||
{
|
|
||||||
filterCoeffs[i] = (SAMPLETYPE)(coeffs[i] * scale);
|
|
||||||
// create also stereo set of filter coefficients: this allows compiler
|
|
||||||
// to autovectorize filter evaluation much more efficiently
|
|
||||||
filterCoeffsStereo[2 * i] = (SAMPLETYPE)(coeffs[i] * scale);
|
|
||||||
filterCoeffsStereo[2 * i + 1] = (SAMPLETYPE)(coeffs[i] * scale);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
uint FIRFilter::getLength() const
|
|
||||||
{
|
|
||||||
return length;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// Applies the filter to the given sequence of samples.
|
|
||||||
//
|
|
||||||
// Note : The amount of outputted samples is by value of 'filter_length'
|
|
||||||
// smaller than the amount of input samples.
|
|
||||||
uint FIRFilter::evaluate(SAMPLETYPE *dest, const SAMPLETYPE *src, uint numSamples, uint numChannels)
|
|
||||||
{
|
|
||||||
assert(length > 0);
|
|
||||||
assert(lengthDiv8 * 8 == length);
|
|
||||||
|
|
||||||
if (numSamples < length) return 0;
|
|
||||||
|
|
||||||
#ifndef USE_MULTICH_ALWAYS
|
|
||||||
if (numChannels == 1)
|
|
||||||
{
|
|
||||||
return evaluateFilterMono(dest, src, numSamples);
|
|
||||||
}
|
|
||||||
else if (numChannels == 2)
|
|
||||||
{
|
|
||||||
return evaluateFilterStereo(dest, src, numSamples);
|
|
||||||
}
|
|
||||||
else
|
|
||||||
#endif // USE_MULTICH_ALWAYS
|
|
||||||
{
|
|
||||||
assert(numChannels > 0);
|
|
||||||
return evaluateFilterMulti(dest, src, numSamples, numChannels);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// Operator 'new' is overloaded so that it automatically creates a suitable instance
|
|
||||||
// depending on if we've a MMX-capable CPU available or not.
|
|
||||||
void * FIRFilter::operator new(size_t)
|
|
||||||
{
|
|
||||||
// Notice! don't use "new FIRFilter" directly, use "newInstance" to create a new instance instead!
|
|
||||||
ST_THROW_RT_ERROR("Error in FIRFilter::new: Don't use 'new FIRFilter', use 'newInstance' member instead!");
|
|
||||||
return newInstance();
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
FIRFilter * FIRFilter::newInstance()
|
|
||||||
{
|
|
||||||
uint uExtensions;
|
|
||||||
|
|
||||||
uExtensions = detectCPUextensions();
|
|
||||||
|
|
||||||
// Check if MMX/SSE instruction set extensions supported by CPU
|
|
||||||
|
|
||||||
#ifdef SOUNDTOUCH_ALLOW_MMX
|
|
||||||
// MMX routines available only with integer sample types
|
|
||||||
if (uExtensions & SUPPORT_MMX)
|
|
||||||
{
|
|
||||||
return ::new FIRFilterMMX;
|
|
||||||
}
|
|
||||||
else
|
|
||||||
#endif // SOUNDTOUCH_ALLOW_MMX
|
|
||||||
|
|
||||||
#ifdef SOUNDTOUCH_ALLOW_SSE
|
|
||||||
if (uExtensions & SUPPORT_SSE)
|
|
||||||
{
|
|
||||||
// SSE support
|
|
||||||
return ::new FIRFilterSSE;
|
|
||||||
}
|
|
||||||
else
|
|
||||||
#endif // SOUNDTOUCH_ALLOW_SSE
|
|
||||||
|
|
||||||
{
|
|
||||||
// ISA optimizations not supported, use plain C version
|
|
||||||
return ::new FIRFilter;
|
|
||||||
}
|
|
||||||
}
|
|
140
Externals/soundtouch/FIRFilter.h
vendored
140
Externals/soundtouch/FIRFilter.h
vendored
|
@ -1,140 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
///
|
|
||||||
/// General FIR digital filter routines with MMX optimization.
|
|
||||||
///
|
|
||||||
/// Note : MMX optimized functions reside in a separate, platform-specific file,
|
|
||||||
/// e.g. 'mmx_win.cpp' or 'mmx_gcc.cpp'
|
|
||||||
///
|
|
||||||
/// Author : Copyright (c) Olli Parviainen
|
|
||||||
/// Author e-mail : oparviai 'at' iki.fi
|
|
||||||
/// SoundTouch WWW: http://www.surina.net/soundtouch
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// License :
|
|
||||||
//
|
|
||||||
// SoundTouch audio processing library
|
|
||||||
// Copyright (c) Olli Parviainen
|
|
||||||
//
|
|
||||||
// This library is free software; you can redistribute it and/or
|
|
||||||
// modify it under the terms of the GNU Lesser General Public
|
|
||||||
// License as published by the Free Software Foundation; either
|
|
||||||
// version 2.1 of the License, or (at your option) any later version.
|
|
||||||
//
|
|
||||||
// This library is distributed in the hope that it will be useful,
|
|
||||||
// but WITHOUT ANY WARRANTY; without even the implied warranty of
|
|
||||||
// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
|
||||||
// Lesser General Public License for more details.
|
|
||||||
//
|
|
||||||
// You should have received a copy of the GNU Lesser General Public
|
|
||||||
// License along with this library; if not, write to the Free Software
|
|
||||||
// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#ifndef FIRFilter_H
|
|
||||||
#define FIRFilter_H
|
|
||||||
|
|
||||||
#include <stddef.h>
|
|
||||||
#include "STTypes.h"
|
|
||||||
|
|
||||||
namespace soundtouch
|
|
||||||
{
|
|
||||||
|
|
||||||
class FIRFilter
|
|
||||||
{
|
|
||||||
protected:
|
|
||||||
// Number of FIR filter taps
|
|
||||||
uint length;
|
|
||||||
// Number of FIR filter taps divided by 8
|
|
||||||
uint lengthDiv8;
|
|
||||||
|
|
||||||
// Result divider factor in 2^k format
|
|
||||||
uint resultDivFactor;
|
|
||||||
|
|
||||||
// Result divider value.
|
|
||||||
SAMPLETYPE resultDivider;
|
|
||||||
|
|
||||||
// Memory for filter coefficients
|
|
||||||
SAMPLETYPE *filterCoeffs;
|
|
||||||
SAMPLETYPE *filterCoeffsStereo;
|
|
||||||
|
|
||||||
virtual uint evaluateFilterStereo(SAMPLETYPE *dest,
|
|
||||||
const SAMPLETYPE *src,
|
|
||||||
uint numSamples) const;
|
|
||||||
virtual uint evaluateFilterMono(SAMPLETYPE *dest,
|
|
||||||
const SAMPLETYPE *src,
|
|
||||||
uint numSamples) const;
|
|
||||||
virtual uint evaluateFilterMulti(SAMPLETYPE *dest, const SAMPLETYPE *src, uint numSamples, uint numChannels);
|
|
||||||
|
|
||||||
public:
|
|
||||||
FIRFilter();
|
|
||||||
virtual ~FIRFilter();
|
|
||||||
|
|
||||||
/// Operator 'new' is overloaded so that it automatically creates a suitable instance
|
|
||||||
/// depending on if we've a MMX-capable CPU available or not.
|
|
||||||
static void * operator new(size_t s);
|
|
||||||
|
|
||||||
static FIRFilter *newInstance();
|
|
||||||
|
|
||||||
/// Applies the filter to the given sequence of samples.
|
|
||||||
/// Note : The amount of outputted samples is by value of 'filter_length'
|
|
||||||
/// smaller than the amount of input samples.
|
|
||||||
///
|
|
||||||
/// \return Number of samples copied to 'dest'.
|
|
||||||
uint evaluate(SAMPLETYPE *dest,
|
|
||||||
const SAMPLETYPE *src,
|
|
||||||
uint numSamples,
|
|
||||||
uint numChannels);
|
|
||||||
|
|
||||||
uint getLength() const;
|
|
||||||
|
|
||||||
virtual void setCoefficients(const SAMPLETYPE *coeffs,
|
|
||||||
uint newLength,
|
|
||||||
uint uResultDivFactor);
|
|
||||||
};
|
|
||||||
|
|
||||||
|
|
||||||
// Optional subclasses that implement CPU-specific optimizations:
|
|
||||||
|
|
||||||
#ifdef SOUNDTOUCH_ALLOW_MMX
|
|
||||||
|
|
||||||
/// Class that implements MMX optimized functions exclusive for 16bit integer samples type.
|
|
||||||
class FIRFilterMMX : public FIRFilter
|
|
||||||
{
|
|
||||||
protected:
|
|
||||||
short *filterCoeffsUnalign;
|
|
||||||
short *filterCoeffsAlign;
|
|
||||||
|
|
||||||
virtual uint evaluateFilterStereo(short *dest, const short *src, uint numSamples) const override;
|
|
||||||
public:
|
|
||||||
FIRFilterMMX();
|
|
||||||
~FIRFilterMMX();
|
|
||||||
|
|
||||||
virtual void setCoefficients(const short *coeffs, uint newLength, uint uResultDivFactor) override;
|
|
||||||
};
|
|
||||||
|
|
||||||
#endif // SOUNDTOUCH_ALLOW_MMX
|
|
||||||
|
|
||||||
|
|
||||||
#ifdef SOUNDTOUCH_ALLOW_SSE
|
|
||||||
/// Class that implements SSE optimized functions exclusive for floating point samples type.
|
|
||||||
class FIRFilterSSE : public FIRFilter
|
|
||||||
{
|
|
||||||
protected:
|
|
||||||
float *filterCoeffsUnalign;
|
|
||||||
float *filterCoeffsAlign;
|
|
||||||
|
|
||||||
virtual uint evaluateFilterStereo(float *dest, const float *src, uint numSamples) const override;
|
|
||||||
public:
|
|
||||||
FIRFilterSSE();
|
|
||||||
~FIRFilterSSE();
|
|
||||||
|
|
||||||
virtual void setCoefficients(const float *coeffs, uint newLength, uint uResultDivFactor) override;
|
|
||||||
};
|
|
||||||
|
|
||||||
#endif // SOUNDTOUCH_ALLOW_SSE
|
|
||||||
|
|
||||||
}
|
|
||||||
|
|
||||||
#endif // FIRFilter_H
|
|
196
Externals/soundtouch/InterpolateCubic.cpp
vendored
196
Externals/soundtouch/InterpolateCubic.cpp
vendored
|
@ -1,196 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
///
|
|
||||||
/// Cubic interpolation routine.
|
|
||||||
///
|
|
||||||
/// Author : Copyright (c) Olli Parviainen
|
|
||||||
/// Author e-mail : oparviai 'at' iki.fi
|
|
||||||
/// SoundTouch WWW: http://www.surina.net/soundtouch
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// License :
|
|
||||||
//
|
|
||||||
// SoundTouch audio processing library
|
|
||||||
// Copyright (c) Olli Parviainen
|
|
||||||
//
|
|
||||||
// This library is free software; you can redistribute it and/or
|
|
||||||
// modify it under the terms of the GNU Lesser General Public
|
|
||||||
// License as published by the Free Software Foundation; either
|
|
||||||
// version 2.1 of the License, or (at your option) any later version.
|
|
||||||
//
|
|
||||||
// This library is distributed in the hope that it will be useful,
|
|
||||||
// but WITHOUT ANY WARRANTY; without even the implied warranty of
|
|
||||||
// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
|
||||||
// Lesser General Public License for more details.
|
|
||||||
//
|
|
||||||
// You should have received a copy of the GNU Lesser General Public
|
|
||||||
// License along with this library; if not, write to the Free Software
|
|
||||||
// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#include <stddef.h>
|
|
||||||
#include <math.h>
|
|
||||||
#include "InterpolateCubic.h"
|
|
||||||
#include "STTypes.h"
|
|
||||||
|
|
||||||
using namespace soundtouch;
|
|
||||||
|
|
||||||
// cubic interpolation coefficients
|
|
||||||
static const float _coeffs[]=
|
|
||||||
{ -0.5f, 1.0f, -0.5f, 0.0f,
|
|
||||||
1.5f, -2.5f, 0.0f, 1.0f,
|
|
||||||
-1.5f, 2.0f, 0.5f, 0.0f,
|
|
||||||
0.5f, -0.5f, 0.0f, 0.0f};
|
|
||||||
|
|
||||||
|
|
||||||
InterpolateCubic::InterpolateCubic()
|
|
||||||
{
|
|
||||||
fract = 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
void InterpolateCubic::resetRegisters()
|
|
||||||
{
|
|
||||||
fract = 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
/// Transpose mono audio. Returns number of produced output samples, and
|
|
||||||
/// updates "srcSamples" to amount of consumed source samples
|
|
||||||
int InterpolateCubic::transposeMono(SAMPLETYPE *pdest,
|
|
||||||
const SAMPLETYPE *psrc,
|
|
||||||
int &srcSamples)
|
|
||||||
{
|
|
||||||
int i;
|
|
||||||
int srcSampleEnd = srcSamples - 4;
|
|
||||||
int srcCount = 0;
|
|
||||||
|
|
||||||
i = 0;
|
|
||||||
while (srcCount < srcSampleEnd)
|
|
||||||
{
|
|
||||||
float out;
|
|
||||||
const float x3 = 1.0f;
|
|
||||||
const float x2 = (float)fract; // x
|
|
||||||
const float x1 = x2*x2; // x^2
|
|
||||||
const float x0 = x1*x2; // x^3
|
|
||||||
float y0, y1, y2, y3;
|
|
||||||
|
|
||||||
assert(fract < 1.0);
|
|
||||||
|
|
||||||
y0 = _coeffs[0] * x0 + _coeffs[1] * x1 + _coeffs[2] * x2 + _coeffs[3] * x3;
|
|
||||||
y1 = _coeffs[4] * x0 + _coeffs[5] * x1 + _coeffs[6] * x2 + _coeffs[7] * x3;
|
|
||||||
y2 = _coeffs[8] * x0 + _coeffs[9] * x1 + _coeffs[10] * x2 + _coeffs[11] * x3;
|
|
||||||
y3 = _coeffs[12] * x0 + _coeffs[13] * x1 + _coeffs[14] * x2 + _coeffs[15] * x3;
|
|
||||||
|
|
||||||
out = y0 * psrc[0] + y1 * psrc[1] + y2 * psrc[2] + y3 * psrc[3];
|
|
||||||
|
|
||||||
pdest[i] = (SAMPLETYPE)out;
|
|
||||||
i ++;
|
|
||||||
|
|
||||||
// update position fraction
|
|
||||||
fract += rate;
|
|
||||||
// update whole positions
|
|
||||||
int whole = (int)fract;
|
|
||||||
fract -= whole;
|
|
||||||
psrc += whole;
|
|
||||||
srcCount += whole;
|
|
||||||
}
|
|
||||||
srcSamples = srcCount;
|
|
||||||
return i;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
/// Transpose stereo audio. Returns number of produced output samples, and
|
|
||||||
/// updates "srcSamples" to amount of consumed source samples
|
|
||||||
int InterpolateCubic::transposeStereo(SAMPLETYPE *pdest,
|
|
||||||
const SAMPLETYPE *psrc,
|
|
||||||
int &srcSamples)
|
|
||||||
{
|
|
||||||
int i;
|
|
||||||
int srcSampleEnd = srcSamples - 4;
|
|
||||||
int srcCount = 0;
|
|
||||||
|
|
||||||
i = 0;
|
|
||||||
while (srcCount < srcSampleEnd)
|
|
||||||
{
|
|
||||||
const float x3 = 1.0f;
|
|
||||||
const float x2 = (float)fract; // x
|
|
||||||
const float x1 = x2*x2; // x^2
|
|
||||||
const float x0 = x1*x2; // x^3
|
|
||||||
float y0, y1, y2, y3;
|
|
||||||
float out0, out1;
|
|
||||||
|
|
||||||
assert(fract < 1.0);
|
|
||||||
|
|
||||||
y0 = _coeffs[0] * x0 + _coeffs[1] * x1 + _coeffs[2] * x2 + _coeffs[3] * x3;
|
|
||||||
y1 = _coeffs[4] * x0 + _coeffs[5] * x1 + _coeffs[6] * x2 + _coeffs[7] * x3;
|
|
||||||
y2 = _coeffs[8] * x0 + _coeffs[9] * x1 + _coeffs[10] * x2 + _coeffs[11] * x3;
|
|
||||||
y3 = _coeffs[12] * x0 + _coeffs[13] * x1 + _coeffs[14] * x2 + _coeffs[15] * x3;
|
|
||||||
|
|
||||||
out0 = y0 * psrc[0] + y1 * psrc[2] + y2 * psrc[4] + y3 * psrc[6];
|
|
||||||
out1 = y0 * psrc[1] + y1 * psrc[3] + y2 * psrc[5] + y3 * psrc[7];
|
|
||||||
|
|
||||||
pdest[2*i] = (SAMPLETYPE)out0;
|
|
||||||
pdest[2*i+1] = (SAMPLETYPE)out1;
|
|
||||||
i ++;
|
|
||||||
|
|
||||||
// update position fraction
|
|
||||||
fract += rate;
|
|
||||||
// update whole positions
|
|
||||||
int whole = (int)fract;
|
|
||||||
fract -= whole;
|
|
||||||
psrc += 2*whole;
|
|
||||||
srcCount += whole;
|
|
||||||
}
|
|
||||||
srcSamples = srcCount;
|
|
||||||
return i;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
/// Transpose multi-channel audio. Returns number of produced output samples, and
|
|
||||||
/// updates "srcSamples" to amount of consumed source samples
|
|
||||||
int InterpolateCubic::transposeMulti(SAMPLETYPE *pdest,
|
|
||||||
const SAMPLETYPE *psrc,
|
|
||||||
int &srcSamples)
|
|
||||||
{
|
|
||||||
int i;
|
|
||||||
int srcSampleEnd = srcSamples - 4;
|
|
||||||
int srcCount = 0;
|
|
||||||
|
|
||||||
i = 0;
|
|
||||||
while (srcCount < srcSampleEnd)
|
|
||||||
{
|
|
||||||
const float x3 = 1.0f;
|
|
||||||
const float x2 = (float)fract; // x
|
|
||||||
const float x1 = x2*x2; // x^2
|
|
||||||
const float x0 = x1*x2; // x^3
|
|
||||||
float y0, y1, y2, y3;
|
|
||||||
|
|
||||||
assert(fract < 1.0);
|
|
||||||
|
|
||||||
y0 = _coeffs[0] * x0 + _coeffs[1] * x1 + _coeffs[2] * x2 + _coeffs[3] * x3;
|
|
||||||
y1 = _coeffs[4] * x0 + _coeffs[5] * x1 + _coeffs[6] * x2 + _coeffs[7] * x3;
|
|
||||||
y2 = _coeffs[8] * x0 + _coeffs[9] * x1 + _coeffs[10] * x2 + _coeffs[11] * x3;
|
|
||||||
y3 = _coeffs[12] * x0 + _coeffs[13] * x1 + _coeffs[14] * x2 + _coeffs[15] * x3;
|
|
||||||
|
|
||||||
for (int c = 0; c < numChannels; c ++)
|
|
||||||
{
|
|
||||||
float out;
|
|
||||||
out = y0 * psrc[c] + y1 * psrc[c + numChannels] + y2 * psrc[c + 2 * numChannels] + y3 * psrc[c + 3 * numChannels];
|
|
||||||
pdest[0] = (SAMPLETYPE)out;
|
|
||||||
pdest ++;
|
|
||||||
}
|
|
||||||
i ++;
|
|
||||||
|
|
||||||
// update position fraction
|
|
||||||
fract += rate;
|
|
||||||
// update whole positions
|
|
||||||
int whole = (int)fract;
|
|
||||||
fract -= whole;
|
|
||||||
psrc += numChannels*whole;
|
|
||||||
srcCount += whole;
|
|
||||||
}
|
|
||||||
srcSamples = srcCount;
|
|
||||||
return i;
|
|
||||||
}
|
|
69
Externals/soundtouch/InterpolateCubic.h
vendored
69
Externals/soundtouch/InterpolateCubic.h
vendored
|
@ -1,69 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
///
|
|
||||||
/// Cubic interpolation routine.
|
|
||||||
///
|
|
||||||
/// Author : Copyright (c) Olli Parviainen
|
|
||||||
/// Author e-mail : oparviai 'at' iki.fi
|
|
||||||
/// SoundTouch WWW: http://www.surina.net/soundtouch
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// License :
|
|
||||||
//
|
|
||||||
// SoundTouch audio processing library
|
|
||||||
// Copyright (c) Olli Parviainen
|
|
||||||
//
|
|
||||||
// This library is free software; you can redistribute it and/or
|
|
||||||
// modify it under the terms of the GNU Lesser General Public
|
|
||||||
// License as published by the Free Software Foundation; either
|
|
||||||
// version 2.1 of the License, or (at your option) any later version.
|
|
||||||
//
|
|
||||||
// This library is distributed in the hope that it will be useful,
|
|
||||||
// but WITHOUT ANY WARRANTY; without even the implied warranty of
|
|
||||||
// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
|
||||||
// Lesser General Public License for more details.
|
|
||||||
//
|
|
||||||
// You should have received a copy of the GNU Lesser General Public
|
|
||||||
// License along with this library; if not, write to the Free Software
|
|
||||||
// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#ifndef _InterpolateCubic_H_
|
|
||||||
#define _InterpolateCubic_H_
|
|
||||||
|
|
||||||
#include "RateTransposer.h"
|
|
||||||
#include "STTypes.h"
|
|
||||||
|
|
||||||
namespace soundtouch
|
|
||||||
{
|
|
||||||
|
|
||||||
class InterpolateCubic : public TransposerBase
|
|
||||||
{
|
|
||||||
protected:
|
|
||||||
virtual int transposeMono(SAMPLETYPE *dest,
|
|
||||||
const SAMPLETYPE *src,
|
|
||||||
int &srcSamples) override;
|
|
||||||
virtual int transposeStereo(SAMPLETYPE *dest,
|
|
||||||
const SAMPLETYPE *src,
|
|
||||||
int &srcSamples) override;
|
|
||||||
virtual int transposeMulti(SAMPLETYPE *dest,
|
|
||||||
const SAMPLETYPE *src,
|
|
||||||
int &srcSamples) override;
|
|
||||||
|
|
||||||
double fract;
|
|
||||||
|
|
||||||
public:
|
|
||||||
InterpolateCubic();
|
|
||||||
|
|
||||||
virtual void resetRegisters() override;
|
|
||||||
|
|
||||||
virtual int getLatency() const override
|
|
||||||
{
|
|
||||||
return 1;
|
|
||||||
}
|
|
||||||
};
|
|
||||||
|
|
||||||
}
|
|
||||||
|
|
||||||
#endif
|
|
296
Externals/soundtouch/InterpolateLinear.cpp
vendored
296
Externals/soundtouch/InterpolateLinear.cpp
vendored
|
@ -1,296 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
///
|
|
||||||
/// Linear interpolation algorithm.
|
|
||||||
///
|
|
||||||
/// Author : Copyright (c) Olli Parviainen
|
|
||||||
/// Author e-mail : oparviai 'at' iki.fi
|
|
||||||
/// SoundTouch WWW: http://www.surina.net/soundtouch
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// License :
|
|
||||||
//
|
|
||||||
// SoundTouch audio processing library
|
|
||||||
// Copyright (c) Olli Parviainen
|
|
||||||
//
|
|
||||||
// This library is free software; you can redistribute it and/or
|
|
||||||
// modify it under the terms of the GNU Lesser General Public
|
|
||||||
// License as published by the Free Software Foundation; either
|
|
||||||
// version 2.1 of the License, or (at your option) any later version.
|
|
||||||
//
|
|
||||||
// This library is distributed in the hope that it will be useful,
|
|
||||||
// but WITHOUT ANY WARRANTY; without even the implied warranty of
|
|
||||||
// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
|
||||||
// Lesser General Public License for more details.
|
|
||||||
//
|
|
||||||
// You should have received a copy of the GNU Lesser General Public
|
|
||||||
// License along with this library; if not, write to the Free Software
|
|
||||||
// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#include <assert.h>
|
|
||||||
#include <stdlib.h>
|
|
||||||
#include "InterpolateLinear.h"
|
|
||||||
|
|
||||||
using namespace soundtouch;
|
|
||||||
|
|
||||||
//////////////////////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// InterpolateLinearInteger - integer arithmetic implementation
|
|
||||||
//
|
|
||||||
|
|
||||||
/// fixed-point interpolation routine precision
|
|
||||||
#define SCALE 65536
|
|
||||||
|
|
||||||
|
|
||||||
// Constructor
|
|
||||||
InterpolateLinearInteger::InterpolateLinearInteger() : TransposerBase()
|
|
||||||
{
|
|
||||||
// Notice: use local function calling syntax for sake of clarity,
|
|
||||||
// to indicate the fact that C++ constructor can't call virtual functions.
|
|
||||||
resetRegisters();
|
|
||||||
setRate(1.0f);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
void InterpolateLinearInteger::resetRegisters()
|
|
||||||
{
|
|
||||||
iFract = 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// Transposes the sample rate of the given samples using linear interpolation.
|
|
||||||
// 'Mono' version of the routine. Returns the number of samples returned in
|
|
||||||
// the "dest" buffer
|
|
||||||
int InterpolateLinearInteger::transposeMono(SAMPLETYPE *dest, const SAMPLETYPE *src, int &srcSamples)
|
|
||||||
{
|
|
||||||
int i;
|
|
||||||
int srcSampleEnd = srcSamples - 1;
|
|
||||||
int srcCount = 0;
|
|
||||||
|
|
||||||
i = 0;
|
|
||||||
while (srcCount < srcSampleEnd)
|
|
||||||
{
|
|
||||||
LONG_SAMPLETYPE temp;
|
|
||||||
|
|
||||||
assert(iFract < SCALE);
|
|
||||||
|
|
||||||
temp = (SCALE - iFract) * src[0] + iFract * src[1];
|
|
||||||
dest[i] = (SAMPLETYPE)(temp / SCALE);
|
|
||||||
i++;
|
|
||||||
|
|
||||||
iFract += iRate;
|
|
||||||
|
|
||||||
int iWhole = iFract / SCALE;
|
|
||||||
iFract -= iWhole * SCALE;
|
|
||||||
srcCount += iWhole;
|
|
||||||
src += iWhole;
|
|
||||||
}
|
|
||||||
srcSamples = srcCount;
|
|
||||||
|
|
||||||
return i;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// Transposes the sample rate of the given samples using linear interpolation.
|
|
||||||
// 'Stereo' version of the routine. Returns the number of samples returned in
|
|
||||||
// the "dest" buffer
|
|
||||||
int InterpolateLinearInteger::transposeStereo(SAMPLETYPE *dest, const SAMPLETYPE *src, int &srcSamples)
|
|
||||||
{
|
|
||||||
int i;
|
|
||||||
int srcSampleEnd = srcSamples - 1;
|
|
||||||
int srcCount = 0;
|
|
||||||
|
|
||||||
i = 0;
|
|
||||||
while (srcCount < srcSampleEnd)
|
|
||||||
{
|
|
||||||
LONG_SAMPLETYPE temp0;
|
|
||||||
LONG_SAMPLETYPE temp1;
|
|
||||||
|
|
||||||
assert(iFract < SCALE);
|
|
||||||
|
|
||||||
temp0 = (SCALE - iFract) * src[0] + iFract * src[2];
|
|
||||||
temp1 = (SCALE - iFract) * src[1] + iFract * src[3];
|
|
||||||
dest[0] = (SAMPLETYPE)(temp0 / SCALE);
|
|
||||||
dest[1] = (SAMPLETYPE)(temp1 / SCALE);
|
|
||||||
dest += 2;
|
|
||||||
i++;
|
|
||||||
|
|
||||||
iFract += iRate;
|
|
||||||
|
|
||||||
int iWhole = iFract / SCALE;
|
|
||||||
iFract -= iWhole * SCALE;
|
|
||||||
srcCount += iWhole;
|
|
||||||
src += 2*iWhole;
|
|
||||||
}
|
|
||||||
srcSamples = srcCount;
|
|
||||||
|
|
||||||
return i;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
int InterpolateLinearInteger::transposeMulti(SAMPLETYPE *dest, const SAMPLETYPE *src, int &srcSamples)
|
|
||||||
{
|
|
||||||
int i;
|
|
||||||
int srcSampleEnd = srcSamples - 1;
|
|
||||||
int srcCount = 0;
|
|
||||||
|
|
||||||
i = 0;
|
|
||||||
while (srcCount < srcSampleEnd)
|
|
||||||
{
|
|
||||||
LONG_SAMPLETYPE temp, vol1;
|
|
||||||
|
|
||||||
assert(iFract < SCALE);
|
|
||||||
vol1 = (LONG_SAMPLETYPE)(SCALE - iFract);
|
|
||||||
for (int c = 0; c < numChannels; c ++)
|
|
||||||
{
|
|
||||||
temp = vol1 * src[c] + iFract * src[c + numChannels];
|
|
||||||
dest[0] = (SAMPLETYPE)(temp / SCALE);
|
|
||||||
dest ++;
|
|
||||||
}
|
|
||||||
i++;
|
|
||||||
|
|
||||||
iFract += iRate;
|
|
||||||
|
|
||||||
int iWhole = iFract / SCALE;
|
|
||||||
iFract -= iWhole * SCALE;
|
|
||||||
srcCount += iWhole;
|
|
||||||
src += iWhole * numChannels;
|
|
||||||
}
|
|
||||||
srcSamples = srcCount;
|
|
||||||
|
|
||||||
return i;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// Sets new target iRate. Normal iRate = 1.0, smaller values represent slower
|
|
||||||
// iRate, larger faster iRates.
|
|
||||||
void InterpolateLinearInteger::setRate(double newRate)
|
|
||||||
{
|
|
||||||
iRate = (int)(newRate * SCALE + 0.5);
|
|
||||||
TransposerBase::setRate(newRate);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
//////////////////////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// InterpolateLinearFloat - floating point arithmetic implementation
|
|
||||||
//
|
|
||||||
//////////////////////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
|
|
||||||
// Constructor
|
|
||||||
InterpolateLinearFloat::InterpolateLinearFloat() : TransposerBase()
|
|
||||||
{
|
|
||||||
// Notice: use local function calling syntax for sake of clarity,
|
|
||||||
// to indicate the fact that C++ constructor can't call virtual functions.
|
|
||||||
resetRegisters();
|
|
||||||
setRate(1.0);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
void InterpolateLinearFloat::resetRegisters()
|
|
||||||
{
|
|
||||||
fract = 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// Transposes the sample rate of the given samples using linear interpolation.
|
|
||||||
// 'Mono' version of the routine. Returns the number of samples returned in
|
|
||||||
// the "dest" buffer
|
|
||||||
int InterpolateLinearFloat::transposeMono(SAMPLETYPE *dest, const SAMPLETYPE *src, int &srcSamples)
|
|
||||||
{
|
|
||||||
int i;
|
|
||||||
int srcSampleEnd = srcSamples - 1;
|
|
||||||
int srcCount = 0;
|
|
||||||
|
|
||||||
i = 0;
|
|
||||||
while (srcCount < srcSampleEnd)
|
|
||||||
{
|
|
||||||
double out;
|
|
||||||
assert(fract < 1.0);
|
|
||||||
|
|
||||||
out = (1.0 - fract) * src[0] + fract * src[1];
|
|
||||||
dest[i] = (SAMPLETYPE)out;
|
|
||||||
i ++;
|
|
||||||
|
|
||||||
// update position fraction
|
|
||||||
fract += rate;
|
|
||||||
// update whole positions
|
|
||||||
int whole = (int)fract;
|
|
||||||
fract -= whole;
|
|
||||||
src += whole;
|
|
||||||
srcCount += whole;
|
|
||||||
}
|
|
||||||
srcSamples = srcCount;
|
|
||||||
return i;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// Transposes the sample rate of the given samples using linear interpolation.
|
|
||||||
// 'Mono' version of the routine. Returns the number of samples returned in
|
|
||||||
// the "dest" buffer
|
|
||||||
int InterpolateLinearFloat::transposeStereo(SAMPLETYPE *dest, const SAMPLETYPE *src, int &srcSamples)
|
|
||||||
{
|
|
||||||
int i;
|
|
||||||
int srcSampleEnd = srcSamples - 1;
|
|
||||||
int srcCount = 0;
|
|
||||||
|
|
||||||
i = 0;
|
|
||||||
while (srcCount < srcSampleEnd)
|
|
||||||
{
|
|
||||||
double out0, out1;
|
|
||||||
assert(fract < 1.0);
|
|
||||||
|
|
||||||
out0 = (1.0 - fract) * src[0] + fract * src[2];
|
|
||||||
out1 = (1.0 - fract) * src[1] + fract * src[3];
|
|
||||||
dest[2*i] = (SAMPLETYPE)out0;
|
|
||||||
dest[2*i+1] = (SAMPLETYPE)out1;
|
|
||||||
i ++;
|
|
||||||
|
|
||||||
// update position fraction
|
|
||||||
fract += rate;
|
|
||||||
// update whole positions
|
|
||||||
int whole = (int)fract;
|
|
||||||
fract -= whole;
|
|
||||||
src += 2*whole;
|
|
||||||
srcCount += whole;
|
|
||||||
}
|
|
||||||
srcSamples = srcCount;
|
|
||||||
return i;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
int InterpolateLinearFloat::transposeMulti(SAMPLETYPE *dest, const SAMPLETYPE *src, int &srcSamples)
|
|
||||||
{
|
|
||||||
int i;
|
|
||||||
int srcSampleEnd = srcSamples - 1;
|
|
||||||
int srcCount = 0;
|
|
||||||
|
|
||||||
i = 0;
|
|
||||||
while (srcCount < srcSampleEnd)
|
|
||||||
{
|
|
||||||
float temp, vol1, fract_float;
|
|
||||||
|
|
||||||
vol1 = (float)(1.0 - fract);
|
|
||||||
fract_float = (float)fract;
|
|
||||||
for (int c = 0; c < numChannels; c ++)
|
|
||||||
{
|
|
||||||
temp = vol1 * src[c] + fract_float * src[c + numChannels];
|
|
||||||
*dest = (SAMPLETYPE)temp;
|
|
||||||
dest ++;
|
|
||||||
}
|
|
||||||
i++;
|
|
||||||
|
|
||||||
fract += rate;
|
|
||||||
|
|
||||||
int iWhole = (int)fract;
|
|
||||||
fract -= iWhole;
|
|
||||||
srcCount += iWhole;
|
|
||||||
src += iWhole * numChannels;
|
|
||||||
}
|
|
||||||
srcSamples = srcCount;
|
|
||||||
|
|
||||||
return i;
|
|
||||||
}
|
|
98
Externals/soundtouch/InterpolateLinear.h
vendored
98
Externals/soundtouch/InterpolateLinear.h
vendored
|
@ -1,98 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
///
|
|
||||||
/// Linear interpolation routine.
|
|
||||||
///
|
|
||||||
/// Author : Copyright (c) Olli Parviainen
|
|
||||||
/// Author e-mail : oparviai 'at' iki.fi
|
|
||||||
/// SoundTouch WWW: http://www.surina.net/soundtouch
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// License :
|
|
||||||
//
|
|
||||||
// SoundTouch audio processing library
|
|
||||||
// Copyright (c) Olli Parviainen
|
|
||||||
//
|
|
||||||
// This library is free software; you can redistribute it and/or
|
|
||||||
// modify it under the terms of the GNU Lesser General Public
|
|
||||||
// License as published by the Free Software Foundation; either
|
|
||||||
// version 2.1 of the License, or (at your option) any later version.
|
|
||||||
//
|
|
||||||
// This library is distributed in the hope that it will be useful,
|
|
||||||
// but WITHOUT ANY WARRANTY; without even the implied warranty of
|
|
||||||
// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
|
||||||
// Lesser General Public License for more details.
|
|
||||||
//
|
|
||||||
// You should have received a copy of the GNU Lesser General Public
|
|
||||||
// License along with this library; if not, write to the Free Software
|
|
||||||
// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#ifndef _InterpolateLinear_H_
|
|
||||||
#define _InterpolateLinear_H_
|
|
||||||
|
|
||||||
#include "RateTransposer.h"
|
|
||||||
#include "STTypes.h"
|
|
||||||
|
|
||||||
namespace soundtouch
|
|
||||||
{
|
|
||||||
|
|
||||||
/// Linear transposer class that uses integer arithmetic
|
|
||||||
class InterpolateLinearInteger : public TransposerBase
|
|
||||||
{
|
|
||||||
protected:
|
|
||||||
int iFract;
|
|
||||||
int iRate;
|
|
||||||
|
|
||||||
virtual int transposeMono(SAMPLETYPE *dest,
|
|
||||||
const SAMPLETYPE *src,
|
|
||||||
int &srcSamples) override;
|
|
||||||
virtual int transposeStereo(SAMPLETYPE *dest,
|
|
||||||
const SAMPLETYPE *src,
|
|
||||||
int &srcSamples) override;
|
|
||||||
virtual int transposeMulti(SAMPLETYPE *dest, const SAMPLETYPE *src, int &srcSamples) override;
|
|
||||||
public:
|
|
||||||
InterpolateLinearInteger();
|
|
||||||
|
|
||||||
/// Sets new target rate. Normal rate = 1.0, smaller values represent slower
|
|
||||||
/// rate, larger faster rates.
|
|
||||||
virtual void setRate(double newRate) override;
|
|
||||||
|
|
||||||
virtual void resetRegisters() override;
|
|
||||||
|
|
||||||
virtual int getLatency() const override
|
|
||||||
{
|
|
||||||
return 0;
|
|
||||||
}
|
|
||||||
};
|
|
||||||
|
|
||||||
|
|
||||||
/// Linear transposer class that uses floating point arithmetic
|
|
||||||
class InterpolateLinearFloat : public TransposerBase
|
|
||||||
{
|
|
||||||
protected:
|
|
||||||
double fract;
|
|
||||||
|
|
||||||
virtual int transposeMono(SAMPLETYPE *dest,
|
|
||||||
const SAMPLETYPE *src,
|
|
||||||
int &srcSamples);
|
|
||||||
virtual int transposeStereo(SAMPLETYPE *dest,
|
|
||||||
const SAMPLETYPE *src,
|
|
||||||
int &srcSamples);
|
|
||||||
virtual int transposeMulti(SAMPLETYPE *dest, const SAMPLETYPE *src, int &srcSamples);
|
|
||||||
|
|
||||||
public:
|
|
||||||
InterpolateLinearFloat();
|
|
||||||
|
|
||||||
virtual void resetRegisters();
|
|
||||||
|
|
||||||
int getLatency() const
|
|
||||||
{
|
|
||||||
return 0;
|
|
||||||
}
|
|
||||||
};
|
|
||||||
|
|
||||||
}
|
|
||||||
|
|
||||||
#endif
|
|
181
Externals/soundtouch/InterpolateShannon.cpp
vendored
181
Externals/soundtouch/InterpolateShannon.cpp
vendored
|
@ -1,181 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
///
|
|
||||||
/// Sample interpolation routine using 8-tap band-limited Shannon interpolation
|
|
||||||
/// with kaiser window.
|
|
||||||
///
|
|
||||||
/// Notice. This algorithm is remarkably much heavier than linear or cubic
|
|
||||||
/// interpolation, and not remarkably better than cubic algorithm. Thus mostly
|
|
||||||
/// for experimental purposes
|
|
||||||
///
|
|
||||||
/// Author : Copyright (c) Olli Parviainen
|
|
||||||
/// Author e-mail : oparviai 'at' iki.fi
|
|
||||||
/// SoundTouch WWW: http://www.surina.net/soundtouch
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// License :
|
|
||||||
//
|
|
||||||
// SoundTouch audio processing library
|
|
||||||
// Copyright (c) Olli Parviainen
|
|
||||||
//
|
|
||||||
// This library is free software; you can redistribute it and/or
|
|
||||||
// modify it under the terms of the GNU Lesser General Public
|
|
||||||
// License as published by the Free Software Foundation; either
|
|
||||||
// version 2.1 of the License, or (at your option) any later version.
|
|
||||||
//
|
|
||||||
// This library is distributed in the hope that it will be useful,
|
|
||||||
// but WITHOUT ANY WARRANTY; without even the implied warranty of
|
|
||||||
// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
|
||||||
// Lesser General Public License for more details.
|
|
||||||
//
|
|
||||||
// You should have received a copy of the GNU Lesser General Public
|
|
||||||
// License along with this library; if not, write to the Free Software
|
|
||||||
// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#include <math.h>
|
|
||||||
#include "InterpolateShannon.h"
|
|
||||||
#include "STTypes.h"
|
|
||||||
|
|
||||||
using namespace soundtouch;
|
|
||||||
|
|
||||||
|
|
||||||
/// Kaiser window with beta = 2.0
|
|
||||||
/// Values scaled down by 5% to avoid overflows
|
|
||||||
static const double _kaiser8[8] =
|
|
||||||
{
|
|
||||||
0.41778693317814,
|
|
||||||
0.64888025049173,
|
|
||||||
0.83508562409944,
|
|
||||||
0.93887857733412,
|
|
||||||
0.93887857733412,
|
|
||||||
0.83508562409944,
|
|
||||||
0.64888025049173,
|
|
||||||
0.41778693317814
|
|
||||||
};
|
|
||||||
|
|
||||||
|
|
||||||
InterpolateShannon::InterpolateShannon()
|
|
||||||
{
|
|
||||||
fract = 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
void InterpolateShannon::resetRegisters()
|
|
||||||
{
|
|
||||||
fract = 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
#define PI 3.1415926536
|
|
||||||
#define sinc(x) (sin(PI * (x)) / (PI * (x)))
|
|
||||||
|
|
||||||
/// Transpose mono audio. Returns number of produced output samples, and
|
|
||||||
/// updates "srcSamples" to amount of consumed source samples
|
|
||||||
int InterpolateShannon::transposeMono(SAMPLETYPE *pdest,
|
|
||||||
const SAMPLETYPE *psrc,
|
|
||||||
int &srcSamples)
|
|
||||||
{
|
|
||||||
int i;
|
|
||||||
int srcSampleEnd = srcSamples - 8;
|
|
||||||
int srcCount = 0;
|
|
||||||
|
|
||||||
i = 0;
|
|
||||||
while (srcCount < srcSampleEnd)
|
|
||||||
{
|
|
||||||
double out;
|
|
||||||
assert(fract < 1.0);
|
|
||||||
|
|
||||||
out = psrc[0] * sinc(-3.0 - fract) * _kaiser8[0];
|
|
||||||
out += psrc[1] * sinc(-2.0 - fract) * _kaiser8[1];
|
|
||||||
out += psrc[2] * sinc(-1.0 - fract) * _kaiser8[2];
|
|
||||||
if (fract < 1e-6)
|
|
||||||
{
|
|
||||||
out += psrc[3] * _kaiser8[3]; // sinc(0) = 1
|
|
||||||
}
|
|
||||||
else
|
|
||||||
{
|
|
||||||
out += psrc[3] * sinc(- fract) * _kaiser8[3];
|
|
||||||
}
|
|
||||||
out += psrc[4] * sinc( 1.0 - fract) * _kaiser8[4];
|
|
||||||
out += psrc[5] * sinc( 2.0 - fract) * _kaiser8[5];
|
|
||||||
out += psrc[6] * sinc( 3.0 - fract) * _kaiser8[6];
|
|
||||||
out += psrc[7] * sinc( 4.0 - fract) * _kaiser8[7];
|
|
||||||
|
|
||||||
pdest[i] = (SAMPLETYPE)out;
|
|
||||||
i ++;
|
|
||||||
|
|
||||||
// update position fraction
|
|
||||||
fract += rate;
|
|
||||||
// update whole positions
|
|
||||||
int whole = (int)fract;
|
|
||||||
fract -= whole;
|
|
||||||
psrc += whole;
|
|
||||||
srcCount += whole;
|
|
||||||
}
|
|
||||||
srcSamples = srcCount;
|
|
||||||
return i;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
/// Transpose stereo audio. Returns number of produced output samples, and
|
|
||||||
/// updates "srcSamples" to amount of consumed source samples
|
|
||||||
int InterpolateShannon::transposeStereo(SAMPLETYPE *pdest,
|
|
||||||
const SAMPLETYPE *psrc,
|
|
||||||
int &srcSamples)
|
|
||||||
{
|
|
||||||
int i;
|
|
||||||
int srcSampleEnd = srcSamples - 8;
|
|
||||||
int srcCount = 0;
|
|
||||||
|
|
||||||
i = 0;
|
|
||||||
while (srcCount < srcSampleEnd)
|
|
||||||
{
|
|
||||||
double out0, out1, w;
|
|
||||||
assert(fract < 1.0);
|
|
||||||
|
|
||||||
w = sinc(-3.0 - fract) * _kaiser8[0];
|
|
||||||
out0 = psrc[0] * w; out1 = psrc[1] * w;
|
|
||||||
w = sinc(-2.0 - fract) * _kaiser8[1];
|
|
||||||
out0 += psrc[2] * w; out1 += psrc[3] * w;
|
|
||||||
w = sinc(-1.0 - fract) * _kaiser8[2];
|
|
||||||
out0 += psrc[4] * w; out1 += psrc[5] * w;
|
|
||||||
w = _kaiser8[3] * ((fract < 1e-5) ? 1.0 : sinc(- fract)); // sinc(0) = 1
|
|
||||||
out0 += psrc[6] * w; out1 += psrc[7] * w;
|
|
||||||
w = sinc( 1.0 - fract) * _kaiser8[4];
|
|
||||||
out0 += psrc[8] * w; out1 += psrc[9] * w;
|
|
||||||
w = sinc( 2.0 - fract) * _kaiser8[5];
|
|
||||||
out0 += psrc[10] * w; out1 += psrc[11] * w;
|
|
||||||
w = sinc( 3.0 - fract) * _kaiser8[6];
|
|
||||||
out0 += psrc[12] * w; out1 += psrc[13] * w;
|
|
||||||
w = sinc( 4.0 - fract) * _kaiser8[7];
|
|
||||||
out0 += psrc[14] * w; out1 += psrc[15] * w;
|
|
||||||
|
|
||||||
pdest[2*i] = (SAMPLETYPE)out0;
|
|
||||||
pdest[2*i+1] = (SAMPLETYPE)out1;
|
|
||||||
i ++;
|
|
||||||
|
|
||||||
// update position fraction
|
|
||||||
fract += rate;
|
|
||||||
// update whole positions
|
|
||||||
int whole = (int)fract;
|
|
||||||
fract -= whole;
|
|
||||||
psrc += 2*whole;
|
|
||||||
srcCount += whole;
|
|
||||||
}
|
|
||||||
srcSamples = srcCount;
|
|
||||||
return i;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
/// Transpose stereo audio. Returns number of produced output samples, and
|
|
||||||
/// updates "srcSamples" to amount of consumed source samples
|
|
||||||
int InterpolateShannon::transposeMulti(SAMPLETYPE *,
|
|
||||||
const SAMPLETYPE *,
|
|
||||||
int &)
|
|
||||||
{
|
|
||||||
// not implemented
|
|
||||||
assert(false);
|
|
||||||
return 0;
|
|
||||||
}
|
|
74
Externals/soundtouch/InterpolateShannon.h
vendored
74
Externals/soundtouch/InterpolateShannon.h
vendored
|
@ -1,74 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
///
|
|
||||||
/// Sample interpolation routine using 8-tap band-limited Shannon interpolation
|
|
||||||
/// with kaiser window.
|
|
||||||
///
|
|
||||||
/// Notice. This algorithm is remarkably much heavier than linear or cubic
|
|
||||||
/// interpolation, and not remarkably better than cubic algorithm. Thus mostly
|
|
||||||
/// for experimental purposes
|
|
||||||
///
|
|
||||||
/// Author : Copyright (c) Olli Parviainen
|
|
||||||
/// Author e-mail : oparviai 'at' iki.fi
|
|
||||||
/// SoundTouch WWW: http://www.surina.net/soundtouch
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// License :
|
|
||||||
//
|
|
||||||
// SoundTouch audio processing library
|
|
||||||
// Copyright (c) Olli Parviainen
|
|
||||||
//
|
|
||||||
// This library is free software; you can redistribute it and/or
|
|
||||||
// modify it under the terms of the GNU Lesser General Public
|
|
||||||
// License as published by the Free Software Foundation; either
|
|
||||||
// version 2.1 of the License, or (at your option) any later version.
|
|
||||||
//
|
|
||||||
// This library is distributed in the hope that it will be useful,
|
|
||||||
// but WITHOUT ANY WARRANTY; without even the implied warranty of
|
|
||||||
// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
|
||||||
// Lesser General Public License for more details.
|
|
||||||
//
|
|
||||||
// You should have received a copy of the GNU Lesser General Public
|
|
||||||
// License along with this library; if not, write to the Free Software
|
|
||||||
// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#ifndef _InterpolateShannon_H_
|
|
||||||
#define _InterpolateShannon_H_
|
|
||||||
|
|
||||||
#include "RateTransposer.h"
|
|
||||||
#include "STTypes.h"
|
|
||||||
|
|
||||||
namespace soundtouch
|
|
||||||
{
|
|
||||||
|
|
||||||
class InterpolateShannon : public TransposerBase
|
|
||||||
{
|
|
||||||
protected:
|
|
||||||
int transposeMono(SAMPLETYPE *dest,
|
|
||||||
const SAMPLETYPE *src,
|
|
||||||
int &srcSamples) override;
|
|
||||||
int transposeStereo(SAMPLETYPE *dest,
|
|
||||||
const SAMPLETYPE *src,
|
|
||||||
int &srcSamples) override;
|
|
||||||
int transposeMulti(SAMPLETYPE *dest,
|
|
||||||
const SAMPLETYPE *src,
|
|
||||||
int &srcSamples) override;
|
|
||||||
|
|
||||||
double fract;
|
|
||||||
|
|
||||||
public:
|
|
||||||
InterpolateShannon();
|
|
||||||
|
|
||||||
void resetRegisters() override;
|
|
||||||
|
|
||||||
virtual int getLatency() const override
|
|
||||||
{
|
|
||||||
return 3;
|
|
||||||
}
|
|
||||||
};
|
|
||||||
|
|
||||||
}
|
|
||||||
|
|
||||||
#endif
|
|
277
Externals/soundtouch/PeakFinder.cpp
vendored
277
Externals/soundtouch/PeakFinder.cpp
vendored
|
@ -1,277 +0,0 @@
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
///
|
|
||||||
/// Peak detection routine.
|
|
||||||
///
|
|
||||||
/// The routine detects highest value on an array of values and calculates the
|
|
||||||
/// precise peak location as a mass-center of the 'hump' around the peak value.
|
|
||||||
///
|
|
||||||
/// Author : Copyright (c) Olli Parviainen
|
|
||||||
/// Author e-mail : oparviai 'at' iki.fi
|
|
||||||
/// SoundTouch WWW: http://www.surina.net/soundtouch
|
|
||||||
///
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
//
|
|
||||||
// License :
|
|
||||||
//
|
|
||||||
// SoundTouch audio processing library
|
|
||||||
// Copyright (c) Olli Parviainen
|
|
||||||
//
|
|
||||||
// This library is free software; you can redistribute it and/or
|
|
||||||
// modify it under the terms of the GNU Lesser General Public
|
|
||||||
// License as published by the Free Software Foundation; either
|
|
||||||
// version 2.1 of the License, or (at your option) any later version.
|
|
||||||
//
|
|
||||||
// This library is distributed in the hope that it will be useful,
|
|
||||||
// but WITHOUT ANY WARRANTY; without even the implied warranty of
|
|
||||||
// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
|
||||||
// Lesser General Public License for more details.
|
|
||||||
//
|
|
||||||
// You should have received a copy of the GNU Lesser General Public
|
|
||||||
// License along with this library; if not, write to the Free Software
|
|
||||||
// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
|
|
||||||
//
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
#include <math.h>
|
|
||||||
#include <assert.h>
|
|
||||||
|
|
||||||
#include "PeakFinder.h"
|
|
||||||
|
|
||||||
using namespace soundtouch;
|
|
||||||
|
|
||||||
#define max(x, y) (((x) > (y)) ? (x) : (y))
|
|
||||||
|
|
||||||
|
|
||||||
PeakFinder::PeakFinder()
|
|
||||||
{
|
|
||||||
minPos = maxPos = 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// Finds real 'top' of a peak hump from neighnourhood of the given 'peakpos'.
|
|
||||||
int PeakFinder::findTop(const float *data, int peakpos) const
|
|
||||||
{
|
|
||||||
int i;
|
|
||||||
int start, end;
|
|
||||||
float refvalue;
|
|
||||||
|
|
||||||
refvalue = data[peakpos];
|
|
||||||
|
|
||||||
// seek within ±10 points
|
|
||||||
start = peakpos - 10;
|
|
||||||
if (start < minPos) start = minPos;
|
|
||||||
end = peakpos + 10;
|
|
||||||
if (end > maxPos) end = maxPos;
|
|
||||||
|
|
||||||
for (i = start; i <= end; i ++)
|
|
||||||
{
|
|
||||||
if (data[i] > refvalue)
|
|
||||||
{
|
|
||||||
peakpos = i;
|
|
||||||
refvalue = data[i];
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
// failure if max value is at edges of seek range => it's not peak, it's at slope.
|
|
||||||
if ((peakpos == start) || (peakpos == end)) return 0;
|
|
||||||
|
|
||||||
return peakpos;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// Finds 'ground level' of a peak hump by starting from 'peakpos' and proceeding
|
|
||||||
// to direction defined by 'direction' until next 'hump' after minimum value will
|
|
||||||
// begin
|
|
||||||
int PeakFinder::findGround(const float *data, int peakpos, int direction) const
|
|
||||||
{
|
|
||||||
int lowpos;
|
|
||||||
int pos;
|
|
||||||
int climb_count;
|
|
||||||
float refvalue;
|
|
||||||
float delta;
|
|
||||||
|
|
||||||
climb_count = 0;
|
|
||||||
refvalue = data[peakpos];
|
|
||||||
lowpos = peakpos;
|
|
||||||
|
|
||||||
pos = peakpos;
|
|
||||||
|
|
||||||
while ((pos > minPos+1) && (pos < maxPos-1))
|
|
||||||
{
|
|
||||||
int prevpos;
|
|
||||||
|
|
||||||
prevpos = pos;
|
|
||||||
pos += direction;
|
|
||||||
|
|
||||||
// calculate derivate
|
|
||||||
delta = data[pos] - data[prevpos];
|
|
||||||
if (delta <= 0)
|
|
||||||
{
|
|
||||||
// going downhill, ok
|
|
||||||
if (climb_count)
|
|
||||||
{
|
|
||||||
climb_count --; // decrease climb count
|
|
||||||
}
|
|
||||||
|
|
||||||
// check if new minimum found
|
|
||||||
if (data[pos] < refvalue)
|
|
||||||
{
|
|
||||||
// new minimum found
|
|
||||||
lowpos = pos;
|
|
||||||
refvalue = data[pos];
|
|
||||||
}
|
|
||||||
}
|
|
||||||
else
|
|
||||||
{
|
|
||||||
// going uphill, increase climbing counter
|
|
||||||
climb_count ++;
|
|
||||||
if (climb_count > 5) break; // we've been climbing too long => it's next uphill => quit
|
|
||||||
}
|
|
||||||
}
|
|
||||||
return lowpos;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// Find offset where the value crosses the given level, when starting from 'peakpos' and
|
|
||||||
// proceeds to direction defined in 'direction'
|
|
||||||
int PeakFinder::findCrossingLevel(const float *data, float level, int peakpos, int direction) const
|
|
||||||
{
|
|
||||||
float peaklevel;
|
|
||||||
int pos;
|
|
||||||
|
|
||||||
peaklevel = data[peakpos];
|
|
||||||
assert(peaklevel >= level);
|
|
||||||
pos = peakpos;
|
|
||||||
while ((pos >= minPos) && (pos + direction < maxPos))
|
|
||||||
{
|
|
||||||
if (data[pos + direction] < level) return pos; // crossing found
|
|
||||||
pos += direction;
|
|
||||||
}
|
|
||||||
return -1; // not found
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// Calculates the center of mass location of 'data' array items between 'firstPos' and 'lastPos'
|
|
||||||
double PeakFinder::calcMassCenter(const float *data, int firstPos, int lastPos) const
|
|
||||||
{
|
|
||||||
int i;
|
|
||||||
float sum;
|
|
||||||
float wsum;
|
|
||||||
|
|
||||||
sum = 0;
|
|
||||||
wsum = 0;
|
|
||||||
for (i = firstPos; i <= lastPos; i ++)
|
|
||||||
{
|
|
||||||
sum += (float)i * data[i];
|
|
||||||
wsum += data[i];
|
|
||||||
}
|
|
||||||
|
|
||||||
if (wsum < 1e-6) return 0;
|
|
||||||
return sum / wsum;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
/// get exact center of peak near given position by calculating local mass of center
|
|
||||||
double PeakFinder::getPeakCenter(const float *data, int peakpos) const
|
|
||||||
{
|
|
||||||
float peakLevel; // peak level
|
|
||||||
int crosspos1, crosspos2; // position where the peak 'hump' crosses cutting level
|
|
||||||
float cutLevel; // cutting value
|
|
||||||
float groundLevel; // ground level of the peak
|
|
||||||
int gp1, gp2; // bottom positions of the peak 'hump'
|
|
||||||
|
|
||||||
// find ground positions.
|
|
||||||
gp1 = findGround(data, peakpos, -1);
|
|
||||||
gp2 = findGround(data, peakpos, 1);
|
|
||||||
|
|
||||||
peakLevel = data[peakpos];
|
|
||||||
|
|
||||||
if (gp1 == gp2)
|
|
||||||
{
|
|
||||||
// avoid rounding errors when all are equal
|
|
||||||
assert(gp1 == peakpos);
|
|
||||||
cutLevel = groundLevel = peakLevel;
|
|
||||||
} else {
|
|
||||||
// get average of the ground levels
|
|
||||||
groundLevel = 0.5f * (data[gp1] + data[gp2]);
|
|
||||||
|
|
||||||
// calculate 70%-level of the peak
|
|
||||||
cutLevel = 0.70f * peakLevel + 0.30f * groundLevel;
|
|
||||||
}
|
|
||||||
|
|
||||||
// find mid-level crossings
|
|
||||||
crosspos1 = findCrossingLevel(data, cutLevel, peakpos, -1);
|
|
||||||
crosspos2 = findCrossingLevel(data, cutLevel, peakpos, 1);
|
|
||||||
|
|
||||||
if ((crosspos1 < 0) || (crosspos2 < 0)) return 0; // no crossing, no peak..
|
|
||||||
|
|
||||||
// calculate mass center of the peak surroundings
|
|
||||||
return calcMassCenter(data, crosspos1, crosspos2);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
double PeakFinder::detectPeak(const float *data, int aminPos, int amaxPos)
|
|
||||||
{
|
|
||||||
|
|
||||||
int i;
|
|
||||||
int peakpos; // position of peak level
|
|
||||||
double highPeak, peak;
|
|
||||||
|
|
||||||
this->minPos = aminPos;
|
|
||||||
this->maxPos = amaxPos;
|
|
||||||
|
|
||||||
// find absolute peak
|
|
||||||
peakpos = minPos;
|
|
||||||
peak = data[minPos];
|
|
||||||
for (i = minPos + 1; i < maxPos; i ++)
|
|
||||||
{
|
|
||||||
if (data[i] > peak)
|
|
||||||
{
|
|
||||||
peak = data[i];
|
|
||||||
peakpos = i;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
// Calculate exact location of the highest peak mass center
|
|
||||||
highPeak = getPeakCenter(data, peakpos);
|
|
||||||
peak = highPeak;
|
|
||||||
|
|
||||||
// Now check if the highest peak were in fact harmonic of the true base beat peak
|
|
||||||
// - sometimes the highest peak can be Nth harmonic of the true base peak yet
|
|
||||||
// just a slightly higher than the true base
|
|
||||||
|
|
||||||
for (i = 1; i < 3; i ++)
|
|
||||||
{
|
|
||||||
double peaktmp, harmonic;
|
|
||||||
int i1,i2;
|
|
||||||
|
|
||||||
harmonic = (double)pow(2.0, i);
|
|
||||||
peakpos = (int)(highPeak / harmonic + 0.5f);
|
|
||||||
if (peakpos < minPos) break;
|
|
||||||
peakpos = findTop(data, peakpos); // seek true local maximum index
|
|
||||||
if (peakpos == 0) continue; // no local max here
|
|
||||||
|
|
||||||
// calculate mass-center of possible harmonic peak
|
|
||||||
peaktmp = getPeakCenter(data, peakpos);
|
|
||||||
|
|
||||||
// accept harmonic peak if
|
|
||||||
// (a) it is found
|
|
||||||
// (b) is within ±4% of the expected harmonic interval
|
|
||||||
// (c) has at least half x-corr value of the max. peak
|
|
||||||
|
|
||||||
double diff = harmonic * peaktmp / highPeak;
|
|
||||||
if ((diff < 0.96) || (diff > 1.04)) continue; // peak too afar from expected
|
|
||||||
|
|
||||||
// now compare to highest detected peak
|
|
||||||
i1 = (int)(highPeak + 0.5);
|
|
||||||
i2 = (int)(peaktmp + 0.5);
|
|
||||||
if (data[i2] >= 0.4*data[i1])
|
|
||||||
{
|
|
||||||
// The harmonic is at least half as high primary peak,
|
|
||||||
// thus use the harmonic peak instead
|
|
||||||
peak = peaktmp;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
return peak;
|
|
||||||
}
|
|
Some files were not shown because too many files have changed in this diff Show more
Loading…
Add table
Add a link
Reference in a new issue